--- /dev/null
+// ==================================================
+// fancyBox v3.5.7
+//
+// Licensed GPLv3 for open source use
+// or fancyBox Commercial License for commercial use
+//
+// http://fancyapps.com/fancybox/
+// Copyright 2019 fancyApps
+//
+// ==================================================
+(function (window, document, $, undefined) {
+ "use strict";
+
+ window.console = window.console || {
+ info: function (stuff) {}
+ };
+
+ // If there's no jQuery, fancyBox can't work
+ // =========================================
+
+ if (!$) {
+ return;
+ }
+
+ // Check if fancyBox is already initialized
+ // ========================================
+
+ if ($.fn.fancybox) {
+ console.info("fancyBox already initialized");
+
+ return;
+ }
+
+ // Private default settings
+ // ========================
+
+ var defaults = {
+ // Close existing modals
+ // Set this to false if you do not need to stack multiple instances
+ closeExisting: false,
+
+ // Enable infinite gallery navigation
+ loop: false,
+
+ // Horizontal space between slides
+ gutter: 50,
+
+ // Enable keyboard navigation
+ keyboard: true,
+
+ // Should allow caption to overlap the content
+ preventCaptionOverlap: true,
+
+ // Should display navigation arrows at the screen edges
+ arrows: true,
+
+ // Should display counter at the top left corner
+ infobar: true,
+
+ // Should display close button (using `btnTpl.smallBtn` template) over the content
+ // Can be true, false, "auto"
+ // If "auto" - will be automatically enabled for "html", "inline" or "ajax" items
+ smallBtn: "auto",
+
+ // Should display toolbar (buttons at the top)
+ // Can be true, false, "auto"
+ // If "auto" - will be automatically hidden if "smallBtn" is enabled
+ toolbar: "auto",
+
+ // What buttons should appear in the top right corner.
+ // Buttons will be created using templates from `btnTpl` option
+ // and they will be placed into toolbar (class="fancybox-toolbar"` element)
+ buttons: [
+ "zoom",
+ //"share",
+ "slideShow",
+ //"fullScreen",
+ //"download",
+ "thumbs",
+ "close"
+ ],
+
+ // Detect "idle" time in seconds
+ idleTime: 3,
+
+ // Disable right-click and use simple image protection for images
+ protect: false,
+
+ // Shortcut to make content "modal" - disable keyboard navigtion, hide buttons, etc
+ modal: false,
+
+ image: {
+ // Wait for images to load before displaying
+ // true - wait for image to load and then display;
+ // false - display thumbnail and load the full-sized image over top,
+ // requires predefined image dimensions (`data-width` and `data-height` attributes)
+ preload: false
+ },
+
+ ajax: {
+ // Object containing settings for ajax request
+ settings: {
+ // This helps to indicate that request comes from the modal
+ // Feel free to change naming
+ data: {
+ fancybox: true
+ }
+ }
+ },
+
+ iframe: {
+ // Iframe template
+ tpl: '<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" allowfullscreen="allowfullscreen" allow="autoplay; fullscreen" src=""></iframe>',
+
+ // Preload iframe before displaying it
+ // This allows to calculate iframe content width and height
+ // (note: Due to "Same Origin Policy", you can't get cross domain data).
+ preload: true,
+
+ // Custom CSS styling for iframe wrapping element
+ // You can use this to set custom iframe dimensions
+ css: {},
+
+ // Iframe tag attributes
+ attr: {
+ scrolling: "auto"
+ }
+ },
+
+ // For HTML5 video only
+ video: {
+ tpl: '<video class="fancybox-video" controls controlsList="nodownload" poster="{{poster}}">' +
+ '<source src="{{src}}" type="{{format}}" />' +
+ 'Sorry, your browser doesn\'t support embedded videos, <a href="{{src}}">download</a> and watch with your favorite video player!' +
+ "</video>",
+ format: "", // custom video format
+ autoStart: true
+ },
+
+ // Default content type if cannot be detected automatically
+ defaultType: "image",
+
+ // Open/close animation type
+ // Possible values:
+ // false - disable
+ // "zoom" - zoom images from/to thumbnail
+ // "fade"
+ // "zoom-in-out"
+ //
+ animationEffect: "zoom",
+
+ // Duration in ms for open/close animation
+ animationDuration: 366,
+
+ // Should image change opacity while zooming
+ // If opacity is "auto", then opacity will be changed if image and thumbnail have different aspect ratios
+ zoomOpacity: "auto",
+
+ // Transition effect between slides
+ //
+ // Possible values:
+ // false - disable
+ // "fade'
+ // "slide'
+ // "circular'
+ // "tube'
+ // "zoom-in-out'
+ // "rotate'
+ //
+ transitionEffect: "fade",
+
+ // Duration in ms for transition animation
+ transitionDuration: 366,
+
+ // Custom CSS class for slide element
+ slideClass: "",
+
+ // Custom CSS class for layout
+ baseClass: "",
+
+ // Base template for layout
+ baseTpl: '<div class="fancybox-container" role="dialog" tabindex="-1">' +
+ '<div class="fancybox-bg"></div>' +
+ '<div class="fancybox-inner">' +
+ '<div class="fancybox-infobar"><span data-fancybox-index></span> / <span data-fancybox-count></span></div>' +
+ '<div class="fancybox-toolbar">{{buttons}}</div>' +
+ '<div class="fancybox-navigation">{{arrows}}</div>' +
+ '<div class="fancybox-stage"></div>' +
+ '<div class="fancybox-caption"><div class="fancybox-caption__body"></div></div>' +
+ "</div>" +
+ "</div>",
+
+ // Loading indicator template
+ spinnerTpl: '<div class="fancybox-loading"></div>',
+
+ // Error message template
+ errorTpl: '<div class="fancybox-error"><p>{{ERROR}}</p></div>',
+
+ btnTpl: {
+ download: '<a download data-fancybox-download class="fancybox-button fancybox-button--download" title="{{DOWNLOAD}}" href="javascript:;">' +
+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M18.62 17.09V19H5.38v-1.91zm-2.97-6.96L17 11.45l-5 4.87-5-4.87 1.36-1.32 2.68 2.64V5h1.92v7.77z"/></svg>' +
+ "</a>",
+
+ zoom: '<button data-fancybox-zoom class="fancybox-button fancybox-button--zoom" title="{{ZOOM}}">' +
+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M18.7 17.3l-3-3a5.9 5.9 0 0 0-.6-7.6 5.9 5.9 0 0 0-8.4 0 5.9 5.9 0 0 0 0 8.4 5.9 5.9 0 0 0 7.7.7l3 3a1 1 0 0 0 1.3 0c.4-.5.4-1 0-1.5zM8.1 13.8a4 4 0 0 1 0-5.7 4 4 0 0 1 5.7 0 4 4 0 0 1 0 5.7 4 4 0 0 1-5.7 0z"/></svg>' +
+ "</button>",
+
+ close: '<button data-fancybox-close class="fancybox-button fancybox-button--close" title="{{CLOSE}}">' +
+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M12 10.6L6.6 5.2 5.2 6.6l5.4 5.4-5.4 5.4 1.4 1.4 5.4-5.4 5.4 5.4 1.4-1.4-5.4-5.4 5.4-5.4-1.4-1.4-5.4 5.4z"/></svg>' +
+ "</button>",
+
+ // Arrows
+ arrowLeft: '<button data-fancybox-prev class="fancybox-button fancybox-button--arrow_left" title="{{PREV}}">' +
+ '<div><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M11.28 15.7l-1.34 1.37L5 12l4.94-5.07 1.34 1.38-2.68 2.72H19v1.94H8.6z"/></svg></div>' +
+ "</button>",
+
+ arrowRight: '<button data-fancybox-next class="fancybox-button fancybox-button--arrow_right" title="{{NEXT}}">' +
+ '<div><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M15.4 12.97l-2.68 2.72 1.34 1.38L19 12l-4.94-5.07-1.34 1.38 2.68 2.72H5v1.94z"/></svg></div>' +
+ "</button>",
+
+ // This small close button will be appended to your html/inline/ajax content by default,
+ // if "smallBtn" option is not set to false
+ smallBtn: '<button type="button" data-fancybox-close class="fancybox-button fancybox-close-small" title="{{CLOSE}}">' +
+ '<svg xmlns="http://www.w3.org/2000/svg" version="1" viewBox="0 0 24 24"><path d="M13 12l5-5-1-1-5 5-5-5-1 1 5 5-5 5 1 1 5-5 5 5 1-1z"/></svg>' +
+ "</button>"
+ },
+
+ // Container is injected into this element
+ parentEl: "body",
+
+ // Hide browser vertical scrollbars; use at your own risk
+ hideScrollbar: true,
+
+ // Focus handling
+ // ==============
+
+ // Try to focus on the first focusable element after opening
+ autoFocus: true,
+
+ // Put focus back to active element after closing
+ backFocus: true,
+
+ // Do not let user to focus on element outside modal content
+ trapFocus: true,
+
+ // Module specific options
+ // =======================
+
+ fullScreen: {
+ autoStart: false
+ },
+
+ // Set `touch: false` to disable panning/swiping
+ touch: {
+ vertical: true, // Allow to drag content vertically
+ momentum: true // Continue movement after releasing mouse/touch when panning
+ },
+
+ // Hash value when initializing manually,
+ // set `false` to disable hash change
+ hash: null,
+
+ // Customize or add new media types
+ // Example:
+ /*
+ media : {
+ youtube : {
+ params : {
+ autoplay : 0
+ }
+ }
+ }
+ */
+ media: {},
+
+ slideShow: {
+ autoStart: false,
+ speed: 3000
+ },
+
+ thumbs: {
+ autoStart: false, // Display thumbnails on opening
+ hideOnClose: true, // Hide thumbnail grid when closing animation starts
+ parentEl: ".fancybox-container", // Container is injected into this element
+ axis: "y" // Vertical (y) or horizontal (x) scrolling
+ },
+
+ // Use mousewheel to navigate gallery
+ // If 'auto' - enabled for images only
+ wheel: "auto",
+
+ // Callbacks
+ //==========
+
+ // See Documentation/API/Events for more information
+ // Example:
+ /*
+ afterShow: function( instance, current ) {
+ console.info( 'Clicked element:' );
+ console.info( current.opts.$orig );
+ }
+ */
+
+ onInit: $.noop, // When instance has been initialized
+
+ beforeLoad: $.noop, // Before the content of a slide is being loaded
+ afterLoad: $.noop, // When the content of a slide is done loading
+
+ beforeShow: $.noop, // Before open animation starts
+ afterShow: $.noop, // When content is done loading and animating
+
+ beforeClose: $.noop, // Before the instance attempts to close. Return false to cancel the close.
+ afterClose: $.noop, // After instance has been closed
+
+ onActivate: $.noop, // When instance is brought to front
+ onDeactivate: $.noop, // When other instance has been activated
+
+ // Interaction
+ // ===========
+
+ // Use options below to customize taken action when user clicks or double clicks on the fancyBox area,
+ // each option can be string or method that returns value.
+ //
+ // Possible values:
+ // "close" - close instance
+ // "next" - move to next gallery item
+ // "nextOrClose" - move to next gallery item or close if gallery has only one item
+ // "toggleControls" - show/hide controls
+ // "zoom" - zoom image (if loaded)
+ // false - do nothing
+
+ // Clicked on the content
+ clickContent: function (current, event) {
+ return current.type === "image" ? "zoom" : false;
+ },
+
+ // Clicked on the slide
+ clickSlide: "close",
+
+ // Clicked on the background (backdrop) element;
+ // if you have not changed the layout, then most likely you need to use `clickSlide` option
+ clickOutside: "close",
+
+ // Same as previous two, but for double click
+ dblclickContent: false,
+ dblclickSlide: false,
+ dblclickOutside: false,
+
+ // Custom options when mobile device is detected
+ // =============================================
+
+ mobile: {
+ preventCaptionOverlap: false,
+ idleTime: false,
+ clickContent: function (current, event) {
+ return current.type === "image" ? "toggleControls" : false;
+ },
+ clickSlide: function (current, event) {
+ return current.type === "image" ? "toggleControls" : "close";
+ },
+ dblclickContent: function (current, event) {
+ return current.type === "image" ? "zoom" : false;
+ },
+ dblclickSlide: function (current, event) {
+ return current.type === "image" ? "zoom" : false;
+ }
+ },
+
+ // Internationalization
+ // ====================
+
+ lang: "en",
+ i18n: {
+ en: {
+ CLOSE: "Close",
+ NEXT: "Next",
+ PREV: "Previous",
+ ERROR: "The requested content cannot be loaded. <br/> Please try again later.",
+ PLAY_START: "Start slideshow",
+ PLAY_STOP: "Pause slideshow",
+ FULL_SCREEN: "Full screen",
+ THUMBS: "Thumbnails",
+ DOWNLOAD: "Download",
+ SHARE: "Share",
+ ZOOM: "Zoom"
+ },
+ de: {
+ CLOSE: "Schließen",
+ NEXT: "Weiter",
+ PREV: "Zurück",
+ ERROR: "Die angeforderten Daten konnten nicht geladen werden. <br/> Bitte versuchen Sie es später nochmal.",
+ PLAY_START: "Diaschau starten",
+ PLAY_STOP: "Diaschau beenden",
+ FULL_SCREEN: "Vollbild",
+ THUMBS: "Vorschaubilder",
+ DOWNLOAD: "Herunterladen",
+ SHARE: "Teilen",
+ ZOOM: "Vergrößern"
+ }
+ }
+ };
+
+ // Few useful variables and methods
+ // ================================
+
+ var $W = $(window);
+ var $D = $(document);
+
+ var called = 0;
+
+ // Check if an object is a jQuery object and not a native JavaScript object
+ // ========================================================================
+ var isQuery = function (obj) {
+ return obj && obj.hasOwnProperty && obj instanceof $;
+ };
+
+ // Handle multiple browsers for "requestAnimationFrame" and "cancelAnimationFrame"
+ // ===============================================================================
+ var requestAFrame = (function () {
+ return (
+ window.requestAnimationFrame ||
+ window.webkitRequestAnimationFrame ||
+ window.mozRequestAnimationFrame ||
+ window.oRequestAnimationFrame ||
+ // if all else fails, use setTimeout
+ function (callback) {
+ return window.setTimeout(callback, 1000 / 60);
+ }
+ );
+ })();
+
+ var cancelAFrame = (function () {
+ return (
+ window.cancelAnimationFrame ||
+ window.webkitCancelAnimationFrame ||
+ window.mozCancelAnimationFrame ||
+ window.oCancelAnimationFrame ||
+ function (id) {
+ window.clearTimeout(id);
+ }
+ );
+ })();
+
+ // Detect the supported transition-end event property name
+ // =======================================================
+ var transitionEnd = (function () {
+ var el = document.createElement("fakeelement"),
+ t;
+
+ var transitions = {
+ transition: "transitionend",
+ OTransition: "oTransitionEnd",
+ MozTransition: "transitionend",
+ WebkitTransition: "webkitTransitionEnd"
+ };
+
+ for (t in transitions) {
+ if (el.style[t] !== undefined) {
+ return transitions[t];
+ }
+ }
+
+ return "transitionend";
+ })();
+
+ // Force redraw on an element.
+ // This helps in cases where the browser doesn't redraw an updated element properly
+ // ================================================================================
+ var forceRedraw = function ($el) {
+ return $el && $el.length && $el[0].offsetHeight;
+ };
+
+ // Exclude array (`buttons`) options from deep merging
+ // ===================================================
+ var mergeOpts = function (opts1, opts2) {
+ var rez = $.extend(true, {}, opts1, opts2);
+
+ $.each(opts2, function (key, value) {
+ if ($.isArray(value)) {
+ rez[key] = value;
+ }
+ });
+
+ return rez;
+ };
+
+ // How much of an element is visible in viewport
+ // =============================================
+
+ var inViewport = function (elem) {
+ var elemCenter, rez;
+
+ if (!elem || elem.ownerDocument !== document) {
+ return false;
+ }
+
+ $(".fancybox-container").css("pointer-events", "none");
+
+ elemCenter = {
+ x: elem.getBoundingClientRect().left + elem.offsetWidth / 2,
+ y: elem.getBoundingClientRect().top + elem.offsetHeight / 2
+ };
+
+ rez = document.elementFromPoint(elemCenter.x, elemCenter.y) === elem;
+
+ $(".fancybox-container").css("pointer-events", "");
+
+ return rez;
+ };
+
+ // Class definition
+ // ================
+
+ var FancyBox = function (content, opts, index) {
+ var self = this;
+
+ self.opts = mergeOpts({
+ index: index
+ }, $.fancybox.defaults);
+
+ if ($.isPlainObject(opts)) {
+ self.opts = mergeOpts(self.opts, opts);
+ }
+
+ if ($.fancybox.isMobile) {
+ self.opts = mergeOpts(self.opts, self.opts.mobile);
+ }
+
+ self.id = self.opts.id || ++called;
+
+ self.currIndex = parseInt(self.opts.index, 10) || 0;
+ self.prevIndex = null;
+
+ self.prevPos = null;
+ self.currPos = 0;
+
+ self.firstRun = true;
+
+ // All group items
+ self.group = [];
+
+ // Existing slides (for current, next and previous gallery items)
+ self.slides = {};
+
+ // Create group elements
+ self.addContent(content);
+
+ if (!self.group.length) {
+ return;
+ }
+
+ self.init();
+ };
+
+ $.extend(FancyBox.prototype, {
+ // Create DOM structure
+ // ====================
+
+ init: function () {
+ var self = this,
+ firstItem = self.group[self.currIndex],
+ firstItemOpts = firstItem.opts,
+ $container,
+ buttonStr;
+
+ if (firstItemOpts.closeExisting) {
+ $.fancybox.close(true);
+ }
+
+ // Hide scrollbars
+ // ===============
+
+ $("body").addClass("fancybox-active");
+
+ if (
+ !$.fancybox.getInstance() &&
+ firstItemOpts.hideScrollbar !== false &&
+ !$.fancybox.isMobile &&
+ document.body.scrollHeight > window.innerHeight
+ ) {
+ $("head").append(
+ '<style id="fancybox-style-noscroll" type="text/css">.compensate-for-scrollbar{margin-right:' +
+ (window.innerWidth - document.documentElement.clientWidth) +
+ "px;}</style>"
+ );
+
+ $("body").addClass("compensate-for-scrollbar");
+ }
+
+ // Build html markup and set references
+ // ====================================
+
+ // Build html code for buttons and insert into main template
+ buttonStr = "";
+
+ $.each(firstItemOpts.buttons, function (index, value) {
+ buttonStr += firstItemOpts.btnTpl[value] || "";
+ });
+
+ // Create markup from base template, it will be initially hidden to
+ // avoid unnecessary work like painting while initializing is not complete
+ $container = $(
+ self.translate(
+ self,
+ firstItemOpts.baseTpl
+ .replace("{{buttons}}", buttonStr)
+ .replace("{{arrows}}", firstItemOpts.btnTpl.arrowLeft + firstItemOpts.btnTpl.arrowRight)
+ )
+ )
+ .attr("id", "fancybox-container-" + self.id)
+ .addClass(firstItemOpts.baseClass)
+ .data("FancyBox", self)
+ .appendTo(firstItemOpts.parentEl);
+
+ // Create object holding references to jQuery wrapped nodes
+ self.$refs = {
+ container: $container
+ };
+
+ ["bg", "inner", "infobar", "toolbar", "stage", "caption", "navigation"].forEach(function (item) {
+ self.$refs[item] = $container.find(".fancybox-" + item);
+ });
+
+ self.trigger("onInit");
+
+ // Enable events, deactive previous instances
+ self.activate();
+
+ // Build slides, load and reveal content
+ self.jumpTo(self.currIndex);
+ },
+
+ // Simple i18n support - replaces object keys found in template
+ // with corresponding values
+ // ============================================================
+
+ translate: function (obj, str) {
+ var arr = obj.opts.i18n[obj.opts.lang] || obj.opts.i18n.en;
+
+ return str.replace(/\{\{(\w+)\}\}/g, function (match, n) {
+ return arr[n] === undefined ? match : arr[n];
+ });
+ },
+
+ // Populate current group with fresh content
+ // Check if each object has valid type and content
+ // ===============================================
+
+ addContent: function (content) {
+ var self = this,
+ items = $.makeArray(content),
+ thumbs;
+
+ $.each(items, function (i, item) {
+ var obj = {},
+ opts = {},
+ $item,
+ type,
+ found,
+ src,
+ srcParts;
+
+ // Step 1 - Make sure we have an object
+ // ====================================
+
+ if ($.isPlainObject(item)) {
+ // We probably have manual usage here, something like
+ // $.fancybox.open( [ { src : "image.jpg", type : "image" } ] )
+
+ obj = item;
+ opts = item.opts || item;
+ } else if ($.type(item) === "object" && $(item).length) {
+ // Here we probably have jQuery collection returned by some selector
+ $item = $(item);
+
+ // Support attributes like `data-options='{"touch" : false}'` and `data-touch='false'`
+ opts = $item.data() || {};
+ opts = $.extend(true, {}, opts, opts.options);
+
+ // Here we store clicked element
+ opts.$orig = $item;
+
+ obj.src = self.opts.src || opts.src || $item.attr("href");
+
+ // Assume that simple syntax is used, for example:
+ // `$.fancybox.open( $("#test"), {} );`
+ if (!obj.type && !obj.src) {
+ obj.type = "inline";
+ obj.src = item;
+ }
+ } else {
+ // Assume we have a simple html code, for example:
+ // $.fancybox.open( '<div><h1>Hi!</h1></div>' );
+ obj = {
+ type: "html",
+ src: item + ""
+ };
+ }
+
+ // Each gallery object has full collection of options
+ obj.opts = $.extend(true, {}, self.opts, opts);
+
+ // Do not merge buttons array
+ if ($.isArray(opts.buttons)) {
+ obj.opts.buttons = opts.buttons;
+ }
+
+ if ($.fancybox.isMobile && obj.opts.mobile) {
+ obj.opts = mergeOpts(obj.opts, obj.opts.mobile);
+ }
+
+ // Step 2 - Make sure we have content type, if not - try to guess
+ // ==============================================================
+
+ type = obj.type || obj.opts.type;
+ src = obj.src || "";
+
+ if (!type && src) {
+ if ((found = src.match(/\.(mp4|mov|ogv|webm)((\?|#).*)?$/i))) {
+ type = "video";
+
+ if (!obj.opts.video.format) {
+ obj.opts.video.format = "video/" + (found[1] === "ogv" ? "ogg" : found[1]);
+ }
+ } else if (src.match(/(^data:image\/[a-z0-9+\/=]*,)|(\.(jp(e|g|eg)|gif|png|bmp|webp|svg|ico)((\?|#).*)?$)/i)) {
+ type = "image";
+ } else if (src.match(/\.(pdf)((\?|#).*)?$/i)) {
+ type = "iframe";
+ obj = $.extend(true, obj, {
+ contentType: "pdf",
+ opts: {
+ iframe: {
+ preload: false
+ }
+ }
+ });
+ } else if (src.charAt(0) === "#") {
+ type = "inline";
+ }
+ }
+
+ if (type) {
+ obj.type = type;
+ } else {
+ self.trigger("objectNeedsType", obj);
+ }
+
+ if (!obj.contentType) {
+ obj.contentType = $.inArray(obj.type, ["html", "inline", "ajax"]) > -1 ? "html" : obj.type;
+ }
+
+ // Step 3 - Some adjustments
+ // =========================
+
+ obj.index = self.group.length;
+
+ if (obj.opts.smallBtn == "auto") {
+ obj.opts.smallBtn = $.inArray(obj.type, ["html", "inline", "ajax"]) > -1;
+ }
+
+ if (obj.opts.toolbar === "auto") {
+ obj.opts.toolbar = !obj.opts.smallBtn;
+ }
+
+ // Find thumbnail image, check if exists and if is in the viewport
+ obj.$thumb = obj.opts.$thumb || null;
+
+ if (obj.opts.$trigger && obj.index === self.opts.index) {
+ obj.$thumb = obj.opts.$trigger.find("img:first");
+
+ if (obj.$thumb.length) {
+ obj.opts.$orig = obj.opts.$trigger;
+ }
+ }
+
+ if (!(obj.$thumb && obj.$thumb.length) && obj.opts.$orig) {
+ obj.$thumb = obj.opts.$orig.find("img:first");
+ }
+
+ if (obj.$thumb && !obj.$thumb.length) {
+ obj.$thumb = null;
+ }
+
+ obj.thumb = obj.opts.thumb || (obj.$thumb ? obj.$thumb[0].src : null);
+
+ // "caption" is a "special" option, it can be used to customize caption per gallery item
+ if ($.type(obj.opts.caption) === "function") {
+ obj.opts.caption = obj.opts.caption.apply(item, [self, obj]);
+ }
+
+ if ($.type(self.opts.caption) === "function") {
+ obj.opts.caption = self.opts.caption.apply(item, [self, obj]);
+ }
+
+ // Make sure we have caption as a string or jQuery object
+ if (!(obj.opts.caption instanceof $)) {
+ obj.opts.caption = obj.opts.caption === undefined ? "" : obj.opts.caption + "";
+ }
+
+ // Check if url contains "filter" used to filter the content
+ // Example: "ajax.html #something"
+ if (obj.type === "ajax") {
+ srcParts = src.split(/\s+/, 2);
+
+ if (srcParts.length > 1) {
+ obj.src = srcParts.shift();
+
+ obj.opts.filter = srcParts.shift();
+ }
+ }
+
+ // Hide all buttons and disable interactivity for modal items
+ if (obj.opts.modal) {
+ obj.opts = $.extend(true, obj.opts, {
+ trapFocus: true,
+ // Remove buttons
+ infobar: 0,
+ toolbar: 0,
+
+ smallBtn: 0,
+
+ // Disable keyboard navigation
+ keyboard: 0,
+
+ // Disable some modules
+ slideShow: 0,
+ fullScreen: 0,
+ thumbs: 0,
+ touch: 0,
+
+ // Disable click event handlers
+ clickContent: false,
+ clickSlide: false,
+ clickOutside: false,
+ dblclickContent: false,
+ dblclickSlide: false,
+ dblclickOutside: false
+ });
+ }
+
+ // Step 4 - Add processed object to group
+ // ======================================
+
+ self.group.push(obj);
+ });
+
+ // Update controls if gallery is already opened
+ if (Object.keys(self.slides).length) {
+ self.updateControls();
+
+ // Update thumbnails, if needed
+ thumbs = self.Thumbs;
+
+ if (thumbs && thumbs.isActive) {
+ thumbs.create();
+
+ thumbs.focus();
+ }
+ }
+ },
+
+ // Attach an event handler functions for:
+ // - navigation buttons
+ // - browser scrolling, resizing;
+ // - focusing
+ // - keyboard
+ // - detecting inactivity
+ // ======================================
+
+ addEvents: function () {
+ var self = this;
+
+ self.removeEvents();
+
+ // Make navigation elements clickable
+ // ==================================
+
+ self.$refs.container
+ .on("click.fb-close", "[data-fancybox-close]", function (e) {
+ e.stopPropagation();
+ e.preventDefault();
+
+ self.close(e);
+ })
+ .on("touchstart.fb-prev click.fb-prev", "[data-fancybox-prev]", function (e) {
+ e.stopPropagation();
+ e.preventDefault();
+
+ self.previous();
+ })
+ .on("touchstart.fb-next click.fb-next", "[data-fancybox-next]", function (e) {
+ e.stopPropagation();
+ e.preventDefault();
+
+ self.next();
+ })
+ .on("click.fb", "[data-fancybox-zoom]", function (e) {
+ // Click handler for zoom button
+ self[self.isScaledDown() ? "scaleToActual" : "scaleToFit"]();
+ });
+
+ // Handle page scrolling and browser resizing
+ // ==========================================
+
+ $W.on("orientationchange.fb resize.fb", function (e) {
+ if (e && e.originalEvent && e.originalEvent.type === "resize") {
+ if (self.requestId) {
+ cancelAFrame(self.requestId);
+ }
+
+ self.requestId = requestAFrame(function () {
+ self.update(e);
+ });
+ } else {
+ if (self.current && self.current.type === "iframe") {
+ self.$refs.stage.hide();
+ }
+
+ setTimeout(
+ function () {
+ self.$refs.stage.show();
+
+ self.update(e);
+ },
+ $.fancybox.isMobile ? 600 : 250
+ );
+ }
+ });
+
+ $D.on("keydown.fb", function (e) {
+ var instance = $.fancybox ? $.fancybox.getInstance() : null,
+ current = instance.current,
+ keycode = e.keyCode || e.which;
+
+ // Trap keyboard focus inside of the modal
+ // =======================================
+
+ if (keycode == 9) {
+ if (current.opts.trapFocus) {
+ self.focus(e);
+ }
+
+ return;
+ }
+
+ // Enable keyboard navigation
+ // ==========================
+
+ if (!current.opts.keyboard || e.ctrlKey || e.altKey || e.shiftKey || $(e.target).is("input,textarea,video,audio,select")) {
+ return;
+ }
+
+ // Backspace and Esc keys
+ if (keycode === 8 || keycode === 27) {
+ e.preventDefault();
+
+ self.close(e);
+
+ return;
+ }
+
+ // Left arrow and Up arrow
+ if (keycode === 37 || keycode === 38) {
+ e.preventDefault();
+
+ self.previous();
+
+ return;
+ }
+
+ // Righ arrow and Down arrow
+ if (keycode === 39 || keycode === 40) {
+ e.preventDefault();
+
+ self.next();
+
+ return;
+ }
+
+ self.trigger("afterKeydown", e, keycode);
+ });
+
+ // Hide controls after some inactivity period
+ if (self.group[self.currIndex].opts.idleTime) {
+ self.idleSecondsCounter = 0;
+
+ $D.on(
+ "mousemove.fb-idle mouseleave.fb-idle mousedown.fb-idle touchstart.fb-idle touchmove.fb-idle scroll.fb-idle keydown.fb-idle",
+ function (e) {
+ self.idleSecondsCounter = 0;
+
+ if (self.isIdle) {
+ self.showControls();
+ }
+
+ self.isIdle = false;
+ }
+ );
+
+ self.idleInterval = window.setInterval(function () {
+ self.idleSecondsCounter++;
+
+ if (self.idleSecondsCounter >= self.group[self.currIndex].opts.idleTime && !self.isDragging) {
+ self.isIdle = true;
+ self.idleSecondsCounter = 0;
+
+ self.hideControls();
+ }
+ }, 1000);
+ }
+ },
+
+ // Remove events added by the core
+ // ===============================
+
+ removeEvents: function () {
+ var self = this;
+
+ $W.off("orientationchange.fb resize.fb");
+ $D.off("keydown.fb .fb-idle");
+
+ this.$refs.container.off(".fb-close .fb-prev .fb-next");
+
+ if (self.idleInterval) {
+ window.clearInterval(self.idleInterval);
+
+ self.idleInterval = null;
+ }
+ },
+
+ // Change to previous gallery item
+ // ===============================
+
+ previous: function (duration) {
+ return this.jumpTo(this.currPos - 1, duration);
+ },
+
+ // Change to next gallery item
+ // ===========================
+
+ next: function (duration) {
+ return this.jumpTo(this.currPos + 1, duration);
+ },
+
+ // Switch to selected gallery item
+ // ===============================
+
+ jumpTo: function (pos, duration) {
+ var self = this,
+ groupLen = self.group.length,
+ firstRun,
+ isMoved,
+ loop,
+ current,
+ previous,
+ slidePos,
+ stagePos,
+ prop,
+ diff;
+
+ if (self.isDragging || self.isClosing || (self.isAnimating && self.firstRun)) {
+ return;
+ }
+
+ // Should loop?
+ pos = parseInt(pos, 10);
+ loop = self.current ? self.current.opts.loop : self.opts.loop;
+
+ if (!loop && (pos < 0 || pos >= groupLen)) {
+ return false;
+ }
+
+ // Check if opening for the first time; this helps to speed things up
+ firstRun = self.firstRun = !Object.keys(self.slides).length;
+
+ // Create slides
+ previous = self.current;
+
+ self.prevIndex = self.currIndex;
+ self.prevPos = self.currPos;
+
+ current = self.createSlide(pos);
+
+ if (groupLen > 1) {
+ if (loop || current.index < groupLen - 1) {
+ self.createSlide(pos + 1);
+ }
+
+ if (loop || current.index > 0) {
+ self.createSlide(pos - 1);
+ }
+ }
+
+ self.current = current;
+ self.currIndex = current.index;
+ self.currPos = current.pos;
+
+ self.trigger("beforeShow", firstRun);
+
+ self.updateControls();
+
+ // Validate duration length
+ current.forcedDuration = undefined;
+
+ if ($.isNumeric(duration)) {
+ current.forcedDuration = duration;
+ } else {
+ duration = current.opts[firstRun ? "animationDuration" : "transitionDuration"];
+ }
+
+ duration = parseInt(duration, 10);
+
+ // Check if user has swiped the slides or if still animating
+ isMoved = self.isMoved(current);
+
+ // Make sure current slide is visible
+ current.$slide.addClass("fancybox-slide--current");
+
+ // Fresh start - reveal container, current slide and start loading content
+ if (firstRun) {
+ if (current.opts.animationEffect && duration) {
+ self.$refs.container.css("transition-duration", duration + "ms");
+ }
+
+ self.$refs.container.addClass("fancybox-is-open").trigger("focus");
+
+ // Attempt to load content into slide
+ // This will later call `afterLoad` -> `revealContent`
+ self.loadSlide(current);
+
+ self.preload("image");
+
+ return;
+ }
+
+ // Get actual slide/stage positions (before cleaning up)
+ slidePos = $.fancybox.getTranslate(previous.$slide);
+ stagePos = $.fancybox.getTranslate(self.$refs.stage);
+
+ // Clean up all slides
+ $.each(self.slides, function (index, slide) {
+ $.fancybox.stop(slide.$slide, true);
+ });
+
+ if (previous.pos !== current.pos) {
+ previous.isComplete = false;
+ }
+
+ previous.$slide.removeClass("fancybox-slide--complete fancybox-slide--current");
+
+ // If slides are out of place, then animate them to correct position
+ if (isMoved) {
+ // Calculate horizontal swipe distance
+ diff = slidePos.left - (previous.pos * slidePos.width + previous.pos * previous.opts.gutter);
+
+ $.each(self.slides, function (index, slide) {
+ slide.$slide.removeClass("fancybox-animated").removeClass(function (index, className) {
+ return (className.match(/(^|\s)fancybox-fx-\S+/g) || []).join(" ");
+ });
+
+ // Make sure that each slide is in equal distance
+ // This is mostly needed for freshly added slides, because they are not yet positioned
+ var leftPos = slide.pos * slidePos.width + slide.pos * slide.opts.gutter;
+
+ $.fancybox.setTranslate(slide.$slide, {
+ top: 0,
+ left: leftPos - stagePos.left + diff
+ });
+
+ if (slide.pos !== current.pos) {
+ slide.$slide.addClass("fancybox-slide--" + (slide.pos > current.pos ? "next" : "previous"));
+ }
+
+ // Redraw to make sure that transition will start
+ forceRedraw(slide.$slide);
+
+ // Animate the slide
+ $.fancybox.animate(
+ slide.$slide, {
+ top: 0,
+ left: (slide.pos - current.pos) * slidePos.width + (slide.pos - current.pos) * slide.opts.gutter
+ },
+ duration,
+ function () {
+ slide.$slide
+ .css({
+ transform: "",
+ opacity: ""
+ })
+ .removeClass("fancybox-slide--next fancybox-slide--previous");
+
+ if (slide.pos === self.currPos) {
+ self.complete();
+ }
+ }
+ );
+ });
+ } else if (duration && current.opts.transitionEffect) {
+ // Set transition effect for previously active slide
+ prop = "fancybox-animated fancybox-fx-" + current.opts.transitionEffect;
+
+ previous.$slide.addClass("fancybox-slide--" + (previous.pos > current.pos ? "next" : "previous"));
+
+ $.fancybox.animate(
+ previous.$slide,
+ prop,
+ duration,
+ function () {
+ previous.$slide.removeClass(prop).removeClass("fancybox-slide--next fancybox-slide--previous");
+ },
+ false
+ );
+ }
+
+ if (current.isLoaded) {
+ self.revealContent(current);
+ } else {
+ self.loadSlide(current);
+ }
+
+ self.preload("image");
+ },
+
+ // Create new "slide" element
+ // These are gallery items that are actually added to DOM
+ // =======================================================
+
+ createSlide: function (pos) {
+ var self = this,
+ $slide,
+ index;
+
+ index = pos % self.group.length;
+ index = index < 0 ? self.group.length + index : index;
+
+ if (!self.slides[pos] && self.group[index]) {
+ $slide = $('<div class="fancybox-slide"></div>').appendTo(self.$refs.stage);
+
+ self.slides[pos] = $.extend(true, {}, self.group[index], {
+ pos: pos,
+ $slide: $slide,
+ isLoaded: false
+ });
+
+ self.updateSlide(self.slides[pos]);
+ }
+
+ return self.slides[pos];
+ },
+
+ // Scale image to the actual size of the image;
+ // x and y values should be relative to the slide
+ // ==============================================
+
+ scaleToActual: function (x, y, duration) {
+ var self = this,
+ current = self.current,
+ $content = current.$content,
+ canvasWidth = $.fancybox.getTranslate(current.$slide).width,
+ canvasHeight = $.fancybox.getTranslate(current.$slide).height,
+ newImgWidth = current.width,
+ newImgHeight = current.height,
+ imgPos,
+ posX,
+ posY,
+ scaleX,
+ scaleY;
+
+ if (self.isAnimating || self.isMoved() || !$content || !(current.type == "image" && current.isLoaded && !current.hasError)) {
+ return;
+ }
+
+ self.isAnimating = true;
+
+ $.fancybox.stop($content);
+
+ x = x === undefined ? canvasWidth * 0.5 : x;
+ y = y === undefined ? canvasHeight * 0.5 : y;
+
+ imgPos = $.fancybox.getTranslate($content);
+
+ imgPos.top -= $.fancybox.getTranslate(current.$slide).top;
+ imgPos.left -= $.fancybox.getTranslate(current.$slide).left;
+
+ scaleX = newImgWidth / imgPos.width;
+ scaleY = newImgHeight / imgPos.height;
+
+ // Get center position for original image
+ posX = canvasWidth * 0.5 - newImgWidth * 0.5;
+ posY = canvasHeight * 0.5 - newImgHeight * 0.5;
+
+ // Make sure image does not move away from edges
+ if (newImgWidth > canvasWidth) {
+ posX = imgPos.left * scaleX - (x * scaleX - x);
+
+ if (posX > 0) {
+ posX = 0;
+ }
+
+ if (posX < canvasWidth - newImgWidth) {
+ posX = canvasWidth - newImgWidth;
+ }
+ }
+
+ if (newImgHeight > canvasHeight) {
+ posY = imgPos.top * scaleY - (y * scaleY - y);
+
+ if (posY > 0) {
+ posY = 0;
+ }
+
+ if (posY < canvasHeight - newImgHeight) {
+ posY = canvasHeight - newImgHeight;
+ }
+ }
+
+ self.updateCursor(newImgWidth, newImgHeight);
+
+ $.fancybox.animate(
+ $content, {
+ top: posY,
+ left: posX,
+ scaleX: scaleX,
+ scaleY: scaleY
+ },
+ duration || 366,
+ function () {
+ self.isAnimating = false;
+ }
+ );
+
+ // Stop slideshow
+ if (self.SlideShow && self.SlideShow.isActive) {
+ self.SlideShow.stop();
+ }
+ },
+
+ // Scale image to fit inside parent element
+ // ========================================
+
+ scaleToFit: function (duration) {
+ var self = this,
+ current = self.current,
+ $content = current.$content,
+ end;
+
+ if (self.isAnimating || self.isMoved() || !$content || !(current.type == "image" && current.isLoaded && !current.hasError)) {
+ return;
+ }
+
+ self.isAnimating = true;
+
+ $.fancybox.stop($content);
+
+ end = self.getFitPos(current);
+
+ self.updateCursor(end.width, end.height);
+
+ $.fancybox.animate(
+ $content, {
+ top: end.top,
+ left: end.left,
+ scaleX: end.width / $content.width(),
+ scaleY: end.height / $content.height()
+ },
+ duration || 366,
+ function () {
+ self.isAnimating = false;
+ }
+ );
+ },
+
+ // Calculate image size to fit inside viewport
+ // ===========================================
+
+ getFitPos: function (slide) {
+ var self = this,
+ $content = slide.$content,
+ $slide = slide.$slide,
+ width = slide.width || slide.opts.width,
+ height = slide.height || slide.opts.height,
+ maxWidth,
+ maxHeight,
+ minRatio,
+ aspectRatio,
+ rez = {};
+
+ if (!slide.isLoaded || !$content || !$content.length) {
+ return false;
+ }
+
+ maxWidth = $.fancybox.getTranslate(self.$refs.stage).width;
+ maxHeight = $.fancybox.getTranslate(self.$refs.stage).height;
+
+ maxWidth -=
+ parseFloat($slide.css("paddingLeft")) +
+ parseFloat($slide.css("paddingRight")) +
+ parseFloat($content.css("marginLeft")) +
+ parseFloat($content.css("marginRight"));
+
+ maxHeight -=
+ parseFloat($slide.css("paddingTop")) +
+ parseFloat($slide.css("paddingBottom")) +
+ parseFloat($content.css("marginTop")) +
+ parseFloat($content.css("marginBottom"));
+
+ if (!width || !height) {
+ width = maxWidth;
+ height = maxHeight;
+ }
+
+ minRatio = Math.min(1, maxWidth / width, maxHeight / height);
+
+ width = minRatio * width;
+ height = minRatio * height;
+
+ // Adjust width/height to precisely fit into container
+ if (width > maxWidth - 0.5) {
+ width = maxWidth;
+ }
+
+ if (height > maxHeight - 0.5) {
+ height = maxHeight;
+ }
+
+ if (slide.type === "image") {
+ rez.top = Math.floor((maxHeight - height) * 0.5) + parseFloat($slide.css("paddingTop"));
+ rez.left = Math.floor((maxWidth - width) * 0.5) + parseFloat($slide.css("paddingLeft"));
+ } else if (slide.contentType === "video") {
+ // Force aspect ratio for the video
+ // "I say the whole world must learn of our peaceful ways… by force!"
+ aspectRatio = slide.opts.width && slide.opts.height ? width / height : slide.opts.ratio || 16 / 9;
+
+ if (height > width / aspectRatio) {
+ height = width / aspectRatio;
+ } else if (width > height * aspectRatio) {
+ width = height * aspectRatio;
+ }
+ }
+
+ rez.width = width;
+ rez.height = height;
+
+ return rez;
+ },
+
+ // Update content size and position for all slides
+ // ==============================================
+
+ update: function (e) {
+ var self = this;
+
+ $.each(self.slides, function (key, slide) {
+ self.updateSlide(slide, e);
+ });
+ },
+
+ // Update slide content position and size
+ // ======================================
+
+ updateSlide: function (slide, e) {
+ var self = this,
+ $content = slide && slide.$content,
+ width = slide.width || slide.opts.width,
+ height = slide.height || slide.opts.height,
+ $slide = slide.$slide;
+
+ // First, prevent caption overlap, if needed
+ self.adjustCaption(slide);
+
+ // Then resize content to fit inside the slide
+ if ($content && (width || height || slide.contentType === "video") && !slide.hasError) {
+ $.fancybox.stop($content);
+
+ $.fancybox.setTranslate($content, self.getFitPos(slide));
+
+ if (slide.pos === self.currPos) {
+ self.isAnimating = false;
+
+ self.updateCursor();
+ }
+ }
+
+ // Then some adjustments
+ self.adjustLayout(slide);
+
+ if ($slide.length) {
+ $slide.trigger("refresh");
+
+ if (slide.pos === self.currPos) {
+ self.$refs.toolbar
+ .add(self.$refs.navigation.find(".fancybox-button--arrow_right"))
+ .toggleClass("compensate-for-scrollbar", $slide.get(0).scrollHeight > $slide.get(0).clientHeight);
+ }
+ }
+
+ self.trigger("onUpdate", slide, e);
+ },
+
+ // Horizontally center slide
+ // =========================
+
+ centerSlide: function (duration) {
+ var self = this,
+ current = self.current,
+ $slide = current.$slide;
+
+ if (self.isClosing || !current) {
+ return;
+ }
+
+ $slide.siblings().css({
+ transform: "",
+ opacity: ""
+ });
+
+ $slide
+ .parent()
+ .children()
+ .removeClass("fancybox-slide--previous fancybox-slide--next");
+
+ $.fancybox.animate(
+ $slide, {
+ top: 0,
+ left: 0,
+ opacity: 1
+ },
+ duration === undefined ? 0 : duration,
+ function () {
+ // Clean up
+ $slide.css({
+ transform: "",
+ opacity: ""
+ });
+
+ if (!current.isComplete) {
+ self.complete();
+ }
+ },
+ false
+ );
+ },
+
+ // Check if current slide is moved (swiped)
+ // ========================================
+
+ isMoved: function (slide) {
+ var current = slide || this.current,
+ slidePos,
+ stagePos;
+
+ if (!current) {
+ return false;
+ }
+
+ stagePos = $.fancybox.getTranslate(this.$refs.stage);
+ slidePos = $.fancybox.getTranslate(current.$slide);
+
+ return (
+ !current.$slide.hasClass("fancybox-animated") &&
+ (Math.abs(slidePos.top - stagePos.top) > 0.5 || Math.abs(slidePos.left - stagePos.left) > 0.5)
+ );
+ },
+
+ // Update cursor style depending if content can be zoomed
+ // ======================================================
+
+ updateCursor: function (nextWidth, nextHeight) {
+ var self = this,
+ current = self.current,
+ $container = self.$refs.container,
+ canPan,
+ isZoomable;
+
+ if (!current || self.isClosing || !self.Guestures) {
+ return;
+ }
+
+ $container.removeClass("fancybox-is-zoomable fancybox-can-zoomIn fancybox-can-zoomOut fancybox-can-swipe fancybox-can-pan");
+
+ canPan = self.canPan(nextWidth, nextHeight);
+
+ isZoomable = canPan ? true : self.isZoomable();
+
+ $container.toggleClass("fancybox-is-zoomable", isZoomable);
+
+ $("[data-fancybox-zoom]").prop("disabled", !isZoomable);
+
+ if (canPan) {
+ $container.addClass("fancybox-can-pan");
+ } else if (
+ isZoomable &&
+ (current.opts.clickContent === "zoom" || ($.isFunction(current.opts.clickContent) && current.opts.clickContent(current) == "zoom"))
+ ) {
+ $container.addClass("fancybox-can-zoomIn");
+ } else if (current.opts.touch && (current.opts.touch.vertical || self.group.length > 1) && current.contentType !== "video") {
+ $container.addClass("fancybox-can-swipe");
+ }
+ },
+
+ // Check if current slide is zoomable
+ // ==================================
+
+ isZoomable: function () {
+ var self = this,
+ current = self.current,
+ fitPos;
+
+ // Assume that slide is zoomable if:
+ // - image is still loading
+ // - actual size of the image is smaller than available area
+ if (current && !self.isClosing && current.type === "image" && !current.hasError) {
+ if (!current.isLoaded) {
+ return true;
+ }
+
+ fitPos = self.getFitPos(current);
+
+ if (fitPos && (current.width > fitPos.width || current.height > fitPos.height)) {
+ return true;
+ }
+ }
+
+ return false;
+ },
+
+ // Check if current image dimensions are smaller than actual
+ // =========================================================
+
+ isScaledDown: function (nextWidth, nextHeight) {
+ var self = this,
+ rez = false,
+ current = self.current,
+ $content = current.$content;
+
+ if (nextWidth !== undefined && nextHeight !== undefined) {
+ rez = nextWidth < current.width && nextHeight < current.height;
+ } else if ($content) {
+ rez = $.fancybox.getTranslate($content);
+ rez = rez.width < current.width && rez.height < current.height;
+ }
+
+ return rez;
+ },
+
+ // Check if image dimensions exceed parent element
+ // ===============================================
+
+ canPan: function (nextWidth, nextHeight) {
+ var self = this,
+ current = self.current,
+ pos = null,
+ rez = false;
+
+ if (current.type === "image" && (current.isComplete || (nextWidth && nextHeight)) && !current.hasError) {
+ rez = self.getFitPos(current);
+
+ if (nextWidth !== undefined && nextHeight !== undefined) {
+ pos = {
+ width: nextWidth,
+ height: nextHeight
+ };
+ } else if (current.isComplete) {
+ pos = $.fancybox.getTranslate(current.$content);
+ }
+
+ if (pos && rez) {
+ rez = Math.abs(pos.width - rez.width) > 1.5 || Math.abs(pos.height - rez.height) > 1.5;
+ }
+ }
+
+ return rez;
+ },
+
+ // Load content into the slide
+ // ===========================
+
+ loadSlide: function (slide) {
+ var self = this,
+ type,
+ $slide,
+ ajaxLoad;
+
+ if (slide.isLoading || slide.isLoaded) {
+ return;
+ }
+
+ slide.isLoading = true;
+
+ if (self.trigger("beforeLoad", slide) === false) {
+ slide.isLoading = false;
+
+ return false;
+ }
+
+ type = slide.type;
+ $slide = slide.$slide;
+
+ $slide
+ .off("refresh")
+ .trigger("onReset")
+ .addClass(slide.opts.slideClass);
+
+ // Create content depending on the type
+ switch (type) {
+ case "image":
+ self.setImage(slide);
+
+ break;
+
+ case "iframe":
+ self.setIframe(slide);
+
+ break;
+
+ case "html":
+ self.setContent(slide, slide.src || slide.content);
+
+ break;
+
+ case "video":
+ self.setContent(
+ slide,
+ slide.opts.video.tpl
+ .replace(/\{\{src\}\}/gi, slide.src)
+ .replace("{{format}}", slide.opts.videoFormat || slide.opts.video.format || "")
+ .replace("{{poster}}", slide.thumb || "")
+ );
+
+ break;
+
+ case "inline":
+ if ($(slide.src).length) {
+ self.setContent(slide, $(slide.src));
+ } else {
+ self.setError(slide);
+ }
+
+ break;
+
+ case "ajax":
+ self.showLoading(slide);
+
+ ajaxLoad = $.ajax(
+ $.extend({}, slide.opts.ajax.settings, {
+ url: slide.src,
+ success: function (data, textStatus) {
+ if (textStatus === "success") {
+ self.setContent(slide, data);
+ }
+ },
+ error: function (jqXHR, textStatus) {
+ if (jqXHR && textStatus !== "abort") {
+ self.setError(slide);
+ }
+ }
+ })
+ );
+
+ $slide.one("onReset", function () {
+ ajaxLoad.abort();
+ });
+
+ break;
+
+ default:
+ self.setError(slide);
+
+ break;
+ }
+
+ return true;
+ },
+
+ // Use thumbnail image, if possible
+ // ================================
+
+ setImage: function (slide) {
+ var self = this,
+ ghost;
+
+ // Check if need to show loading icon
+ setTimeout(function () {
+ var $img = slide.$image;
+
+ if (!self.isClosing && slide.isLoading && (!$img || !$img.length || !$img[0].complete) && !slide.hasError) {
+ self.showLoading(slide);
+ }
+ }, 50);
+
+ //Check if image has srcset
+ self.checkSrcset(slide);
+
+ // This will be wrapper containing both ghost and actual image
+ slide.$content = $('<div class="fancybox-content"></div>')
+ .addClass("fancybox-is-hidden")
+ .appendTo(slide.$slide.addClass("fancybox-slide--image"));
+
+ // If we have a thumbnail, we can display it while actual image is loading
+ // Users will not stare at black screen and actual image will appear gradually
+ if (slide.opts.preload !== false && slide.opts.width && slide.opts.height && slide.thumb) {
+ slide.width = slide.opts.width;
+ slide.height = slide.opts.height;
+
+ ghost = document.createElement("img");
+
+ ghost.onerror = function () {
+ $(this).remove();
+
+ slide.$ghost = null;
+ };
+
+ ghost.onload = function () {
+ self.afterLoad(slide);
+ };
+
+ slide.$ghost = $(ghost)
+ .addClass("fancybox-image")
+ .appendTo(slide.$content)
+ .attr("src", slide.thumb);
+ }
+
+ // Start loading actual image
+ self.setBigImage(slide);
+ },
+
+ // Check if image has srcset and get the source
+ // ============================================
+ checkSrcset: function (slide) {
+ var srcset = slide.opts.srcset || slide.opts.image.srcset,
+ found,
+ temp,
+ pxRatio,
+ windowWidth;
+
+ // If we have "srcset", then we need to find first matching "src" value.
+ // This is necessary, because when you set an src attribute, the browser will preload the image
+ // before any javascript or even CSS is applied.
+ if (srcset) {
+ pxRatio = window.devicePixelRatio || 1;
+ windowWidth = window.innerWidth * pxRatio;
+
+ temp = srcset.split(",").map(function (el) {
+ var ret = {};
+
+ el.trim()
+ .split(/\s+/)
+ .forEach(function (el, i) {
+ var value = parseInt(el.substring(0, el.length - 1), 10);
+
+ if (i === 0) {
+ return (ret.url = el);
+ }
+
+ if (value) {
+ ret.value = value;
+ ret.postfix = el[el.length - 1];
+ }
+ });
+
+ return ret;
+ });
+
+ // Sort by value
+ temp.sort(function (a, b) {
+ return a.value - b.value;
+ });
+
+ // Ok, now we have an array of all srcset values
+ for (var j = 0; j < temp.length; j++) {
+ var el = temp[j];
+
+ if ((el.postfix === "w" && el.value >= windowWidth) || (el.postfix === "x" && el.value >= pxRatio)) {
+ found = el;
+ break;
+ }
+ }
+
+ // If not found, take the last one
+ if (!found && temp.length) {
+ found = temp[temp.length - 1];
+ }
+
+ if (found) {
+ slide.src = found.url;
+
+ // If we have default width/height values, we can calculate height for matching source
+ if (slide.width && slide.height && found.postfix == "w") {
+ slide.height = (slide.width / slide.height) * found.value;
+ slide.width = found.value;
+ }
+
+ slide.opts.srcset = srcset;
+ }
+ }
+ },
+
+ // Create full-size image
+ // ======================
+
+ setBigImage: function (slide) {
+ var self = this,
+ img = document.createElement("img"),
+ $img = $(img);
+
+ slide.$image = $img
+ .one("error", function () {
+ self.setError(slide);
+ })
+ .one("load", function () {
+ var sizes;
+
+ if (!slide.$ghost) {
+ self.resolveImageSlideSize(slide, this.naturalWidth, this.naturalHeight);
+
+ self.afterLoad(slide);
+ }
+
+ if (self.isClosing) {
+ return;
+ }
+
+ if (slide.opts.srcset) {
+ sizes = slide.opts.sizes;
+
+ if (!sizes || sizes === "auto") {
+ sizes =
+ (slide.width / slide.height > 1 && $W.width() / $W.height() > 1 ? "100" : Math.round((slide.width / slide.height) * 100)) +
+ "vw";
+ }
+
+ $img.attr("sizes", sizes).attr("srcset", slide.opts.srcset);
+ }
+
+ // Hide temporary image after some delay
+ if (slide.$ghost) {
+ setTimeout(function () {
+ if (slide.$ghost && !self.isClosing) {
+ slide.$ghost.hide();
+ }
+ }, Math.min(300, Math.max(1000, slide.height / 1600)));
+ }
+
+ self.hideLoading(slide);
+ })
+ .addClass("fancybox-image")
+ .attr("src", slide.src)
+ .appendTo(slide.$content);
+
+ if ((img.complete || img.readyState == "complete") && $img.naturalWidth && $img.naturalHeight) {
+ $img.trigger("load");
+ } else if (img.error) {
+ $img.trigger("error");
+ }
+ },
+
+ // Computes the slide size from image size and maxWidth/maxHeight
+ // ==============================================================
+
+ resolveImageSlideSize: function (slide, imgWidth, imgHeight) {
+ var maxWidth = parseInt(slide.opts.width, 10),
+ maxHeight = parseInt(slide.opts.height, 10);
+
+ // Sets the default values from the image
+ slide.width = imgWidth;
+ slide.height = imgHeight;
+
+ if (maxWidth > 0) {
+ slide.width = maxWidth;
+ slide.height = Math.floor((maxWidth * imgHeight) / imgWidth);
+ }
+
+ if (maxHeight > 0) {
+ slide.width = Math.floor((maxHeight * imgWidth) / imgHeight);
+ slide.height = maxHeight;
+ }
+ },
+
+ // Create iframe wrapper, iframe and bindings
+ // ==========================================
+
+ setIframe: function (slide) {
+ var self = this,
+ opts = slide.opts.iframe,
+ $slide = slide.$slide,
+ $iframe;
+
+ slide.$content = $('<div class="fancybox-content' + (opts.preload ? " fancybox-is-hidden" : "") + '"></div>')
+ .css(opts.css)
+ .appendTo($slide);
+
+ $slide.addClass("fancybox-slide--" + slide.contentType);
+
+ slide.$iframe = $iframe = $(opts.tpl.replace(/\{rnd\}/g, new Date().getTime()))
+ .attr(opts.attr)
+ .appendTo(slide.$content);
+
+ if (opts.preload) {
+ self.showLoading(slide);
+
+ // Unfortunately, it is not always possible to determine if iframe is successfully loaded
+ // (due to browser security policy)
+
+ $iframe.on("load.fb error.fb", function (e) {
+ this.isReady = 1;
+
+ slide.$slide.trigger("refresh");
+
+ self.afterLoad(slide);
+ });
+
+ // Recalculate iframe content size
+ // ===============================
+
+ $slide.on("refresh.fb", function () {
+ var $content = slide.$content,
+ frameWidth = opts.css.width,
+ frameHeight = opts.css.height,
+ $contents,
+ $body;
+
+ if ($iframe[0].isReady !== 1) {
+ return;
+ }
+
+ try {
+ $contents = $iframe.contents();
+ $body = $contents.find("body");
+ } catch (ignore) {}
+
+ // Calculate content dimensions, if it is accessible
+ if ($body && $body.length && $body.children().length) {
+ // Avoid scrolling to top (if multiple instances)
+ $slide.css("overflow", "visible");
+
+ $content.css({
+ width: "100%",
+ "max-width": "100%",
+ height: "9999px"
+ });
+
+ if (frameWidth === undefined) {
+ frameWidth = Math.ceil(Math.max($body[0].clientWidth, $body.outerWidth(true)));
+ }
+
+ $content.css("width", frameWidth ? frameWidth : "").css("max-width", "");
+
+ if (frameHeight === undefined) {
+ frameHeight = Math.ceil(Math.max($body[0].clientHeight, $body.outerHeight(true)));
+ }
+
+ $content.css("height", frameHeight ? frameHeight : "");
+
+ $slide.css("overflow", "auto");
+ }
+
+ $content.removeClass("fancybox-is-hidden");
+ });
+ } else {
+ self.afterLoad(slide);
+ }
+
+ $iframe.attr("src", slide.src);
+
+ // Remove iframe if closing or changing gallery item
+ $slide.one("onReset", function () {
+ // This helps IE not to throw errors when closing
+ try {
+ $(this)
+ .find("iframe")
+ .hide()
+ .unbind()
+ .attr("src", "//about:blank");
+ } catch (ignore) {}
+
+ $(this)
+ .off("refresh.fb")
+ .empty();
+
+ slide.isLoaded = false;
+ slide.isRevealed = false;
+ });
+ },
+
+ // Wrap and append content to the slide
+ // ======================================
+
+ setContent: function (slide, content) {
+ var self = this;
+
+ if (self.isClosing) {
+ return;
+ }
+
+ self.hideLoading(slide);
+
+ if (slide.$content) {
+ $.fancybox.stop(slide.$content);
+ }
+
+ slide.$slide.empty();
+
+ // If content is a jQuery object, then it will be moved to the slide.
+ // The placeholder is created so we will know where to put it back.
+ if (isQuery(content) && content.parent().length) {
+ // Make sure content is not already moved to fancyBox
+ if (content.hasClass("fancybox-content") || content.parent().hasClass("fancybox-content")) {
+ content.parents(".fancybox-slide").trigger("onReset");
+ }
+
+ // Create temporary element marking original place of the content
+ slide.$placeholder = $("<div>")
+ .hide()
+ .insertAfter(content);
+
+ // Make sure content is visible
+ content.css("display", "inline-block");
+ } else if (!slide.hasError) {
+ // If content is just a plain text, try to convert it to html
+ if ($.type(content) === "string") {
+ content = $("<div>")
+ .append($.trim(content))
+ .contents();
+ }
+
+ // If "filter" option is provided, then filter content
+ if (slide.opts.filter) {
+ content = $("<div>")
+ .html(content)
+ .find(slide.opts.filter);
+ }
+ }
+
+ slide.$slide.one("onReset", function () {
+ // Pause all html5 video/audio
+ $(this)
+ .find("video,audio")
+ .trigger("pause");
+
+ // Put content back
+ if (slide.$placeholder) {
+ slide.$placeholder.after(content.removeClass("fancybox-content").hide()).remove();
+
+ slide.$placeholder = null;
+ }
+
+ // Remove custom close button
+ if (slide.$smallBtn) {
+ slide.$smallBtn.remove();
+
+ slide.$smallBtn = null;
+ }
+
+ // Remove content and mark slide as not loaded
+ if (!slide.hasError) {
+ $(this).empty();
+
+ slide.isLoaded = false;
+ slide.isRevealed = false;
+ }
+ });
+
+ $(content).appendTo(slide.$slide);
+
+ if ($(content).is("video,audio")) {
+ $(content).addClass("fancybox-video");
+
+ $(content).wrap("<div></div>");
+
+ slide.contentType = "video";
+
+ slide.opts.width = slide.opts.width || $(content).attr("width");
+ slide.opts.height = slide.opts.height || $(content).attr("height");
+ }
+
+ slide.$content = slide.$slide
+ .children()
+ .filter("div,form,main,video,audio,article,.fancybox-content")
+ .first();
+
+ slide.$content.siblings().hide();
+
+ // Re-check if there is a valid content
+ // (in some cases, ajax response can contain various elements or plain text)
+ if (!slide.$content.length) {
+ slide.$content = slide.$slide
+ .wrapInner("<div></div>")
+ .children()
+ .first();
+ }
+
+ slide.$content.addClass("fancybox-content");
+
+ slide.$slide.addClass("fancybox-slide--" + slide.contentType);
+
+ self.afterLoad(slide);
+ },
+
+ // Display error message
+ // =====================
+
+ setError: function (slide) {
+ slide.hasError = true;
+
+ slide.$slide
+ .trigger("onReset")
+ .removeClass("fancybox-slide--" + slide.contentType)
+ .addClass("fancybox-slide--error");
+
+ slide.contentType = "html";
+
+ this.setContent(slide, this.translate(slide, slide.opts.errorTpl));
+
+ if (slide.pos === this.currPos) {
+ this.isAnimating = false;
+ }
+ },
+
+ // Show loading icon inside the slide
+ // ==================================
+
+ showLoading: function (slide) {
+ var self = this;
+
+ slide = slide || self.current;
+
+ if (slide && !slide.$spinner) {
+ slide.$spinner = $(self.translate(self, self.opts.spinnerTpl))
+ .appendTo(slide.$slide)
+ .hide()
+ .fadeIn("fast");
+ }
+ },
+
+ // Remove loading icon from the slide
+ // ==================================
+
+ hideLoading: function (slide) {
+ var self = this;
+
+ slide = slide || self.current;
+
+ if (slide && slide.$spinner) {
+ slide.$spinner.stop().remove();
+
+ delete slide.$spinner;
+ }
+ },
+
+ // Adjustments after slide content has been loaded
+ // ===============================================
+
+ afterLoad: function (slide) {
+ var self = this;
+
+ if (self.isClosing) {
+ return;
+ }
+
+ slide.isLoading = false;
+ slide.isLoaded = true;
+
+ self.trigger("afterLoad", slide);
+
+ self.hideLoading(slide);
+
+ // Add small close button
+ if (slide.opts.smallBtn && (!slide.$smallBtn || !slide.$smallBtn.length)) {
+ slide.$smallBtn = $(self.translate(slide, slide.opts.btnTpl.smallBtn)).appendTo(slide.$content);
+ }
+
+ // Disable right click
+ if (slide.opts.protect && slide.$content && !slide.hasError) {
+ slide.$content.on("contextmenu.fb", function (e) {
+ if (e.button == 2) {
+ e.preventDefault();
+ }
+
+ return true;
+ });
+
+ // Add fake element on top of the image
+ // This makes a bit harder for user to select image
+ if (slide.type === "image") {
+ $('<div class="fancybox-spaceball"></div>').appendTo(slide.$content);
+ }
+ }
+
+ self.adjustCaption(slide);
+
+ self.adjustLayout(slide);
+
+ if (slide.pos === self.currPos) {
+ self.updateCursor();
+ }
+
+ self.revealContent(slide);
+ },
+
+ // Prevent caption overlap,
+ // fix css inconsistency across browsers
+ // =====================================
+
+ adjustCaption: function (slide) {
+ var self = this,
+ current = slide || self.current,
+ caption = current.opts.caption,
+ preventOverlap = current.opts.preventCaptionOverlap,
+ $caption = self.$refs.caption,
+ $clone,
+ captionH = false;
+
+ $caption.toggleClass("fancybox-caption--separate", preventOverlap);
+
+ if (preventOverlap && caption && caption.length) {
+ if (current.pos !== self.currPos) {
+ $clone = $caption.clone().appendTo($caption.parent());
+
+ $clone
+ .children()
+ .eq(0)
+ .empty()
+ .html(caption);
+
+ captionH = $clone.outerHeight(true);
+
+ $clone.empty().remove();
+ } else if (self.$caption) {
+ captionH = self.$caption.outerHeight(true);
+ }
+
+ current.$slide.css("padding-bottom", captionH || "");
+ }
+ },
+
+ // Simple hack to fix inconsistency across browsers, described here (affects Edge, too):
+ // https://bugzilla.mozilla.org/show_bug.cgi?id=748518
+ // ====================================================================================
+
+ adjustLayout: function (slide) {
+ var self = this,
+ current = slide || self.current,
+ scrollHeight,
+ marginBottom,
+ inlinePadding,
+ actualPadding;
+
+ if (current.isLoaded && current.opts.disableLayoutFix !== true) {
+ current.$content.css("margin-bottom", "");
+
+ // If we would always set margin-bottom for the content,
+ // then it would potentially break vertical align
+ if (current.$content.outerHeight() > current.$slide.height() + 0.5) {
+ inlinePadding = current.$slide[0].style["padding-bottom"];
+ actualPadding = current.$slide.css("padding-bottom");
+
+ if (parseFloat(actualPadding) > 0) {
+ scrollHeight = current.$slide[0].scrollHeight;
+
+ current.$slide.css("padding-bottom", 0);
+
+ if (Math.abs(scrollHeight - current.$slide[0].scrollHeight) < 1) {
+ marginBottom = actualPadding;
+ }
+
+ current.$slide.css("padding-bottom", inlinePadding);
+ }
+ }
+
+ current.$content.css("margin-bottom", marginBottom);
+ }
+ },
+
+ // Make content visible
+ // This method is called right after content has been loaded or
+ // user navigates gallery and transition should start
+ // ============================================================
+
+ revealContent: function (slide) {
+ var self = this,
+ $slide = slide.$slide,
+ end = false,
+ start = false,
+ isMoved = self.isMoved(slide),
+ isRevealed = slide.isRevealed,
+ effect,
+ effectClassName,
+ duration,
+ opacity;
+
+ slide.isRevealed = true;
+
+ effect = slide.opts[self.firstRun ? "animationEffect" : "transitionEffect"];
+ duration = slide.opts[self.firstRun ? "animationDuration" : "transitionDuration"];
+
+ duration = parseInt(slide.forcedDuration === undefined ? duration : slide.forcedDuration, 10);
+
+ if (isMoved || slide.pos !== self.currPos || !duration) {
+ effect = false;
+ }
+
+ // Check if can zoom
+ if (effect === "zoom") {
+ if (slide.pos === self.currPos && duration && slide.type === "image" && !slide.hasError && (start = self.getThumbPos(slide))) {
+ end = self.getFitPos(slide);
+ } else {
+ effect = "fade";
+ }
+ }
+
+ // Zoom animation
+ // ==============
+ if (effect === "zoom") {
+ self.isAnimating = true;
+
+ end.scaleX = end.width / start.width;
+ end.scaleY = end.height / start.height;
+
+ // Check if we need to animate opacity
+ opacity = slide.opts.zoomOpacity;
+
+ if (opacity == "auto") {
+ opacity = Math.abs(slide.width / slide.height - start.width / start.height) > 0.1;
+ }
+
+ if (opacity) {
+ start.opacity = 0.1;
+ end.opacity = 1;
+ }
+
+ // Draw image at start position
+ $.fancybox.setTranslate(slide.$content.removeClass("fancybox-is-hidden"), start);
+
+ forceRedraw(slide.$content);
+
+ // Start animation
+ $.fancybox.animate(slide.$content, end, duration, function () {
+ self.isAnimating = false;
+
+ self.complete();
+ });
+
+ return;
+ }
+
+ self.updateSlide(slide);
+
+ // Simply show content if no effect
+ // ================================
+ if (!effect) {
+ slide.$content.removeClass("fancybox-is-hidden");
+
+ if (!isRevealed && isMoved && slide.type === "image" && !slide.hasError) {
+ slide.$content.hide().fadeIn("fast");
+ }
+
+ if (slide.pos === self.currPos) {
+ self.complete();
+ }
+
+ return;
+ }
+
+ // Prepare for CSS transiton
+ // =========================
+ $.fancybox.stop($slide);
+
+ //effectClassName = "fancybox-animated fancybox-slide--" + (slide.pos >= self.prevPos ? "next" : "previous") + " fancybox-fx-" + effect;
+ effectClassName = "fancybox-slide--" + (slide.pos >= self.prevPos ? "next" : "previous") + " fancybox-animated fancybox-fx-" + effect;
+
+ $slide.addClass(effectClassName).removeClass("fancybox-slide--current"); //.addClass(effectClassName);
+
+ slide.$content.removeClass("fancybox-is-hidden");
+
+ // Force reflow
+ forceRedraw($slide);
+
+ if (slide.type !== "image") {
+ slide.$content.hide().show(0);
+ }
+
+ $.fancybox.animate(
+ $slide,
+ "fancybox-slide--current",
+ duration,
+ function () {
+ $slide.removeClass(effectClassName).css({
+ transform: "",
+ opacity: ""
+ });
+
+ if (slide.pos === self.currPos) {
+ self.complete();
+ }
+ },
+ true
+ );
+ },
+
+ // Check if we can and have to zoom from thumbnail
+ //================================================
+
+ getThumbPos: function (slide) {
+ var rez = false,
+ $thumb = slide.$thumb,
+ thumbPos,
+ btw,
+ brw,
+ bbw,
+ blw;
+
+ if (!$thumb || !inViewport($thumb[0])) {
+ return false;
+ }
+
+ thumbPos = $.fancybox.getTranslate($thumb);
+
+ btw = parseFloat($thumb.css("border-top-width") || 0);
+ brw = parseFloat($thumb.css("border-right-width") || 0);
+ bbw = parseFloat($thumb.css("border-bottom-width") || 0);
+ blw = parseFloat($thumb.css("border-left-width") || 0);
+
+ rez = {
+ top: thumbPos.top + btw,
+ left: thumbPos.left + blw,
+ width: thumbPos.width - brw - blw,
+ height: thumbPos.height - btw - bbw,
+ scaleX: 1,
+ scaleY: 1
+ };
+
+ return thumbPos.width > 0 && thumbPos.height > 0 ? rez : false;
+ },
+
+ // Final adjustments after current gallery item is moved to position
+ // and it`s content is loaded
+ // ==================================================================
+
+ complete: function () {
+ var self = this,
+ current = self.current,
+ slides = {},
+ $el;
+
+ if (self.isMoved() || !current.isLoaded) {
+ return;
+ }
+
+ if (!current.isComplete) {
+ current.isComplete = true;
+
+ current.$slide.siblings().trigger("onReset");
+
+ self.preload("inline");
+
+ // Trigger any CSS transiton inside the slide
+ forceRedraw(current.$slide);
+
+ current.$slide.addClass("fancybox-slide--complete");
+
+ // Remove unnecessary slides
+ $.each(self.slides, function (key, slide) {
+ if (slide.pos >= self.currPos - 1 && slide.pos <= self.currPos + 1) {
+ slides[slide.pos] = slide;
+ } else if (slide) {
+ $.fancybox.stop(slide.$slide);
+
+ slide.$slide.off().remove();
+ }
+ });
+
+ self.slides = slides;
+ }
+
+ self.isAnimating = false;
+
+ self.updateCursor();
+
+ self.trigger("afterShow");
+
+ // Autoplay first html5 video/audio
+ if (!!current.opts.video.autoStart) {
+ current.$slide
+ .find("video,audio")
+ .filter(":visible:first")
+ .trigger("play")
+ .one("ended", function () {
+ if (Document.exitFullscreen) {
+ Document.exitFullscreen();
+ } else if (this.webkitExitFullscreen) {
+ this.webkitExitFullscreen();
+ }
+
+ self.next();
+ });
+ }
+
+ // Try to focus on the first focusable element
+ if (current.opts.autoFocus && current.contentType === "html") {
+ // Look for the first input with autofocus attribute
+ $el = current.$content.find("input[autofocus]:enabled:visible:first");
+
+ if ($el.length) {
+ $el.trigger("focus");
+ } else {
+ self.focus(null, true);
+ }
+ }
+
+ // Avoid jumping
+ current.$slide.scrollTop(0).scrollLeft(0);
+ },
+
+ // Preload next and previous slides
+ // ================================
+
+ preload: function (type) {
+ var self = this,
+ prev,
+ next;
+
+ if (self.group.length < 2) {
+ return;
+ }
+
+ next = self.slides[self.currPos + 1];
+ prev = self.slides[self.currPos - 1];
+
+ if (prev && prev.type === type) {
+ self.loadSlide(prev);
+ }
+
+ if (next && next.type === type) {
+ self.loadSlide(next);
+ }
+ },
+
+ // Try to find and focus on the first focusable element
+ // ====================================================
+
+ focus: function (e, firstRun) {
+ var self = this,
+ focusableStr = [
+ "a[href]",
+ "area[href]",
+ 'input:not([disabled]):not([type="hidden"]):not([aria-hidden])',
+ "select:not([disabled]):not([aria-hidden])",
+ "textarea:not([disabled]):not([aria-hidden])",
+ "button:not([disabled]):not([aria-hidden])",
+ "iframe",
+ "object",
+ "embed",
+ "video",
+ "audio",
+ "[contenteditable]",
+ '[tabindex]:not([tabindex^="-"])'
+ ].join(","),
+ focusableItems,
+ focusedItemIndex;
+
+ if (self.isClosing) {
+ return;
+ }
+
+ if (e || !self.current || !self.current.isComplete) {
+ // Focus on any element inside fancybox
+ focusableItems = self.$refs.container.find("*:visible");
+ } else {
+ // Focus inside current slide
+ focusableItems = self.current.$slide.find("*:visible" + (firstRun ? ":not(.fancybox-close-small)" : ""));
+ }
+
+ focusableItems = focusableItems.filter(focusableStr).filter(function () {
+ return $(this).css("visibility") !== "hidden" && !$(this).hasClass("disabled");
+ });
+
+ if (focusableItems.length) {
+ focusedItemIndex = focusableItems.index(document.activeElement);
+
+ if (e && e.shiftKey) {
+ // Back tab
+ if (focusedItemIndex < 0 || focusedItemIndex == 0) {
+ e.preventDefault();
+
+ focusableItems.eq(focusableItems.length - 1).trigger("focus");
+ }
+ } else {
+ // Outside or Forward tab
+ if (focusedItemIndex < 0 || focusedItemIndex == focusableItems.length - 1) {
+ if (e) {
+ e.preventDefault();
+ }
+
+ focusableItems.eq(0).trigger("focus");
+ }
+ }
+ } else {
+ self.$refs.container.trigger("focus");
+ }
+ },
+
+ // Activates current instance - brings container to the front and enables keyboard,
+ // notifies other instances about deactivating
+ // =================================================================================
+
+ activate: function () {
+ var self = this;
+
+ // Deactivate all instances
+ $(".fancybox-container").each(function () {
+ var instance = $(this).data("FancyBox");
+
+ // Skip self and closing instances
+ if (instance && instance.id !== self.id && !instance.isClosing) {
+ instance.trigger("onDeactivate");
+
+ instance.removeEvents();
+
+ instance.isVisible = false;
+ }
+ });
+
+ self.isVisible = true;
+
+ if (self.current || self.isIdle) {
+ self.update();
+
+ self.updateControls();
+ }
+
+ self.trigger("onActivate");
+
+ self.addEvents();
+ },
+
+ // Start closing procedure
+ // This will start "zoom-out" animation if needed and clean everything up afterwards
+ // =================================================================================
+
+ close: function (e, d) {
+ var self = this,
+ current = self.current,
+ effect,
+ duration,
+ $content,
+ domRect,
+ opacity,
+ start,
+ end;
+
+ var done = function () {
+ self.cleanUp(e);
+ };
+
+ if (self.isClosing) {
+ return false;
+ }
+
+ self.isClosing = true;
+
+ // If beforeClose callback prevents closing, make sure content is centered
+ if (self.trigger("beforeClose", e) === false) {
+ self.isClosing = false;
+
+ requestAFrame(function () {
+ self.update();
+ });
+
+ return false;
+ }
+
+ // Remove all events
+ // If there are multiple instances, they will be set again by "activate" method
+ self.removeEvents();
+
+ $content = current.$content;
+ effect = current.opts.animationEffect;
+ duration = $.isNumeric(d) ? d : effect ? current.opts.animationDuration : 0;
+
+ current.$slide.removeClass("fancybox-slide--complete fancybox-slide--next fancybox-slide--previous fancybox-animated");
+
+ if (e !== true) {
+ $.fancybox.stop(current.$slide);
+ } else {
+ effect = false;
+ }
+
+ // Remove other slides
+ current.$slide
+ .siblings()
+ .trigger("onReset")
+ .remove();
+
+ // Trigger animations
+ if (duration) {
+ self.$refs.container
+ .removeClass("fancybox-is-open")
+ .addClass("fancybox-is-closing")
+ .css("transition-duration", duration + "ms");
+ }
+
+ // Clean up
+ self.hideLoading(current);
+
+ self.hideControls(true);
+
+ self.updateCursor();
+
+ // Check if possible to zoom-out
+ if (
+ effect === "zoom" &&
+ !($content && duration && current.type === "image" && !self.isMoved() && !current.hasError && (end = self.getThumbPos(current)))
+ ) {
+ effect = "fade";
+ }
+
+ if (effect === "zoom") {
+ $.fancybox.stop($content);
+
+ domRect = $.fancybox.getTranslate($content);
+
+ start = {
+ top: domRect.top,
+ left: domRect.left,
+ scaleX: domRect.width / end.width,
+ scaleY: domRect.height / end.height,
+ width: end.width,
+ height: end.height
+ };
+
+ // Check if we need to animate opacity
+ opacity = current.opts.zoomOpacity;
+
+ if (opacity == "auto") {
+ opacity = Math.abs(current.width / current.height - end.width / end.height) > 0.1;
+ }
+
+ if (opacity) {
+ end.opacity = 0;
+ }
+
+ $.fancybox.setTranslate($content, start);
+
+ forceRedraw($content);
+
+ $.fancybox.animate($content, end, duration, done);
+
+ return true;
+ }
+
+ if (effect && duration) {
+ $.fancybox.animate(
+ current.$slide.addClass("fancybox-slide--previous").removeClass("fancybox-slide--current"),
+ "fancybox-animated fancybox-fx-" + effect,
+ duration,
+ done
+ );
+ } else {
+ // If skip animation
+ if (e === true) {
+ setTimeout(done, duration);
+ } else {
+ done();
+ }
+ }
+
+ return true;
+ },
+
+ // Final adjustments after removing the instance
+ // =============================================
+
+ cleanUp: function (e) {
+ var self = this,
+ instance,
+ $focus = self.current.opts.$orig,
+ x,
+ y;
+
+ self.current.$slide.trigger("onReset");
+
+ self.$refs.container.empty().remove();
+
+ self.trigger("afterClose", e);
+
+ // Place back focus
+ if (!!self.current.opts.backFocus) {
+ if (!$focus || !$focus.length || !$focus.is(":visible")) {
+ $focus = self.$trigger;
+ }
+
+ if ($focus && $focus.length) {
+ x = window.scrollX;
+ y = window.scrollY;
+
+ $focus.trigger("focus");
+
+ $("html, body")
+ .scrollTop(y)
+ .scrollLeft(x);
+ }
+ }
+
+ self.current = null;
+
+ // Check if there are other instances
+ instance = $.fancybox.getInstance();
+
+ if (instance) {
+ instance.activate();
+ } else {
+ $("body").removeClass("fancybox-active compensate-for-scrollbar");
+
+ $("#fancybox-style-noscroll").remove();
+ }
+ },
+
+ // Call callback and trigger an event
+ // ==================================
+
+ trigger: function (name, slide) {
+ var args = Array.prototype.slice.call(arguments, 1),
+ self = this,
+ obj = slide && slide.opts ? slide : self.current,
+ rez;
+
+ if (obj) {
+ args.unshift(obj);
+ } else {
+ obj = self;
+ }
+
+ args.unshift(self);
+
+ if ($.isFunction(obj.opts[name])) {
+ rez = obj.opts[name].apply(obj, args);
+ }
+
+ if (rez === false) {
+ return rez;
+ }
+
+ if (name === "afterClose" || !self.$refs) {
+ $D.trigger(name + ".fb", args);
+ } else {
+ self.$refs.container.trigger(name + ".fb", args);
+ }
+ },
+
+ // Update infobar values, navigation button states and reveal caption
+ // ==================================================================
+
+ updateControls: function () {
+ var self = this,
+ current = self.current,
+ index = current.index,
+ $container = self.$refs.container,
+ $caption = self.$refs.caption,
+ caption = current.opts.caption;
+
+ // Recalculate content dimensions
+ current.$slide.trigger("refresh");
+
+ // Set caption
+ if (caption && caption.length) {
+ self.$caption = $caption;
+
+ $caption
+ .children()
+ .eq(0)
+ .html(caption);
+ } else {
+ self.$caption = null;
+ }
+
+ if (!self.hasHiddenControls && !self.isIdle) {
+ self.showControls();
+ }
+
+ // Update info and navigation elements
+ $container.find("[data-fancybox-count]").html(self.group.length);
+ $container.find("[data-fancybox-index]").html(index + 1);
+
+ $container.find("[data-fancybox-prev]").prop("disabled", !current.opts.loop && index <= 0);
+ $container.find("[data-fancybox-next]").prop("disabled", !current.opts.loop && index >= self.group.length - 1);
+
+ if (current.type === "image") {
+ // Re-enable buttons; update download button source
+ $container
+ .find("[data-fancybox-zoom]")
+ .show()
+ .end()
+ .find("[data-fancybox-download]")
+ .attr("href", current.opts.image.src || current.src)
+ .show();
+ } else if (current.opts.toolbar) {
+ $container.find("[data-fancybox-download],[data-fancybox-zoom]").hide();
+ }
+
+ // Make sure focus is not on disabled button/element
+ if ($(document.activeElement).is(":hidden,[disabled]")) {
+ self.$refs.container.trigger("focus");
+ }
+ },
+
+ // Hide toolbar and caption
+ // ========================
+
+ hideControls: function (andCaption) {
+ var self = this,
+ arr = ["infobar", "toolbar", "nav"];
+
+ if (andCaption || !self.current.opts.preventCaptionOverlap) {
+ arr.push("caption");
+ }
+
+ this.$refs.container.removeClass(
+ arr
+ .map(function (i) {
+ return "fancybox-show-" + i;
+ })
+ .join(" ")
+ );
+
+ this.hasHiddenControls = true;
+ },
+
+ showControls: function () {
+ var self = this,
+ opts = self.current ? self.current.opts : self.opts,
+ $container = self.$refs.container;
+
+ self.hasHiddenControls = false;
+ self.idleSecondsCounter = 0;
+
+ $container
+ .toggleClass("fancybox-show-toolbar", !!(opts.toolbar && opts.buttons))
+ .toggleClass("fancybox-show-infobar", !!(opts.infobar && self.group.length > 1))
+ .toggleClass("fancybox-show-caption", !!self.$caption)
+ .toggleClass("fancybox-show-nav", !!(opts.arrows && self.group.length > 1))
+ .toggleClass("fancybox-is-modal", !!opts.modal);
+ },
+
+ // Toggle toolbar and caption
+ // ==========================
+
+ toggleControls: function () {
+ if (this.hasHiddenControls) {
+ this.showControls();
+ } else {
+ this.hideControls();
+ }
+ }
+ });
+
+ $.fancybox = {
+ version: "3.5.7",
+ defaults: defaults,
+
+ // Get current instance and execute a command.
+ //
+ // Examples of usage:
+ //
+ // $instance = $.fancybox.getInstance();
+ // $.fancybox.getInstance().jumpTo( 1 );
+ // $.fancybox.getInstance( 'jumpTo', 1 );
+ // $.fancybox.getInstance( function() {
+ // console.info( this.currIndex );
+ // });
+ // ======================================================
+
+ getInstance: function (command) {
+ var instance = $('.fancybox-container:not(".fancybox-is-closing"):last').data("FancyBox"),
+ args = Array.prototype.slice.call(arguments, 1);
+
+ if (instance instanceof FancyBox) {
+ if ($.type(command) === "string") {
+ instance[command].apply(instance, args);
+ } else if ($.type(command) === "function") {
+ command.apply(instance, args);
+ }
+
+ return instance;
+ }
+
+ return false;
+ },
+
+ // Create new instance
+ // ===================
+
+ open: function (items, opts, index) {
+ return new FancyBox(items, opts, index);
+ },
+
+ // Close current or all instances
+ // ==============================
+
+ close: function (all) {
+ var instance = this.getInstance();
+
+ if (instance) {
+ instance.close();
+
+ // Try to find and close next instance
+ if (all === true) {
+ this.close(all);
+ }
+ }
+ },
+
+ // Close all instances and unbind all events
+ // =========================================
+
+ destroy: function () {
+ this.close(true);
+
+ $D.add("body").off("click.fb-start", "**");
+ },
+
+ // Try to detect mobile devices
+ // ============================
+
+ isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),
+
+ // Detect if 'translate3d' support is available
+ // ============================================
+
+ use3d: (function () {
+ var div = document.createElement("div");
+
+ return (
+ window.getComputedStyle &&
+ window.getComputedStyle(div) &&
+ window.getComputedStyle(div).getPropertyValue("transform") &&
+ !(document.documentMode && document.documentMode < 11)
+ );
+ })(),
+
+ // Helper function to get current visual state of an element
+ // returns array[ top, left, horizontal-scale, vertical-scale, opacity ]
+ // =====================================================================
+
+ getTranslate: function ($el) {
+ var domRect;
+
+ if (!$el || !$el.length) {
+ return false;
+ }
+
+ domRect = $el[0].getBoundingClientRect();
+
+ return {
+ top: domRect.top || 0,
+ left: domRect.left || 0,
+ width: domRect.width,
+ height: domRect.height,
+ opacity: parseFloat($el.css("opacity"))
+ };
+ },
+
+ // Shortcut for setting "translate3d" properties for element
+ // Can set be used to set opacity, too
+ // ========================================================
+
+ setTranslate: function ($el, props) {
+ var str = "",
+ css = {};
+
+ if (!$el || !props) {
+ return;
+ }
+
+ if (props.left !== undefined || props.top !== undefined) {
+ str =
+ (props.left === undefined ? $el.position().left : props.left) +
+ "px, " +
+ (props.top === undefined ? $el.position().top : props.top) +
+ "px";
+
+ if (this.use3d) {
+ str = "translate3d(" + str + ", 0px)";
+ } else {
+ str = "translate(" + str + ")";
+ }
+ }
+
+ if (props.scaleX !== undefined && props.scaleY !== undefined) {
+ str += " scale(" + props.scaleX + ", " + props.scaleY + ")";
+ } else if (props.scaleX !== undefined) {
+ str += " scaleX(" + props.scaleX + ")";
+ }
+
+ if (str.length) {
+ css.transform = str;
+ }
+
+ if (props.opacity !== undefined) {
+ css.opacity = props.opacity;
+ }
+
+ if (props.width !== undefined) {
+ css.width = props.width;
+ }
+
+ if (props.height !== undefined) {
+ css.height = props.height;
+ }
+
+ return $el.css(css);
+ },
+
+ // Simple CSS transition handler
+ // =============================
+
+ animate: function ($el, to, duration, callback, leaveAnimationName) {
+ var self = this,
+ from;
+
+ if ($.isFunction(duration)) {
+ callback = duration;
+ duration = null;
+ }
+
+ self.stop($el);
+
+ from = self.getTranslate($el);
+
+ $el.on(transitionEnd, function (e) {
+ // Skip events from child elements and z-index change
+ if (e && e.originalEvent && (!$el.is(e.originalEvent.target) || e.originalEvent.propertyName == "z-index")) {
+ return;
+ }
+
+ self.stop($el);
+
+ if ($.isNumeric(duration)) {
+ $el.css("transition-duration", "");
+ }
+
+ if ($.isPlainObject(to)) {
+ if (to.scaleX !== undefined && to.scaleY !== undefined) {
+ self.setTranslate($el, {
+ top: to.top,
+ left: to.left,
+ width: from.width * to.scaleX,
+ height: from.height * to.scaleY,
+ scaleX: 1,
+ scaleY: 1
+ });
+ }
+ } else if (leaveAnimationName !== true) {
+ $el.removeClass(to);
+ }
+
+ if ($.isFunction(callback)) {
+ callback(e);
+ }
+ });
+
+ if ($.isNumeric(duration)) {
+ $el.css("transition-duration", duration + "ms");
+ }
+
+ // Start animation by changing CSS properties or class name
+ if ($.isPlainObject(to)) {
+ if (to.scaleX !== undefined && to.scaleY !== undefined) {
+ delete to.width;
+ delete to.height;
+
+ if ($el.parent().hasClass("fancybox-slide--image")) {
+ $el.parent().addClass("fancybox-is-scaling");
+ }
+ }
+
+ $.fancybox.setTranslate($el, to);
+ } else {
+ $el.addClass(to);
+ }
+
+ // Make sure that `transitionend` callback gets fired
+ $el.data(
+ "timer",
+ setTimeout(function () {
+ $el.trigger(transitionEnd);
+ }, duration + 33)
+ );
+ },
+
+ stop: function ($el, callCallback) {
+ if ($el && $el.length) {
+ clearTimeout($el.data("timer"));
+
+ if (callCallback) {
+ $el.trigger(transitionEnd);
+ }
+
+ $el.off(transitionEnd).css("transition-duration", "");
+
+ $el.parent().removeClass("fancybox-is-scaling");
+ }
+ }
+ };
+
+ // Default click handler for "fancyboxed" links
+ // ============================================
+
+ function _run(e, opts) {
+ var items = [],
+ index = 0,
+ $target,
+ value,
+ instance;
+
+ // Avoid opening multiple times
+ if (e && e.isDefaultPrevented()) {
+ return;
+ }
+
+ e.preventDefault();
+
+ opts = opts || {};
+
+ if (e && e.data) {
+ opts = mergeOpts(e.data.options, opts);
+ }
+
+ $target = opts.$target || $(e.currentTarget).trigger("blur");
+ instance = $.fancybox.getInstance();
+
+ if (instance && instance.$trigger && instance.$trigger.is($target)) {
+ return;
+ }
+
+ if (opts.selector) {
+ items = $(opts.selector);
+ } else {
+ // Get all related items and find index for clicked one
+ value = $target.attr("data-fancybox") || "";
+
+ if (value) {
+ items = e.data ? e.data.items : [];
+ items = items.length ? items.filter('[data-fancybox="' + value + '"]') : $('[data-fancybox="' + value + '"]');
+ } else {
+ items = [$target];
+ }
+ }
+
+ index = $(items).index($target);
+
+ // Sometimes current item can not be found
+ if (index < 0) {
+ index = 0;
+ }
+
+ instance = $.fancybox.open(items, opts, index);
+
+ // Save last active element
+ instance.$trigger = $target;
+ }
+
+ // Create a jQuery plugin
+ // ======================
+
+ $.fn.fancybox = function (options) {
+ var selector;
+
+ options = options || {};
+ selector = options.selector || false;
+
+ if (selector) {
+ // Use body element instead of document so it executes first
+ $("body")
+ .off("click.fb-start", selector)
+ .on("click.fb-start", selector, {
+ options: options
+ }, _run);
+ } else {
+ this.off("click.fb-start").on(
+ "click.fb-start", {
+ items: this,
+ options: options
+ },
+ _run
+ );
+ }
+
+ return this;
+ };
+
+ // Self initializing plugin for all elements having `data-fancybox` attribute
+ // ==========================================================================
+
+ $D.on("click.fb-start", "[data-fancybox]", _run);
+
+ // Enable "trigger elements"
+ // =========================
+
+ $D.on("click.fb-start", "[data-fancybox-trigger]", function (e) {
+ $('[data-fancybox="' + $(this).attr("data-fancybox-trigger") + '"]')
+ .eq($(this).attr("data-fancybox-index") || 0)
+ .trigger("click.fb-start", {
+ $trigger: $(this)
+ });
+ });
+
+ // Track focus event for better accessibility styling
+ // ==================================================
+ (function () {
+ var buttonStr = ".fancybox-button",
+ focusStr = "fancybox-focus",
+ $pressed = null;
+
+ $D.on("mousedown mouseup focus blur", buttonStr, function (e) {
+ switch (e.type) {
+ case "mousedown":
+ $pressed = $(this);
+ break;
+ case "mouseup":
+ $pressed = null;
+ break;
+ case "focusin":
+ $(buttonStr).removeClass(focusStr);
+
+ if (!$(this).is($pressed) && !$(this).is("[disabled]")) {
+ $(this).addClass(focusStr);
+ }
+ break;
+ case "focusout":
+ $(buttonStr).removeClass(focusStr);
+ break;
+ }
+ });
+ })();
+})(window, document, jQuery);
+// ==========================================================================
+//
+// Media
+// Adds additional media type support
+//
+// ==========================================================================
+(function ($) {
+ "use strict";
+
+ // Object containing properties for each media type
+ var defaults = {
+ youtube: {
+ matcher: /(youtube\.com|youtu\.be|youtube\-nocookie\.com)\/(watch\?(.*&)?v=|v\/|u\/|embed\/?)?(videoseries\?list=(.*)|[\w-]{11}|\?listType=(.*)&list=(.*))(.*)/i,
+ params: {
+ autoplay: 1,
+ autohide: 1,
+ fs: 1,
+ rel: 0,
+ hd: 1,
+ wmode: "transparent",
+ enablejsapi: 1,
+ html5: 1
+ },
+ paramPlace: 8,
+ type: "iframe",
+ url: "https://www.youtube-nocookie.com/embed/$4",
+ thumb: "https://img.youtube.com/vi/$4/hqdefault.jpg"
+ },
+
+ vimeo: {
+ matcher: /^.+vimeo.com\/(.*\/)?([\d]+)(.*)?/,
+ params: {
+ autoplay: 1,
+ hd: 1,
+ show_title: 1,
+ show_byline: 1,
+ show_portrait: 0,
+ fullscreen: 1
+ },
+ paramPlace: 3,
+ type: "iframe",
+ url: "//player.vimeo.com/video/$2"
+ },
+
+ instagram: {
+ matcher: /(instagr\.am|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,
+ type: "image",
+ url: "//$1/p/$2/media/?size=l"
+ },
+
+ // Examples:
+ // http://maps.google.com/?ll=48.857995,2.294297&spn=0.007666,0.021136&t=m&z=16
+ // https://www.google.com/maps/@37.7852006,-122.4146355,14.65z
+ // https://www.google.com/maps/@52.2111123,2.9237542,6.61z?hl=en
+ // https://www.google.com/maps/place/Googleplex/@37.4220041,-122.0833494,17z/data=!4m5!3m4!1s0x0:0x6c296c66619367e0!8m2!3d37.4219998!4d-122.0840572
+ gmap_place: {
+ matcher: /(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(((maps\/(place\/(.*)\/)?\@(.*),(\d+.?\d+?)z))|(\?ll=))(.*)?/i,
+ type: "iframe",
+ url: function (rez) {
+ return (
+ "//maps.google." +
+ rez[2] +
+ "/?ll=" +
+ (rez[9] ? rez[9] + "&z=" + Math.floor(rez[10]) + (rez[12] ? rez[12].replace(/^\//, "&") : "") : rez[12] + "").replace(/\?/, "&") +
+ "&output=" +
+ (rez[12] && rez[12].indexOf("layer=c") > 0 ? "svembed" : "embed")
+ );
+ }
+ },
+
+ // Examples:
+ // https://www.google.com/maps/search/Empire+State+Building/
+ // https://www.google.com/maps/search/?api=1&query=centurylink+field
+ // https://www.google.com/maps/search/?api=1&query=47.5951518,-122.3316393
+ gmap_search: {
+ matcher: /(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(maps\/search\/)(.*)/i,
+ type: "iframe",
+ url: function (rez) {
+ return "//maps.google." + rez[2] + "/maps?q=" + rez[5].replace("query=", "q=").replace("api=1", "") + "&output=embed";
+ }
+ }
+ };
+
+ // Formats matching url to final form
+ var format = function (url, rez, params) {
+ if (!url) {
+ return;
+ }
+
+ params = params || "";
+
+ if ($.type(params) === "object") {
+ params = $.param(params, true);
+ }
+
+ $.each(rez, function (key, value) {
+ url = url.replace("$" + key, value || "");
+ });
+
+ if (params.length) {
+ url += (url.indexOf("?") > 0 ? "&" : "?") + params;
+ }
+
+ return url;
+ };
+
+ $(document).on("objectNeedsType.fb", function (e, instance, item) {
+ var url = item.src || "",
+ type = false,
+ media,
+ thumb,
+ rez,
+ params,
+ urlParams,
+ paramObj,
+ provider;
+
+ media = $.extend(true, {}, defaults, item.opts.media);
+
+ // Look for any matching media type
+ $.each(media, function (providerName, providerOpts) {
+ rez = url.match(providerOpts.matcher);
+
+ if (!rez) {
+ return;
+ }
+
+ type = providerOpts.type;
+ provider = providerName;
+ paramObj = {};
+
+ if (providerOpts.paramPlace && rez[providerOpts.paramPlace]) {
+ urlParams = rez[providerOpts.paramPlace];
+
+ if (urlParams[0] == "?") {
+ urlParams = urlParams.substring(1);
+ }
+
+ urlParams = urlParams.split("&");
+
+ for (var m = 0; m < urlParams.length; ++m) {
+ var p = urlParams[m].split("=", 2);
+
+ if (p.length == 2) {
+ paramObj[p[0]] = decodeURIComponent(p[1].replace(/\+/g, " "));
+ }
+ }
+ }
+
+ params = $.extend(true, {}, providerOpts.params, item.opts[providerName], paramObj);
+
+ url =
+ $.type(providerOpts.url) === "function" ? providerOpts.url.call(this, rez, params, item) : format(providerOpts.url, rez, params);
+
+ thumb =
+ $.type(providerOpts.thumb) === "function" ? providerOpts.thumb.call(this, rez, params, item) : format(providerOpts.thumb, rez);
+
+ if (providerName === "youtube") {
+ url = url.replace(/&t=((\d+)m)?(\d+)s/, function (match, p1, m, s) {
+ return "&start=" + ((m ? parseInt(m, 10) * 60 : 0) + parseInt(s, 10));
+ });
+ } else if (providerName === "vimeo") {
+ url = url.replace("&%23", "#");
+ }
+
+ return false;
+ });
+
+ // If it is found, then change content type and update the url
+
+ if (type) {
+ if (!item.opts.thumb && !(item.opts.$thumb && item.opts.$thumb.length)) {
+ item.opts.thumb = thumb;
+ }
+
+ if (type === "iframe") {
+ item.opts = $.extend(true, item.opts, {
+ iframe: {
+ preload: false,
+ attr: {
+ scrolling: "no"
+ }
+ }
+ });
+ }
+
+ $.extend(item, {
+ type: type,
+ src: url,
+ origSrc: item.src,
+ contentSource: provider,
+ contentType: type === "image" ? "image" : provider == "gmap_place" || provider == "gmap_search" ? "map" : "video"
+ });
+ } else if (url) {
+ item.type = item.opts.defaultType;
+ }
+ });
+
+ // Load YouTube/Video API on request to detect when video finished playing
+ var VideoAPILoader = {
+ youtube: {
+ src: "https://www.youtube.com/iframe_api",
+ class: "YT",
+ loading: false,
+ loaded: false
+ },
+
+ vimeo: {
+ src: "https://player.vimeo.com/api/player.js",
+ class: "Vimeo",
+ loading: false,
+ loaded: false
+ },
+
+ load: function (vendor) {
+ var _this = this,
+ script;
+
+ if (this[vendor].loaded) {
+ setTimeout(function () {
+ _this.done(vendor);
+ });
+ return;
+ }
+
+ if (this[vendor].loading) {
+ return;
+ }
+
+ this[vendor].loading = true;
+
+ script = document.createElement("script");
+ script.type = "text/javascript";
+ script.src = this[vendor].src;
+
+ if (vendor === "youtube") {
+ window.onYouTubeIframeAPIReady = function () {
+ _this[vendor].loaded = true;
+ _this.done(vendor);
+ };
+ } else {
+ script.onload = function () {
+ _this[vendor].loaded = true;
+ _this.done(vendor);
+ };
+ }
+
+ document.body.appendChild(script);
+ },
+ done: function (vendor) {
+ var instance, $el, player;
+
+ if (vendor === "youtube") {
+ delete window.onYouTubeIframeAPIReady;
+ }
+
+ instance = $.fancybox.getInstance();
+
+ if (instance) {
+ $el = instance.current.$content.find("iframe");
+
+ if (vendor === "youtube" && YT !== undefined && YT) {
+ player = new YT.Player($el.attr("id"), {
+ events: {
+ onStateChange: function (e) {
+ if (e.data == 0) {
+ instance.next();
+ }
+ }
+ }
+ });
+ } else if (vendor === "vimeo" && Vimeo !== undefined && Vimeo) {
+ player = new Vimeo.Player($el);
+
+ player.on("ended", function () {
+ instance.next();
+ });
+ }
+ }
+ }
+ };
+
+ $(document).on({
+ "afterShow.fb": function (e, instance, current) {
+ if (instance.group.length > 1 && (current.contentSource === "youtube" || current.contentSource === "vimeo")) {
+ VideoAPILoader.load(current.contentSource);
+ }
+ }
+ });
+})(jQuery);
+// ==========================================================================
+//
+// Guestures
+// Adds touch guestures, handles click and tap events
+//
+// ==========================================================================
+(function (window, document, $) {
+ "use strict";
+
+ var requestAFrame = (function () {
+ return (
+ window.requestAnimationFrame ||
+ window.webkitRequestAnimationFrame ||
+ window.mozRequestAnimationFrame ||
+ window.oRequestAnimationFrame ||
+ // if all else fails, use setTimeout
+ function (callback) {
+ return window.setTimeout(callback, 1000 / 60);
+ }
+ );
+ })();
+
+ var cancelAFrame = (function () {
+ return (
+ window.cancelAnimationFrame ||
+ window.webkitCancelAnimationFrame ||
+ window.mozCancelAnimationFrame ||
+ window.oCancelAnimationFrame ||
+ function (id) {
+ window.clearTimeout(id);
+ }
+ );
+ })();
+
+ var getPointerXY = function (e) {
+ var result = [];
+
+ e = e.originalEvent || e || window.e;
+ e = e.touches && e.touches.length ? e.touches : e.changedTouches && e.changedTouches.length ? e.changedTouches : [e];
+
+ for (var key in e) {
+ if (e[key].pageX) {
+ result.push({
+ x: e[key].pageX,
+ y: e[key].pageY
+ });
+ } else if (e[key].clientX) {
+ result.push({
+ x: e[key].clientX,
+ y: e[key].clientY
+ });
+ }
+ }
+
+ return result;
+ };
+
+ var distance = function (point2, point1, what) {
+ if (!point1 || !point2) {
+ return 0;
+ }
+
+ if (what === "x") {
+ return point2.x - point1.x;
+ } else if (what === "y") {
+ return point2.y - point1.y;
+ }
+
+ return Math.sqrt(Math.pow(point2.x - point1.x, 2) + Math.pow(point2.y - point1.y, 2));
+ };
+
+ var isClickable = function ($el) {
+ if (
+ $el.is('a,area,button,[role="button"],input,label,select,summary,textarea,video,audio,iframe') ||
+ $.isFunction($el.get(0).onclick) ||
+ $el.data("selectable")
+ ) {
+ return true;
+ }
+
+ // Check for attributes like data-fancybox-next or data-fancybox-close
+ for (var i = 0, atts = $el[0].attributes, n = atts.length; i < n; i++) {
+ if (atts[i].nodeName.substr(0, 14) === "data-fancybox-") {
+ return true;
+ }
+ }
+
+ return false;
+ };
+
+ var hasScrollbars = function (el) {
+ var overflowY = window.getComputedStyle(el)["overflow-y"],
+ overflowX = window.getComputedStyle(el)["overflow-x"],
+ vertical = (overflowY === "scroll" || overflowY === "auto") && el.scrollHeight > el.clientHeight,
+ horizontal = (overflowX === "scroll" || overflowX === "auto") && el.scrollWidth > el.clientWidth;
+
+ return vertical || horizontal;
+ };
+
+ var isScrollable = function ($el) {
+ var rez = false;
+
+ while (true) {
+ rez = hasScrollbars($el.get(0));
+
+ if (rez) {
+ break;
+ }
+
+ $el = $el.parent();
+
+ if (!$el.length || $el.hasClass("fancybox-stage") || $el.is("body")) {
+ break;
+ }
+ }
+
+ return rez;
+ };
+
+ var Guestures = function (instance) {
+ var self = this;
+
+ self.instance = instance;
+
+ self.$bg = instance.$refs.bg;
+ self.$stage = instance.$refs.stage;
+ self.$container = instance.$refs.container;
+
+ self.destroy();
+
+ self.$container.on("touchstart.fb.touch mousedown.fb.touch", $.proxy(self, "ontouchstart"));
+ };
+
+ Guestures.prototype.destroy = function () {
+ var self = this;
+
+ self.$container.off(".fb.touch");
+
+ $(document).off(".fb.touch");
+
+ if (self.requestId) {
+ cancelAFrame(self.requestId);
+ self.requestId = null;
+ }
+
+ if (self.tapped) {
+ clearTimeout(self.tapped);
+ self.tapped = null;
+ }
+ };
+
+ Guestures.prototype.ontouchstart = function (e) {
+ var self = this,
+ $target = $(e.target),
+ instance = self.instance,
+ current = instance.current,
+ $slide = current.$slide,
+ $content = current.$content,
+ isTouchDevice = e.type == "touchstart";
+
+ // Do not respond to both (touch and mouse) events
+ if (isTouchDevice) {
+ self.$container.off("mousedown.fb.touch");
+ }
+
+ // Ignore right click
+ if (e.originalEvent && e.originalEvent.button == 2) {
+ return;
+ }
+
+ // Ignore taping on links, buttons, input elements
+ if (!$slide.length || !$target.length || isClickable($target) || isClickable($target.parent())) {
+ return;
+ }
+ // Ignore clicks on the scrollbar
+ if (!$target.is("img") && e.originalEvent.clientX > $target[0].clientWidth + $target.offset().left) {
+ return;
+ }
+
+ // Ignore clicks while zooming or closing
+ if (!current || instance.isAnimating || current.$slide.hasClass("fancybox-animated")) {
+ e.stopPropagation();
+ e.preventDefault();
+
+ return;
+ }
+
+ self.realPoints = self.startPoints = getPointerXY(e);
+
+ if (!self.startPoints.length) {
+ return;
+ }
+
+ // Allow other scripts to catch touch event if "touch" is set to false
+ if (current.touch) {
+ e.stopPropagation();
+ }
+
+ self.startEvent = e;
+
+ self.canTap = true;
+ self.$target = $target;
+ self.$content = $content;
+ self.opts = current.opts.touch;
+
+ self.isPanning = false;
+ self.isSwiping = false;
+ self.isZooming = false;
+ self.isScrolling = false;
+ self.canPan = instance.canPan();
+
+ self.startTime = new Date().getTime();
+ self.distanceX = self.distanceY = self.distance = 0;
+
+ self.canvasWidth = Math.round($slide[0].clientWidth);
+ self.canvasHeight = Math.round($slide[0].clientHeight);
+
+ self.contentLastPos = null;
+ self.contentStartPos = $.fancybox.getTranslate(self.$content) || {
+ top: 0,
+ left: 0
+ };
+ self.sliderStartPos = $.fancybox.getTranslate($slide);
+
+ // Since position will be absolute, but we need to make it relative to the stage
+ self.stagePos = $.fancybox.getTranslate(instance.$refs.stage);
+
+ self.sliderStartPos.top -= self.stagePos.top;
+ self.sliderStartPos.left -= self.stagePos.left;
+
+ self.contentStartPos.top -= self.stagePos.top;
+ self.contentStartPos.left -= self.stagePos.left;
+
+ $(document)
+ .off(".fb.touch")
+ .on(isTouchDevice ? "touchend.fb.touch touchcancel.fb.touch" : "mouseup.fb.touch mouseleave.fb.touch", $.proxy(self, "ontouchend"))
+ .on(isTouchDevice ? "touchmove.fb.touch" : "mousemove.fb.touch", $.proxy(self, "ontouchmove"));
+
+ if ($.fancybox.isMobile) {
+ document.addEventListener("scroll", self.onscroll, true);
+ }
+
+ // Skip if clicked outside the sliding area
+ if (!(self.opts || self.canPan) || !($target.is(self.$stage) || self.$stage.find($target).length)) {
+ if ($target.is(".fancybox-image")) {
+ e.preventDefault();
+ }
+
+ if (!($.fancybox.isMobile && $target.parents(".fancybox-caption").length)) {
+ return;
+ }
+ }
+
+ self.isScrollable = isScrollable($target) || isScrollable($target.parent());
+
+ // Check if element is scrollable and try to prevent default behavior (scrolling)
+ if (!($.fancybox.isMobile && self.isScrollable)) {
+ e.preventDefault();
+ }
+
+ // One finger or mouse click - swipe or pan an image
+ if (self.startPoints.length === 1 || current.hasError) {
+ if (self.canPan) {
+ $.fancybox.stop(self.$content);
+
+ self.isPanning = true;
+ } else {
+ self.isSwiping = true;
+ }
+
+ self.$container.addClass("fancybox-is-grabbing");
+ }
+
+ // Two fingers - zoom image
+ if (self.startPoints.length === 2 && current.type === "image" && (current.isLoaded || current.$ghost)) {
+ self.canTap = false;
+ self.isSwiping = false;
+ self.isPanning = false;
+
+ self.isZooming = true;
+
+ $.fancybox.stop(self.$content);
+
+ self.centerPointStartX = (self.startPoints[0].x + self.startPoints[1].x) * 0.5 - $(window).scrollLeft();
+ self.centerPointStartY = (self.startPoints[0].y + self.startPoints[1].y) * 0.5 - $(window).scrollTop();
+
+ self.percentageOfImageAtPinchPointX = (self.centerPointStartX - self.contentStartPos.left) / self.contentStartPos.width;
+ self.percentageOfImageAtPinchPointY = (self.centerPointStartY - self.contentStartPos.top) / self.contentStartPos.height;
+
+ self.startDistanceBetweenFingers = distance(self.startPoints[0], self.startPoints[1]);
+ }
+ };
+
+ Guestures.prototype.onscroll = function (e) {
+ var self = this;
+
+ self.isScrolling = true;
+
+ document.removeEventListener("scroll", self.onscroll, true);
+ };
+
+ Guestures.prototype.ontouchmove = function (e) {
+ var self = this;
+
+ // Make sure user has not released over iframe or disabled element
+ if (e.originalEvent.buttons !== undefined && e.originalEvent.buttons === 0) {
+ self.ontouchend(e);
+ return;
+ }
+
+ if (self.isScrolling) {
+ self.canTap = false;
+ return;
+ }
+
+ self.newPoints = getPointerXY(e);
+
+ if (!(self.opts || self.canPan) || !self.newPoints.length || !self.newPoints.length) {
+ return;
+ }
+
+ if (!(self.isSwiping && self.isSwiping === true)) {
+ e.preventDefault();
+ }
+
+ self.distanceX = distance(self.newPoints[0], self.startPoints[0], "x");
+ self.distanceY = distance(self.newPoints[0], self.startPoints[0], "y");
+
+ self.distance = distance(self.newPoints[0], self.startPoints[0]);
+
+ // Skip false ontouchmove events (Chrome)
+ if (self.distance > 0) {
+ if (self.isSwiping) {
+ self.onSwipe(e);
+ } else if (self.isPanning) {
+ self.onPan();
+ } else if (self.isZooming) {
+ self.onZoom();
+ }
+ }
+ };
+
+ Guestures.prototype.onSwipe = function (e) {
+ var self = this,
+ instance = self.instance,
+ swiping = self.isSwiping,
+ left = self.sliderStartPos.left || 0,
+ angle;
+
+ // If direction is not yet determined
+ if (swiping === true) {
+ // We need at least 10px distance to correctly calculate an angle
+ if (Math.abs(self.distance) > 10) {
+ self.canTap = false;
+
+ if (instance.group.length < 2 && self.opts.vertical) {
+ self.isSwiping = "y";
+ } else if (instance.isDragging || self.opts.vertical === false || (self.opts.vertical === "auto" && $(window).width() > 800)) {
+ self.isSwiping = "x";
+ } else {
+ angle = Math.abs((Math.atan2(self.distanceY, self.distanceX) * 180) / Math.PI);
+
+ self.isSwiping = angle > 45 && angle < 135 ? "y" : "x";
+ }
+
+ if (self.isSwiping === "y" && $.fancybox.isMobile && self.isScrollable) {
+ self.isScrolling = true;
+
+ return;
+ }
+
+ instance.isDragging = self.isSwiping;
+
+ // Reset points to avoid jumping, because we dropped first swipes to calculate the angle
+ self.startPoints = self.newPoints;
+
+ $.each(instance.slides, function (index, slide) {
+ var slidePos, stagePos;
+
+ $.fancybox.stop(slide.$slide);
+
+ slidePos = $.fancybox.getTranslate(slide.$slide);
+ stagePos = $.fancybox.getTranslate(instance.$refs.stage);
+
+ slide.$slide
+ .css({
+ transform: "",
+ opacity: "",
+ "transition-duration": ""
+ })
+ .removeClass("fancybox-animated")
+ .removeClass(function (index, className) {
+ return (className.match(/(^|\s)fancybox-fx-\S+/g) || []).join(" ");
+ });
+
+ if (slide.pos === instance.current.pos) {
+ self.sliderStartPos.top = slidePos.top - stagePos.top;
+ self.sliderStartPos.left = slidePos.left - stagePos.left;
+ }
+
+ $.fancybox.setTranslate(slide.$slide, {
+ top: slidePos.top - stagePos.top,
+ left: slidePos.left - stagePos.left
+ });
+ });
+
+ // Stop slideshow
+ if (instance.SlideShow && instance.SlideShow.isActive) {
+ instance.SlideShow.stop();
+ }
+ }
+
+ return;
+ }
+
+ // Sticky edges
+ if (swiping == "x") {
+ if (
+ self.distanceX > 0 &&
+ (self.instance.group.length < 2 || (self.instance.current.index === 0 && !self.instance.current.opts.loop))
+ ) {
+ left = left + Math.pow(self.distanceX, 0.8);
+ } else if (
+ self.distanceX < 0 &&
+ (self.instance.group.length < 2 ||
+ (self.instance.current.index === self.instance.group.length - 1 && !self.instance.current.opts.loop))
+ ) {
+ left = left - Math.pow(-self.distanceX, 0.8);
+ } else {
+ left = left + self.distanceX;
+ }
+ }
+
+ self.sliderLastPos = {
+ top: swiping == "x" ? 0 : self.sliderStartPos.top + self.distanceY,
+ left: left
+ };
+
+ if (self.requestId) {
+ cancelAFrame(self.requestId);
+
+ self.requestId = null;
+ }
+
+ self.requestId = requestAFrame(function () {
+ if (self.sliderLastPos) {
+ $.each(self.instance.slides, function (index, slide) {
+ var pos = slide.pos - self.instance.currPos;
+
+ $.fancybox.setTranslate(slide.$slide, {
+ top: self.sliderLastPos.top,
+ left: self.sliderLastPos.left + pos * self.canvasWidth + pos * slide.opts.gutter
+ });
+ });
+
+ self.$container.addClass("fancybox-is-sliding");
+ }
+ });
+ };
+
+ Guestures.prototype.onPan = function () {
+ var self = this;
+
+ // Prevent accidental movement (sometimes, when tapping casually, finger can move a bit)
+ if (distance(self.newPoints[0], self.realPoints[0]) < ($.fancybox.isMobile ? 10 : 5)) {
+ self.startPoints = self.newPoints;
+ return;
+ }
+
+ self.canTap = false;
+
+ self.contentLastPos = self.limitMovement();
+
+ if (self.requestId) {
+ cancelAFrame(self.requestId);
+ }
+
+ self.requestId = requestAFrame(function () {
+ $.fancybox.setTranslate(self.$content, self.contentLastPos);
+ });
+ };
+
+ // Make panning sticky to the edges
+ Guestures.prototype.limitMovement = function () {
+ var self = this;
+
+ var canvasWidth = self.canvasWidth;
+ var canvasHeight = self.canvasHeight;
+
+ var distanceX = self.distanceX;
+ var distanceY = self.distanceY;
+
+ var contentStartPos = self.contentStartPos;
+
+ var currentOffsetX = contentStartPos.left;
+ var currentOffsetY = contentStartPos.top;
+
+ var currentWidth = contentStartPos.width;
+ var currentHeight = contentStartPos.height;
+
+ var minTranslateX, minTranslateY, maxTranslateX, maxTranslateY, newOffsetX, newOffsetY;
+
+ if (currentWidth > canvasWidth) {
+ newOffsetX = currentOffsetX + distanceX;
+ } else {
+ newOffsetX = currentOffsetX;
+ }
+
+ newOffsetY = currentOffsetY + distanceY;
+
+ // Slow down proportionally to traveled distance
+ minTranslateX = Math.max(0, canvasWidth * 0.5 - currentWidth * 0.5);
+ minTranslateY = Math.max(0, canvasHeight * 0.5 - currentHeight * 0.5);
+
+ maxTranslateX = Math.min(canvasWidth - currentWidth, canvasWidth * 0.5 - currentWidth * 0.5);
+ maxTranslateY = Math.min(canvasHeight - currentHeight, canvasHeight * 0.5 - currentHeight * 0.5);
+
+ // ->
+ if (distanceX > 0 && newOffsetX > minTranslateX) {
+ newOffsetX = minTranslateX - 1 + Math.pow(-minTranslateX + currentOffsetX + distanceX, 0.8) || 0;
+ }
+
+ // <-
+ if (distanceX < 0 && newOffsetX < maxTranslateX) {
+ newOffsetX = maxTranslateX + 1 - Math.pow(maxTranslateX - currentOffsetX - distanceX, 0.8) || 0;
+ }
+
+ // \/
+ if (distanceY > 0 && newOffsetY > minTranslateY) {
+ newOffsetY = minTranslateY - 1 + Math.pow(-minTranslateY + currentOffsetY + distanceY, 0.8) || 0;
+ }
+
+ // /\
+ if (distanceY < 0 && newOffsetY < maxTranslateY) {
+ newOffsetY = maxTranslateY + 1 - Math.pow(maxTranslateY - currentOffsetY - distanceY, 0.8) || 0;
+ }
+
+ return {
+ top: newOffsetY,
+ left: newOffsetX
+ };
+ };
+
+ Guestures.prototype.limitPosition = function (newOffsetX, newOffsetY, newWidth, newHeight) {
+ var self = this;
+
+ var canvasWidth = self.canvasWidth;
+ var canvasHeight = self.canvasHeight;
+
+ if (newWidth > canvasWidth) {
+ newOffsetX = newOffsetX > 0 ? 0 : newOffsetX;
+ newOffsetX = newOffsetX < canvasWidth - newWidth ? canvasWidth - newWidth : newOffsetX;
+ } else {
+ // Center horizontally
+ newOffsetX = Math.max(0, canvasWidth / 2 - newWidth / 2);
+ }
+
+ if (newHeight > canvasHeight) {
+ newOffsetY = newOffsetY > 0 ? 0 : newOffsetY;
+ newOffsetY = newOffsetY < canvasHeight - newHeight ? canvasHeight - newHeight : newOffsetY;
+ } else {
+ // Center vertically
+ newOffsetY = Math.max(0, canvasHeight / 2 - newHeight / 2);
+ }
+
+ return {
+ top: newOffsetY,
+ left: newOffsetX
+ };
+ };
+
+ Guestures.prototype.onZoom = function () {
+ var self = this;
+
+ // Calculate current distance between points to get pinch ratio and new width and height
+ var contentStartPos = self.contentStartPos;
+
+ var currentWidth = contentStartPos.width;
+ var currentHeight = contentStartPos.height;
+
+ var currentOffsetX = contentStartPos.left;
+ var currentOffsetY = contentStartPos.top;
+
+ var endDistanceBetweenFingers = distance(self.newPoints[0], self.newPoints[1]);
+
+ var pinchRatio = endDistanceBetweenFingers / self.startDistanceBetweenFingers;
+
+ var newWidth = Math.floor(currentWidth * pinchRatio);
+ var newHeight = Math.floor(currentHeight * pinchRatio);
+
+ // This is the translation due to pinch-zooming
+ var translateFromZoomingX = (currentWidth - newWidth) * self.percentageOfImageAtPinchPointX;
+ var translateFromZoomingY = (currentHeight - newHeight) * self.percentageOfImageAtPinchPointY;
+
+ // Point between the two touches
+ var centerPointEndX = (self.newPoints[0].x + self.newPoints[1].x) / 2 - $(window).scrollLeft();
+ var centerPointEndY = (self.newPoints[0].y + self.newPoints[1].y) / 2 - $(window).scrollTop();
+
+ // And this is the translation due to translation of the centerpoint
+ // between the two fingers
+ var translateFromTranslatingX = centerPointEndX - self.centerPointStartX;
+ var translateFromTranslatingY = centerPointEndY - self.centerPointStartY;
+
+ // The new offset is the old/current one plus the total translation
+ var newOffsetX = currentOffsetX + (translateFromZoomingX + translateFromTranslatingX);
+ var newOffsetY = currentOffsetY + (translateFromZoomingY + translateFromTranslatingY);
+
+ var newPos = {
+ top: newOffsetY,
+ left: newOffsetX,
+ scaleX: pinchRatio,
+ scaleY: pinchRatio
+ };
+
+ self.canTap = false;
+
+ self.newWidth = newWidth;
+ self.newHeight = newHeight;
+
+ self.contentLastPos = newPos;
+
+ if (self.requestId) {
+ cancelAFrame(self.requestId);
+ }
+
+ self.requestId = requestAFrame(function () {
+ $.fancybox.setTranslate(self.$content, self.contentLastPos);
+ });
+ };
+
+ Guestures.prototype.ontouchend = function (e) {
+ var self = this;
+
+ var swiping = self.isSwiping;
+ var panning = self.isPanning;
+ var zooming = self.isZooming;
+ var scrolling = self.isScrolling;
+
+ self.endPoints = getPointerXY(e);
+ self.dMs = Math.max(new Date().getTime() - self.startTime, 1);
+
+ self.$container.removeClass("fancybox-is-grabbing");
+
+ $(document).off(".fb.touch");
+
+ document.removeEventListener("scroll", self.onscroll, true);
+
+ if (self.requestId) {
+ cancelAFrame(self.requestId);
+
+ self.requestId = null;
+ }
+
+ self.isSwiping = false;
+ self.isPanning = false;
+ self.isZooming = false;
+ self.isScrolling = false;
+
+ self.instance.isDragging = false;
+
+ if (self.canTap) {
+ return self.onTap(e);
+ }
+
+ self.speed = 100;
+
+ // Speed in px/ms
+ self.velocityX = (self.distanceX / self.dMs) * 0.5;
+ self.velocityY = (self.distanceY / self.dMs) * 0.5;
+
+ if (panning) {
+ self.endPanning();
+ } else if (zooming) {
+ self.endZooming();
+ } else {
+ self.endSwiping(swiping, scrolling);
+ }
+
+ return;
+ };
+
+ Guestures.prototype.endSwiping = function (swiping, scrolling) {
+ var self = this,
+ ret = false,
+ len = self.instance.group.length,
+ distanceX = Math.abs(self.distanceX),
+ canAdvance = swiping == "x" && len > 1 && ((self.dMs > 130 && distanceX > 10) || distanceX > 50),
+ speedX = 300;
+
+ self.sliderLastPos = null;
+
+ // Close if swiped vertically / navigate if horizontally
+ if (swiping == "y" && !scrolling && Math.abs(self.distanceY) > 50) {
+ // Continue vertical movement
+ $.fancybox.animate(
+ self.instance.current.$slide, {
+ top: self.sliderStartPos.top + self.distanceY + self.velocityY * 150,
+ opacity: 0
+ },
+ 200
+ );
+ ret = self.instance.close(true, 250);
+ } else if (canAdvance && self.distanceX > 0) {
+ ret = self.instance.previous(speedX);
+ } else if (canAdvance && self.distanceX < 0) {
+ ret = self.instance.next(speedX);
+ }
+
+ if (ret === false && (swiping == "x" || swiping == "y")) {
+ self.instance.centerSlide(200);
+ }
+
+ self.$container.removeClass("fancybox-is-sliding");
+ };
+
+ // Limit panning from edges
+ // ========================
+ Guestures.prototype.endPanning = function () {
+ var self = this,
+ newOffsetX,
+ newOffsetY,
+ newPos;
+
+ if (!self.contentLastPos) {
+ return;
+ }
+
+ if (self.opts.momentum === false || self.dMs > 350) {
+ newOffsetX = self.contentLastPos.left;
+ newOffsetY = self.contentLastPos.top;
+ } else {
+ // Continue movement
+ newOffsetX = self.contentLastPos.left + self.velocityX * 500;
+ newOffsetY = self.contentLastPos.top + self.velocityY * 500;
+ }
+
+ newPos = self.limitPosition(newOffsetX, newOffsetY, self.contentStartPos.width, self.contentStartPos.height);
+
+ newPos.width = self.contentStartPos.width;
+ newPos.height = self.contentStartPos.height;
+
+ $.fancybox.animate(self.$content, newPos, 366);
+ };
+
+ Guestures.prototype.endZooming = function () {
+ var self = this;
+
+ var current = self.instance.current;
+
+ var newOffsetX, newOffsetY, newPos, reset;
+
+ var newWidth = self.newWidth;
+ var newHeight = self.newHeight;
+
+ if (!self.contentLastPos) {
+ return;
+ }
+
+ newOffsetX = self.contentLastPos.left;
+ newOffsetY = self.contentLastPos.top;
+
+ reset = {
+ top: newOffsetY,
+ left: newOffsetX,
+ width: newWidth,
+ height: newHeight,
+ scaleX: 1,
+ scaleY: 1
+ };
+
+ // Reset scalex/scaleY values; this helps for perfomance and does not break animation
+ $.fancybox.setTranslate(self.$content, reset);
+
+ if (newWidth < self.canvasWidth && newHeight < self.canvasHeight) {
+ self.instance.scaleToFit(150);
+ } else if (newWidth > current.width || newHeight > current.height) {
+ self.instance.scaleToActual(self.centerPointStartX, self.centerPointStartY, 150);
+ } else {
+ newPos = self.limitPosition(newOffsetX, newOffsetY, newWidth, newHeight);
+
+ $.fancybox.animate(self.$content, newPos, 150);
+ }
+ };
+
+ Guestures.prototype.onTap = function (e) {
+ var self = this;
+ var $target = $(e.target);
+
+ var instance = self.instance;
+ var current = instance.current;
+
+ var endPoints = (e && getPointerXY(e)) || self.startPoints;
+
+ var tapX = endPoints[0] ? endPoints[0].x - $(window).scrollLeft() - self.stagePos.left : 0;
+ var tapY = endPoints[0] ? endPoints[0].y - $(window).scrollTop() - self.stagePos.top : 0;
+
+ var where;
+
+ var process = function (prefix) {
+ var action = current.opts[prefix];
+
+ if ($.isFunction(action)) {
+ action = action.apply(instance, [current, e]);
+ }
+
+ if (!action) {
+ return;
+ }
+
+ switch (action) {
+ case "close":
+ instance.close(self.startEvent);
+
+ break;
+
+ case "toggleControls":
+ instance.toggleControls();
+
+ break;
+
+ case "next":
+ instance.next();
+
+ break;
+
+ case "nextOrClose":
+ if (instance.group.length > 1) {
+ instance.next();
+ } else {
+ instance.close(self.startEvent);
+ }
+
+ break;
+
+ case "zoom":
+ if (current.type == "image" && (current.isLoaded || current.$ghost)) {
+ if (instance.canPan()) {
+ instance.scaleToFit();
+ } else if (instance.isScaledDown()) {
+ instance.scaleToActual(tapX, tapY);
+ } else if (instance.group.length < 2) {
+ instance.close(self.startEvent);
+ }
+ }
+
+ break;
+ }
+ };
+
+ // Ignore right click
+ if (e.originalEvent && e.originalEvent.button == 2) {
+ return;
+ }
+
+ // Skip if clicked on the scrollbar
+ if (!$target.is("img") && tapX > $target[0].clientWidth + $target.offset().left) {
+ return;
+ }
+
+ // Check where is clicked
+ if ($target.is(".fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-container")) {
+ where = "Outside";
+ } else if ($target.is(".fancybox-slide")) {
+ where = "Slide";
+ } else if (
+ instance.current.$content &&
+ instance.current.$content
+ .find($target)
+ .addBack()
+ .filter($target).length
+ ) {
+ where = "Content";
+ } else {
+ return;
+ }
+
+ // Check if this is a double tap
+ if (self.tapped) {
+ // Stop previously created single tap
+ clearTimeout(self.tapped);
+ self.tapped = null;
+
+ // Skip if distance between taps is too big
+ if (Math.abs(tapX - self.tapX) > 50 || Math.abs(tapY - self.tapY) > 50) {
+ return this;
+ }
+
+ // OK, now we assume that this is a double-tap
+ process("dblclick" + where);
+ } else {
+ // Single tap will be processed if user has not clicked second time within 300ms
+ // or there is no need to wait for double-tap
+ self.tapX = tapX;
+ self.tapY = tapY;
+
+ if (current.opts["dblclick" + where] && current.opts["dblclick" + where] !== current.opts["click" + where]) {
+ self.tapped = setTimeout(function () {
+ self.tapped = null;
+
+ if (!instance.isAnimating) {
+ process("click" + where);
+ }
+ }, 500);
+ } else {
+ process("click" + where);
+ }
+ }
+
+ return this;
+ };
+
+ $(document)
+ .on("onActivate.fb", function (e, instance) {
+ if (instance && !instance.Guestures) {
+ instance.Guestures = new Guestures(instance);
+ }
+ })
+ .on("beforeClose.fb", function (e, instance) {
+ if (instance && instance.Guestures) {
+ instance.Guestures.destroy();
+ }
+ });
+})(window, document, jQuery);
+// ==========================================================================
+//
+// SlideShow
+// Enables slideshow functionality
+//
+// Example of usage:
+// $.fancybox.getInstance().SlideShow.start()
+//
+// ==========================================================================
+(function (document, $) {
+ "use strict";
+
+ $.extend(true, $.fancybox.defaults, {
+ btnTpl: {
+ slideShow: '<button data-fancybox-play class="fancybox-button fancybox-button--play" title="{{PLAY_START}}">' +
+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M6.5 5.4v13.2l11-6.6z"/></svg>' +
+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M8.33 5.75h2.2v12.5h-2.2V5.75zm5.15 0h2.2v12.5h-2.2V5.75z"/></svg>' +
+ "</button>"
+ },
+ slideShow: {
+ autoStart: false,
+ speed: 3000,
+ progress: true
+ }
+ });
+
+ var SlideShow = function (instance) {
+ this.instance = instance;
+ this.init();
+ };
+
+ $.extend(SlideShow.prototype, {
+ timer: null,
+ isActive: false,
+ $button: null,
+
+ init: function () {
+ var self = this,
+ instance = self.instance,
+ opts = instance.group[instance.currIndex].opts.slideShow;
+
+ self.$button = instance.$refs.toolbar.find("[data-fancybox-play]").on("click", function () {
+ self.toggle();
+ });
+
+ if (instance.group.length < 2 || !opts) {
+ self.$button.hide();
+ } else if (opts.progress) {
+ self.$progress = $('<div class="fancybox-progress"></div>').appendTo(instance.$refs.inner);
+ }
+ },
+
+ set: function (force) {
+ var self = this,
+ instance = self.instance,
+ current = instance.current;
+
+ // Check if reached last element
+ if (current && (force === true || current.opts.loop || instance.currIndex < instance.group.length - 1)) {
+ if (self.isActive && current.contentType !== "video") {
+ if (self.$progress) {
+ $.fancybox.animate(self.$progress.show(), {
+ scaleX: 1
+ }, current.opts.slideShow.speed);
+ }
+
+ self.timer = setTimeout(function () {
+ if (!instance.current.opts.loop && instance.current.index == instance.group.length - 1) {
+ instance.jumpTo(0);
+ } else {
+ instance.next();
+ }
+ }, current.opts.slideShow.speed);
+ }
+ } else {
+ self.stop();
+ instance.idleSecondsCounter = 0;
+ instance.showControls();
+ }
+ },
+
+ clear: function () {
+ var self = this;
+
+ clearTimeout(self.timer);
+
+ self.timer = null;
+
+ if (self.$progress) {
+ self.$progress.removeAttr("style").hide();
+ }
+ },
+
+ start: function () {
+ var self = this,
+ current = self.instance.current;
+
+ if (current) {
+ self.$button
+ .attr("title", (current.opts.i18n[current.opts.lang] || current.opts.i18n.en).PLAY_STOP)
+ .removeClass("fancybox-button--play")
+ .addClass("fancybox-button--pause");
+
+ self.isActive = true;
+
+ if (current.isComplete) {
+ self.set(true);
+ }
+
+ self.instance.trigger("onSlideShowChange", true);
+ }
+ },
+
+ stop: function () {
+ var self = this,
+ current = self.instance.current;
+
+ self.clear();
+
+ self.$button
+ .attr("title", (current.opts.i18n[current.opts.lang] || current.opts.i18n.en).PLAY_START)
+ .removeClass("fancybox-button--pause")
+ .addClass("fancybox-button--play");
+
+ self.isActive = false;
+
+ self.instance.trigger("onSlideShowChange", false);
+
+ if (self.$progress) {
+ self.$progress.removeAttr("style").hide();
+ }
+ },
+
+ toggle: function () {
+ var self = this;
+
+ if (self.isActive) {
+ self.stop();
+ } else {
+ self.start();
+ }
+ }
+ });
+
+ $(document).on({
+ "onInit.fb": function (e, instance) {
+ if (instance && !instance.SlideShow) {
+ instance.SlideShow = new SlideShow(instance);
+ }
+ },
+
+ "beforeShow.fb": function (e, instance, current, firstRun) {
+ var SlideShow = instance && instance.SlideShow;
+
+ if (firstRun) {
+ if (SlideShow && current.opts.slideShow.autoStart) {
+ SlideShow.start();
+ }
+ } else if (SlideShow && SlideShow.isActive) {
+ SlideShow.clear();
+ }
+ },
+
+ "afterShow.fb": function (e, instance, current) {
+ var SlideShow = instance && instance.SlideShow;
+
+ if (SlideShow && SlideShow.isActive) {
+ SlideShow.set();
+ }
+ },
+
+ "afterKeydown.fb": function (e, instance, current, keypress, keycode) {
+ var SlideShow = instance && instance.SlideShow;
+
+ // "P" or Spacebar
+ if (SlideShow && current.opts.slideShow && (keycode === 80 || keycode === 32) && !$(document.activeElement).is("button,a,input")) {
+ keypress.preventDefault();
+
+ SlideShow.toggle();
+ }
+ },
+
+ "beforeClose.fb onDeactivate.fb": function (e, instance) {
+ var SlideShow = instance && instance.SlideShow;
+
+ if (SlideShow) {
+ SlideShow.stop();
+ }
+ }
+ });
+
+ // Page Visibility API to pause slideshow when window is not active
+ $(document).on("visibilitychange", function () {
+ var instance = $.fancybox.getInstance(),
+ SlideShow = instance && instance.SlideShow;
+
+ if (SlideShow && SlideShow.isActive) {
+ if (document.hidden) {
+ SlideShow.clear();
+ } else {
+ SlideShow.set();
+ }
+ }
+ });
+})(document, jQuery);
+// ==========================================================================
+//
+// FullScreen
+// Adds fullscreen functionality
+//
+// ==========================================================================
+(function (document, $) {
+ "use strict";
+
+ // Collection of methods supported by user browser
+ var fn = (function () {
+ var fnMap = [
+ ["requestFullscreen", "exitFullscreen", "fullscreenElement", "fullscreenEnabled", "fullscreenchange", "fullscreenerror"],
+ // new WebKit
+ [
+ "webkitRequestFullscreen",
+ "webkitExitFullscreen",
+ "webkitFullscreenElement",
+ "webkitFullscreenEnabled",
+ "webkitfullscreenchange",
+ "webkitfullscreenerror"
+ ],
+ // old WebKit (Safari 5.1)
+ [
+ "webkitRequestFullScreen",
+ "webkitCancelFullScreen",
+ "webkitCurrentFullScreenElement",
+ "webkitCancelFullScreen",
+ "webkitfullscreenchange",
+ "webkitfullscreenerror"
+ ],
+ [
+ "mozRequestFullScreen",
+ "mozCancelFullScreen",
+ "mozFullScreenElement",
+ "mozFullScreenEnabled",
+ "mozfullscreenchange",
+ "mozfullscreenerror"
+ ],
+ ["msRequestFullscreen", "msExitFullscreen", "msFullscreenElement", "msFullscreenEnabled", "MSFullscreenChange", "MSFullscreenError"]
+ ];
+
+ var ret = {};
+
+ for (var i = 0; i < fnMap.length; i++) {
+ var val = fnMap[i];
+
+ if (val && val[1] in document) {
+ for (var j = 0; j < val.length; j++) {
+ ret[fnMap[0][j]] = val[j];
+ }
+
+ return ret;
+ }
+ }
+
+ return false;
+ })();
+
+ if (fn) {
+ var FullScreen = {
+ request: function (elem) {
+ elem = elem || document.documentElement;
+
+ elem[fn.requestFullscreen](elem.ALLOW_KEYBOARD_INPUT);
+ },
+ exit: function () {
+ document[fn.exitFullscreen]();
+ },
+ toggle: function (elem) {
+ elem = elem || document.documentElement;
+
+ if (this.isFullscreen()) {
+ this.exit();
+ } else {
+ this.request(elem);
+ }
+ },
+ isFullscreen: function () {
+ return Boolean(document[fn.fullscreenElement]);
+ },
+ enabled: function () {
+ return Boolean(document[fn.fullscreenEnabled]);
+ }
+ };
+
+ $.extend(true, $.fancybox.defaults, {
+ btnTpl: {
+ fullScreen: '<button data-fancybox-fullscreen class="fancybox-button fancybox-button--fsenter" title="{{FULL_SCREEN}}">' +
+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M7 14H5v5h5v-2H7v-3zm-2-4h2V7h3V5H5v5zm12 7h-3v2h5v-5h-2v3zM14 5v2h3v3h2V5h-5z"/></svg>' +
+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M5 16h3v3h2v-5H5zm3-8H5v2h5V5H8zm6 11h2v-3h3v-2h-5zm2-11V5h-2v5h5V8z"/></svg>' +
+ "</button>"
+ },
+ fullScreen: {
+ autoStart: false
+ }
+ });
+
+ $(document).on(fn.fullscreenchange, function () {
+ var isFullscreen = FullScreen.isFullscreen(),
+ instance = $.fancybox.getInstance();
+
+ if (instance) {
+ // If image is zooming, then force to stop and reposition properly
+ if (instance.current && instance.current.type === "image" && instance.isAnimating) {
+ instance.isAnimating = false;
+
+ instance.update(true, true, 0);
+
+ if (!instance.isComplete) {
+ instance.complete();
+ }
+ }
+
+ instance.trigger("onFullscreenChange", isFullscreen);
+
+ instance.$refs.container.toggleClass("fancybox-is-fullscreen", isFullscreen);
+
+ instance.$refs.toolbar
+ .find("[data-fancybox-fullscreen]")
+ .toggleClass("fancybox-button--fsenter", !isFullscreen)
+ .toggleClass("fancybox-button--fsexit", isFullscreen);
+ }
+ });
+ }
+
+ $(document).on({
+ "onInit.fb": function (e, instance) {
+ var $container;
+
+ if (!fn) {
+ instance.$refs.toolbar.find("[data-fancybox-fullscreen]").remove();
+
+ return;
+ }
+
+ if (instance && instance.group[instance.currIndex].opts.fullScreen) {
+ $container = instance.$refs.container;
+
+ $container.on("click.fb-fullscreen", "[data-fancybox-fullscreen]", function (e) {
+ e.stopPropagation();
+ e.preventDefault();
+
+ FullScreen.toggle();
+ });
+
+ if (instance.opts.fullScreen && instance.opts.fullScreen.autoStart === true) {
+ FullScreen.request();
+ }
+
+ // Expose API
+ instance.FullScreen = FullScreen;
+ } else if (instance) {
+ instance.$refs.toolbar.find("[data-fancybox-fullscreen]").hide();
+ }
+ },
+
+ "afterKeydown.fb": function (e, instance, current, keypress, keycode) {
+ // "F"
+ if (instance && instance.FullScreen && keycode === 70) {
+ keypress.preventDefault();
+
+ instance.FullScreen.toggle();
+ }
+ },
+
+ "beforeClose.fb": function (e, instance) {
+ if (instance && instance.FullScreen && instance.$refs.container.hasClass("fancybox-is-fullscreen")) {
+ FullScreen.exit();
+ }
+ }
+ });
+})(document, jQuery);
+// ==========================================================================
+//
+// Thumbs
+// Displays thumbnails in a grid
+//
+// ==========================================================================
+(function (document, $) {
+ "use strict";
+
+ var CLASS = "fancybox-thumbs",
+ CLASS_ACTIVE = CLASS + "-active";
+
+ // Make sure there are default values
+ $.fancybox.defaults = $.extend(
+ true, {
+ btnTpl: {
+ thumbs: '<button data-fancybox-thumbs class="fancybox-button fancybox-button--thumbs" title="{{THUMBS}}">' +
+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M14.59 14.59h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76H5.65v-3.76zm8.94-4.47h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76H5.65v-3.76zm8.94-4.47h3.76v3.76h-3.76V5.65zm-4.47 0h3.76v3.76h-3.76V5.65zm-4.47 0h3.76v3.76H5.65V5.65z"/></svg>' +
+ "</button>"
+ },
+ thumbs: {
+ autoStart: false, // Display thumbnails on opening
+ hideOnClose: true, // Hide thumbnail grid when closing animation starts
+ parentEl: ".fancybox-container", // Container is injected into this element
+ axis: "y" // Vertical (y) or horizontal (x) scrolling
+ }
+ },
+ $.fancybox.defaults
+ );
+
+ var FancyThumbs = function (instance) {
+ this.init(instance);
+ };
+
+ $.extend(FancyThumbs.prototype, {
+ $button: null,
+ $grid: null,
+ $list: null,
+ isVisible: false,
+ isActive: false,
+
+ init: function (instance) {
+ var self = this,
+ group = instance.group,
+ enabled = 0;
+
+ self.instance = instance;
+ self.opts = group[instance.currIndex].opts.thumbs;
+
+ instance.Thumbs = self;
+
+ self.$button = instance.$refs.toolbar.find("[data-fancybox-thumbs]");
+
+ // Enable thumbs if at least two group items have thumbnails
+ for (var i = 0, len = group.length; i < len; i++) {
+ if (group[i].thumb) {
+ enabled++;
+ }
+
+ if (enabled > 1) {
+ break;
+ }
+ }
+
+ if (enabled > 1 && !!self.opts) {
+ self.$button.removeAttr("style").on("click", function () {
+ self.toggle();
+ });
+
+ self.isActive = true;
+ } else {
+ self.$button.hide();
+ }
+ },
+
+ create: function () {
+ var self = this,
+ instance = self.instance,
+ parentEl = self.opts.parentEl,
+ list = [],
+ src;
+
+ if (!self.$grid) {
+ // Create main element
+ self.$grid = $('<div class="' + CLASS + " " + CLASS + "-" + self.opts.axis + '"></div>').appendTo(
+ instance.$refs.container
+ .find(parentEl)
+ .addBack()
+ .filter(parentEl)
+ );
+
+ // Add "click" event that performs gallery navigation
+ self.$grid.on("click", "a", function () {
+ instance.jumpTo($(this).attr("data-index"));
+ });
+ }
+
+ // Build the list
+ if (!self.$list) {
+ self.$list = $('<div class="' + CLASS + '__list">').appendTo(self.$grid);
+ }
+
+ $.each(instance.group, function (i, item) {
+ src = item.thumb;
+
+ if (!src && item.type === "image") {
+ src = item.src;
+ }
+
+ list.push(
+ '<a href="javascript:;" tabindex="0" data-index="' +
+ i +
+ '"' +
+ (src && src.length ? ' style="background-image:url(' + src + ')"' : 'class="fancybox-thumbs-missing"') +
+ "></a>"
+ );
+ });
+
+ self.$list[0].innerHTML = list.join("");
+
+ if (self.opts.axis === "x") {
+ // Set fixed width for list element to enable horizontal scrolling
+ self.$list.width(
+ parseInt(self.$grid.css("padding-right"), 10) +
+ instance.group.length *
+ self.$list
+ .children()
+ .eq(0)
+ .outerWidth(true)
+ );
+ }
+ },
+
+ focus: function (duration) {
+ var self = this,
+ $list = self.$list,
+ $grid = self.$grid,
+ thumb,
+ thumbPos;
+
+ if (!self.instance.current) {
+ return;
+ }
+
+ thumb = $list
+ .children()
+ .removeClass(CLASS_ACTIVE)
+ .filter('[data-index="' + self.instance.current.index + '"]')
+ .addClass(CLASS_ACTIVE);
+
+ thumbPos = thumb.position();
+
+ // Check if need to scroll to make current thumb visible
+ if (self.opts.axis === "y" && (thumbPos.top < 0 || thumbPos.top > $list.height() - thumb.outerHeight())) {
+ $list.stop().animate({
+ scrollTop: $list.scrollTop() + thumbPos.top
+ },
+ duration
+ );
+ } else if (
+ self.opts.axis === "x" &&
+ (thumbPos.left < $grid.scrollLeft() || thumbPos.left > $grid.scrollLeft() + ($grid.width() - thumb.outerWidth()))
+ ) {
+ $list
+ .parent()
+ .stop()
+ .animate({
+ scrollLeft: thumbPos.left
+ },
+ duration
+ );
+ }
+ },
+
+ update: function () {
+ var that = this;
+ that.instance.$refs.container.toggleClass("fancybox-show-thumbs", this.isVisible);
+
+ if (that.isVisible) {
+ if (!that.$grid) {
+ that.create();
+ }
+
+ that.instance.trigger("onThumbsShow");
+
+ that.focus(0);
+ } else if (that.$grid) {
+ that.instance.trigger("onThumbsHide");
+ }
+
+ // Update content position
+ that.instance.update();
+ },
+
+ hide: function () {
+ this.isVisible = false;
+ this.update();
+ },
+
+ show: function () {
+ this.isVisible = true;
+ this.update();
+ },
+
+ toggle: function () {
+ this.isVisible = !this.isVisible;
+ this.update();
+ }
+ });
+
+ $(document).on({
+ "onInit.fb": function (e, instance) {
+ var Thumbs;
+
+ if (instance && !instance.Thumbs) {
+ Thumbs = new FancyThumbs(instance);
+
+ if (Thumbs.isActive && Thumbs.opts.autoStart === true) {
+ Thumbs.show();
+ }
+ }
+ },
+
+ "beforeShow.fb": function (e, instance, item, firstRun) {
+ var Thumbs = instance && instance.Thumbs;
+
+ if (Thumbs && Thumbs.isVisible) {
+ Thumbs.focus(firstRun ? 0 : 250);
+ }
+ },
+
+ "afterKeydown.fb": function (e, instance, current, keypress, keycode) {
+ var Thumbs = instance && instance.Thumbs;
+
+ // "G"
+ if (Thumbs && Thumbs.isActive && keycode === 71) {
+ keypress.preventDefault();
+
+ Thumbs.toggle();
+ }
+ },
+
+ "beforeClose.fb": function (e, instance) {
+ var Thumbs = instance && instance.Thumbs;
+
+ if (Thumbs && Thumbs.isVisible && Thumbs.opts.hideOnClose !== false) {
+ Thumbs.$grid.hide();
+ }
+ }
+ });
+})(document, jQuery);
+//// ==========================================================================
+//
+// Share
+// Displays simple form for sharing current url
+//
+// ==========================================================================
+(function (document, $) {
+ "use strict";
+
+ $.extend(true, $.fancybox.defaults, {
+ btnTpl: {
+ share: '<button data-fancybox-share class="fancybox-button fancybox-button--share" title="{{SHARE}}">' +
+ '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M2.55 19c1.4-8.4 9.1-9.8 11.9-9.8V5l7 7-7 6.3v-3.5c-2.8 0-10.5 2.1-11.9 4.2z"/></svg>' +
+ "</button>"
+ },
+ share: {
+ url: function (instance, item) {
+ return (
+ (!instance.currentHash && !(item.type === "inline" || item.type === "html") ? item.origSrc || item.src : false) || window.location
+ );
+ },
+ tpl: '<div class="fancybox-share">' +
+ "<h1>{{SHARE}}</h1>" +
+ "<p>" +
+ '<a class="fancybox-share__button fancybox-share__button--fb" href="https://www.facebook.com/sharer/sharer.php?u={{url}}">' +
+ '<svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m287 456v-299c0-21 6-35 35-35h38v-63c-7-1-29-3-55-3-54 0-91 33-91 94v306m143-254h-205v72h196" /></svg>' +
+ "<span>Facebook</span>" +
+ "</a>" +
+ '<a class="fancybox-share__button fancybox-share__button--tw" href="https://twitter.com/intent/tweet?url={{url}}&text={{descr}}">' +
+ '<svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m456 133c-14 7-31 11-47 13 17-10 30-27 37-46-15 10-34 16-52 20-61-62-157-7-141 75-68-3-129-35-169-85-22 37-11 86 26 109-13 0-26-4-37-9 0 39 28 72 65 80-12 3-25 4-37 2 10 33 41 57 77 57-42 30-77 38-122 34 170 111 378-32 359-208 16-11 30-25 41-42z" /></svg>' +
+ "<span>Twitter</span>" +
+ "</a>" +
+ '<a class="fancybox-share__button fancybox-share__button--pt" href="https://www.pinterest.com/pin/create/button/?url={{url}}&description={{descr}}&media={{media}}">' +
+ '<svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m265 56c-109 0-164 78-164 144 0 39 15 74 47 87 5 2 10 0 12-5l4-19c2-6 1-8-3-13-9-11-15-25-15-45 0-58 43-110 113-110 62 0 96 38 96 88 0 67-30 122-73 122-24 0-42-19-36-44 6-29 20-60 20-81 0-19-10-35-31-35-25 0-44 26-44 60 0 21 7 36 7 36l-30 125c-8 37-1 83 0 87 0 3 4 4 5 2 2-3 32-39 42-75l16-64c8 16 31 29 56 29 74 0 124-67 124-157 0-69-58-132-146-132z" fill="#fff"/></svg>' +
+ "<span>Pinterest</span>" +
+ "</a>" +
+ "</p>" +
+ '<p><input class="fancybox-share__input" type="text" value="{{url_raw}}" onclick="select()" /></p>' +
+ "</div>"
+ }
+ });
+
+ function escapeHtml(string) {
+ var entityMap = {
+ "&": "&",
+ "<": "<",
+ ">": ">",
+ '"': """,
+ "'": "'",
+ "/": "/",
+ "`": "`",
+ "=": "="
+ };
+
+ return String(string).replace(/[&<>"'`=\/]/g, function (s) {
+ return entityMap[s];
+ });
+ }
+
+ $(document).on("click", "[data-fancybox-share]", function () {
+ var instance = $.fancybox.getInstance(),
+ current = instance.current || null,
+ url,
+ tpl;
+
+ if (!current) {
+ return;
+ }
+
+ if ($.type(current.opts.share.url) === "function") {
+ url = current.opts.share.url.apply(current, [instance, current]);
+ }
+
+ tpl = current.opts.share.tpl
+ .replace(/\{\{media\}\}/g, current.type === "image" ? encodeURIComponent(current.src) : "")
+ .replace(/\{\{url\}\}/g, encodeURIComponent(url))
+ .replace(/\{\{url_raw\}\}/g, escapeHtml(url))
+ .replace(/\{\{descr\}\}/g, instance.$caption ? encodeURIComponent(instance.$caption.text()) : "");
+
+ $.fancybox.open({
+ src: instance.translate(instance, tpl),
+ type: "html",
+ opts: {
+ touch: false,
+ animationEffect: false,
+ afterLoad: function (shareInstance, shareCurrent) {
+ // Close self if parent instance is closing
+ instance.$refs.container.one("beforeClose.fb", function () {
+ shareInstance.close(null, 0);
+ });
+
+ // Opening links in a popup window
+ shareCurrent.$content.find(".fancybox-share__button").click(function () {
+ window.open(this.href, "Share", "width=550, height=450");
+ return false;
+ });
+ },
+ mobile: {
+ autoFocus: false
+ }
+ }
+ });
+ });
+})(document, jQuery);
+// ==========================================================================
+//
+// Hash
+// Enables linking to each modal
+//
+// ==========================================================================
+(function (window, document, $) {
+ "use strict";
+
+ // Simple $.escapeSelector polyfill (for jQuery prior v3)
+ if (!$.escapeSelector) {
+ $.escapeSelector = function (sel) {
+ var rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g;
+ var fcssescape = function (ch, asCodePoint) {
+ if (asCodePoint) {
+ // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER
+ if (ch === "\0") {
+ return "\uFFFD";
+ }
+
+ // Control characters and (dependent upon position) numbers get escaped as code points
+ return ch.slice(0, -1) + "\\" + ch.charCodeAt(ch.length - 1).toString(16) + " ";
+ }
+
+ // Other potentially-special ASCII characters get backslash-escaped
+ return "\\" + ch;
+ };
+
+ return (sel + "").replace(rcssescape, fcssescape);
+ };
+ }
+
+ // Get info about gallery name and current index from url
+ function parseUrl() {
+ var hash = window.location.hash.substr(1),
+ rez = hash.split("-"),
+ index = rez.length > 1 && /^\+?\d+$/.test(rez[rez.length - 1]) ? parseInt(rez.pop(-1), 10) || 1 : 1,
+ gallery = rez.join("-");
+
+ return {
+ hash: hash,
+ /* Index is starting from 1 */
+ index: index < 1 ? 1 : index,
+ gallery: gallery
+ };
+ }
+
+ // Trigger click evnt on links to open new fancyBox instance
+ function triggerFromUrl(url) {
+ if (url.gallery !== "") {
+ // If we can find element matching 'data-fancybox' atribute,
+ // then triggering click event should start fancyBox
+ $("[data-fancybox='" + $.escapeSelector(url.gallery) + "']")
+ .eq(url.index - 1)
+ .focus()
+ .trigger("click.fb-start");
+ }
+ }
+
+ // Get gallery name from current instance
+ function getGalleryID(instance) {
+ var opts, ret;
+
+ if (!instance) {
+ return false;
+ }
+
+ opts = instance.current ? instance.current.opts : instance.opts;
+ ret = opts.hash || (opts.$orig ? opts.$orig.data("fancybox") || opts.$orig.data("fancybox-trigger") : "");
+
+ return ret === "" ? false : ret;
+ }
+
+ // Start when DOM becomes ready
+ $(function () {
+ // Check if user has disabled this module
+ if ($.fancybox.defaults.hash === false) {
+ return;
+ }
+
+ // Update hash when opening/closing fancyBox
+ $(document).on({
+ "onInit.fb": function (e, instance) {
+ var url, gallery;
+
+ if (instance.group[instance.currIndex].opts.hash === false) {
+ return;
+ }
+
+ url = parseUrl();
+ gallery = getGalleryID(instance);
+
+ // Make sure gallery start index matches index from hash
+ if (gallery && url.gallery && gallery == url.gallery) {
+ instance.currIndex = url.index - 1;
+ }
+ },
+
+ "beforeShow.fb": function (e, instance, current, firstRun) {
+ var gallery;
+
+ if (!current || current.opts.hash === false) {
+ return;
+ }
+
+ // Check if need to update window hash
+ gallery = getGalleryID(instance);
+
+ if (!gallery) {
+ return;
+ }
+
+ // Variable containing last hash value set by fancyBox
+ // It will be used to determine if fancyBox needs to close after hash change is detected
+ instance.currentHash = gallery + (instance.group.length > 1 ? "-" + (current.index + 1) : "");
+
+ // If current hash is the same (this instance most likely is opened by hashchange), then do nothing
+ if (window.location.hash === "#" + instance.currentHash) {
+ return;
+ }
+
+ if (firstRun && !instance.origHash) {
+ instance.origHash = window.location.hash;
+ }
+
+ if (instance.hashTimer) {
+ clearTimeout(instance.hashTimer);
+ }
+
+ // Update hash
+ instance.hashTimer = setTimeout(function () {
+ if ("replaceState" in window.history) {
+ window.history[firstRun ? "pushState" : "replaceState"]({},
+ document.title,
+ window.location.pathname + window.location.search + "#" + instance.currentHash
+ );
+
+ if (firstRun) {
+ instance.hasCreatedHistory = true;
+ }
+ } else {
+ window.location.hash = instance.currentHash;
+ }
+
+ instance.hashTimer = null;
+ }, 300);
+ },
+
+ "beforeClose.fb": function (e, instance, current) {
+ if (!current || current.opts.hash === false) {
+ return;
+ }
+
+ clearTimeout(instance.hashTimer);
+
+ // Goto previous history entry
+ if (instance.currentHash && instance.hasCreatedHistory) {
+ window.history.back();
+ } else if (instance.currentHash) {
+ if ("replaceState" in window.history) {
+ window.history.replaceState({}, document.title, window.location.pathname + window.location.search + (instance.origHash || ""));
+ } else {
+ window.location.hash = instance.origHash;
+ }
+ }
+
+ instance.currentHash = null;
+ }
+ });
+
+ // Check if need to start/close after url has changed
+ $(window).on("hashchange.fb", function () {
+ var url = parseUrl(),
+ fb = null;
+
+ // Find last fancyBox instance that has "hash"
+ $.each(
+ $(".fancybox-container")
+ .get()
+ .reverse(),
+ function (index, value) {
+ var tmp = $(value).data("FancyBox");
+
+ if (tmp && tmp.currentHash) {
+ fb = tmp;
+ return false;
+ }
+ }
+ );
+
+ if (fb) {
+ // Now, compare hash values
+ if (fb.currentHash !== url.gallery + "-" + url.index && !(url.index === 1 && fb.currentHash == url.gallery)) {
+ fb.currentHash = null;
+
+ fb.close();
+ }
+ } else if (url.gallery !== "") {
+ triggerFromUrl(url);
+ }
+ });
+
+ // Check current hash and trigger click event on matching element to start fancyBox, if needed
+ setTimeout(function () {
+ if (!$.fancybox.getInstance()) {
+ triggerFromUrl(parseUrl());
+ }
+ }, 50);
+ });
+})(window, document, jQuery);
+// ==========================================================================
+//
+// Wheel
+// Basic mouse weheel support for gallery navigation
+//
+// ==========================================================================
+(function (document, $) {
+ "use strict";
+
+ var prevTime = new Date().getTime();
+
+ $(document).on({
+ "onInit.fb": function (e, instance, current) {
+ instance.$refs.stage.on("mousewheel DOMMouseScroll wheel MozMousePixelScroll", function (e) {
+ var current = instance.current,
+ currTime = new Date().getTime();
+
+ if (instance.group.length < 2 || current.opts.wheel === false || (current.opts.wheel === "auto" && current.type !== "image")) {
+ return;
+ }
+
+ e.preventDefault();
+ e.stopPropagation();
+
+ if (current.$slide.hasClass("fancybox-animated")) {
+ return;
+ }
+
+ e = e.originalEvent || e;
+
+ if (currTime - prevTime < 250) {
+ return;
+ }
+
+ prevTime = currTime;
+
+ instance[(-e.deltaY || -e.deltaX || e.wheelDelta || -e.detail) < 0 ? "next" : "previous"]();
+ });
+ }
+ });
+})(document, jQuery);
\ No newline at end of file
--- /dev/null
+// ==================================================
+// fancyBox v3.5.7
+//
+// Licensed GPLv3 for open source use
+// or fancyBox Commercial License for commercial use
+//
+// http://fancyapps.com/fancybox/
+// Copyright 2019 fancyApps
+//
+// ==================================================
+!function(t,e,n,o){"use strict";function i(t,e){var o,i,a,s=[],r=0;t&&t.isDefaultPrevented()||(t.preventDefault(),e=e||{},t&&t.data&&(e=h(t.data.options,e)),o=e.$target||n(t.currentTarget).trigger("blur"),(a=n.fancybox.getInstance())&&a.$trigger&&a.$trigger.is(o)||(e.selector?s=n(e.selector):(i=o.attr("data-fancybox")||"",i?(s=t.data?t.data.items:[],s=s.length?s.filter('[data-fancybox="'+i+'"]'):n('[data-fancybox="'+i+'"]')):s=[o]),r=n(s).index(o),r<0&&(r=0),a=n.fancybox.open(s,e,r),a.$trigger=o))}if(t.console=t.console||{info:function(t){}},n){if(n.fn.fancybox)return void console.info("fancyBox already initialized");var a={closeExisting:!1,loop:!1,gutter:50,keyboard:!0,preventCaptionOverlap:!0,arrows:!0,infobar:!0,smallBtn:"auto",toolbar:"auto",buttons:["zoom","slideShow","thumbs","close"],idleTime:3,protect:!1,modal:!1,image:{preload:!1},ajax:{settings:{data:{fancybox:!0}}},iframe:{tpl:'<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" allowfullscreen="allowfullscreen" allow="autoplay; fullscreen" src=""></iframe>',preload:!0,css:{},attr:{scrolling:"auto"}},video:{tpl:'<video class="fancybox-video" controls controlsList="nodownload" poster="{{poster}}"><source src="{{src}}" type="{{format}}" />Sorry, your browser doesn\'t support embedded videos, <a href="{{src}}">download</a> and watch with your favorite video player!</video>',format:"",autoStart:!0},defaultType:"image",animationEffect:"zoom",animationDuration:366,zoomOpacity:"auto",transitionEffect:"fade",transitionDuration:366,slideClass:"",baseClass:"",baseTpl:'<div class="fancybox-container" role="dialog" tabindex="-1"><div class="fancybox-bg"></div><div class="fancybox-inner"><div class="fancybox-infobar"><span data-fancybox-index></span> / <span data-fancybox-count></span></div><div class="fancybox-toolbar">{{buttons}}</div><div class="fancybox-navigation">{{arrows}}</div><div class="fancybox-stage"></div><div class="fancybox-caption"><div class="fancybox-caption__body"></div></div></div></div>',spinnerTpl:'<div class="fancybox-loading"></div>',errorTpl:'<div class="fancybox-error"><p>{{ERROR}}</p></div>',btnTpl:{download:'<a download data-fancybox-download class="fancybox-button fancybox-button--download" title="{{DOWNLOAD}}" href="javascript:;"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M18.62 17.09V19H5.38v-1.91zm-2.97-6.96L17 11.45l-5 4.87-5-4.87 1.36-1.32 2.68 2.64V5h1.92v7.77z"/></svg></a>',zoom:'<button data-fancybox-zoom class="fancybox-button fancybox-button--zoom" title="{{ZOOM}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M18.7 17.3l-3-3a5.9 5.9 0 0 0-.6-7.6 5.9 5.9 0 0 0-8.4 0 5.9 5.9 0 0 0 0 8.4 5.9 5.9 0 0 0 7.7.7l3 3a1 1 0 0 0 1.3 0c.4-.5.4-1 0-1.5zM8.1 13.8a4 4 0 0 1 0-5.7 4 4 0 0 1 5.7 0 4 4 0 0 1 0 5.7 4 4 0 0 1-5.7 0z"/></svg></button>',close:'<button data-fancybox-close class="fancybox-button fancybox-button--close" title="{{CLOSE}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M12 10.6L6.6 5.2 5.2 6.6l5.4 5.4-5.4 5.4 1.4 1.4 5.4-5.4 5.4 5.4 1.4-1.4-5.4-5.4 5.4-5.4-1.4-1.4-5.4 5.4z"/></svg></button>',arrowLeft:'<button data-fancybox-prev class="fancybox-button fancybox-button--arrow_left" title="{{PREV}}"><div><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M11.28 15.7l-1.34 1.37L5 12l4.94-5.07 1.34 1.38-2.68 2.72H19v1.94H8.6z"/></svg></div></button>',arrowRight:'<button data-fancybox-next class="fancybox-button fancybox-button--arrow_right" title="{{NEXT}}"><div><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M15.4 12.97l-2.68 2.72 1.34 1.38L19 12l-4.94-5.07-1.34 1.38 2.68 2.72H5v1.94z"/></svg></div></button>',smallBtn:'<button type="button" data-fancybox-close class="fancybox-button fancybox-close-small" title="{{CLOSE}}"><svg xmlns="http://www.w3.org/2000/svg" version="1" viewBox="0 0 24 24"><path d="M13 12l5-5-1-1-5 5-5-5-1 1 5 5-5 5 1 1 5-5 5 5 1-1z"/></svg></button>'},parentEl:"body",hideScrollbar:!0,autoFocus:!0,backFocus:!0,trapFocus:!0,fullScreen:{autoStart:!1},touch:{vertical:!0,momentum:!0},hash:null,media:{},slideShow:{autoStart:!1,speed:3e3},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:".fancybox-container",axis:"y"},wheel:"auto",onInit:n.noop,beforeLoad:n.noop,afterLoad:n.noop,beforeShow:n.noop,afterShow:n.noop,beforeClose:n.noop,afterClose:n.noop,onActivate:n.noop,onDeactivate:n.noop,clickContent:function(t,e){return"image"===t.type&&"zoom"},clickSlide:"close",clickOutside:"close",dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1,mobile:{preventCaptionOverlap:!1,idleTime:!1,clickContent:function(t,e){return"image"===t.type&&"toggleControls"},clickSlide:function(t,e){return"image"===t.type?"toggleControls":"close"},dblclickContent:function(t,e){return"image"===t.type&&"zoom"},dblclickSlide:function(t,e){return"image"===t.type&&"zoom"}},lang:"en",i18n:{en:{CLOSE:"Close",NEXT:"Next",PREV:"Previous",ERROR:"The requested content cannot be loaded. <br/> Please try again later.",PLAY_START:"Start slideshow",PLAY_STOP:"Pause slideshow",FULL_SCREEN:"Full screen",THUMBS:"Thumbnails",DOWNLOAD:"Download",SHARE:"Share",ZOOM:"Zoom"},de:{CLOSE:"Schließen",NEXT:"Weiter",PREV:"Zurück",ERROR:"Die angeforderten Daten konnten nicht geladen werden. <br/> Bitte versuchen Sie es später nochmal.",PLAY_START:"Diaschau starten",PLAY_STOP:"Diaschau beenden",FULL_SCREEN:"Vollbild",THUMBS:"Vorschaubilder",DOWNLOAD:"Herunterladen",SHARE:"Teilen",ZOOM:"Vergrößern"}}},s=n(t),r=n(e),c=0,l=function(t){return t&&t.hasOwnProperty&&t instanceof n},d=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||t.oRequestAnimationFrame||function(e){return t.setTimeout(e,1e3/60)}}(),u=function(){return t.cancelAnimationFrame||t.webkitCancelAnimationFrame||t.mozCancelAnimationFrame||t.oCancelAnimationFrame||function(e){t.clearTimeout(e)}}(),f=function(){var t,n=e.createElement("fakeelement"),o={transition:"transitionend",OTransition:"oTransitionEnd",MozTransition:"transitionend",WebkitTransition:"webkitTransitionEnd"};for(t in o)if(void 0!==n.style[t])return o[t];return"transitionend"}(),p=function(t){return t&&t.length&&t[0].offsetHeight},h=function(t,e){var o=n.extend(!0,{},t,e);return n.each(e,function(t,e){n.isArray(e)&&(o[t]=e)}),o},g=function(t){var o,i;return!(!t||t.ownerDocument!==e)&&(n(".fancybox-container").css("pointer-events","none"),o={x:t.getBoundingClientRect().left+t.offsetWidth/2,y:t.getBoundingClientRect().top+t.offsetHeight/2},i=e.elementFromPoint(o.x,o.y)===t,n(".fancybox-container").css("pointer-events",""),i)},b=function(t,e,o){var i=this;i.opts=h({index:o},n.fancybox.defaults),n.isPlainObject(e)&&(i.opts=h(i.opts,e)),n.fancybox.isMobile&&(i.opts=h(i.opts,i.opts.mobile)),i.id=i.opts.id||++c,i.currIndex=parseInt(i.opts.index,10)||0,i.prevIndex=null,i.prevPos=null,i.currPos=0,i.firstRun=!0,i.group=[],i.slides={},i.addContent(t),i.group.length&&i.init()};n.extend(b.prototype,{init:function(){var o,i,a=this,s=a.group[a.currIndex],r=s.opts;r.closeExisting&&n.fancybox.close(!0),n("body").addClass("fancybox-active"),!n.fancybox.getInstance()&&!1!==r.hideScrollbar&&!n.fancybox.isMobile&&e.body.scrollHeight>t.innerHeight&&(n("head").append('<style id="fancybox-style-noscroll" type="text/css">.compensate-for-scrollbar{margin-right:'+(t.innerWidth-e.documentElement.clientWidth)+"px;}</style>"),n("body").addClass("compensate-for-scrollbar")),i="",n.each(r.buttons,function(t,e){i+=r.btnTpl[e]||""}),o=n(a.translate(a,r.baseTpl.replace("{{buttons}}",i).replace("{{arrows}}",r.btnTpl.arrowLeft+r.btnTpl.arrowRight))).attr("id","fancybox-container-"+a.id).addClass(r.baseClass).data("FancyBox",a).appendTo(r.parentEl),a.$refs={container:o},["bg","inner","infobar","toolbar","stage","caption","navigation"].forEach(function(t){a.$refs[t]=o.find(".fancybox-"+t)}),a.trigger("onInit"),a.activate(),a.jumpTo(a.currIndex)},translate:function(t,e){var n=t.opts.i18n[t.opts.lang]||t.opts.i18n.en;return e.replace(/\{\{(\w+)\}\}/g,function(t,e){return void 0===n[e]?t:n[e]})},addContent:function(t){var e,o=this,i=n.makeArray(t);n.each(i,function(t,e){var i,a,s,r,c,l={},d={};n.isPlainObject(e)?(l=e,d=e.opts||e):"object"===n.type(e)&&n(e).length?(i=n(e),d=i.data()||{},d=n.extend(!0,{},d,d.options),d.$orig=i,l.src=o.opts.src||d.src||i.attr("href"),l.type||l.src||(l.type="inline",l.src=e)):l={type:"html",src:e+""},l.opts=n.extend(!0,{},o.opts,d),n.isArray(d.buttons)&&(l.opts.buttons=d.buttons),n.fancybox.isMobile&&l.opts.mobile&&(l.opts=h(l.opts,l.opts.mobile)),a=l.type||l.opts.type,r=l.src||"",!a&&r&&((s=r.match(/\.(mp4|mov|ogv|webm)((\?|#).*)?$/i))?(a="video",l.opts.video.format||(l.opts.video.format="video/"+("ogv"===s[1]?"ogg":s[1]))):r.match(/(^data:image\/[a-z0-9+\/=]*,)|(\.(jp(e|g|eg)|gif|png|bmp|webp|svg|ico)((\?|#).*)?$)/i)?a="image":r.match(/\.(pdf)((\?|#).*)?$/i)?(a="iframe",l=n.extend(!0,l,{contentType:"pdf",opts:{iframe:{preload:!1}}})):"#"===r.charAt(0)&&(a="inline")),a?l.type=a:o.trigger("objectNeedsType",l),l.contentType||(l.contentType=n.inArray(l.type,["html","inline","ajax"])>-1?"html":l.type),l.index=o.group.length,"auto"==l.opts.smallBtn&&(l.opts.smallBtn=n.inArray(l.type,["html","inline","ajax"])>-1),"auto"===l.opts.toolbar&&(l.opts.toolbar=!l.opts.smallBtn),l.$thumb=l.opts.$thumb||null,l.opts.$trigger&&l.index===o.opts.index&&(l.$thumb=l.opts.$trigger.find("img:first"),l.$thumb.length&&(l.opts.$orig=l.opts.$trigger)),l.$thumb&&l.$thumb.length||!l.opts.$orig||(l.$thumb=l.opts.$orig.find("img:first")),l.$thumb&&!l.$thumb.length&&(l.$thumb=null),l.thumb=l.opts.thumb||(l.$thumb?l.$thumb[0].src:null),"function"===n.type(l.opts.caption)&&(l.opts.caption=l.opts.caption.apply(e,[o,l])),"function"===n.type(o.opts.caption)&&(l.opts.caption=o.opts.caption.apply(e,[o,l])),l.opts.caption instanceof n||(l.opts.caption=void 0===l.opts.caption?"":l.opts.caption+""),"ajax"===l.type&&(c=r.split(/\s+/,2),c.length>1&&(l.src=c.shift(),l.opts.filter=c.shift())),l.opts.modal&&(l.opts=n.extend(!0,l.opts,{trapFocus:!0,infobar:0,toolbar:0,smallBtn:0,keyboard:0,slideShow:0,fullScreen:0,thumbs:0,touch:0,clickContent:!1,clickSlide:!1,clickOutside:!1,dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1})),o.group.push(l)}),Object.keys(o.slides).length&&(o.updateControls(),(e=o.Thumbs)&&e.isActive&&(e.create(),e.focus()))},addEvents:function(){var e=this;e.removeEvents(),e.$refs.container.on("click.fb-close","[data-fancybox-close]",function(t){t.stopPropagation(),t.preventDefault(),e.close(t)}).on("touchstart.fb-prev click.fb-prev","[data-fancybox-prev]",function(t){t.stopPropagation(),t.preventDefault(),e.previous()}).on("touchstart.fb-next click.fb-next","[data-fancybox-next]",function(t){t.stopPropagation(),t.preventDefault(),e.next()}).on("click.fb","[data-fancybox-zoom]",function(t){e[e.isScaledDown()?"scaleToActual":"scaleToFit"]()}),s.on("orientationchange.fb resize.fb",function(t){t&&t.originalEvent&&"resize"===t.originalEvent.type?(e.requestId&&u(e.requestId),e.requestId=d(function(){e.update(t)})):(e.current&&"iframe"===e.current.type&&e.$refs.stage.hide(),setTimeout(function(){e.$refs.stage.show(),e.update(t)},n.fancybox.isMobile?600:250))}),r.on("keydown.fb",function(t){var o=n.fancybox?n.fancybox.getInstance():null,i=o.current,a=t.keyCode||t.which;if(9==a)return void(i.opts.trapFocus&&e.focus(t));if(!(!i.opts.keyboard||t.ctrlKey||t.altKey||t.shiftKey||n(t.target).is("input,textarea,video,audio,select")))return 8===a||27===a?(t.preventDefault(),void e.close(t)):37===a||38===a?(t.preventDefault(),void e.previous()):39===a||40===a?(t.preventDefault(),void e.next()):void e.trigger("afterKeydown",t,a)}),e.group[e.currIndex].opts.idleTime&&(e.idleSecondsCounter=0,r.on("mousemove.fb-idle mouseleave.fb-idle mousedown.fb-idle touchstart.fb-idle touchmove.fb-idle scroll.fb-idle keydown.fb-idle",function(t){e.idleSecondsCounter=0,e.isIdle&&e.showControls(),e.isIdle=!1}),e.idleInterval=t.setInterval(function(){++e.idleSecondsCounter>=e.group[e.currIndex].opts.idleTime&&!e.isDragging&&(e.isIdle=!0,e.idleSecondsCounter=0,e.hideControls())},1e3))},removeEvents:function(){var e=this;s.off("orientationchange.fb resize.fb"),r.off("keydown.fb .fb-idle"),this.$refs.container.off(".fb-close .fb-prev .fb-next"),e.idleInterval&&(t.clearInterval(e.idleInterval),e.idleInterval=null)},previous:function(t){return this.jumpTo(this.currPos-1,t)},next:function(t){return this.jumpTo(this.currPos+1,t)},jumpTo:function(t,e){var o,i,a,s,r,c,l,d,u,f=this,h=f.group.length;if(!(f.isDragging||f.isClosing||f.isAnimating&&f.firstRun)){if(t=parseInt(t,10),!(a=f.current?f.current.opts.loop:f.opts.loop)&&(t<0||t>=h))return!1;if(o=f.firstRun=!Object.keys(f.slides).length,r=f.current,f.prevIndex=f.currIndex,f.prevPos=f.currPos,s=f.createSlide(t),h>1&&((a||s.index<h-1)&&f.createSlide(t+1),(a||s.index>0)&&f.createSlide(t-1)),f.current=s,f.currIndex=s.index,f.currPos=s.pos,f.trigger("beforeShow",o),f.updateControls(),s.forcedDuration=void 0,n.isNumeric(e)?s.forcedDuration=e:e=s.opts[o?"animationDuration":"transitionDuration"],e=parseInt(e,10),i=f.isMoved(s),s.$slide.addClass("fancybox-slide--current"),o)return s.opts.animationEffect&&e&&f.$refs.container.css("transition-duration",e+"ms"),f.$refs.container.addClass("fancybox-is-open").trigger("focus"),f.loadSlide(s),void f.preload("image");c=n.fancybox.getTranslate(r.$slide),l=n.fancybox.getTranslate(f.$refs.stage),n.each(f.slides,function(t,e){n.fancybox.stop(e.$slide,!0)}),r.pos!==s.pos&&(r.isComplete=!1),r.$slide.removeClass("fancybox-slide--complete fancybox-slide--current"),i?(u=c.left-(r.pos*c.width+r.pos*r.opts.gutter),n.each(f.slides,function(t,o){o.$slide.removeClass("fancybox-animated").removeClass(function(t,e){return(e.match(/(^|\s)fancybox-fx-\S+/g)||[]).join(" ")});var i=o.pos*c.width+o.pos*o.opts.gutter;n.fancybox.setTranslate(o.$slide,{top:0,left:i-l.left+u}),o.pos!==s.pos&&o.$slide.addClass("fancybox-slide--"+(o.pos>s.pos?"next":"previous")),p(o.$slide),n.fancybox.animate(o.$slide,{top:0,left:(o.pos-s.pos)*c.width+(o.pos-s.pos)*o.opts.gutter},e,function(){o.$slide.css({transform:"",opacity:""}).removeClass("fancybox-slide--next fancybox-slide--previous"),o.pos===f.currPos&&f.complete()})})):e&&s.opts.transitionEffect&&(d="fancybox-animated fancybox-fx-"+s.opts.transitionEffect,r.$slide.addClass("fancybox-slide--"+(r.pos>s.pos?"next":"previous")),n.fancybox.animate(r.$slide,d,e,function(){r.$slide.removeClass(d).removeClass("fancybox-slide--next fancybox-slide--previous")},!1)),s.isLoaded?f.revealContent(s):f.loadSlide(s),f.preload("image")}},createSlide:function(t){var e,o,i=this;return o=t%i.group.length,o=o<0?i.group.length+o:o,!i.slides[t]&&i.group[o]&&(e=n('<div class="fancybox-slide"></div>').appendTo(i.$refs.stage),i.slides[t]=n.extend(!0,{},i.group[o],{pos:t,$slide:e,isLoaded:!1}),i.updateSlide(i.slides[t])),i.slides[t]},scaleToActual:function(t,e,o){var i,a,s,r,c,l=this,d=l.current,u=d.$content,f=n.fancybox.getTranslate(d.$slide).width,p=n.fancybox.getTranslate(d.$slide).height,h=d.width,g=d.height;l.isAnimating||l.isMoved()||!u||"image"!=d.type||!d.isLoaded||d.hasError||(l.isAnimating=!0,n.fancybox.stop(u),t=void 0===t?.5*f:t,e=void 0===e?.5*p:e,i=n.fancybox.getTranslate(u),i.top-=n.fancybox.getTranslate(d.$slide).top,i.left-=n.fancybox.getTranslate(d.$slide).left,r=h/i.width,c=g/i.height,a=.5*f-.5*h,s=.5*p-.5*g,h>f&&(a=i.left*r-(t*r-t),a>0&&(a=0),a<f-h&&(a=f-h)),g>p&&(s=i.top*c-(e*c-e),s>0&&(s=0),s<p-g&&(s=p-g)),l.updateCursor(h,g),n.fancybox.animate(u,{top:s,left:a,scaleX:r,scaleY:c},o||366,function(){l.isAnimating=!1}),l.SlideShow&&l.SlideShow.isActive&&l.SlideShow.stop())},scaleToFit:function(t){var e,o=this,i=o.current,a=i.$content;o.isAnimating||o.isMoved()||!a||"image"!=i.type||!i.isLoaded||i.hasError||(o.isAnimating=!0,n.fancybox.stop(a),e=o.getFitPos(i),o.updateCursor(e.width,e.height),n.fancybox.animate(a,{top:e.top,left:e.left,scaleX:e.width/a.width(),scaleY:e.height/a.height()},t||366,function(){o.isAnimating=!1}))},getFitPos:function(t){var e,o,i,a,s=this,r=t.$content,c=t.$slide,l=t.width||t.opts.width,d=t.height||t.opts.height,u={};return!!(t.isLoaded&&r&&r.length)&&(e=n.fancybox.getTranslate(s.$refs.stage).width,o=n.fancybox.getTranslate(s.$refs.stage).height,e-=parseFloat(c.css("paddingLeft"))+parseFloat(c.css("paddingRight"))+parseFloat(r.css("marginLeft"))+parseFloat(r.css("marginRight")),o-=parseFloat(c.css("paddingTop"))+parseFloat(c.css("paddingBottom"))+parseFloat(r.css("marginTop"))+parseFloat(r.css("marginBottom")),l&&d||(l=e,d=o),i=Math.min(1,e/l,o/d),l*=i,d*=i,l>e-.5&&(l=e),d>o-.5&&(d=o),"image"===t.type?(u.top=Math.floor(.5*(o-d))+parseFloat(c.css("paddingTop")),u.left=Math.floor(.5*(e-l))+parseFloat(c.css("paddingLeft"))):"video"===t.contentType&&(a=t.opts.width&&t.opts.height?l/d:t.opts.ratio||16/9,d>l/a?d=l/a:l>d*a&&(l=d*a)),u.width=l,u.height=d,u)},update:function(t){var e=this;n.each(e.slides,function(n,o){e.updateSlide(o,t)})},updateSlide:function(t,e){var o=this,i=t&&t.$content,a=t.width||t.opts.width,s=t.height||t.opts.height,r=t.$slide;o.adjustCaption(t),i&&(a||s||"video"===t.contentType)&&!t.hasError&&(n.fancybox.stop(i),n.fancybox.setTranslate(i,o.getFitPos(t)),t.pos===o.currPos&&(o.isAnimating=!1,o.updateCursor())),o.adjustLayout(t),r.length&&(r.trigger("refresh"),t.pos===o.currPos&&o.$refs.toolbar.add(o.$refs.navigation.find(".fancybox-button--arrow_right")).toggleClass("compensate-for-scrollbar",r.get(0).scrollHeight>r.get(0).clientHeight)),o.trigger("onUpdate",t,e)},centerSlide:function(t){var e=this,o=e.current,i=o.$slide;!e.isClosing&&o&&(i.siblings().css({transform:"",opacity:""}),i.parent().children().removeClass("fancybox-slide--previous fancybox-slide--next"),n.fancybox.animate(i,{top:0,left:0,opacity:1},void 0===t?0:t,function(){i.css({transform:"",opacity:""}),o.isComplete||e.complete()},!1))},isMoved:function(t){var e,o,i=t||this.current;return!!i&&(o=n.fancybox.getTranslate(this.$refs.stage),e=n.fancybox.getTranslate(i.$slide),!i.$slide.hasClass("fancybox-animated")&&(Math.abs(e.top-o.top)>.5||Math.abs(e.left-o.left)>.5))},updateCursor:function(t,e){var o,i,a=this,s=a.current,r=a.$refs.container;s&&!a.isClosing&&a.Guestures&&(r.removeClass("fancybox-is-zoomable fancybox-can-zoomIn fancybox-can-zoomOut fancybox-can-swipe fancybox-can-pan"),o=a.canPan(t,e),i=!!o||a.isZoomable(),r.toggleClass("fancybox-is-zoomable",i),n("[data-fancybox-zoom]").prop("disabled",!i),o?r.addClass("fancybox-can-pan"):i&&("zoom"===s.opts.clickContent||n.isFunction(s.opts.clickContent)&&"zoom"==s.opts.clickContent(s))?r.addClass("fancybox-can-zoomIn"):s.opts.touch&&(s.opts.touch.vertical||a.group.length>1)&&"video"!==s.contentType&&r.addClass("fancybox-can-swipe"))},isZoomable:function(){var t,e=this,n=e.current;if(n&&!e.isClosing&&"image"===n.type&&!n.hasError){if(!n.isLoaded)return!0;if((t=e.getFitPos(n))&&(n.width>t.width||n.height>t.height))return!0}return!1},isScaledDown:function(t,e){var o=this,i=!1,a=o.current,s=a.$content;return void 0!==t&&void 0!==e?i=t<a.width&&e<a.height:s&&(i=n.fancybox.getTranslate(s),i=i.width<a.width&&i.height<a.height),i},canPan:function(t,e){var o=this,i=o.current,a=null,s=!1;return"image"===i.type&&(i.isComplete||t&&e)&&!i.hasError&&(s=o.getFitPos(i),void 0!==t&&void 0!==e?a={width:t,height:e}:i.isComplete&&(a=n.fancybox.getTranslate(i.$content)),a&&s&&(s=Math.abs(a.width-s.width)>1.5||Math.abs(a.height-s.height)>1.5)),s},loadSlide:function(t){var e,o,i,a=this;if(!t.isLoading&&!t.isLoaded){if(t.isLoading=!0,!1===a.trigger("beforeLoad",t))return t.isLoading=!1,!1;switch(e=t.type,o=t.$slide,o.off("refresh").trigger("onReset").addClass(t.opts.slideClass),e){case"image":a.setImage(t);break;case"iframe":a.setIframe(t);break;case"html":a.setContent(t,t.src||t.content);break;case"video":a.setContent(t,t.opts.video.tpl.replace(/\{\{src\}\}/gi,t.src).replace("{{format}}",t.opts.videoFormat||t.opts.video.format||"").replace("{{poster}}",t.thumb||""));break;case"inline":n(t.src).length?a.setContent(t,n(t.src)):a.setError(t);break;case"ajax":a.showLoading(t),i=n.ajax(n.extend({},t.opts.ajax.settings,{url:t.src,success:function(e,n){"success"===n&&a.setContent(t,e)},error:function(e,n){e&&"abort"!==n&&a.setError(t)}})),o.one("onReset",function(){i.abort()});break;default:a.setError(t)}return!0}},setImage:function(t){var o,i=this;setTimeout(function(){var e=t.$image;i.isClosing||!t.isLoading||e&&e.length&&e[0].complete||t.hasError||i.showLoading(t)},50),i.checkSrcset(t),t.$content=n('<div class="fancybox-content"></div>').addClass("fancybox-is-hidden").appendTo(t.$slide.addClass("fancybox-slide--image")),!1!==t.opts.preload&&t.opts.width&&t.opts.height&&t.thumb&&(t.width=t.opts.width,t.height=t.opts.height,o=e.createElement("img"),o.onerror=function(){n(this).remove(),t.$ghost=null},o.onload=function(){i.afterLoad(t)},t.$ghost=n(o).addClass("fancybox-image").appendTo(t.$content).attr("src",t.thumb)),i.setBigImage(t)},checkSrcset:function(e){var n,o,i,a,s=e.opts.srcset||e.opts.image.srcset;if(s){i=t.devicePixelRatio||1,a=t.innerWidth*i,o=s.split(",").map(function(t){var e={};return t.trim().split(/\s+/).forEach(function(t,n){var o=parseInt(t.substring(0,t.length-1),10);if(0===n)return e.url=t;o&&(e.value=o,e.postfix=t[t.length-1])}),e}),o.sort(function(t,e){return t.value-e.value});for(var r=0;r<o.length;r++){var c=o[r];if("w"===c.postfix&&c.value>=a||"x"===c.postfix&&c.value>=i){n=c;break}}!n&&o.length&&(n=o[o.length-1]),n&&(e.src=n.url,e.width&&e.height&&"w"==n.postfix&&(e.height=e.width/e.height*n.value,e.width=n.value),e.opts.srcset=s)}},setBigImage:function(t){var o=this,i=e.createElement("img"),a=n(i);t.$image=a.one("error",function(){o.setError(t)}).one("load",function(){var e;t.$ghost||(o.resolveImageSlideSize(t,this.naturalWidth,this.naturalHeight),o.afterLoad(t)),o.isClosing||(t.opts.srcset&&(e=t.opts.sizes,e&&"auto"!==e||(e=(t.width/t.height>1&&s.width()/s.height()>1?"100":Math.round(t.width/t.height*100))+"vw"),a.attr("sizes",e).attr("srcset",t.opts.srcset)),t.$ghost&&setTimeout(function(){t.$ghost&&!o.isClosing&&t.$ghost.hide()},Math.min(300,Math.max(1e3,t.height/1600))),o.hideLoading(t))}).addClass("fancybox-image").attr("src",t.src).appendTo(t.$content),(i.complete||"complete"==i.readyState)&&a.naturalWidth&&a.naturalHeight?a.trigger("load"):i.error&&a.trigger("error")},resolveImageSlideSize:function(t,e,n){var o=parseInt(t.opts.width,10),i=parseInt(t.opts.height,10);t.width=e,t.height=n,o>0&&(t.width=o,t.height=Math.floor(o*n/e)),i>0&&(t.width=Math.floor(i*e/n),t.height=i)},setIframe:function(t){var e,o=this,i=t.opts.iframe,a=t.$slide;t.$content=n('<div class="fancybox-content'+(i.preload?" fancybox-is-hidden":"")+'"></div>').css(i.css).appendTo(a),a.addClass("fancybox-slide--"+t.contentType),t.$iframe=e=n(i.tpl.replace(/\{rnd\}/g,(new Date).getTime())).attr(i.attr).appendTo(t.$content),i.preload?(o.showLoading(t),e.on("load.fb error.fb",function(e){this.isReady=1,t.$slide.trigger("refresh"),o.afterLoad(t)}),a.on("refresh.fb",function(){var n,o,s=t.$content,r=i.css.width,c=i.css.height;if(1===e[0].isReady){try{n=e.contents(),o=n.find("body")}catch(t){}o&&o.length&&o.children().length&&(a.css("overflow","visible"),s.css({width:"100%","max-width":"100%",height:"9999px"}),void 0===r&&(r=Math.ceil(Math.max(o[0].clientWidth,o.outerWidth(!0)))),s.css("width",r||"").css("max-width",""),void 0===c&&(c=Math.ceil(Math.max(o[0].clientHeight,o.outerHeight(!0)))),s.css("height",c||""),a.css("overflow","auto")),s.removeClass("fancybox-is-hidden")}})):o.afterLoad(t),e.attr("src",t.src),a.one("onReset",function(){try{n(this).find("iframe").hide().unbind().attr("src","//about:blank")}catch(t){}n(this).off("refresh.fb").empty(),t.isLoaded=!1,t.isRevealed=!1})},setContent:function(t,e){var o=this;o.isClosing||(o.hideLoading(t),t.$content&&n.fancybox.stop(t.$content),t.$slide.empty(),l(e)&&e.parent().length?((e.hasClass("fancybox-content")||e.parent().hasClass("fancybox-content"))&&e.parents(".fancybox-slide").trigger("onReset"),t.$placeholder=n("<div>").hide().insertAfter(e),e.css("display","inline-block")):t.hasError||("string"===n.type(e)&&(e=n("<div>").append(n.trim(e)).contents()),t.opts.filter&&(e=n("<div>").html(e).find(t.opts.filter))),t.$slide.one("onReset",function(){n(this).find("video,audio").trigger("pause"),t.$placeholder&&(t.$placeholder.after(e.removeClass("fancybox-content").hide()).remove(),t.$placeholder=null),t.$smallBtn&&(t.$smallBtn.remove(),t.$smallBtn=null),t.hasError||(n(this).empty(),t.isLoaded=!1,t.isRevealed=!1)}),n(e).appendTo(t.$slide),n(e).is("video,audio")&&(n(e).addClass("fancybox-video"),n(e).wrap("<div></div>"),t.contentType="video",t.opts.width=t.opts.width||n(e).attr("width"),t.opts.height=t.opts.height||n(e).attr("height")),t.$content=t.$slide.children().filter("div,form,main,video,audio,article,.fancybox-content").first(),t.$content.siblings().hide(),t.$content.length||(t.$content=t.$slide.wrapInner("<div></div>").children().first()),t.$content.addClass("fancybox-content"),t.$slide.addClass("fancybox-slide--"+t.contentType),o.afterLoad(t))},setError:function(t){t.hasError=!0,t.$slide.trigger("onReset").removeClass("fancybox-slide--"+t.contentType).addClass("fancybox-slide--error"),t.contentType="html",this.setContent(t,this.translate(t,t.opts.errorTpl)),t.pos===this.currPos&&(this.isAnimating=!1)},showLoading:function(t){var e=this;(t=t||e.current)&&!t.$spinner&&(t.$spinner=n(e.translate(e,e.opts.spinnerTpl)).appendTo(t.$slide).hide().fadeIn("fast"))},hideLoading:function(t){var e=this;(t=t||e.current)&&t.$spinner&&(t.$spinner.stop().remove(),delete t.$spinner)},afterLoad:function(t){var e=this;e.isClosing||(t.isLoading=!1,t.isLoaded=!0,e.trigger("afterLoad",t),e.hideLoading(t),!t.opts.smallBtn||t.$smallBtn&&t.$smallBtn.length||(t.$smallBtn=n(e.translate(t,t.opts.btnTpl.smallBtn)).appendTo(t.$content)),t.opts.protect&&t.$content&&!t.hasError&&(t.$content.on("contextmenu.fb",function(t){return 2==t.button&&t.preventDefault(),!0}),"image"===t.type&&n('<div class="fancybox-spaceball"></div>').appendTo(t.$content)),e.adjustCaption(t),e.adjustLayout(t),t.pos===e.currPos&&e.updateCursor(),e.revealContent(t))},adjustCaption:function(t){var e,n=this,o=t||n.current,i=o.opts.caption,a=o.opts.preventCaptionOverlap,s=n.$refs.caption,r=!1;s.toggleClass("fancybox-caption--separate",a),a&&i&&i.length&&(o.pos!==n.currPos?(e=s.clone().appendTo(s.parent()),e.children().eq(0).empty().html(i),r=e.outerHeight(!0),e.empty().remove()):n.$caption&&(r=n.$caption.outerHeight(!0)),o.$slide.css("padding-bottom",r||""))},adjustLayout:function(t){var e,n,o,i,a=this,s=t||a.current;s.isLoaded&&!0!==s.opts.disableLayoutFix&&(s.$content.css("margin-bottom",""),s.$content.outerHeight()>s.$slide.height()+.5&&(o=s.$slide[0].style["padding-bottom"],i=s.$slide.css("padding-bottom"),parseFloat(i)>0&&(e=s.$slide[0].scrollHeight,s.$slide.css("padding-bottom",0),Math.abs(e-s.$slide[0].scrollHeight)<1&&(n=i),s.$slide.css("padding-bottom",o))),s.$content.css("margin-bottom",n))},revealContent:function(t){var e,o,i,a,s=this,r=t.$slide,c=!1,l=!1,d=s.isMoved(t),u=t.isRevealed;return t.isRevealed=!0,e=t.opts[s.firstRun?"animationEffect":"transitionEffect"],i=t.opts[s.firstRun?"animationDuration":"transitionDuration"],i=parseInt(void 0===t.forcedDuration?i:t.forcedDuration,10),!d&&t.pos===s.currPos&&i||(e=!1),"zoom"===e&&(t.pos===s.currPos&&i&&"image"===t.type&&!t.hasError&&(l=s.getThumbPos(t))?c=s.getFitPos(t):e="fade"),"zoom"===e?(s.isAnimating=!0,c.scaleX=c.width/l.width,c.scaleY=c.height/l.height,a=t.opts.zoomOpacity,"auto"==a&&(a=Math.abs(t.width/t.height-l.width/l.height)>.1),a&&(l.opacity=.1,c.opacity=1),n.fancybox.setTranslate(t.$content.removeClass("fancybox-is-hidden"),l),p(t.$content),void n.fancybox.animate(t.$content,c,i,function(){s.isAnimating=!1,s.complete()})):(s.updateSlide(t),e?(n.fancybox.stop(r),o="fancybox-slide--"+(t.pos>=s.prevPos?"next":"previous")+" fancybox-animated fancybox-fx-"+e,r.addClass(o).removeClass("fancybox-slide--current"),t.$content.removeClass("fancybox-is-hidden"),p(r),"image"!==t.type&&t.$content.hide().show(0),void n.fancybox.animate(r,"fancybox-slide--current",i,function(){r.removeClass(o).css({transform:"",opacity:""}),t.pos===s.currPos&&s.complete()},!0)):(t.$content.removeClass("fancybox-is-hidden"),u||!d||"image"!==t.type||t.hasError||t.$content.hide().fadeIn("fast"),void(t.pos===s.currPos&&s.complete())))},getThumbPos:function(t){var e,o,i,a,s,r=!1,c=t.$thumb;return!(!c||!g(c[0]))&&(e=n.fancybox.getTranslate(c),o=parseFloat(c.css("border-top-width")||0),i=parseFloat(c.css("border-right-width")||0),a=parseFloat(c.css("border-bottom-width")||0),s=parseFloat(c.css("border-left-width")||0),r={top:e.top+o,left:e.left+s,width:e.width-i-s,height:e.height-o-a,scaleX:1,scaleY:1},e.width>0&&e.height>0&&r)},complete:function(){var t,e=this,o=e.current,i={};!e.isMoved()&&o.isLoaded&&(o.isComplete||(o.isComplete=!0,o.$slide.siblings().trigger("onReset"),e.preload("inline"),p(o.$slide),o.$slide.addClass("fancybox-slide--complete"),n.each(e.slides,function(t,o){o.pos>=e.currPos-1&&o.pos<=e.currPos+1?i[o.pos]=o:o&&(n.fancybox.stop(o.$slide),o.$slide.off().remove())}),e.slides=i),e.isAnimating=!1,e.updateCursor(),e.trigger("afterShow"),o.opts.video.autoStart&&o.$slide.find("video,audio").filter(":visible:first").trigger("play").one("ended",function(){Document.exitFullscreen?Document.exitFullscreen():this.webkitExitFullscreen&&this.webkitExitFullscreen(),e.next()}),o.opts.autoFocus&&"html"===o.contentType&&(t=o.$content.find("input[autofocus]:enabled:visible:first"),t.length?t.trigger("focus"):e.focus(null,!0)),o.$slide.scrollTop(0).scrollLeft(0))},preload:function(t){var e,n,o=this;o.group.length<2||(n=o.slides[o.currPos+1],e=o.slides[o.currPos-1],e&&e.type===t&&o.loadSlide(e),n&&n.type===t&&o.loadSlide(n))},focus:function(t,o){var i,a,s=this,r=["a[href]","area[href]",'input:not([disabled]):not([type="hidden"]):not([aria-hidden])',"select:not([disabled]):not([aria-hidden])","textarea:not([disabled]):not([aria-hidden])","button:not([disabled]):not([aria-hidden])","iframe","object","embed","video","audio","[contenteditable]",'[tabindex]:not([tabindex^="-"])'].join(",");s.isClosing||(i=!t&&s.current&&s.current.isComplete?s.current.$slide.find("*:visible"+(o?":not(.fancybox-close-small)":"")):s.$refs.container.find("*:visible"),i=i.filter(r).filter(function(){return"hidden"!==n(this).css("visibility")&&!n(this).hasClass("disabled")}),i.length?(a=i.index(e.activeElement),t&&t.shiftKey?(a<0||0==a)&&(t.preventDefault(),i.eq(i.length-1).trigger("focus")):(a<0||a==i.length-1)&&(t&&t.preventDefault(),i.eq(0).trigger("focus"))):s.$refs.container.trigger("focus"))},activate:function(){var t=this;n(".fancybox-container").each(function(){var e=n(this).data("FancyBox");e&&e.id!==t.id&&!e.isClosing&&(e.trigger("onDeactivate"),e.removeEvents(),e.isVisible=!1)}),t.isVisible=!0,(t.current||t.isIdle)&&(t.update(),t.updateControls()),t.trigger("onActivate"),t.addEvents()},close:function(t,e){var o,i,a,s,r,c,l,u=this,f=u.current,h=function(){u.cleanUp(t)};return!u.isClosing&&(u.isClosing=!0,!1===u.trigger("beforeClose",t)?(u.isClosing=!1,d(function(){u.update()}),!1):(u.removeEvents(),a=f.$content,o=f.opts.animationEffect,i=n.isNumeric(e)?e:o?f.opts.animationDuration:0,f.$slide.removeClass("fancybox-slide--complete fancybox-slide--next fancybox-slide--previous fancybox-animated"),!0!==t?n.fancybox.stop(f.$slide):o=!1,f.$slide.siblings().trigger("onReset").remove(),i&&u.$refs.container.removeClass("fancybox-is-open").addClass("fancybox-is-closing").css("transition-duration",i+"ms"),u.hideLoading(f),u.hideControls(!0),u.updateCursor(),"zoom"!==o||a&&i&&"image"===f.type&&!u.isMoved()&&!f.hasError&&(l=u.getThumbPos(f))||(o="fade"),"zoom"===o?(n.fancybox.stop(a),s=n.fancybox.getTranslate(a),c={top:s.top,left:s.left,scaleX:s.width/l.width,scaleY:s.height/l.height,width:l.width,height:l.height},r=f.opts.zoomOpacity,
+"auto"==r&&(r=Math.abs(f.width/f.height-l.width/l.height)>.1),r&&(l.opacity=0),n.fancybox.setTranslate(a,c),p(a),n.fancybox.animate(a,l,i,h),!0):(o&&i?n.fancybox.animate(f.$slide.addClass("fancybox-slide--previous").removeClass("fancybox-slide--current"),"fancybox-animated fancybox-fx-"+o,i,h):!0===t?setTimeout(h,i):h(),!0)))},cleanUp:function(e){var o,i,a,s=this,r=s.current.opts.$orig;s.current.$slide.trigger("onReset"),s.$refs.container.empty().remove(),s.trigger("afterClose",e),s.current.opts.backFocus&&(r&&r.length&&r.is(":visible")||(r=s.$trigger),r&&r.length&&(i=t.scrollX,a=t.scrollY,r.trigger("focus"),n("html, body").scrollTop(a).scrollLeft(i))),s.current=null,o=n.fancybox.getInstance(),o?o.activate():(n("body").removeClass("fancybox-active compensate-for-scrollbar"),n("#fancybox-style-noscroll").remove())},trigger:function(t,e){var o,i=Array.prototype.slice.call(arguments,1),a=this,s=e&&e.opts?e:a.current;if(s?i.unshift(s):s=a,i.unshift(a),n.isFunction(s.opts[t])&&(o=s.opts[t].apply(s,i)),!1===o)return o;"afterClose"!==t&&a.$refs?a.$refs.container.trigger(t+".fb",i):r.trigger(t+".fb",i)},updateControls:function(){var t=this,o=t.current,i=o.index,a=t.$refs.container,s=t.$refs.caption,r=o.opts.caption;o.$slide.trigger("refresh"),r&&r.length?(t.$caption=s,s.children().eq(0).html(r)):t.$caption=null,t.hasHiddenControls||t.isIdle||t.showControls(),a.find("[data-fancybox-count]").html(t.group.length),a.find("[data-fancybox-index]").html(i+1),a.find("[data-fancybox-prev]").prop("disabled",!o.opts.loop&&i<=0),a.find("[data-fancybox-next]").prop("disabled",!o.opts.loop&&i>=t.group.length-1),"image"===o.type?a.find("[data-fancybox-zoom]").show().end().find("[data-fancybox-download]").attr("href",o.opts.image.src||o.src).show():o.opts.toolbar&&a.find("[data-fancybox-download],[data-fancybox-zoom]").hide(),n(e.activeElement).is(":hidden,[disabled]")&&t.$refs.container.trigger("focus")},hideControls:function(t){var e=this,n=["infobar","toolbar","nav"];!t&&e.current.opts.preventCaptionOverlap||n.push("caption"),this.$refs.container.removeClass(n.map(function(t){return"fancybox-show-"+t}).join(" ")),this.hasHiddenControls=!0},showControls:function(){var t=this,e=t.current?t.current.opts:t.opts,n=t.$refs.container;t.hasHiddenControls=!1,t.idleSecondsCounter=0,n.toggleClass("fancybox-show-toolbar",!(!e.toolbar||!e.buttons)).toggleClass("fancybox-show-infobar",!!(e.infobar&&t.group.length>1)).toggleClass("fancybox-show-caption",!!t.$caption).toggleClass("fancybox-show-nav",!!(e.arrows&&t.group.length>1)).toggleClass("fancybox-is-modal",!!e.modal)},toggleControls:function(){this.hasHiddenControls?this.showControls():this.hideControls()}}),n.fancybox={version:"3.5.7",defaults:a,getInstance:function(t){var e=n('.fancybox-container:not(".fancybox-is-closing"):last').data("FancyBox"),o=Array.prototype.slice.call(arguments,1);return e instanceof b&&("string"===n.type(t)?e[t].apply(e,o):"function"===n.type(t)&&t.apply(e,o),e)},open:function(t,e,n){return new b(t,e,n)},close:function(t){var e=this.getInstance();e&&(e.close(),!0===t&&this.close(t))},destroy:function(){this.close(!0),r.add("body").off("click.fb-start","**")},isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),use3d:function(){var n=e.createElement("div");return t.getComputedStyle&&t.getComputedStyle(n)&&t.getComputedStyle(n).getPropertyValue("transform")&&!(e.documentMode&&e.documentMode<11)}(),getTranslate:function(t){var e;return!(!t||!t.length)&&(e=t[0].getBoundingClientRect(),{top:e.top||0,left:e.left||0,width:e.width,height:e.height,opacity:parseFloat(t.css("opacity"))})},setTranslate:function(t,e){var n="",o={};if(t&&e)return void 0===e.left&&void 0===e.top||(n=(void 0===e.left?t.position().left:e.left)+"px, "+(void 0===e.top?t.position().top:e.top)+"px",n=this.use3d?"translate3d("+n+", 0px)":"translate("+n+")"),void 0!==e.scaleX&&void 0!==e.scaleY?n+=" scale("+e.scaleX+", "+e.scaleY+")":void 0!==e.scaleX&&(n+=" scaleX("+e.scaleX+")"),n.length&&(o.transform=n),void 0!==e.opacity&&(o.opacity=e.opacity),void 0!==e.width&&(o.width=e.width),void 0!==e.height&&(o.height=e.height),t.css(o)},animate:function(t,e,o,i,a){var s,r=this;n.isFunction(o)&&(i=o,o=null),r.stop(t),s=r.getTranslate(t),t.on(f,function(c){(!c||!c.originalEvent||t.is(c.originalEvent.target)&&"z-index"!=c.originalEvent.propertyName)&&(r.stop(t),n.isNumeric(o)&&t.css("transition-duration",""),n.isPlainObject(e)?void 0!==e.scaleX&&void 0!==e.scaleY&&r.setTranslate(t,{top:e.top,left:e.left,width:s.width*e.scaleX,height:s.height*e.scaleY,scaleX:1,scaleY:1}):!0!==a&&t.removeClass(e),n.isFunction(i)&&i(c))}),n.isNumeric(o)&&t.css("transition-duration",o+"ms"),n.isPlainObject(e)?(void 0!==e.scaleX&&void 0!==e.scaleY&&(delete e.width,delete e.height,t.parent().hasClass("fancybox-slide--image")&&t.parent().addClass("fancybox-is-scaling")),n.fancybox.setTranslate(t,e)):t.addClass(e),t.data("timer",setTimeout(function(){t.trigger(f)},o+33))},stop:function(t,e){t&&t.length&&(clearTimeout(t.data("timer")),e&&t.trigger(f),t.off(f).css("transition-duration",""),t.parent().removeClass("fancybox-is-scaling"))}},n.fn.fancybox=function(t){var e;return t=t||{},e=t.selector||!1,e?n("body").off("click.fb-start",e).on("click.fb-start",e,{options:t},i):this.off("click.fb-start").on("click.fb-start",{items:this,options:t},i),this},r.on("click.fb-start","[data-fancybox]",i),r.on("click.fb-start","[data-fancybox-trigger]",function(t){n('[data-fancybox="'+n(this).attr("data-fancybox-trigger")+'"]').eq(n(this).attr("data-fancybox-index")||0).trigger("click.fb-start",{$trigger:n(this)})}),function(){var t=null;r.on("mousedown mouseup focus blur",".fancybox-button",function(e){switch(e.type){case"mousedown":t=n(this);break;case"mouseup":t=null;break;case"focusin":n(".fancybox-button").removeClass("fancybox-focus"),n(this).is(t)||n(this).is("[disabled]")||n(this).addClass("fancybox-focus");break;case"focusout":n(".fancybox-button").removeClass("fancybox-focus")}})}()}}(window,document,jQuery),function(t){"use strict";var e={youtube:{matcher:/(youtube\.com|youtu\.be|youtube\-nocookie\.com)\/(watch\?(.*&)?v=|v\/|u\/|embed\/?)?(videoseries\?list=(.*)|[\w-]{11}|\?listType=(.*)&list=(.*))(.*)/i,params:{autoplay:1,autohide:1,fs:1,rel:0,hd:1,wmode:"transparent",enablejsapi:1,html5:1},paramPlace:8,type:"iframe",url:"https://www.youtube-nocookie.com/embed/$4",thumb:"https://img.youtube.com/vi/$4/hqdefault.jpg"},vimeo:{matcher:/^.+vimeo.com\/(.*\/)?([\d]+)(.*)?/,params:{autoplay:1,hd:1,show_title:1,show_byline:1,show_portrait:0,fullscreen:1},paramPlace:3,type:"iframe",url:"//player.vimeo.com/video/$2"},instagram:{matcher:/(instagr\.am|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,type:"image",url:"//$1/p/$2/media/?size=l"},gmap_place:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(((maps\/(place\/(.*)\/)?\@(.*),(\d+.?\d+?)z))|(\?ll=))(.*)?/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/?ll="+(t[9]?t[9]+"&z="+Math.floor(t[10])+(t[12]?t[12].replace(/^\//,"&"):""):t[12]+"").replace(/\?/,"&")+"&output="+(t[12]&&t[12].indexOf("layer=c")>0?"svembed":"embed")}},gmap_search:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(maps\/search\/)(.*)/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/maps?q="+t[5].replace("query=","q=").replace("api=1","")+"&output=embed"}}},n=function(e,n,o){if(e)return o=o||"","object"===t.type(o)&&(o=t.param(o,!0)),t.each(n,function(t,n){e=e.replace("$"+t,n||"")}),o.length&&(e+=(e.indexOf("?")>0?"&":"?")+o),e};t(document).on("objectNeedsType.fb",function(o,i,a){var s,r,c,l,d,u,f,p=a.src||"",h=!1;s=t.extend(!0,{},e,a.opts.media),t.each(s,function(e,o){if(c=p.match(o.matcher)){if(h=o.type,f=e,u={},o.paramPlace&&c[o.paramPlace]){d=c[o.paramPlace],"?"==d[0]&&(d=d.substring(1)),d=d.split("&");for(var i=0;i<d.length;++i){var s=d[i].split("=",2);2==s.length&&(u[s[0]]=decodeURIComponent(s[1].replace(/\+/g," ")))}}return l=t.extend(!0,{},o.params,a.opts[e],u),p="function"===t.type(o.url)?o.url.call(this,c,l,a):n(o.url,c,l),r="function"===t.type(o.thumb)?o.thumb.call(this,c,l,a):n(o.thumb,c),"youtube"===e?p=p.replace(/&t=((\d+)m)?(\d+)s/,function(t,e,n,o){return"&start="+((n?60*parseInt(n,10):0)+parseInt(o,10))}):"vimeo"===e&&(p=p.replace("&%23","#")),!1}}),h?(a.opts.thumb||a.opts.$thumb&&a.opts.$thumb.length||(a.opts.thumb=r),"iframe"===h&&(a.opts=t.extend(!0,a.opts,{iframe:{preload:!1,attr:{scrolling:"no"}}})),t.extend(a,{type:h,src:p,origSrc:a.src,contentSource:f,contentType:"image"===h?"image":"gmap_place"==f||"gmap_search"==f?"map":"video"})):p&&(a.type=a.opts.defaultType)});var o={youtube:{src:"https://www.youtube.com/iframe_api",class:"YT",loading:!1,loaded:!1},vimeo:{src:"https://player.vimeo.com/api/player.js",class:"Vimeo",loading:!1,loaded:!1},load:function(t){var e,n=this;if(this[t].loaded)return void setTimeout(function(){n.done(t)});this[t].loading||(this[t].loading=!0,e=document.createElement("script"),e.type="text/javascript",e.src=this[t].src,"youtube"===t?window.onYouTubeIframeAPIReady=function(){n[t].loaded=!0,n.done(t)}:e.onload=function(){n[t].loaded=!0,n.done(t)},document.body.appendChild(e))},done:function(e){var n,o,i;"youtube"===e&&delete window.onYouTubeIframeAPIReady,(n=t.fancybox.getInstance())&&(o=n.current.$content.find("iframe"),"youtube"===e&&void 0!==YT&&YT?i=new YT.Player(o.attr("id"),{events:{onStateChange:function(t){0==t.data&&n.next()}}}):"vimeo"===e&&void 0!==Vimeo&&Vimeo&&(i=new Vimeo.Player(o),i.on("ended",function(){n.next()})))}};t(document).on({"afterShow.fb":function(t,e,n){e.group.length>1&&("youtube"===n.contentSource||"vimeo"===n.contentSource)&&o.load(n.contentSource)}})}(jQuery),function(t,e,n){"use strict";var o=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||t.oRequestAnimationFrame||function(e){return t.setTimeout(e,1e3/60)}}(),i=function(){return t.cancelAnimationFrame||t.webkitCancelAnimationFrame||t.mozCancelAnimationFrame||t.oCancelAnimationFrame||function(e){t.clearTimeout(e)}}(),a=function(e){var n=[];e=e.originalEvent||e||t.e,e=e.touches&&e.touches.length?e.touches:e.changedTouches&&e.changedTouches.length?e.changedTouches:[e];for(var o in e)e[o].pageX?n.push({x:e[o].pageX,y:e[o].pageY}):e[o].clientX&&n.push({x:e[o].clientX,y:e[o].clientY});return n},s=function(t,e,n){return e&&t?"x"===n?t.x-e.x:"y"===n?t.y-e.y:Math.sqrt(Math.pow(t.x-e.x,2)+Math.pow(t.y-e.y,2)):0},r=function(t){if(t.is('a,area,button,[role="button"],input,label,select,summary,textarea,video,audio,iframe')||n.isFunction(t.get(0).onclick)||t.data("selectable"))return!0;for(var e=0,o=t[0].attributes,i=o.length;e<i;e++)if("data-fancybox-"===o[e].nodeName.substr(0,14))return!0;return!1},c=function(e){var n=t.getComputedStyle(e)["overflow-y"],o=t.getComputedStyle(e)["overflow-x"],i=("scroll"===n||"auto"===n)&&e.scrollHeight>e.clientHeight,a=("scroll"===o||"auto"===o)&&e.scrollWidth>e.clientWidth;return i||a},l=function(t){for(var e=!1;;){if(e=c(t.get(0)))break;if(t=t.parent(),!t.length||t.hasClass("fancybox-stage")||t.is("body"))break}return e},d=function(t){var e=this;e.instance=t,e.$bg=t.$refs.bg,e.$stage=t.$refs.stage,e.$container=t.$refs.container,e.destroy(),e.$container.on("touchstart.fb.touch mousedown.fb.touch",n.proxy(e,"ontouchstart"))};d.prototype.destroy=function(){var t=this;t.$container.off(".fb.touch"),n(e).off(".fb.touch"),t.requestId&&(i(t.requestId),t.requestId=null),t.tapped&&(clearTimeout(t.tapped),t.tapped=null)},d.prototype.ontouchstart=function(o){var i=this,c=n(o.target),d=i.instance,u=d.current,f=u.$slide,p=u.$content,h="touchstart"==o.type;if(h&&i.$container.off("mousedown.fb.touch"),(!o.originalEvent||2!=o.originalEvent.button)&&f.length&&c.length&&!r(c)&&!r(c.parent())&&(c.is("img")||!(o.originalEvent.clientX>c[0].clientWidth+c.offset().left))){if(!u||d.isAnimating||u.$slide.hasClass("fancybox-animated"))return o.stopPropagation(),void o.preventDefault();i.realPoints=i.startPoints=a(o),i.startPoints.length&&(u.touch&&o.stopPropagation(),i.startEvent=o,i.canTap=!0,i.$target=c,i.$content=p,i.opts=u.opts.touch,i.isPanning=!1,i.isSwiping=!1,i.isZooming=!1,i.isScrolling=!1,i.canPan=d.canPan(),i.startTime=(new Date).getTime(),i.distanceX=i.distanceY=i.distance=0,i.canvasWidth=Math.round(f[0].clientWidth),i.canvasHeight=Math.round(f[0].clientHeight),i.contentLastPos=null,i.contentStartPos=n.fancybox.getTranslate(i.$content)||{top:0,left:0},i.sliderStartPos=n.fancybox.getTranslate(f),i.stagePos=n.fancybox.getTranslate(d.$refs.stage),i.sliderStartPos.top-=i.stagePos.top,i.sliderStartPos.left-=i.stagePos.left,i.contentStartPos.top-=i.stagePos.top,i.contentStartPos.left-=i.stagePos.left,n(e).off(".fb.touch").on(h?"touchend.fb.touch touchcancel.fb.touch":"mouseup.fb.touch mouseleave.fb.touch",n.proxy(i,"ontouchend")).on(h?"touchmove.fb.touch":"mousemove.fb.touch",n.proxy(i,"ontouchmove")),n.fancybox.isMobile&&e.addEventListener("scroll",i.onscroll,!0),((i.opts||i.canPan)&&(c.is(i.$stage)||i.$stage.find(c).length)||(c.is(".fancybox-image")&&o.preventDefault(),n.fancybox.isMobile&&c.parents(".fancybox-caption").length))&&(i.isScrollable=l(c)||l(c.parent()),n.fancybox.isMobile&&i.isScrollable||o.preventDefault(),(1===i.startPoints.length||u.hasError)&&(i.canPan?(n.fancybox.stop(i.$content),i.isPanning=!0):i.isSwiping=!0,i.$container.addClass("fancybox-is-grabbing")),2===i.startPoints.length&&"image"===u.type&&(u.isLoaded||u.$ghost)&&(i.canTap=!1,i.isSwiping=!1,i.isPanning=!1,i.isZooming=!0,n.fancybox.stop(i.$content),i.centerPointStartX=.5*(i.startPoints[0].x+i.startPoints[1].x)-n(t).scrollLeft(),i.centerPointStartY=.5*(i.startPoints[0].y+i.startPoints[1].y)-n(t).scrollTop(),i.percentageOfImageAtPinchPointX=(i.centerPointStartX-i.contentStartPos.left)/i.contentStartPos.width,i.percentageOfImageAtPinchPointY=(i.centerPointStartY-i.contentStartPos.top)/i.contentStartPos.height,i.startDistanceBetweenFingers=s(i.startPoints[0],i.startPoints[1]))))}},d.prototype.onscroll=function(t){var n=this;n.isScrolling=!0,e.removeEventListener("scroll",n.onscroll,!0)},d.prototype.ontouchmove=function(t){var e=this;return void 0!==t.originalEvent.buttons&&0===t.originalEvent.buttons?void e.ontouchend(t):e.isScrolling?void(e.canTap=!1):(e.newPoints=a(t),void((e.opts||e.canPan)&&e.newPoints.length&&e.newPoints.length&&(e.isSwiping&&!0===e.isSwiping||t.preventDefault(),e.distanceX=s(e.newPoints[0],e.startPoints[0],"x"),e.distanceY=s(e.newPoints[0],e.startPoints[0],"y"),e.distance=s(e.newPoints[0],e.startPoints[0]),e.distance>0&&(e.isSwiping?e.onSwipe(t):e.isPanning?e.onPan():e.isZooming&&e.onZoom()))))},d.prototype.onSwipe=function(e){var a,s=this,r=s.instance,c=s.isSwiping,l=s.sliderStartPos.left||0;if(!0!==c)"x"==c&&(s.distanceX>0&&(s.instance.group.length<2||0===s.instance.current.index&&!s.instance.current.opts.loop)?l+=Math.pow(s.distanceX,.8):s.distanceX<0&&(s.instance.group.length<2||s.instance.current.index===s.instance.group.length-1&&!s.instance.current.opts.loop)?l-=Math.pow(-s.distanceX,.8):l+=s.distanceX),s.sliderLastPos={top:"x"==c?0:s.sliderStartPos.top+s.distanceY,left:l},s.requestId&&(i(s.requestId),s.requestId=null),s.requestId=o(function(){s.sliderLastPos&&(n.each(s.instance.slides,function(t,e){var o=e.pos-s.instance.currPos;n.fancybox.setTranslate(e.$slide,{top:s.sliderLastPos.top,left:s.sliderLastPos.left+o*s.canvasWidth+o*e.opts.gutter})}),s.$container.addClass("fancybox-is-sliding"))});else if(Math.abs(s.distance)>10){if(s.canTap=!1,r.group.length<2&&s.opts.vertical?s.isSwiping="y":r.isDragging||!1===s.opts.vertical||"auto"===s.opts.vertical&&n(t).width()>800?s.isSwiping="x":(a=Math.abs(180*Math.atan2(s.distanceY,s.distanceX)/Math.PI),s.isSwiping=a>45&&a<135?"y":"x"),"y"===s.isSwiping&&n.fancybox.isMobile&&s.isScrollable)return void(s.isScrolling=!0);r.isDragging=s.isSwiping,s.startPoints=s.newPoints,n.each(r.slides,function(t,e){var o,i;n.fancybox.stop(e.$slide),o=n.fancybox.getTranslate(e.$slide),i=n.fancybox.getTranslate(r.$refs.stage),e.$slide.css({transform:"",opacity:"","transition-duration":""}).removeClass("fancybox-animated").removeClass(function(t,e){return(e.match(/(^|\s)fancybox-fx-\S+/g)||[]).join(" ")}),e.pos===r.current.pos&&(s.sliderStartPos.top=o.top-i.top,s.sliderStartPos.left=o.left-i.left),n.fancybox.setTranslate(e.$slide,{top:o.top-i.top,left:o.left-i.left})}),r.SlideShow&&r.SlideShow.isActive&&r.SlideShow.stop()}},d.prototype.onPan=function(){var t=this;if(s(t.newPoints[0],t.realPoints[0])<(n.fancybox.isMobile?10:5))return void(t.startPoints=t.newPoints);t.canTap=!1,t.contentLastPos=t.limitMovement(),t.requestId&&i(t.requestId),t.requestId=o(function(){n.fancybox.setTranslate(t.$content,t.contentLastPos)})},d.prototype.limitMovement=function(){var t,e,n,o,i,a,s=this,r=s.canvasWidth,c=s.canvasHeight,l=s.distanceX,d=s.distanceY,u=s.contentStartPos,f=u.left,p=u.top,h=u.width,g=u.height;return i=h>r?f+l:f,a=p+d,t=Math.max(0,.5*r-.5*h),e=Math.max(0,.5*c-.5*g),n=Math.min(r-h,.5*r-.5*h),o=Math.min(c-g,.5*c-.5*g),l>0&&i>t&&(i=t-1+Math.pow(-t+f+l,.8)||0),l<0&&i<n&&(i=n+1-Math.pow(n-f-l,.8)||0),d>0&&a>e&&(a=e-1+Math.pow(-e+p+d,.8)||0),d<0&&a<o&&(a=o+1-Math.pow(o-p-d,.8)||0),{top:a,left:i}},d.prototype.limitPosition=function(t,e,n,o){var i=this,a=i.canvasWidth,s=i.canvasHeight;return n>a?(t=t>0?0:t,t=t<a-n?a-n:t):t=Math.max(0,a/2-n/2),o>s?(e=e>0?0:e,e=e<s-o?s-o:e):e=Math.max(0,s/2-o/2),{top:e,left:t}},d.prototype.onZoom=function(){var e=this,a=e.contentStartPos,r=a.width,c=a.height,l=a.left,d=a.top,u=s(e.newPoints[0],e.newPoints[1]),f=u/e.startDistanceBetweenFingers,p=Math.floor(r*f),h=Math.floor(c*f),g=(r-p)*e.percentageOfImageAtPinchPointX,b=(c-h)*e.percentageOfImageAtPinchPointY,m=(e.newPoints[0].x+e.newPoints[1].x)/2-n(t).scrollLeft(),v=(e.newPoints[0].y+e.newPoints[1].y)/2-n(t).scrollTop(),y=m-e.centerPointStartX,x=v-e.centerPointStartY,w=l+(g+y),$=d+(b+x),S={top:$,left:w,scaleX:f,scaleY:f};e.canTap=!1,e.newWidth=p,e.newHeight=h,e.contentLastPos=S,e.requestId&&i(e.requestId),e.requestId=o(function(){n.fancybox.setTranslate(e.$content,e.contentLastPos)})},d.prototype.ontouchend=function(t){var o=this,s=o.isSwiping,r=o.isPanning,c=o.isZooming,l=o.isScrolling;if(o.endPoints=a(t),o.dMs=Math.max((new Date).getTime()-o.startTime,1),o.$container.removeClass("fancybox-is-grabbing"),n(e).off(".fb.touch"),e.removeEventListener("scroll",o.onscroll,!0),o.requestId&&(i(o.requestId),o.requestId=null),o.isSwiping=!1,o.isPanning=!1,o.isZooming=!1,o.isScrolling=!1,o.instance.isDragging=!1,o.canTap)return o.onTap(t);o.speed=100,o.velocityX=o.distanceX/o.dMs*.5,o.velocityY=o.distanceY/o.dMs*.5,r?o.endPanning():c?o.endZooming():o.endSwiping(s,l)},d.prototype.endSwiping=function(t,e){var o=this,i=!1,a=o.instance.group.length,s=Math.abs(o.distanceX),r="x"==t&&a>1&&(o.dMs>130&&s>10||s>50);o.sliderLastPos=null,"y"==t&&!e&&Math.abs(o.distanceY)>50?(n.fancybox.animate(o.instance.current.$slide,{top:o.sliderStartPos.top+o.distanceY+150*o.velocityY,opacity:0},200),i=o.instance.close(!0,250)):r&&o.distanceX>0?i=o.instance.previous(300):r&&o.distanceX<0&&(i=o.instance.next(300)),!1!==i||"x"!=t&&"y"!=t||o.instance.centerSlide(200),o.$container.removeClass("fancybox-is-sliding")},d.prototype.endPanning=function(){var t,e,o,i=this;i.contentLastPos&&(!1===i.opts.momentum||i.dMs>350?(t=i.contentLastPos.left,e=i.contentLastPos.top):(t=i.contentLastPos.left+500*i.velocityX,e=i.contentLastPos.top+500*i.velocityY),o=i.limitPosition(t,e,i.contentStartPos.width,i.contentStartPos.height),o.width=i.contentStartPos.width,o.height=i.contentStartPos.height,n.fancybox.animate(i.$content,o,366))},d.prototype.endZooming=function(){var t,e,o,i,a=this,s=a.instance.current,r=a.newWidth,c=a.newHeight;a.contentLastPos&&(t=a.contentLastPos.left,e=a.contentLastPos.top,i={top:e,left:t,width:r,height:c,scaleX:1,scaleY:1},n.fancybox.setTranslate(a.$content,i),r<a.canvasWidth&&c<a.canvasHeight?a.instance.scaleToFit(150):r>s.width||c>s.height?a.instance.scaleToActual(a.centerPointStartX,a.centerPointStartY,150):(o=a.limitPosition(t,e,r,c),n.fancybox.animate(a.$content,o,150)))},d.prototype.onTap=function(e){var o,i=this,s=n(e.target),r=i.instance,c=r.current,l=e&&a(e)||i.startPoints,d=l[0]?l[0].x-n(t).scrollLeft()-i.stagePos.left:0,u=l[0]?l[0].y-n(t).scrollTop()-i.stagePos.top:0,f=function(t){var o=c.opts[t];if(n.isFunction(o)&&(o=o.apply(r,[c,e])),o)switch(o){case"close":r.close(i.startEvent);break;case"toggleControls":r.toggleControls();break;case"next":r.next();break;case"nextOrClose":r.group.length>1?r.next():r.close(i.startEvent);break;case"zoom":"image"==c.type&&(c.isLoaded||c.$ghost)&&(r.canPan()?r.scaleToFit():r.isScaledDown()?r.scaleToActual(d,u):r.group.length<2&&r.close(i.startEvent))}};if((!e.originalEvent||2!=e.originalEvent.button)&&(s.is("img")||!(d>s[0].clientWidth+s.offset().left))){if(s.is(".fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-container"))o="Outside";else if(s.is(".fancybox-slide"))o="Slide";else{if(!r.current.$content||!r.current.$content.find(s).addBack().filter(s).length)return;o="Content"}if(i.tapped){if(clearTimeout(i.tapped),i.tapped=null,Math.abs(d-i.tapX)>50||Math.abs(u-i.tapY)>50)return this;f("dblclick"+o)}else i.tapX=d,i.tapY=u,c.opts["dblclick"+o]&&c.opts["dblclick"+o]!==c.opts["click"+o]?i.tapped=setTimeout(function(){i.tapped=null,r.isAnimating||f("click"+o)},500):f("click"+o);return this}},n(e).on("onActivate.fb",function(t,e){e&&!e.Guestures&&(e.Guestures=new d(e))}).on("beforeClose.fb",function(t,e){e&&e.Guestures&&e.Guestures.destroy()})}(window,document,jQuery),function(t,e){"use strict";e.extend(!0,e.fancybox.defaults,{btnTpl:{slideShow:'<button data-fancybox-play class="fancybox-button fancybox-button--play" title="{{PLAY_START}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M6.5 5.4v13.2l11-6.6z"/></svg><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M8.33 5.75h2.2v12.5h-2.2V5.75zm5.15 0h2.2v12.5h-2.2V5.75z"/></svg></button>'},slideShow:{autoStart:!1,speed:3e3,progress:!0}});var n=function(t){this.instance=t,this.init()};e.extend(n.prototype,{timer:null,isActive:!1,$button:null,init:function(){var t=this,n=t.instance,o=n.group[n.currIndex].opts.slideShow;t.$button=n.$refs.toolbar.find("[data-fancybox-play]").on("click",function(){t.toggle()}),n.group.length<2||!o?t.$button.hide():o.progress&&(t.$progress=e('<div class="fancybox-progress"></div>').appendTo(n.$refs.inner))},set:function(t){var n=this,o=n.instance,i=o.current;i&&(!0===t||i.opts.loop||o.currIndex<o.group.length-1)?n.isActive&&"video"!==i.contentType&&(n.$progress&&e.fancybox.animate(n.$progress.show(),{scaleX:1},i.opts.slideShow.speed),n.timer=setTimeout(function(){o.current.opts.loop||o.current.index!=o.group.length-1?o.next():o.jumpTo(0)},i.opts.slideShow.speed)):(n.stop(),o.idleSecondsCounter=0,o.showControls())},clear:function(){var t=this;clearTimeout(t.timer),t.timer=null,t.$progress&&t.$progress.removeAttr("style").hide()},start:function(){var t=this,e=t.instance.current;e&&(t.$button.attr("title",(e.opts.i18n[e.opts.lang]||e.opts.i18n.en).PLAY_STOP).removeClass("fancybox-button--play").addClass("fancybox-button--pause"),t.isActive=!0,e.isComplete&&t.set(!0),t.instance.trigger("onSlideShowChange",!0))},stop:function(){var t=this,e=t.instance.current;t.clear(),t.$button.attr("title",(e.opts.i18n[e.opts.lang]||e.opts.i18n.en).PLAY_START).removeClass("fancybox-button--pause").addClass("fancybox-button--play"),t.isActive=!1,t.instance.trigger("onSlideShowChange",!1),t.$progress&&t.$progress.removeAttr("style").hide()},toggle:function(){var t=this;t.isActive?t.stop():t.start()}}),e(t).on({"onInit.fb":function(t,e){e&&!e.SlideShow&&(e.SlideShow=new n(e))},"beforeShow.fb":function(t,e,n,o){var i=e&&e.SlideShow;o?i&&n.opts.slideShow.autoStart&&i.start():i&&i.isActive&&i.clear()},"afterShow.fb":function(t,e,n){var o=e&&e.SlideShow;o&&o.isActive&&o.set()},"afterKeydown.fb":function(n,o,i,a,s){var r=o&&o.SlideShow;!r||!i.opts.slideShow||80!==s&&32!==s||e(t.activeElement).is("button,a,input")||(a.preventDefault(),r.toggle())},"beforeClose.fb onDeactivate.fb":function(t,e){var n=e&&e.SlideShow;n&&n.stop()}}),e(t).on("visibilitychange",function(){var n=e.fancybox.getInstance(),o=n&&n.SlideShow;o&&o.isActive&&(t.hidden?o.clear():o.set())})}(document,jQuery),function(t,e){"use strict";var n=function(){for(var e=[["requestFullscreen","exitFullscreen","fullscreenElement","fullscreenEnabled","fullscreenchange","fullscreenerror"],["webkitRequestFullscreen","webkitExitFullscreen","webkitFullscreenElement","webkitFullscreenEnabled","webkitfullscreenchange","webkitfullscreenerror"],["webkitRequestFullScreen","webkitCancelFullScreen","webkitCurrentFullScreenElement","webkitCancelFullScreen","webkitfullscreenchange","webkitfullscreenerror"],["mozRequestFullScreen","mozCancelFullScreen","mozFullScreenElement","mozFullScreenEnabled","mozfullscreenchange","mozfullscreenerror"],["msRequestFullscreen","msExitFullscreen","msFullscreenElement","msFullscreenEnabled","MSFullscreenChange","MSFullscreenError"]],n={},o=0;o<e.length;o++){var i=e[o];if(i&&i[1]in t){for(var a=0;a<i.length;a++)n[e[0][a]]=i[a];return n}}return!1}();if(n){var o={request:function(e){e=e||t.documentElement,e[n.requestFullscreen](e.ALLOW_KEYBOARD_INPUT)},exit:function(){t[n.exitFullscreen]()},toggle:function(e){e=e||t.documentElement,this.isFullscreen()?this.exit():this.request(e)},isFullscreen:function(){return Boolean(t[n.fullscreenElement])},enabled:function(){return Boolean(t[n.fullscreenEnabled])}};e.extend(!0,e.fancybox.defaults,{btnTpl:{fullScreen:'<button data-fancybox-fullscreen class="fancybox-button fancybox-button--fsenter" title="{{FULL_SCREEN}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M7 14H5v5h5v-2H7v-3zm-2-4h2V7h3V5H5v5zm12 7h-3v2h5v-5h-2v3zM14 5v2h3v3h2V5h-5z"/></svg><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M5 16h3v3h2v-5H5zm3-8H5v2h5V5H8zm6 11h2v-3h3v-2h-5zm2-11V5h-2v5h5V8z"/></svg></button>'},fullScreen:{autoStart:!1}}),e(t).on(n.fullscreenchange,function(){var t=o.isFullscreen(),n=e.fancybox.getInstance();n&&(n.current&&"image"===n.current.type&&n.isAnimating&&(n.isAnimating=!1,n.update(!0,!0,0),n.isComplete||n.complete()),n.trigger("onFullscreenChange",t),n.$refs.container.toggleClass("fancybox-is-fullscreen",t),n.$refs.toolbar.find("[data-fancybox-fullscreen]").toggleClass("fancybox-button--fsenter",!t).toggleClass("fancybox-button--fsexit",t))})}e(t).on({"onInit.fb":function(t,e){var i;if(!n)return void e.$refs.toolbar.find("[data-fancybox-fullscreen]").remove();e&&e.group[e.currIndex].opts.fullScreen?(i=e.$refs.container,i.on("click.fb-fullscreen","[data-fancybox-fullscreen]",function(t){t.stopPropagation(),t.preventDefault(),o.toggle()}),e.opts.fullScreen&&!0===e.opts.fullScreen.autoStart&&o.request(),e.FullScreen=o):e&&e.$refs.toolbar.find("[data-fancybox-fullscreen]").hide()},"afterKeydown.fb":function(t,e,n,o,i){e&&e.FullScreen&&70===i&&(o.preventDefault(),e.FullScreen.toggle())},"beforeClose.fb":function(t,e){e&&e.FullScreen&&e.$refs.container.hasClass("fancybox-is-fullscreen")&&o.exit()}})}(document,jQuery),function(t,e){"use strict";var n="fancybox-thumbs";e.fancybox.defaults=e.extend(!0,{btnTpl:{thumbs:'<button data-fancybox-thumbs class="fancybox-button fancybox-button--thumbs" title="{{THUMBS}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M14.59 14.59h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76H5.65v-3.76zm8.94-4.47h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76H5.65v-3.76zm8.94-4.47h3.76v3.76h-3.76V5.65zm-4.47 0h3.76v3.76h-3.76V5.65zm-4.47 0h3.76v3.76H5.65V5.65z"/></svg></button>'},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:".fancybox-container",axis:"y"}},e.fancybox.defaults);var o=function(t){this.init(t)};e.extend(o.prototype,{$button:null,$grid:null,$list:null,isVisible:!1,isActive:!1,init:function(t){var e=this,n=t.group,o=0;e.instance=t,e.opts=n[t.currIndex].opts.thumbs,t.Thumbs=e,e.$button=t.$refs.toolbar.find("[data-fancybox-thumbs]");for(var i=0,a=n.length;i<a&&(n[i].thumb&&o++,!(o>1));i++);o>1&&e.opts?(e.$button.removeAttr("style").on("click",function(){e.toggle()}),e.isActive=!0):e.$button.hide()},create:function(){var t,o=this,i=o.instance,a=o.opts.parentEl,s=[];o.$grid||(o.$grid=e('<div class="'+n+" "+n+"-"+o.opts.axis+'"></div>').appendTo(i.$refs.container.find(a).addBack().filter(a)),o.$grid.on("click","a",function(){i.jumpTo(e(this).attr("data-index"))})),o.$list||(o.$list=e('<div class="'+n+'__list">').appendTo(o.$grid)),e.each(i.group,function(e,n){t=n.thumb,t||"image"!==n.type||(t=n.src),s.push('<a href="javascript:;" tabindex="0" data-index="'+e+'"'+(t&&t.length?' style="background-image:url('+t+')"':'class="fancybox-thumbs-missing"')+"></a>")}),o.$list[0].innerHTML=s.join(""),"x"===o.opts.axis&&o.$list.width(parseInt(o.$grid.css("padding-right"),10)+i.group.length*o.$list.children().eq(0).outerWidth(!0))},focus:function(t){var e,n,o=this,i=o.$list,a=o.$grid;o.instance.current&&(e=i.children().removeClass("fancybox-thumbs-active").filter('[data-index="'+o.instance.current.index+'"]').addClass("fancybox-thumbs-active"),n=e.position(),"y"===o.opts.axis&&(n.top<0||n.top>i.height()-e.outerHeight())?i.stop().animate({scrollTop:i.scrollTop()+n.top},t):"x"===o.opts.axis&&(n.left<a.scrollLeft()||n.left>a.scrollLeft()+(a.width()-e.outerWidth()))&&i.parent().stop().animate({scrollLeft:n.left},t))},update:function(){var t=this;t.instance.$refs.container.toggleClass("fancybox-show-thumbs",this.isVisible),t.isVisible?(t.$grid||t.create(),t.instance.trigger("onThumbsShow"),t.focus(0)):t.$grid&&t.instance.trigger("onThumbsHide"),t.instance.update()},hide:function(){this.isVisible=!1,this.update()},show:function(){this.isVisible=!0,this.update()},toggle:function(){this.isVisible=!this.isVisible,this.update()}}),e(t).on({"onInit.fb":function(t,e){var n;e&&!e.Thumbs&&(n=new o(e),n.isActive&&!0===n.opts.autoStart&&n.show())},"beforeShow.fb":function(t,e,n,o){var i=e&&e.Thumbs;i&&i.isVisible&&i.focus(o?0:250)},"afterKeydown.fb":function(t,e,n,o,i){var a=e&&e.Thumbs;a&&a.isActive&&71===i&&(o.preventDefault(),a.toggle())},"beforeClose.fb":function(t,e){var n=e&&e.Thumbs;n&&n.isVisible&&!1!==n.opts.hideOnClose&&n.$grid.hide()}})}(document,jQuery),function(t,e){"use strict";function n(t){var e={"&":"&","<":"<",">":">",'"':""","'":"'","/":"/","`":"`","=":"="};return String(t).replace(/[&<>"'`=\/]/g,function(t){return e[t]})}e.extend(!0,e.fancybox.defaults,{btnTpl:{share:'<button data-fancybox-share class="fancybox-button fancybox-button--share" title="{{SHARE}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M2.55 19c1.4-8.4 9.1-9.8 11.9-9.8V5l7 7-7 6.3v-3.5c-2.8 0-10.5 2.1-11.9 4.2z"/></svg></button>'},share:{url:function(t,e){return!t.currentHash&&"inline"!==e.type&&"html"!==e.type&&(e.origSrc||e.src)||window.location},
+tpl:'<div class="fancybox-share"><h1>{{SHARE}}</h1><p><a class="fancybox-share__button fancybox-share__button--fb" href="https://www.facebook.com/sharer/sharer.php?u={{url}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m287 456v-299c0-21 6-35 35-35h38v-63c-7-1-29-3-55-3-54 0-91 33-91 94v306m143-254h-205v72h196" /></svg><span>Facebook</span></a><a class="fancybox-share__button fancybox-share__button--tw" href="https://twitter.com/intent/tweet?url={{url}}&text={{descr}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m456 133c-14 7-31 11-47 13 17-10 30-27 37-46-15 10-34 16-52 20-61-62-157-7-141 75-68-3-129-35-169-85-22 37-11 86 26 109-13 0-26-4-37-9 0 39 28 72 65 80-12 3-25 4-37 2 10 33 41 57 77 57-42 30-77 38-122 34 170 111 378-32 359-208 16-11 30-25 41-42z" /></svg><span>Twitter</span></a><a class="fancybox-share__button fancybox-share__button--pt" href="https://www.pinterest.com/pin/create/button/?url={{url}}&description={{descr}}&media={{media}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m265 56c-109 0-164 78-164 144 0 39 15 74 47 87 5 2 10 0 12-5l4-19c2-6 1-8-3-13-9-11-15-25-15-45 0-58 43-110 113-110 62 0 96 38 96 88 0 67-30 122-73 122-24 0-42-19-36-44 6-29 20-60 20-81 0-19-10-35-31-35-25 0-44 26-44 60 0 21 7 36 7 36l-30 125c-8 37-1 83 0 87 0 3 4 4 5 2 2-3 32-39 42-75l16-64c8 16 31 29 56 29 74 0 124-67 124-157 0-69-58-132-146-132z" fill="#fff"/></svg><span>Pinterest</span></a></p><p><input class="fancybox-share__input" type="text" value="{{url_raw}}" onclick="select()" /></p></div>'}}),e(t).on("click","[data-fancybox-share]",function(){var t,o,i=e.fancybox.getInstance(),a=i.current||null;a&&("function"===e.type(a.opts.share.url)&&(t=a.opts.share.url.apply(a,[i,a])),o=a.opts.share.tpl.replace(/\{\{media\}\}/g,"image"===a.type?encodeURIComponent(a.src):"").replace(/\{\{url\}\}/g,encodeURIComponent(t)).replace(/\{\{url_raw\}\}/g,n(t)).replace(/\{\{descr\}\}/g,i.$caption?encodeURIComponent(i.$caption.text()):""),e.fancybox.open({src:i.translate(i,o),type:"html",opts:{touch:!1,animationEffect:!1,afterLoad:function(t,e){i.$refs.container.one("beforeClose.fb",function(){t.close(null,0)}),e.$content.find(".fancybox-share__button").click(function(){return window.open(this.href,"Share","width=550, height=450"),!1})},mobile:{autoFocus:!1}}}))})}(document,jQuery),function(t,e,n){"use strict";function o(){var e=t.location.hash.substr(1),n=e.split("-"),o=n.length>1&&/^\+?\d+$/.test(n[n.length-1])?parseInt(n.pop(-1),10)||1:1,i=n.join("-");return{hash:e,index:o<1?1:o,gallery:i}}function i(t){""!==t.gallery&&n("[data-fancybox='"+n.escapeSelector(t.gallery)+"']").eq(t.index-1).focus().trigger("click.fb-start")}function a(t){var e,n;return!!t&&(e=t.current?t.current.opts:t.opts,""!==(n=e.hash||(e.$orig?e.$orig.data("fancybox")||e.$orig.data("fancybox-trigger"):""))&&n)}n.escapeSelector||(n.escapeSelector=function(t){return(t+"").replace(/([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g,function(t,e){return e?"\0"===t?"�":t.slice(0,-1)+"\\"+t.charCodeAt(t.length-1).toString(16)+" ":"\\"+t})}),n(function(){!1!==n.fancybox.defaults.hash&&(n(e).on({"onInit.fb":function(t,e){var n,i;!1!==e.group[e.currIndex].opts.hash&&(n=o(),(i=a(e))&&n.gallery&&i==n.gallery&&(e.currIndex=n.index-1))},"beforeShow.fb":function(n,o,i,s){var r;i&&!1!==i.opts.hash&&(r=a(o))&&(o.currentHash=r+(o.group.length>1?"-"+(i.index+1):""),t.location.hash!=="#"+o.currentHash&&(s&&!o.origHash&&(o.origHash=t.location.hash),o.hashTimer&&clearTimeout(o.hashTimer),o.hashTimer=setTimeout(function(){"replaceState"in t.history?(t.history[s?"pushState":"replaceState"]({},e.title,t.location.pathname+t.location.search+"#"+o.currentHash),s&&(o.hasCreatedHistory=!0)):t.location.hash=o.currentHash,o.hashTimer=null},300)))},"beforeClose.fb":function(n,o,i){i&&!1!==i.opts.hash&&(clearTimeout(o.hashTimer),o.currentHash&&o.hasCreatedHistory?t.history.back():o.currentHash&&("replaceState"in t.history?t.history.replaceState({},e.title,t.location.pathname+t.location.search+(o.origHash||"")):t.location.hash=o.origHash),o.currentHash=null)}}),n(t).on("hashchange.fb",function(){var t=o(),e=null;n.each(n(".fancybox-container").get().reverse(),function(t,o){var i=n(o).data("FancyBox");if(i&&i.currentHash)return e=i,!1}),e?e.currentHash===t.gallery+"-"+t.index||1===t.index&&e.currentHash==t.gallery||(e.currentHash=null,e.close()):""!==t.gallery&&i(t)}),setTimeout(function(){n.fancybox.getInstance()||i(o())},50))})}(window,document,jQuery),function(t,e){"use strict";var n=(new Date).getTime();e(t).on({"onInit.fb":function(t,e,o){e.$refs.stage.on("mousewheel DOMMouseScroll wheel MozMousePixelScroll",function(t){var o=e.current,i=(new Date).getTime();e.group.length<2||!1===o.opts.wheel||"auto"===o.opts.wheel&&"image"!==o.type||(t.preventDefault(),t.stopPropagation(),o.$slide.hasClass("fancybox-animated")||(t=t.originalEvent||t,i-n<250||(n=i,e[(-t.deltaY||-t.deltaX||t.wheelDelta||-t.detail)<0?"next":"previous"]())))})}})}(document,jQuery);
\ No newline at end of file
projects / friendica-addons.git / commitdiff