From: Grischa Brockhaus <github@brockha.us>
Date: Thu, 24 Nov 2022 22:48:08 +0000 (+0100)
Subject: AddOn Fancybox
X-Git-Url: https://git.mxchange.org/?a=commitdiff_plain;h=ae28f6ef01347f7a38370aab42d4e959d8a72038;p=friendica-addons.git

AddOn Fancybox

This addon loads all media attachments of a post into a "fancybox" instead of linking directly to the media.
Each post gets its own attachment library, when there are more than one media attached you can scroll through them.
---

diff --git a/fancybox/CHANGELOG.md b/fancybox/CHANGELOG.md
new file mode 100644
index 00000000..60edc635
--- /dev/null
+++ b/fancybox/CHANGELOG.md
@@ -0,0 +1,9 @@
+### Version 1.01
+
+* One gallery for each post
+* All media attached to a post are added to the posts gallery.
+* Loop scrolling: You can step from last media to first and vice versa.
+### Version 1.00
+
+* First test version released.
+* One fancybox per page displaying first media of each post.
\ No newline at end of file
diff --git a/fancybox/README.md b/fancybox/README.md
new file mode 100644
index 00000000..3e342ee9
--- /dev/null
+++ b/fancybox/README.md
@@ -0,0 +1,19 @@
+# Post image gallery using fancybox
+
+Addon author: [Grischa Brockhaus](https://brockha.us)
+
+## Description
+
+This addon loads all media attachments of a post into a "fancybox" instead of linking directly to the media.
+
+Each post gets its own attachment library, when there are more than one media attached you can scroll through them.
+
+## Licenses
+
+### Fancybox Library
+
+This AddOn is using the jQuery library [fancybox](https://github.com/fancyapps/fancybox). 
+
+The fancyBox libryry is licensed under the GPLv3 license for all open source applications. A commercial license is required for all commercial applications (including sites, themes and apps you plan to sell).
+
+[Read more about fancyBox license](https://github.com/fancyapps/fancybox).
\ No newline at end of file
diff --git a/fancybox/asset/fancybox/README.md b/fancybox/asset/fancybox/README.md
new file mode 100644
index 00000000..e32b89e1
--- /dev/null
+++ b/fancybox/asset/fancybox/README.md
@@ -0,0 +1,62 @@
+# fancyBox 3.5.7
+
+jQuery lightbox script for displaying images, videos and more.
+Touch enabled, responsive and fully customizable.
+
+See the [project page](http://fancyapps.com/fancybox/3/) for documentation and a demonstration.
+
+Follow [@thefancyapps](//twitter.com/thefancyapps) for updates.
+
+
+## Quick start
+
+1\.  Add latest jQuery and fancyBox files
+
+```html
+<script src="https://code.jquery.com/jquery-3.3.1.min.js"></script>
+
+<link  href="/path/to/jquery.fancybox.min.css" rel="stylesheet">
+<script src="/path/to/jquery.fancybox.min.js"></script>
+```
+
+
+2\.  Create links
+
+```html
+<a data-fancybox="gallery" href="big_1.jpg">
+    <img src="small_1.jpg">
+</a>
+
+<a data-fancybox="gallery" href="big_2.jpg">
+    <img src="small_2.jpg">
+</a>
+```
+
+
+3\. Enjoy!
+
+
+## License
+
+fancyBox is licensed under the [GPLv3](http://choosealicense.com/licenses/gpl-3.0) license for all open source applications.
+A commercial license is required for all commercial applications (including sites, themes and apps you plan to sell).
+
+[Read more about fancyBox license](http://fancyapps.com/fancybox/3/#license).
+
+## Bugs and feature requests
+
+If you find a bug, please report it [here on Github](https://github.com/fancyapps/fancybox/issues).
+
+Guidelines for bug reports:
+
+1. Use the GitHub issue search — check if the issue has already been reported.
+2. Check if the issue has been fixed — try to reproduce it using the latest master or development branch in the repository.
+3. Isolate the problem — create a reduced test case and a live example. You can use CodePen to fork any demo found on documentation to use it as a template.
+
+A good bug report shouldn't leave others needing to chase you up for more information.
+Please try to be as detailed as possible in your report.
+
+
+Feature requests are welcome. Please look for existing ones and use GitHub's "reactions" feature to vote.
+
+Please do not use the issue tracker for personal support requests - use Stack Overflow ([fancybox-3](http://stackoverflow.com/questions/tagged/fancybox-3) tag) instead.
diff --git a/fancybox/asset/fancybox/fancybox.config.js b/fancybox/asset/fancybox/fancybox.config.js
new file mode 100644
index 00000000..904390d5
--- /dev/null
+++ b/fancybox/asset/fancybox/fancybox.config.js
@@ -0,0 +1,3 @@
+$(document).ready(function() {
+    $.fancybox.defaults.loop = "true";
+});
\ No newline at end of file
diff --git a/fancybox/asset/fancybox/jquery.fancybox.css b/fancybox/asset/fancybox/jquery.fancybox.css
new file mode 100644
index 00000000..16b01254
--- /dev/null
+++ b/fancybox/asset/fancybox/jquery.fancybox.css
@@ -0,0 +1,895 @@
+body.compensate-for-scrollbar {
+    overflow: hidden;
+}
+
+.fancybox-active {
+    height: auto;
+}
+
+.fancybox-is-hidden {
+    left: -9999px;
+    margin: 0;
+    position: absolute !important;
+    top: -9999px;
+    visibility: hidden;
+}
+
+.fancybox-container {
+    -webkit-backface-visibility: hidden;
+    height: 100%;
+    left: 0;
+    outline: none;
+    position: fixed;
+    -webkit-tap-highlight-color: transparent;
+    top: 0;
+    -ms-touch-action: manipulation;
+    touch-action: manipulation;
+    transform: translateZ(0);
+    width: 100%;
+    z-index: 99992;
+}
+
+.fancybox-container * {
+    box-sizing: border-box;
+}
+
+.fancybox-outer,
+.fancybox-inner,
+.fancybox-bg,
+.fancybox-stage {
+    bottom: 0;
+    left: 0;
+    position: absolute;
+    right: 0;
+    top: 0;
+}
+
+.fancybox-outer {
+    -webkit-overflow-scrolling: touch;
+    overflow-y: auto;
+}
+
+.fancybox-bg {
+    background: rgb(30, 30, 30);
+    opacity: 0;
+    transition-duration: inherit;
+    transition-property: opacity;
+    transition-timing-function: cubic-bezier(.47, 0, .74, .71);
+}
+
+.fancybox-is-open .fancybox-bg {
+    opacity: .9;
+    transition-timing-function: cubic-bezier(.22, .61, .36, 1);
+}
+
+.fancybox-infobar,
+.fancybox-toolbar,
+.fancybox-caption,
+.fancybox-navigation .fancybox-button {
+    direction: ltr;
+    opacity: 0;
+    position: absolute;
+    transition: opacity .25s ease, visibility 0s ease .25s;
+    visibility: hidden;
+    z-index: 99997;
+}
+
+.fancybox-show-infobar .fancybox-infobar,
+.fancybox-show-toolbar .fancybox-toolbar,
+.fancybox-show-caption .fancybox-caption,
+.fancybox-show-nav .fancybox-navigation .fancybox-button {
+    opacity: 1;
+    transition: opacity .25s ease 0s, visibility 0s ease 0s;
+    visibility: visible;
+}
+
+.fancybox-infobar {
+    color: #ccc;
+    font-size: 13px;
+    -webkit-font-smoothing: subpixel-antialiased;
+    height: 44px;
+    left: 0;
+    line-height: 44px;
+    min-width: 44px;
+    mix-blend-mode: difference;
+    padding: 0 10px;
+    pointer-events: none;
+    top: 0;
+    -webkit-touch-callout: none;
+    -webkit-user-select: none;
+    -moz-user-select: none;
+    -ms-user-select: none;
+    user-select: none;
+}
+
+.fancybox-toolbar {
+    right: 0;
+    top: 0;
+}
+
+.fancybox-stage {
+    direction: ltr;
+    overflow: visible;
+    transform: translateZ(0);
+    z-index: 99994;
+}
+
+.fancybox-is-open .fancybox-stage {
+    overflow: hidden;
+}
+
+.fancybox-slide {
+    -webkit-backface-visibility: hidden;
+    /* Using without prefix would break IE11 */
+    display: none;
+    height: 100%;
+    left: 0;
+    outline: none;
+    overflow: auto;
+    -webkit-overflow-scrolling: touch;
+    padding: 44px;
+    position: absolute;
+    text-align: center;
+    top: 0;
+    transition-property: transform, opacity;
+    white-space: normal;
+    width: 100%;
+    z-index: 99994;
+}
+
+.fancybox-slide::before {
+    content: '';
+    display: inline-block;
+    font-size: 0;
+    height: 100%;
+    vertical-align: middle;
+    width: 0;
+}
+
+.fancybox-is-sliding .fancybox-slide,
+.fancybox-slide--previous,
+.fancybox-slide--current,
+.fancybox-slide--next {
+    display: block;
+}
+
+.fancybox-slide--image {
+    overflow: hidden;
+    padding: 44px 0;
+}
+
+.fancybox-slide--image::before {
+    display: none;
+}
+
+.fancybox-slide--html {
+    padding: 6px;
+}
+
+.fancybox-content {
+    background: #fff;
+    display: inline-block;
+    margin: 0;
+    max-width: 100%;
+    overflow: auto;
+    -webkit-overflow-scrolling: touch;
+    padding: 44px;
+    position: relative;
+    text-align: left;
+    vertical-align: middle;
+}
+
+.fancybox-slide--image .fancybox-content {
+    animation-timing-function: cubic-bezier(.5, 0, .14, 1);
+    -webkit-backface-visibility: hidden;
+    background: transparent;
+    background-repeat: no-repeat;
+    background-size: 100% 100%;
+    left: 0;
+    max-width: none;
+    overflow: visible;
+    padding: 0;
+    position: absolute;
+    top: 0;
+    -ms-transform-origin: top left;
+    transform-origin: top left;
+    transition-property: transform, opacity;
+    -webkit-user-select: none;
+    -moz-user-select: none;
+    -ms-user-select: none;
+    user-select: none;
+    z-index: 99995;
+}
+
+.fancybox-can-zoomOut .fancybox-content {
+    cursor: zoom-out;
+}
+
+.fancybox-can-zoomIn .fancybox-content {
+    cursor: zoom-in;
+}
+
+.fancybox-can-swipe .fancybox-content,
+.fancybox-can-pan .fancybox-content {
+    cursor: -webkit-grab;
+    cursor: grab;
+}
+
+.fancybox-is-grabbing .fancybox-content {
+    cursor: -webkit-grabbing;
+    cursor: grabbing;
+}
+
+.fancybox-container [data-selectable='true'] {
+    cursor: text;
+}
+
+.fancybox-image,
+.fancybox-spaceball {
+    background: transparent;
+    border: 0;
+    height: 100%;
+    left: 0;
+    margin: 0;
+    max-height: none;
+    max-width: none;
+    padding: 0;
+    position: absolute;
+    top: 0;
+    -webkit-user-select: none;
+    -moz-user-select: none;
+    -ms-user-select: none;
+    user-select: none;
+    width: 100%;
+}
+
+.fancybox-spaceball {
+    z-index: 1;
+}
+
+.fancybox-slide--video .fancybox-content,
+.fancybox-slide--map .fancybox-content,
+.fancybox-slide--pdf .fancybox-content,
+.fancybox-slide--iframe .fancybox-content {
+    height: 100%;
+    overflow: visible;
+    padding: 0;
+    width: 100%;
+}
+
+.fancybox-slide--video .fancybox-content {
+    background: #000;
+}
+
+.fancybox-slide--map .fancybox-content {
+    background: #e5e3df;
+}
+
+.fancybox-slide--iframe .fancybox-content {
+    background: #fff;
+}
+
+.fancybox-video,
+.fancybox-iframe {
+    background: transparent;
+    border: 0;
+    display: block;
+    height: 100%;
+    margin: 0;
+    overflow: hidden;
+    padding: 0;
+    width: 100%;
+}
+
+/* Fix iOS */
+.fancybox-iframe {
+    left: 0;
+    position: absolute;
+    top: 0;
+}
+
+.fancybox-error {
+    background: #fff;
+    cursor: default;
+    max-width: 400px;
+    padding: 40px;
+    width: 100%;
+}
+
+.fancybox-error p {
+    color: #444;
+    font-size: 16px;
+    line-height: 20px;
+    margin: 0;
+    padding: 0;
+}
+
+/* Buttons */
+
+.fancybox-button {
+    background: rgba(30, 30, 30, .6);
+    border: 0;
+    border-radius: 0;
+    box-shadow: none;
+    cursor: pointer;
+    display: inline-block;
+    height: 44px;
+    margin: 0;
+    padding: 10px;
+    position: relative;
+    transition: color .2s;
+    vertical-align: top;
+    visibility: inherit;
+    width: 44px;
+}
+
+.fancybox-button,
+.fancybox-button:visited,
+.fancybox-button:link {
+    color: #ccc;
+}
+
+.fancybox-button:hover {
+    color: #fff;
+}
+
+.fancybox-button:focus {
+    outline: none;
+}
+
+.fancybox-button.fancybox-focus {
+    outline: 1px dotted;
+}
+
+.fancybox-button[disabled],
+.fancybox-button[disabled]:hover {
+    color: #888;
+    cursor: default;
+    outline: none;
+}
+
+/* Fix IE11 */
+.fancybox-button div {
+    height: 100%;
+}
+
+.fancybox-button svg {
+    display: block;
+    height: 100%;
+    overflow: visible;
+    position: relative;
+    width: 100%;
+}
+
+.fancybox-button svg path {
+    fill: currentColor;
+    stroke-width: 0;
+}
+
+.fancybox-button--play svg:nth-child(2),
+.fancybox-button--fsenter svg:nth-child(2) {
+    display: none;
+}
+
+.fancybox-button--pause svg:nth-child(1),
+.fancybox-button--fsexit svg:nth-child(1) {
+    display: none;
+}
+
+.fancybox-progress {
+    background: #ff5268;
+    height: 2px;
+    left: 0;
+    position: absolute;
+    right: 0;
+    top: 0;
+    -ms-transform: scaleX(0);
+    transform: scaleX(0);
+    -ms-transform-origin: 0;
+    transform-origin: 0;
+    transition-property: transform;
+    transition-timing-function: linear;
+    z-index: 99998;
+}
+
+/* Close button on the top right corner of html content */
+
+.fancybox-close-small {
+    background: transparent;
+    border: 0;
+    border-radius: 0;
+    color: #ccc;
+    cursor: pointer;
+    opacity: .8;
+    padding: 8px;
+    position: absolute;
+    right: -12px;
+    top: -44px;
+    z-index: 401;
+}
+
+.fancybox-close-small:hover {
+    color: #fff;
+    opacity: 1;
+}
+
+.fancybox-slide--html .fancybox-close-small {
+    color: currentColor;
+    padding: 10px;
+    right: 0;
+    top: 0;
+}
+
+.fancybox-slide--image.fancybox-is-scaling .fancybox-content {
+    overflow: hidden;
+}
+
+.fancybox-is-scaling .fancybox-close-small,
+.fancybox-is-zoomable.fancybox-can-pan .fancybox-close-small {
+    display: none;
+}
+
+/* Navigation arrows */
+
+.fancybox-navigation .fancybox-button {
+    background-clip: content-box;
+    height: 100px;
+    opacity: 0;
+    position: absolute;
+    top: calc(50% - 50px);
+    width: 70px;
+}
+
+.fancybox-navigation .fancybox-button div {
+    padding: 7px;
+}
+
+.fancybox-navigation .fancybox-button--arrow_left {
+    left: 0;
+    left: env(safe-area-inset-left);
+    padding: 31px 26px 31px 6px;
+}
+
+.fancybox-navigation .fancybox-button--arrow_right {
+    padding: 31px 6px 31px 26px;
+    right: 0;
+    right: env(safe-area-inset-right);
+}
+
+/* Caption */
+
+.fancybox-caption {
+    background: linear-gradient(to top,
+        rgba(0, 0, 0, .85) 0%,
+        rgba(0, 0, 0, .3) 50%,
+        rgba(0, 0, 0, .15) 65%,
+        rgba(0, 0, 0, .075) 75.5%,
+        rgba(0, 0, 0, .037) 82.85%,
+        rgba(0, 0, 0, .019) 88%,
+        rgba(0, 0, 0, 0) 100%);
+    bottom: 0;
+    color: #eee;
+    font-size: 14px;
+    font-weight: 400;
+    left: 0;
+    line-height: 1.5;
+    padding: 75px 44px 25px 44px;
+    pointer-events: none;
+    right: 0;
+    text-align: center;
+    z-index: 99996;
+}
+
+@supports (padding: max(0px)) {
+    .fancybox-caption {
+        padding: 75px max(44px, env(safe-area-inset-right)) max(25px, env(safe-area-inset-bottom)) max(44px, env(safe-area-inset-left));
+    }
+}
+
+.fancybox-caption--separate {
+    margin-top: -50px;
+}
+
+.fancybox-caption__body {
+    max-height: 50vh;
+    overflow: auto;
+    pointer-events: all;
+}
+
+.fancybox-caption a,
+.fancybox-caption a:link,
+.fancybox-caption a:visited {
+    color: #ccc;
+    text-decoration: none;
+}
+
+.fancybox-caption a:hover {
+    color: #fff;
+    text-decoration: underline;
+}
+
+/* Loading indicator */
+
+.fancybox-loading {
+    animation: fancybox-rotate 1s linear infinite;
+    background: transparent;
+    border: 4px solid #888;
+    border-bottom-color: #fff;
+    border-radius: 50%;
+    height: 50px;
+    left: 50%;
+    margin: -25px 0 0 -25px;
+    opacity: .7;
+    padding: 0;
+    position: absolute;
+    top: 50%;
+    width: 50px;
+    z-index: 99999;
+}
+
+@keyframes fancybox-rotate {
+    100% {
+        transform: rotate(360deg);
+    }
+}
+
+/* Transition effects */
+
+.fancybox-animated {
+    transition-timing-function: cubic-bezier(0, 0, .25, 1);
+}
+
+/* transitionEffect: slide */
+
+.fancybox-fx-slide.fancybox-slide--previous {
+    opacity: 0;
+    transform: translate3d(-100%, 0, 0);
+}
+
+.fancybox-fx-slide.fancybox-slide--next {
+    opacity: 0;
+    transform: translate3d(100%, 0, 0);
+}
+
+.fancybox-fx-slide.fancybox-slide--current {
+    opacity: 1;
+    transform: translate3d(0, 0, 0);
+}
+
+/* transitionEffect: fade */
+
+.fancybox-fx-fade.fancybox-slide--previous,
+.fancybox-fx-fade.fancybox-slide--next {
+    opacity: 0;
+    transition-timing-function: cubic-bezier(.19, 1, .22, 1);
+}
+
+.fancybox-fx-fade.fancybox-slide--current {
+    opacity: 1;
+}
+
+/* transitionEffect: zoom-in-out */
+
+.fancybox-fx-zoom-in-out.fancybox-slide--previous {
+    opacity: 0;
+    transform: scale3d(1.5, 1.5, 1.5);
+}
+
+.fancybox-fx-zoom-in-out.fancybox-slide--next {
+    opacity: 0;
+    transform: scale3d(.5, .5, .5);
+}
+
+.fancybox-fx-zoom-in-out.fancybox-slide--current {
+    opacity: 1;
+    transform: scale3d(1, 1, 1);
+}
+
+/* transitionEffect: rotate */
+
+.fancybox-fx-rotate.fancybox-slide--previous {
+    opacity: 0;
+    -ms-transform: rotate(-360deg);
+    transform: rotate(-360deg);
+}
+
+.fancybox-fx-rotate.fancybox-slide--next {
+    opacity: 0;
+    -ms-transform: rotate(360deg);
+    transform: rotate(360deg);
+}
+
+.fancybox-fx-rotate.fancybox-slide--current {
+    opacity: 1;
+    -ms-transform: rotate(0deg);
+    transform: rotate(0deg);
+}
+
+/* transitionEffect: circular */
+
+.fancybox-fx-circular.fancybox-slide--previous {
+    opacity: 0;
+    transform: scale3d(0, 0, 0) translate3d(-100%, 0, 0);
+}
+
+.fancybox-fx-circular.fancybox-slide--next {
+    opacity: 0;
+    transform: scale3d(0, 0, 0) translate3d(100%, 0, 0);
+}
+
+.fancybox-fx-circular.fancybox-slide--current {
+    opacity: 1;
+    transform: scale3d(1, 1, 1) translate3d(0, 0, 0);
+}
+
+/* transitionEffect: tube */
+
+.fancybox-fx-tube.fancybox-slide--previous {
+    transform: translate3d(-100%, 0, 0) scale(.1) skew(-10deg);
+}
+
+.fancybox-fx-tube.fancybox-slide--next {
+    transform: translate3d(100%, 0, 0) scale(.1) skew(10deg);
+}
+
+.fancybox-fx-tube.fancybox-slide--current {
+    transform: translate3d(0, 0, 0) scale(1);
+}
+
+/* Styling for Small-Screen Devices */
+@media all and (max-height: 576px) {
+    .fancybox-slide {
+        padding-left: 6px;
+        padding-right: 6px;
+    }
+
+    .fancybox-slide--image {
+        padding: 6px 0;
+    }
+
+    .fancybox-close-small {
+        right: -6px;
+    }
+
+    .fancybox-slide--image .fancybox-close-small {
+        background: #4e4e4e;
+        color: #f2f4f6;
+        height: 36px;
+        opacity: 1;
+        padding: 6px;
+        right: 0;
+        top: 0;
+        width: 36px;
+    }
+
+    .fancybox-caption {
+        padding-left: 12px;
+        padding-right: 12px;
+    }
+
+    @supports (padding: max(0px)) {
+        .fancybox-caption {
+            padding-left: max(12px, env(safe-area-inset-left));
+            padding-right: max(12px, env(safe-area-inset-right));
+        }
+    }
+}
+/* Share */
+
+.fancybox-share {
+    background: #f4f4f4;
+    border-radius: 3px;
+    max-width: 90%;
+    padding: 30px;
+    text-align: center;
+}
+
+.fancybox-share h1 {
+    color: #222;
+    font-size: 35px;
+    font-weight: 700;
+    margin: 0 0 20px 0;
+}
+
+.fancybox-share p {
+    margin: 0;
+    padding: 0;
+}
+
+.fancybox-share__button {
+    border: 0;
+    border-radius: 3px;
+    display: inline-block;
+    font-size: 14px;
+    font-weight: 700;
+    line-height: 40px;
+    margin: 0 5px 10px 5px;
+    min-width: 130px;
+    padding: 0 15px;
+    text-decoration: none;
+    transition: all .2s;
+    -webkit-user-select: none;
+    -moz-user-select: none;
+    -ms-user-select: none;
+    user-select: none;
+    white-space: nowrap;
+}
+
+.fancybox-share__button:visited,
+.fancybox-share__button:link {
+    color: #fff;
+}
+
+.fancybox-share__button:hover {
+    text-decoration: none;
+}
+
+.fancybox-share__button--fb {
+    background: #3b5998;
+}
+
+.fancybox-share__button--fb:hover {
+    background: #344e86;
+}
+
+.fancybox-share__button--pt {
+    background: #bd081d;
+}
+
+.fancybox-share__button--pt:hover {
+    background: #aa0719;
+}
+
+.fancybox-share__button--tw {
+    background: #1da1f2;
+}
+
+.fancybox-share__button--tw:hover {
+    background: #0d95e8;
+}
+
+.fancybox-share__button svg {
+    height: 25px;
+    margin-right: 7px;
+    position: relative;
+    top: -1px;
+    vertical-align: middle;
+    width: 25px;
+}
+
+.fancybox-share__button svg path {
+    fill: #fff;
+}
+
+.fancybox-share__input {
+    background: transparent;
+    border: 0;
+    border-bottom: 1px solid #d7d7d7;
+    border-radius: 0;
+    color: #5d5b5b;
+    font-size: 14px;
+    margin: 10px 0 0 0;
+    outline: none;
+    padding: 10px 15px;
+    width: 100%;
+}
+/* Thumbs */
+
+.fancybox-thumbs {
+    background: #ddd;
+    bottom: 0;
+    display: none;
+    margin: 0;
+    -webkit-overflow-scrolling: touch;
+    -ms-overflow-style: -ms-autohiding-scrollbar;
+    padding: 2px 2px 4px 2px;
+    position: absolute;
+    right: 0;
+    -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
+    top: 0;
+    width: 212px;
+    z-index: 99995;
+}
+
+.fancybox-thumbs-x {
+    overflow-x: auto;
+    overflow-y: hidden;
+}
+
+.fancybox-show-thumbs .fancybox-thumbs {
+    display: block;
+}
+
+.fancybox-show-thumbs .fancybox-inner {
+    right: 212px;
+}
+
+.fancybox-thumbs__list {
+    font-size: 0;
+    height: 100%;
+    list-style: none;
+    margin: 0;
+    overflow-x: hidden;
+    overflow-y: auto;
+    padding: 0;
+    position: absolute;
+    position: relative;
+    white-space: nowrap;
+    width: 100%;
+}
+
+.fancybox-thumbs-x .fancybox-thumbs__list {
+    overflow: hidden;
+}
+
+.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar {
+    width: 7px;
+}
+
+.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar-track {
+    background: #fff;
+    border-radius: 10px;
+    box-shadow: inset 0 0 6px rgba(0, 0, 0, .3);
+}
+
+.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar-thumb {
+    background: #2a2a2a;
+    border-radius: 10px;
+}
+
+.fancybox-thumbs__list a {
+    -webkit-backface-visibility: hidden;
+    backface-visibility: hidden;
+    background-color: rgba(0, 0, 0, .1);
+    background-position: center center;
+    background-repeat: no-repeat;
+    background-size: cover;
+    cursor: pointer;
+    float: left;
+    height: 75px;
+    margin: 2px;
+    max-height: calc(100% - 8px);
+    max-width: calc(50% - 4px);
+    outline: none;
+    overflow: hidden;
+    padding: 0;
+    position: relative;
+    -webkit-tap-highlight-color: transparent;
+    width: 100px;
+}
+
+.fancybox-thumbs__list a::before {
+    border: 6px solid #ff5268;
+    bottom: 0;
+    content: '';
+    left: 0;
+    opacity: 0;
+    position: absolute;
+    right: 0;
+    top: 0;
+    transition: all .2s cubic-bezier(.25, .46, .45, .94);
+    z-index: 99991;
+}
+
+.fancybox-thumbs__list a:focus::before {
+    opacity: .5;
+}
+
+.fancybox-thumbs__list a.fancybox-thumbs-active::before {
+    opacity: 1;
+}
+
+/* Styling for Small-Screen Devices */
+@media all and (max-width: 576px) {
+    .fancybox-thumbs {
+        width: 110px;
+    }
+
+    .fancybox-show-thumbs .fancybox-inner {
+        right: 110px;
+    }
+
+    .fancybox-thumbs__list a {
+        max-width: calc(100% - 10px);
+    }
+}
\ No newline at end of file
diff --git a/fancybox/asset/fancybox/jquery.fancybox.js b/fancybox/asset/fancybox/jquery.fancybox.js
new file mode 100644
index 00000000..806b2703
--- /dev/null
+++ b/fancybox/asset/fancybox/jquery.fancybox.js
@@ -0,0 +1,5632 @@
+// ==================================================
+// fancyBox v3.5.7
+//
+// Licensed GPLv3 for open source use
+// or fancyBox Commercial License for commercial use
+//
+// http://fancyapps.com/fancybox/
+// Copyright 2019 fancyApps
+//
+// ==================================================
+(function (window, document, $, undefined) {
+  "use strict";
+
+  window.console = window.console || {
+    info: function (stuff) {}
+  };
+
+  // If there's no jQuery, fancyBox can't work
+  // =========================================
+
+  if (!$) {
+    return;
+  }
+
+  // Check if fancyBox is already initialized
+  // ========================================
+
+  if ($.fn.fancybox) {
+    console.info("fancyBox already initialized");
+
+    return;
+  }
+
+  // Private default settings
+  // ========================
+
+  var defaults = {
+    // Close existing modals
+    // Set this to false if you do not need to stack multiple instances
+    closeExisting: false,
+
+    // Enable infinite gallery navigation
+    loop: false,
+
+    // Horizontal space between slides
+    gutter: 50,
+
+    // Enable keyboard navigation
+    keyboard: true,
+
+    // Should allow caption to overlap the content
+    preventCaptionOverlap: true,
+
+    // Should display navigation arrows at the screen edges
+    arrows: true,
+
+    // Should display counter at the top left corner
+    infobar: true,
+
+    // Should display close button (using `btnTpl.smallBtn` template) over the content
+    // Can be true, false, "auto"
+    // If "auto" - will be automatically enabled for "html", "inline" or "ajax" items
+    smallBtn: "auto",
+
+    // Should display toolbar (buttons at the top)
+    // Can be true, false, "auto"
+    // If "auto" - will be automatically hidden if "smallBtn" is enabled
+    toolbar: "auto",
+
+    // What buttons should appear in the top right corner.
+    // Buttons will be created using templates from `btnTpl` option
+    // and they will be placed into toolbar (class="fancybox-toolbar"` element)
+    buttons: [
+      "zoom",
+      //"share",
+      "slideShow",
+      //"fullScreen",
+      //"download",
+      "thumbs",
+      "close"
+    ],
+
+    // Detect "idle" time in seconds
+    idleTime: 3,
+
+    // Disable right-click and use simple image protection for images
+    protect: false,
+
+    // Shortcut to make content "modal" - disable keyboard navigtion, hide buttons, etc
+    modal: false,
+
+    image: {
+      // Wait for images to load before displaying
+      //   true  - wait for image to load and then display;
+      //   false - display thumbnail and load the full-sized image over top,
+      //           requires predefined image dimensions (`data-width` and `data-height` attributes)
+      preload: false
+    },
+
+    ajax: {
+      // Object containing settings for ajax request
+      settings: {
+        // This helps to indicate that request comes from the modal
+        // Feel free to change naming
+        data: {
+          fancybox: true
+        }
+      }
+    },
+
+    iframe: {
+      // Iframe template
+      tpl: '<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" allowfullscreen="allowfullscreen" allow="autoplay; fullscreen" src=""></iframe>',
+
+      // Preload iframe before displaying it
+      // This allows to calculate iframe content width and height
+      // (note: Due to "Same Origin Policy", you can't get cross domain data).
+      preload: true,
+
+      // Custom CSS styling for iframe wrapping element
+      // You can use this to set custom iframe dimensions
+      css: {},
+
+      // Iframe tag attributes
+      attr: {
+        scrolling: "auto"
+      }
+    },
+
+    // For HTML5 video only
+    video: {
+      tpl: '<video class="fancybox-video" controls controlsList="nodownload" poster="{{poster}}">' +
+        '<source src="{{src}}" type="{{format}}" />' +
+        'Sorry, your browser doesn\'t support embedded videos, <a href="{{src}}">download</a> and watch with your favorite video player!' +
+        "</video>",
+      format: "", // custom video format
+      autoStart: true
+    },
+
+    // Default content type if cannot be detected automatically
+    defaultType: "image",
+
+    // Open/close animation type
+    // Possible values:
+    //   false            - disable
+    //   "zoom"           - zoom images from/to thumbnail
+    //   "fade"
+    //   "zoom-in-out"
+    //
+    animationEffect: "zoom",
+
+    // Duration in ms for open/close animation
+    animationDuration: 366,
+
+    // Should image change opacity while zooming
+    // If opacity is "auto", then opacity will be changed if image and thumbnail have different aspect ratios
+    zoomOpacity: "auto",
+
+    // Transition effect between slides
+    //
+    // Possible values:
+    //   false            - disable
+    //   "fade'
+    //   "slide'
+    //   "circular'
+    //   "tube'
+    //   "zoom-in-out'
+    //   "rotate'
+    //
+    transitionEffect: "fade",
+
+    // Duration in ms for transition animation
+    transitionDuration: 366,
+
+    // Custom CSS class for slide element
+    slideClass: "",
+
+    // Custom CSS class for layout
+    baseClass: "",
+
+    // Base template for layout
+    baseTpl: '<div class="fancybox-container" role="dialog" tabindex="-1">' +
+      '<div class="fancybox-bg"></div>' +
+      '<div class="fancybox-inner">' +
+      '<div class="fancybox-infobar"><span data-fancybox-index></span>&nbsp;/&nbsp;<span data-fancybox-count></span></div>' +
+      '<div class="fancybox-toolbar">{{buttons}}</div>' +
+      '<div class="fancybox-navigation">{{arrows}}</div>' +
+      '<div class="fancybox-stage"></div>' +
+      '<div class="fancybox-caption"><div class="fancybox-caption__body"></div></div>' +
+      "</div>" +
+      "</div>",
+
+    // Loading indicator template
+    spinnerTpl: '<div class="fancybox-loading"></div>',
+
+    // Error message template
+    errorTpl: '<div class="fancybox-error"><p>{{ERROR}}</p></div>',
+
+    btnTpl: {
+      download: '<a download data-fancybox-download class="fancybox-button fancybox-button--download" title="{{DOWNLOAD}}" href="javascript:;">' +
+        '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M18.62 17.09V19H5.38v-1.91zm-2.97-6.96L17 11.45l-5 4.87-5-4.87 1.36-1.32 2.68 2.64V5h1.92v7.77z"/></svg>' +
+        "</a>",
+
+      zoom: '<button data-fancybox-zoom class="fancybox-button fancybox-button--zoom" title="{{ZOOM}}">' +
+        '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M18.7 17.3l-3-3a5.9 5.9 0 0 0-.6-7.6 5.9 5.9 0 0 0-8.4 0 5.9 5.9 0 0 0 0 8.4 5.9 5.9 0 0 0 7.7.7l3 3a1 1 0 0 0 1.3 0c.4-.5.4-1 0-1.5zM8.1 13.8a4 4 0 0 1 0-5.7 4 4 0 0 1 5.7 0 4 4 0 0 1 0 5.7 4 4 0 0 1-5.7 0z"/></svg>' +
+        "</button>",
+
+      close: '<button data-fancybox-close class="fancybox-button fancybox-button--close" title="{{CLOSE}}">' +
+        '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M12 10.6L6.6 5.2 5.2 6.6l5.4 5.4-5.4 5.4 1.4 1.4 5.4-5.4 5.4 5.4 1.4-1.4-5.4-5.4 5.4-5.4-1.4-1.4-5.4 5.4z"/></svg>' +
+        "</button>",
+
+      // Arrows
+      arrowLeft: '<button data-fancybox-prev class="fancybox-button fancybox-button--arrow_left" title="{{PREV}}">' +
+        '<div><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M11.28 15.7l-1.34 1.37L5 12l4.94-5.07 1.34 1.38-2.68 2.72H19v1.94H8.6z"/></svg></div>' +
+        "</button>",
+
+      arrowRight: '<button data-fancybox-next class="fancybox-button fancybox-button--arrow_right" title="{{NEXT}}">' +
+        '<div><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M15.4 12.97l-2.68 2.72 1.34 1.38L19 12l-4.94-5.07-1.34 1.38 2.68 2.72H5v1.94z"/></svg></div>' +
+        "</button>",
+
+      // This small close button will be appended to your html/inline/ajax content by default,
+      // if "smallBtn" option is not set to false
+      smallBtn: '<button type="button" data-fancybox-close class="fancybox-button fancybox-close-small" title="{{CLOSE}}">' +
+        '<svg xmlns="http://www.w3.org/2000/svg" version="1" viewBox="0 0 24 24"><path d="M13 12l5-5-1-1-5 5-5-5-1 1 5 5-5 5 1 1 5-5 5 5 1-1z"/></svg>' +
+        "</button>"
+    },
+
+    // Container is injected into this element
+    parentEl: "body",
+
+    // Hide browser vertical scrollbars; use at your own risk
+    hideScrollbar: true,
+
+    // Focus handling
+    // ==============
+
+    // Try to focus on the first focusable element after opening
+    autoFocus: true,
+
+    // Put focus back to active element after closing
+    backFocus: true,
+
+    // Do not let user to focus on element outside modal content
+    trapFocus: true,
+
+    // Module specific options
+    // =======================
+
+    fullScreen: {
+      autoStart: false
+    },
+
+    // Set `touch: false` to disable panning/swiping
+    touch: {
+      vertical: true, // Allow to drag content vertically
+      momentum: true // Continue movement after releasing mouse/touch when panning
+    },
+
+    // Hash value when initializing manually,
+    // set `false` to disable hash change
+    hash: null,
+
+    // Customize or add new media types
+    // Example:
+    /*
+      media : {
+        youtube : {
+          params : {
+            autoplay : 0
+          }
+        }
+      }
+    */
+    media: {},
+
+    slideShow: {
+      autoStart: false,
+      speed: 3000
+    },
+
+    thumbs: {
+      autoStart: false, // Display thumbnails on opening
+      hideOnClose: true, // Hide thumbnail grid when closing animation starts
+      parentEl: ".fancybox-container", // Container is injected into this element
+      axis: "y" // Vertical (y) or horizontal (x) scrolling
+    },
+
+    // Use mousewheel to navigate gallery
+    // If 'auto' - enabled for images only
+    wheel: "auto",
+
+    // Callbacks
+    //==========
+
+    // See Documentation/API/Events for more information
+    // Example:
+    /*
+      afterShow: function( instance, current ) {
+        console.info( 'Clicked element:' );
+        console.info( current.opts.$orig );
+      }
+    */
+
+    onInit: $.noop, // When instance has been initialized
+
+    beforeLoad: $.noop, // Before the content of a slide is being loaded
+    afterLoad: $.noop, // When the content of a slide is done loading
+
+    beforeShow: $.noop, // Before open animation starts
+    afterShow: $.noop, // When content is done loading and animating
+
+    beforeClose: $.noop, // Before the instance attempts to close. Return false to cancel the close.
+    afterClose: $.noop, // After instance has been closed
+
+    onActivate: $.noop, // When instance is brought to front
+    onDeactivate: $.noop, // When other instance has been activated
+
+    // Interaction
+    // ===========
+
+    // Use options below to customize taken action when user clicks or double clicks on the fancyBox area,
+    // each option can be string or method that returns value.
+    //
+    // Possible values:
+    //   "close"           - close instance
+    //   "next"            - move to next gallery item
+    //   "nextOrClose"     - move to next gallery item or close if gallery has only one item
+    //   "toggleControls"  - show/hide controls
+    //   "zoom"            - zoom image (if loaded)
+    //   false             - do nothing
+
+    // Clicked on the content
+    clickContent: function (current, event) {
+      return current.type === "image" ? "zoom" : false;
+    },
+
+    // Clicked on the slide
+    clickSlide: "close",
+
+    // Clicked on the background (backdrop) element;
+    // if you have not changed the layout, then most likely you need to use `clickSlide` option
+    clickOutside: "close",
+
+    // Same as previous two, but for double click
+    dblclickContent: false,
+    dblclickSlide: false,
+    dblclickOutside: false,
+
+    // Custom options when mobile device is detected
+    // =============================================
+
+    mobile: {
+      preventCaptionOverlap: false,
+      idleTime: false,
+      clickContent: function (current, event) {
+        return current.type === "image" ? "toggleControls" : false;
+      },
+      clickSlide: function (current, event) {
+        return current.type === "image" ? "toggleControls" : "close";
+      },
+      dblclickContent: function (current, event) {
+        return current.type === "image" ? "zoom" : false;
+      },
+      dblclickSlide: function (current, event) {
+        return current.type === "image" ? "zoom" : false;
+      }
+    },
+
+    // Internationalization
+    // ====================
+
+    lang: "en",
+    i18n: {
+      en: {
+        CLOSE: "Close",
+        NEXT: "Next",
+        PREV: "Previous",
+        ERROR: "The requested content cannot be loaded. <br/> Please try again later.",
+        PLAY_START: "Start slideshow",
+        PLAY_STOP: "Pause slideshow",
+        FULL_SCREEN: "Full screen",
+        THUMBS: "Thumbnails",
+        DOWNLOAD: "Download",
+        SHARE: "Share",
+        ZOOM: "Zoom"
+      },
+      de: {
+        CLOSE: "Schlie&szlig;en",
+        NEXT: "Weiter",
+        PREV: "Zur&uuml;ck",
+        ERROR: "Die angeforderten Daten konnten nicht geladen werden. <br/> Bitte versuchen Sie es sp&auml;ter nochmal.",
+        PLAY_START: "Diaschau starten",
+        PLAY_STOP: "Diaschau beenden",
+        FULL_SCREEN: "Vollbild",
+        THUMBS: "Vorschaubilder",
+        DOWNLOAD: "Herunterladen",
+        SHARE: "Teilen",
+        ZOOM: "Vergr&ouml;&szlig;ern"
+      }
+    }
+  };
+
+  // Few useful variables and methods
+  // ================================
+
+  var $W = $(window);
+  var $D = $(document);
+
+  var called = 0;
+
+  // Check if an object is a jQuery object and not a native JavaScript object
+  // ========================================================================
+  var isQuery = function (obj) {
+    return obj && obj.hasOwnProperty && obj instanceof $;
+  };
+
+  // Handle multiple browsers for "requestAnimationFrame" and "cancelAnimationFrame"
+  // ===============================================================================
+  var requestAFrame = (function () {
+    return (
+      window.requestAnimationFrame ||
+      window.webkitRequestAnimationFrame ||
+      window.mozRequestAnimationFrame ||
+      window.oRequestAnimationFrame ||
+      // if all else fails, use setTimeout
+      function (callback) {
+        return window.setTimeout(callback, 1000 / 60);
+      }
+    );
+  })();
+
+  var cancelAFrame = (function () {
+    return (
+      window.cancelAnimationFrame ||
+      window.webkitCancelAnimationFrame ||
+      window.mozCancelAnimationFrame ||
+      window.oCancelAnimationFrame ||
+      function (id) {
+        window.clearTimeout(id);
+      }
+    );
+  })();
+
+  // Detect the supported transition-end event property name
+  // =======================================================
+  var transitionEnd = (function () {
+    var el = document.createElement("fakeelement"),
+      t;
+
+    var transitions = {
+      transition: "transitionend",
+      OTransition: "oTransitionEnd",
+      MozTransition: "transitionend",
+      WebkitTransition: "webkitTransitionEnd"
+    };
+
+    for (t in transitions) {
+      if (el.style[t] !== undefined) {
+        return transitions[t];
+      }
+    }
+
+    return "transitionend";
+  })();
+
+  // Force redraw on an element.
+  // This helps in cases where the browser doesn't redraw an updated element properly
+  // ================================================================================
+  var forceRedraw = function ($el) {
+    return $el && $el.length && $el[0].offsetHeight;
+  };
+
+  // Exclude array (`buttons`) options from deep merging
+  // ===================================================
+  var mergeOpts = function (opts1, opts2) {
+    var rez = $.extend(true, {}, opts1, opts2);
+
+    $.each(opts2, function (key, value) {
+      if ($.isArray(value)) {
+        rez[key] = value;
+      }
+    });
+
+    return rez;
+  };
+
+  // How much of an element is visible in viewport
+  // =============================================
+
+  var inViewport = function (elem) {
+    var elemCenter, rez;
+
+    if (!elem || elem.ownerDocument !== document) {
+      return false;
+    }
+
+    $(".fancybox-container").css("pointer-events", "none");
+
+    elemCenter = {
+      x: elem.getBoundingClientRect().left + elem.offsetWidth / 2,
+      y: elem.getBoundingClientRect().top + elem.offsetHeight / 2
+    };
+
+    rez = document.elementFromPoint(elemCenter.x, elemCenter.y) === elem;
+
+    $(".fancybox-container").css("pointer-events", "");
+
+    return rez;
+  };
+
+  // Class definition
+  // ================
+
+  var FancyBox = function (content, opts, index) {
+    var self = this;
+
+    self.opts = mergeOpts({
+      index: index
+    }, $.fancybox.defaults);
+
+    if ($.isPlainObject(opts)) {
+      self.opts = mergeOpts(self.opts, opts);
+    }
+
+    if ($.fancybox.isMobile) {
+      self.opts = mergeOpts(self.opts, self.opts.mobile);
+    }
+
+    self.id = self.opts.id || ++called;
+
+    self.currIndex = parseInt(self.opts.index, 10) || 0;
+    self.prevIndex = null;
+
+    self.prevPos = null;
+    self.currPos = 0;
+
+    self.firstRun = true;
+
+    // All group items
+    self.group = [];
+
+    // Existing slides (for current, next and previous gallery items)
+    self.slides = {};
+
+    // Create group elements
+    self.addContent(content);
+
+    if (!self.group.length) {
+      return;
+    }
+
+    self.init();
+  };
+
+  $.extend(FancyBox.prototype, {
+    // Create DOM structure
+    // ====================
+
+    init: function () {
+      var self = this,
+        firstItem = self.group[self.currIndex],
+        firstItemOpts = firstItem.opts,
+        $container,
+        buttonStr;
+
+      if (firstItemOpts.closeExisting) {
+        $.fancybox.close(true);
+      }
+
+      // Hide scrollbars
+      // ===============
+
+      $("body").addClass("fancybox-active");
+
+      if (
+        !$.fancybox.getInstance() &&
+        firstItemOpts.hideScrollbar !== false &&
+        !$.fancybox.isMobile &&
+        document.body.scrollHeight > window.innerHeight
+      ) {
+        $("head").append(
+          '<style id="fancybox-style-noscroll" type="text/css">.compensate-for-scrollbar{margin-right:' +
+          (window.innerWidth - document.documentElement.clientWidth) +
+          "px;}</style>"
+        );
+
+        $("body").addClass("compensate-for-scrollbar");
+      }
+
+      // Build html markup and set references
+      // ====================================
+
+      // Build html code for buttons and insert into main template
+      buttonStr = "";
+
+      $.each(firstItemOpts.buttons, function (index, value) {
+        buttonStr += firstItemOpts.btnTpl[value] || "";
+      });
+
+      // Create markup from base template, it will be initially hidden to
+      // avoid unnecessary work like painting while initializing is not complete
+      $container = $(
+          self.translate(
+            self,
+            firstItemOpts.baseTpl
+            .replace("{{buttons}}", buttonStr)
+            .replace("{{arrows}}", firstItemOpts.btnTpl.arrowLeft + firstItemOpts.btnTpl.arrowRight)
+          )
+        )
+        .attr("id", "fancybox-container-" + self.id)
+        .addClass(firstItemOpts.baseClass)
+        .data("FancyBox", self)
+        .appendTo(firstItemOpts.parentEl);
+
+      // Create object holding references to jQuery wrapped nodes
+      self.$refs = {
+        container: $container
+      };
+
+      ["bg", "inner", "infobar", "toolbar", "stage", "caption", "navigation"].forEach(function (item) {
+        self.$refs[item] = $container.find(".fancybox-" + item);
+      });
+
+      self.trigger("onInit");
+
+      // Enable events, deactive previous instances
+      self.activate();
+
+      // Build slides, load and reveal content
+      self.jumpTo(self.currIndex);
+    },
+
+    // Simple i18n support - replaces object keys found in template
+    // with corresponding values
+    // ============================================================
+
+    translate: function (obj, str) {
+      var arr = obj.opts.i18n[obj.opts.lang] || obj.opts.i18n.en;
+
+      return str.replace(/\{\{(\w+)\}\}/g, function (match, n) {
+        return arr[n] === undefined ? match : arr[n];
+      });
+    },
+
+    // Populate current group with fresh content
+    // Check if each object has valid type and content
+    // ===============================================
+
+    addContent: function (content) {
+      var self = this,
+        items = $.makeArray(content),
+        thumbs;
+
+      $.each(items, function (i, item) {
+        var obj = {},
+          opts = {},
+          $item,
+          type,
+          found,
+          src,
+          srcParts;
+
+        // Step 1 - Make sure we have an object
+        // ====================================
+
+        if ($.isPlainObject(item)) {
+          // We probably have manual usage here, something like
+          // $.fancybox.open( [ { src : "image.jpg", type : "image" } ] )
+
+          obj = item;
+          opts = item.opts || item;
+        } else if ($.type(item) === "object" && $(item).length) {
+          // Here we probably have jQuery collection returned by some selector
+          $item = $(item);
+
+          // Support attributes like `data-options='{"touch" : false}'` and `data-touch='false'`
+          opts = $item.data() || {};
+          opts = $.extend(true, {}, opts, opts.options);
+
+          // Here we store clicked element
+          opts.$orig = $item;
+
+          obj.src = self.opts.src || opts.src || $item.attr("href");
+
+          // Assume that simple syntax is used, for example:
+          //   `$.fancybox.open( $("#test"), {} );`
+          if (!obj.type && !obj.src) {
+            obj.type = "inline";
+            obj.src = item;
+          }
+        } else {
+          // Assume we have a simple html code, for example:
+          //   $.fancybox.open( '<div><h1>Hi!</h1></div>' );
+          obj = {
+            type: "html",
+            src: item + ""
+          };
+        }
+
+        // Each gallery object has full collection of options
+        obj.opts = $.extend(true, {}, self.opts, opts);
+
+        // Do not merge buttons array
+        if ($.isArray(opts.buttons)) {
+          obj.opts.buttons = opts.buttons;
+        }
+
+        if ($.fancybox.isMobile && obj.opts.mobile) {
+          obj.opts = mergeOpts(obj.opts, obj.opts.mobile);
+        }
+
+        // Step 2 - Make sure we have content type, if not - try to guess
+        // ==============================================================
+
+        type = obj.type || obj.opts.type;
+        src = obj.src || "";
+
+        if (!type && src) {
+          if ((found = src.match(/\.(mp4|mov|ogv|webm)((\?|#).*)?$/i))) {
+            type = "video";
+
+            if (!obj.opts.video.format) {
+              obj.opts.video.format = "video/" + (found[1] === "ogv" ? "ogg" : found[1]);
+            }
+          } else if (src.match(/(^data:image\/[a-z0-9+\/=]*,)|(\.(jp(e|g|eg)|gif|png|bmp|webp|svg|ico)((\?|#).*)?$)/i)) {
+            type = "image";
+          } else if (src.match(/\.(pdf)((\?|#).*)?$/i)) {
+            type = "iframe";
+            obj = $.extend(true, obj, {
+              contentType: "pdf",
+              opts: {
+                iframe: {
+                  preload: false
+                }
+              }
+            });
+          } else if (src.charAt(0) === "#") {
+            type = "inline";
+          }
+        }
+
+        if (type) {
+          obj.type = type;
+        } else {
+          self.trigger("objectNeedsType", obj);
+        }
+
+        if (!obj.contentType) {
+          obj.contentType = $.inArray(obj.type, ["html", "inline", "ajax"]) > -1 ? "html" : obj.type;
+        }
+
+        // Step 3 - Some adjustments
+        // =========================
+
+        obj.index = self.group.length;
+
+        if (obj.opts.smallBtn == "auto") {
+          obj.opts.smallBtn = $.inArray(obj.type, ["html", "inline", "ajax"]) > -1;
+        }
+
+        if (obj.opts.toolbar === "auto") {
+          obj.opts.toolbar = !obj.opts.smallBtn;
+        }
+
+        // Find thumbnail image, check if exists and if is in the viewport
+        obj.$thumb = obj.opts.$thumb || null;
+
+        if (obj.opts.$trigger && obj.index === self.opts.index) {
+          obj.$thumb = obj.opts.$trigger.find("img:first");
+
+          if (obj.$thumb.length) {
+            obj.opts.$orig = obj.opts.$trigger;
+          }
+        }
+
+        if (!(obj.$thumb && obj.$thumb.length) && obj.opts.$orig) {
+          obj.$thumb = obj.opts.$orig.find("img:first");
+        }
+
+        if (obj.$thumb && !obj.$thumb.length) {
+          obj.$thumb = null;
+        }
+
+        obj.thumb = obj.opts.thumb || (obj.$thumb ? obj.$thumb[0].src : null);
+
+        // "caption" is a "special" option, it can be used to customize caption per gallery item
+        if ($.type(obj.opts.caption) === "function") {
+          obj.opts.caption = obj.opts.caption.apply(item, [self, obj]);
+        }
+
+        if ($.type(self.opts.caption) === "function") {
+          obj.opts.caption = self.opts.caption.apply(item, [self, obj]);
+        }
+
+        // Make sure we have caption as a string or jQuery object
+        if (!(obj.opts.caption instanceof $)) {
+          obj.opts.caption = obj.opts.caption === undefined ? "" : obj.opts.caption + "";
+        }
+
+        // Check if url contains "filter" used to filter the content
+        // Example: "ajax.html #something"
+        if (obj.type === "ajax") {
+          srcParts = src.split(/\s+/, 2);
+
+          if (srcParts.length > 1) {
+            obj.src = srcParts.shift();
+
+            obj.opts.filter = srcParts.shift();
+          }
+        }
+
+        // Hide all buttons and disable interactivity for modal items
+        if (obj.opts.modal) {
+          obj.opts = $.extend(true, obj.opts, {
+            trapFocus: true,
+            // Remove buttons
+            infobar: 0,
+            toolbar: 0,
+
+            smallBtn: 0,
+
+            // Disable keyboard navigation
+            keyboard: 0,
+
+            // Disable some modules
+            slideShow: 0,
+            fullScreen: 0,
+            thumbs: 0,
+            touch: 0,
+
+            // Disable click event handlers
+            clickContent: false,
+            clickSlide: false,
+            clickOutside: false,
+            dblclickContent: false,
+            dblclickSlide: false,
+            dblclickOutside: false
+          });
+        }
+
+        // Step 4 - Add processed object to group
+        // ======================================
+
+        self.group.push(obj);
+      });
+
+      // Update controls if gallery is already opened
+      if (Object.keys(self.slides).length) {
+        self.updateControls();
+
+        // Update thumbnails, if needed
+        thumbs = self.Thumbs;
+
+        if (thumbs && thumbs.isActive) {
+          thumbs.create();
+
+          thumbs.focus();
+        }
+      }
+    },
+
+    // Attach an event handler functions for:
+    //   - navigation buttons
+    //   - browser scrolling, resizing;
+    //   - focusing
+    //   - keyboard
+    //   - detecting inactivity
+    // ======================================
+
+    addEvents: function () {
+      var self = this;
+
+      self.removeEvents();
+
+      // Make navigation elements clickable
+      // ==================================
+
+      self.$refs.container
+        .on("click.fb-close", "[data-fancybox-close]", function (e) {
+          e.stopPropagation();
+          e.preventDefault();
+
+          self.close(e);
+        })
+        .on("touchstart.fb-prev click.fb-prev", "[data-fancybox-prev]", function (e) {
+          e.stopPropagation();
+          e.preventDefault();
+
+          self.previous();
+        })
+        .on("touchstart.fb-next click.fb-next", "[data-fancybox-next]", function (e) {
+          e.stopPropagation();
+          e.preventDefault();
+
+          self.next();
+        })
+        .on("click.fb", "[data-fancybox-zoom]", function (e) {
+          // Click handler for zoom button
+          self[self.isScaledDown() ? "scaleToActual" : "scaleToFit"]();
+        });
+
+      // Handle page scrolling and browser resizing
+      // ==========================================
+
+      $W.on("orientationchange.fb resize.fb", function (e) {
+        if (e && e.originalEvent && e.originalEvent.type === "resize") {
+          if (self.requestId) {
+            cancelAFrame(self.requestId);
+          }
+
+          self.requestId = requestAFrame(function () {
+            self.update(e);
+          });
+        } else {
+          if (self.current && self.current.type === "iframe") {
+            self.$refs.stage.hide();
+          }
+
+          setTimeout(
+            function () {
+              self.$refs.stage.show();
+
+              self.update(e);
+            },
+            $.fancybox.isMobile ? 600 : 250
+          );
+        }
+      });
+
+      $D.on("keydown.fb", function (e) {
+        var instance = $.fancybox ? $.fancybox.getInstance() : null,
+          current = instance.current,
+          keycode = e.keyCode || e.which;
+
+        // Trap keyboard focus inside of the modal
+        // =======================================
+
+        if (keycode == 9) {
+          if (current.opts.trapFocus) {
+            self.focus(e);
+          }
+
+          return;
+        }
+
+        // Enable keyboard navigation
+        // ==========================
+
+        if (!current.opts.keyboard || e.ctrlKey || e.altKey || e.shiftKey || $(e.target).is("input,textarea,video,audio,select")) {
+          return;
+        }
+
+        // Backspace and Esc keys
+        if (keycode === 8 || keycode === 27) {
+          e.preventDefault();
+
+          self.close(e);
+
+          return;
+        }
+
+        // Left arrow and Up arrow
+        if (keycode === 37 || keycode === 38) {
+          e.preventDefault();
+
+          self.previous();
+
+          return;
+        }
+
+        // Righ arrow and Down arrow
+        if (keycode === 39 || keycode === 40) {
+          e.preventDefault();
+
+          self.next();
+
+          return;
+        }
+
+        self.trigger("afterKeydown", e, keycode);
+      });
+
+      // Hide controls after some inactivity period
+      if (self.group[self.currIndex].opts.idleTime) {
+        self.idleSecondsCounter = 0;
+
+        $D.on(
+          "mousemove.fb-idle mouseleave.fb-idle mousedown.fb-idle touchstart.fb-idle touchmove.fb-idle scroll.fb-idle keydown.fb-idle",
+          function (e) {
+            self.idleSecondsCounter = 0;
+
+            if (self.isIdle) {
+              self.showControls();
+            }
+
+            self.isIdle = false;
+          }
+        );
+
+        self.idleInterval = window.setInterval(function () {
+          self.idleSecondsCounter++;
+
+          if (self.idleSecondsCounter >= self.group[self.currIndex].opts.idleTime && !self.isDragging) {
+            self.isIdle = true;
+            self.idleSecondsCounter = 0;
+
+            self.hideControls();
+          }
+        }, 1000);
+      }
+    },
+
+    // Remove events added by the core
+    // ===============================
+
+    removeEvents: function () {
+      var self = this;
+
+      $W.off("orientationchange.fb resize.fb");
+      $D.off("keydown.fb .fb-idle");
+
+      this.$refs.container.off(".fb-close .fb-prev .fb-next");
+
+      if (self.idleInterval) {
+        window.clearInterval(self.idleInterval);
+
+        self.idleInterval = null;
+      }
+    },
+
+    // Change to previous gallery item
+    // ===============================
+
+    previous: function (duration) {
+      return this.jumpTo(this.currPos - 1, duration);
+    },
+
+    // Change to next gallery item
+    // ===========================
+
+    next: function (duration) {
+      return this.jumpTo(this.currPos + 1, duration);
+    },
+
+    // Switch to selected gallery item
+    // ===============================
+
+    jumpTo: function (pos, duration) {
+      var self = this,
+        groupLen = self.group.length,
+        firstRun,
+        isMoved,
+        loop,
+        current,
+        previous,
+        slidePos,
+        stagePos,
+        prop,
+        diff;
+
+      if (self.isDragging || self.isClosing || (self.isAnimating && self.firstRun)) {
+        return;
+      }
+
+      // Should loop?
+      pos = parseInt(pos, 10);
+      loop = self.current ? self.current.opts.loop : self.opts.loop;
+
+      if (!loop && (pos < 0 || pos >= groupLen)) {
+        return false;
+      }
+
+      // Check if opening for the first time; this helps to speed things up
+      firstRun = self.firstRun = !Object.keys(self.slides).length;
+
+      // Create slides
+      previous = self.current;
+
+      self.prevIndex = self.currIndex;
+      self.prevPos = self.currPos;
+
+      current = self.createSlide(pos);
+
+      if (groupLen > 1) {
+        if (loop || current.index < groupLen - 1) {
+          self.createSlide(pos + 1);
+        }
+
+        if (loop || current.index > 0) {
+          self.createSlide(pos - 1);
+        }
+      }
+
+      self.current = current;
+      self.currIndex = current.index;
+      self.currPos = current.pos;
+
+      self.trigger("beforeShow", firstRun);
+
+      self.updateControls();
+
+      // Validate duration length
+      current.forcedDuration = undefined;
+
+      if ($.isNumeric(duration)) {
+        current.forcedDuration = duration;
+      } else {
+        duration = current.opts[firstRun ? "animationDuration" : "transitionDuration"];
+      }
+
+      duration = parseInt(duration, 10);
+
+      // Check if user has swiped the slides or if still animating
+      isMoved = self.isMoved(current);
+
+      // Make sure current slide is visible
+      current.$slide.addClass("fancybox-slide--current");
+
+      // Fresh start - reveal container, current slide and start loading content
+      if (firstRun) {
+        if (current.opts.animationEffect && duration) {
+          self.$refs.container.css("transition-duration", duration + "ms");
+        }
+
+        self.$refs.container.addClass("fancybox-is-open").trigger("focus");
+
+        // Attempt to load content into slide
+        // This will later call `afterLoad` -> `revealContent`
+        self.loadSlide(current);
+
+        self.preload("image");
+
+        return;
+      }
+
+      // Get actual slide/stage positions (before cleaning up)
+      slidePos = $.fancybox.getTranslate(previous.$slide);
+      stagePos = $.fancybox.getTranslate(self.$refs.stage);
+
+      // Clean up all slides
+      $.each(self.slides, function (index, slide) {
+        $.fancybox.stop(slide.$slide, true);
+      });
+
+      if (previous.pos !== current.pos) {
+        previous.isComplete = false;
+      }
+
+      previous.$slide.removeClass("fancybox-slide--complete fancybox-slide--current");
+
+      // If slides are out of place, then animate them to correct position
+      if (isMoved) {
+        // Calculate horizontal swipe distance
+        diff = slidePos.left - (previous.pos * slidePos.width + previous.pos * previous.opts.gutter);
+
+        $.each(self.slides, function (index, slide) {
+          slide.$slide.removeClass("fancybox-animated").removeClass(function (index, className) {
+            return (className.match(/(^|\s)fancybox-fx-\S+/g) || []).join(" ");
+          });
+
+          // Make sure that each slide is in equal distance
+          // This is mostly needed for freshly added slides, because they are not yet positioned
+          var leftPos = slide.pos * slidePos.width + slide.pos * slide.opts.gutter;
+
+          $.fancybox.setTranslate(slide.$slide, {
+            top: 0,
+            left: leftPos - stagePos.left + diff
+          });
+
+          if (slide.pos !== current.pos) {
+            slide.$slide.addClass("fancybox-slide--" + (slide.pos > current.pos ? "next" : "previous"));
+          }
+
+          // Redraw to make sure that transition will start
+          forceRedraw(slide.$slide);
+
+          // Animate the slide
+          $.fancybox.animate(
+            slide.$slide, {
+              top: 0,
+              left: (slide.pos - current.pos) * slidePos.width + (slide.pos - current.pos) * slide.opts.gutter
+            },
+            duration,
+            function () {
+              slide.$slide
+                .css({
+                  transform: "",
+                  opacity: ""
+                })
+                .removeClass("fancybox-slide--next fancybox-slide--previous");
+
+              if (slide.pos === self.currPos) {
+                self.complete();
+              }
+            }
+          );
+        });
+      } else if (duration && current.opts.transitionEffect) {
+        // Set transition effect for previously active slide
+        prop = "fancybox-animated fancybox-fx-" + current.opts.transitionEffect;
+
+        previous.$slide.addClass("fancybox-slide--" + (previous.pos > current.pos ? "next" : "previous"));
+
+        $.fancybox.animate(
+          previous.$slide,
+          prop,
+          duration,
+          function () {
+            previous.$slide.removeClass(prop).removeClass("fancybox-slide--next fancybox-slide--previous");
+          },
+          false
+        );
+      }
+
+      if (current.isLoaded) {
+        self.revealContent(current);
+      } else {
+        self.loadSlide(current);
+      }
+
+      self.preload("image");
+    },
+
+    // Create new "slide" element
+    // These are gallery items  that are actually added to DOM
+    // =======================================================
+
+    createSlide: function (pos) {
+      var self = this,
+        $slide,
+        index;
+
+      index = pos % self.group.length;
+      index = index < 0 ? self.group.length + index : index;
+
+      if (!self.slides[pos] && self.group[index]) {
+        $slide = $('<div class="fancybox-slide"></div>').appendTo(self.$refs.stage);
+
+        self.slides[pos] = $.extend(true, {}, self.group[index], {
+          pos: pos,
+          $slide: $slide,
+          isLoaded: false
+        });
+
+        self.updateSlide(self.slides[pos]);
+      }
+
+      return self.slides[pos];
+    },
+
+    // Scale image to the actual size of the image;
+    // x and y values should be relative to the slide
+    // ==============================================
+
+    scaleToActual: function (x, y, duration) {
+      var self = this,
+        current = self.current,
+        $content = current.$content,
+        canvasWidth = $.fancybox.getTranslate(current.$slide).width,
+        canvasHeight = $.fancybox.getTranslate(current.$slide).height,
+        newImgWidth = current.width,
+        newImgHeight = current.height,
+        imgPos,
+        posX,
+        posY,
+        scaleX,
+        scaleY;
+
+      if (self.isAnimating || self.isMoved() || !$content || !(current.type == "image" && current.isLoaded && !current.hasError)) {
+        return;
+      }
+
+      self.isAnimating = true;
+
+      $.fancybox.stop($content);
+
+      x = x === undefined ? canvasWidth * 0.5 : x;
+      y = y === undefined ? canvasHeight * 0.5 : y;
+
+      imgPos = $.fancybox.getTranslate($content);
+
+      imgPos.top -= $.fancybox.getTranslate(current.$slide).top;
+      imgPos.left -= $.fancybox.getTranslate(current.$slide).left;
+
+      scaleX = newImgWidth / imgPos.width;
+      scaleY = newImgHeight / imgPos.height;
+
+      // Get center position for original image
+      posX = canvasWidth * 0.5 - newImgWidth * 0.5;
+      posY = canvasHeight * 0.5 - newImgHeight * 0.5;
+
+      // Make sure image does not move away from edges
+      if (newImgWidth > canvasWidth) {
+        posX = imgPos.left * scaleX - (x * scaleX - x);
+
+        if (posX > 0) {
+          posX = 0;
+        }
+
+        if (posX < canvasWidth - newImgWidth) {
+          posX = canvasWidth - newImgWidth;
+        }
+      }
+
+      if (newImgHeight > canvasHeight) {
+        posY = imgPos.top * scaleY - (y * scaleY - y);
+
+        if (posY > 0) {
+          posY = 0;
+        }
+
+        if (posY < canvasHeight - newImgHeight) {
+          posY = canvasHeight - newImgHeight;
+        }
+      }
+
+      self.updateCursor(newImgWidth, newImgHeight);
+
+      $.fancybox.animate(
+        $content, {
+          top: posY,
+          left: posX,
+          scaleX: scaleX,
+          scaleY: scaleY
+        },
+        duration || 366,
+        function () {
+          self.isAnimating = false;
+        }
+      );
+
+      // Stop slideshow
+      if (self.SlideShow && self.SlideShow.isActive) {
+        self.SlideShow.stop();
+      }
+    },
+
+    // Scale image to fit inside parent element
+    // ========================================
+
+    scaleToFit: function (duration) {
+      var self = this,
+        current = self.current,
+        $content = current.$content,
+        end;
+
+      if (self.isAnimating || self.isMoved() || !$content || !(current.type == "image" && current.isLoaded && !current.hasError)) {
+        return;
+      }
+
+      self.isAnimating = true;
+
+      $.fancybox.stop($content);
+
+      end = self.getFitPos(current);
+
+      self.updateCursor(end.width, end.height);
+
+      $.fancybox.animate(
+        $content, {
+          top: end.top,
+          left: end.left,
+          scaleX: end.width / $content.width(),
+          scaleY: end.height / $content.height()
+        },
+        duration || 366,
+        function () {
+          self.isAnimating = false;
+        }
+      );
+    },
+
+    // Calculate image size to fit inside viewport
+    // ===========================================
+
+    getFitPos: function (slide) {
+      var self = this,
+        $content = slide.$content,
+        $slide = slide.$slide,
+        width = slide.width || slide.opts.width,
+        height = slide.height || slide.opts.height,
+        maxWidth,
+        maxHeight,
+        minRatio,
+        aspectRatio,
+        rez = {};
+
+      if (!slide.isLoaded || !$content || !$content.length) {
+        return false;
+      }
+
+      maxWidth = $.fancybox.getTranslate(self.$refs.stage).width;
+      maxHeight = $.fancybox.getTranslate(self.$refs.stage).height;
+
+      maxWidth -=
+        parseFloat($slide.css("paddingLeft")) +
+        parseFloat($slide.css("paddingRight")) +
+        parseFloat($content.css("marginLeft")) +
+        parseFloat($content.css("marginRight"));
+
+      maxHeight -=
+        parseFloat($slide.css("paddingTop")) +
+        parseFloat($slide.css("paddingBottom")) +
+        parseFloat($content.css("marginTop")) +
+        parseFloat($content.css("marginBottom"));
+
+      if (!width || !height) {
+        width = maxWidth;
+        height = maxHeight;
+      }
+
+      minRatio = Math.min(1, maxWidth / width, maxHeight / height);
+
+      width = minRatio * width;
+      height = minRatio * height;
+
+      // Adjust width/height to precisely fit into container
+      if (width > maxWidth - 0.5) {
+        width = maxWidth;
+      }
+
+      if (height > maxHeight - 0.5) {
+        height = maxHeight;
+      }
+
+      if (slide.type === "image") {
+        rez.top = Math.floor((maxHeight - height) * 0.5) + parseFloat($slide.css("paddingTop"));
+        rez.left = Math.floor((maxWidth - width) * 0.5) + parseFloat($slide.css("paddingLeft"));
+      } else if (slide.contentType === "video") {
+        // Force aspect ratio for the video
+        // "I say the whole world must learn of our peaceful ways… by force!"
+        aspectRatio = slide.opts.width && slide.opts.height ? width / height : slide.opts.ratio || 16 / 9;
+
+        if (height > width / aspectRatio) {
+          height = width / aspectRatio;
+        } else if (width > height * aspectRatio) {
+          width = height * aspectRatio;
+        }
+      }
+
+      rez.width = width;
+      rez.height = height;
+
+      return rez;
+    },
+
+    // Update content size and position for all slides
+    // ==============================================
+
+    update: function (e) {
+      var self = this;
+
+      $.each(self.slides, function (key, slide) {
+        self.updateSlide(slide, e);
+      });
+    },
+
+    // Update slide content position and size
+    // ======================================
+
+    updateSlide: function (slide, e) {
+      var self = this,
+        $content = slide && slide.$content,
+        width = slide.width || slide.opts.width,
+        height = slide.height || slide.opts.height,
+        $slide = slide.$slide;
+
+      // First, prevent caption overlap, if needed
+      self.adjustCaption(slide);
+
+      // Then resize content to fit inside the slide
+      if ($content && (width || height || slide.contentType === "video") && !slide.hasError) {
+        $.fancybox.stop($content);
+
+        $.fancybox.setTranslate($content, self.getFitPos(slide));
+
+        if (slide.pos === self.currPos) {
+          self.isAnimating = false;
+
+          self.updateCursor();
+        }
+      }
+
+      // Then some adjustments
+      self.adjustLayout(slide);
+
+      if ($slide.length) {
+        $slide.trigger("refresh");
+
+        if (slide.pos === self.currPos) {
+          self.$refs.toolbar
+            .add(self.$refs.navigation.find(".fancybox-button--arrow_right"))
+            .toggleClass("compensate-for-scrollbar", $slide.get(0).scrollHeight > $slide.get(0).clientHeight);
+        }
+      }
+
+      self.trigger("onUpdate", slide, e);
+    },
+
+    // Horizontally center slide
+    // =========================
+
+    centerSlide: function (duration) {
+      var self = this,
+        current = self.current,
+        $slide = current.$slide;
+
+      if (self.isClosing || !current) {
+        return;
+      }
+
+      $slide.siblings().css({
+        transform: "",
+        opacity: ""
+      });
+
+      $slide
+        .parent()
+        .children()
+        .removeClass("fancybox-slide--previous fancybox-slide--next");
+
+      $.fancybox.animate(
+        $slide, {
+          top: 0,
+          left: 0,
+          opacity: 1
+        },
+        duration === undefined ? 0 : duration,
+        function () {
+          // Clean up
+          $slide.css({
+            transform: "",
+            opacity: ""
+          });
+
+          if (!current.isComplete) {
+            self.complete();
+          }
+        },
+        false
+      );
+    },
+
+    // Check if current slide is moved (swiped)
+    // ========================================
+
+    isMoved: function (slide) {
+      var current = slide || this.current,
+        slidePos,
+        stagePos;
+
+      if (!current) {
+        return false;
+      }
+
+      stagePos = $.fancybox.getTranslate(this.$refs.stage);
+      slidePos = $.fancybox.getTranslate(current.$slide);
+
+      return (
+        !current.$slide.hasClass("fancybox-animated") &&
+        (Math.abs(slidePos.top - stagePos.top) > 0.5 || Math.abs(slidePos.left - stagePos.left) > 0.5)
+      );
+    },
+
+    // Update cursor style depending if content can be zoomed
+    // ======================================================
+
+    updateCursor: function (nextWidth, nextHeight) {
+      var self = this,
+        current = self.current,
+        $container = self.$refs.container,
+        canPan,
+        isZoomable;
+
+      if (!current || self.isClosing || !self.Guestures) {
+        return;
+      }
+
+      $container.removeClass("fancybox-is-zoomable fancybox-can-zoomIn fancybox-can-zoomOut fancybox-can-swipe fancybox-can-pan");
+
+      canPan = self.canPan(nextWidth, nextHeight);
+
+      isZoomable = canPan ? true : self.isZoomable();
+
+      $container.toggleClass("fancybox-is-zoomable", isZoomable);
+
+      $("[data-fancybox-zoom]").prop("disabled", !isZoomable);
+
+      if (canPan) {
+        $container.addClass("fancybox-can-pan");
+      } else if (
+        isZoomable &&
+        (current.opts.clickContent === "zoom" || ($.isFunction(current.opts.clickContent) && current.opts.clickContent(current) == "zoom"))
+      ) {
+        $container.addClass("fancybox-can-zoomIn");
+      } else if (current.opts.touch && (current.opts.touch.vertical || self.group.length > 1) && current.contentType !== "video") {
+        $container.addClass("fancybox-can-swipe");
+      }
+    },
+
+    // Check if current slide is zoomable
+    // ==================================
+
+    isZoomable: function () {
+      var self = this,
+        current = self.current,
+        fitPos;
+
+      // Assume that slide is zoomable if:
+      //   - image is still loading
+      //   - actual size of the image is smaller than available area
+      if (current && !self.isClosing && current.type === "image" && !current.hasError) {
+        if (!current.isLoaded) {
+          return true;
+        }
+
+        fitPos = self.getFitPos(current);
+
+        if (fitPos && (current.width > fitPos.width || current.height > fitPos.height)) {
+          return true;
+        }
+      }
+
+      return false;
+    },
+
+    // Check if current image dimensions are smaller than actual
+    // =========================================================
+
+    isScaledDown: function (nextWidth, nextHeight) {
+      var self = this,
+        rez = false,
+        current = self.current,
+        $content = current.$content;
+
+      if (nextWidth !== undefined && nextHeight !== undefined) {
+        rez = nextWidth < current.width && nextHeight < current.height;
+      } else if ($content) {
+        rez = $.fancybox.getTranslate($content);
+        rez = rez.width < current.width && rez.height < current.height;
+      }
+
+      return rez;
+    },
+
+    // Check if image dimensions exceed parent element
+    // ===============================================
+
+    canPan: function (nextWidth, nextHeight) {
+      var self = this,
+        current = self.current,
+        pos = null,
+        rez = false;
+
+      if (current.type === "image" && (current.isComplete || (nextWidth && nextHeight)) && !current.hasError) {
+        rez = self.getFitPos(current);
+
+        if (nextWidth !== undefined && nextHeight !== undefined) {
+          pos = {
+            width: nextWidth,
+            height: nextHeight
+          };
+        } else if (current.isComplete) {
+          pos = $.fancybox.getTranslate(current.$content);
+        }
+
+        if (pos && rez) {
+          rez = Math.abs(pos.width - rez.width) > 1.5 || Math.abs(pos.height - rez.height) > 1.5;
+        }
+      }
+
+      return rez;
+    },
+
+    // Load content into the slide
+    // ===========================
+
+    loadSlide: function (slide) {
+      var self = this,
+        type,
+        $slide,
+        ajaxLoad;
+
+      if (slide.isLoading || slide.isLoaded) {
+        return;
+      }
+
+      slide.isLoading = true;
+
+      if (self.trigger("beforeLoad", slide) === false) {
+        slide.isLoading = false;
+
+        return false;
+      }
+
+      type = slide.type;
+      $slide = slide.$slide;
+
+      $slide
+        .off("refresh")
+        .trigger("onReset")
+        .addClass(slide.opts.slideClass);
+
+      // Create content depending on the type
+      switch (type) {
+        case "image":
+          self.setImage(slide);
+
+          break;
+
+        case "iframe":
+          self.setIframe(slide);
+
+          break;
+
+        case "html":
+          self.setContent(slide, slide.src || slide.content);
+
+          break;
+
+        case "video":
+          self.setContent(
+            slide,
+            slide.opts.video.tpl
+            .replace(/\{\{src\}\}/gi, slide.src)
+            .replace("{{format}}", slide.opts.videoFormat || slide.opts.video.format || "")
+            .replace("{{poster}}", slide.thumb || "")
+          );
+
+          break;
+
+        case "inline":
+          if ($(slide.src).length) {
+            self.setContent(slide, $(slide.src));
+          } else {
+            self.setError(slide);
+          }
+
+          break;
+
+        case "ajax":
+          self.showLoading(slide);
+
+          ajaxLoad = $.ajax(
+            $.extend({}, slide.opts.ajax.settings, {
+              url: slide.src,
+              success: function (data, textStatus) {
+                if (textStatus === "success") {
+                  self.setContent(slide, data);
+                }
+              },
+              error: function (jqXHR, textStatus) {
+                if (jqXHR && textStatus !== "abort") {
+                  self.setError(slide);
+                }
+              }
+            })
+          );
+
+          $slide.one("onReset", function () {
+            ajaxLoad.abort();
+          });
+
+          break;
+
+        default:
+          self.setError(slide);
+
+          break;
+      }
+
+      return true;
+    },
+
+    // Use thumbnail image, if possible
+    // ================================
+
+    setImage: function (slide) {
+      var self = this,
+        ghost;
+
+      // Check if need to show loading icon
+      setTimeout(function () {
+        var $img = slide.$image;
+
+        if (!self.isClosing && slide.isLoading && (!$img || !$img.length || !$img[0].complete) && !slide.hasError) {
+          self.showLoading(slide);
+        }
+      }, 50);
+
+      //Check if image has srcset
+      self.checkSrcset(slide);
+
+      // This will be wrapper containing both ghost and actual image
+      slide.$content = $('<div class="fancybox-content"></div>')
+        .addClass("fancybox-is-hidden")
+        .appendTo(slide.$slide.addClass("fancybox-slide--image"));
+
+      // If we have a thumbnail, we can display it while actual image is loading
+      // Users will not stare at black screen and actual image will appear gradually
+      if (slide.opts.preload !== false && slide.opts.width && slide.opts.height && slide.thumb) {
+        slide.width = slide.opts.width;
+        slide.height = slide.opts.height;
+
+        ghost = document.createElement("img");
+
+        ghost.onerror = function () {
+          $(this).remove();
+
+          slide.$ghost = null;
+        };
+
+        ghost.onload = function () {
+          self.afterLoad(slide);
+        };
+
+        slide.$ghost = $(ghost)
+          .addClass("fancybox-image")
+          .appendTo(slide.$content)
+          .attr("src", slide.thumb);
+      }
+
+      // Start loading actual image
+      self.setBigImage(slide);
+    },
+
+    // Check if image has srcset and get the source
+    // ============================================
+    checkSrcset: function (slide) {
+      var srcset = slide.opts.srcset || slide.opts.image.srcset,
+        found,
+        temp,
+        pxRatio,
+        windowWidth;
+
+      // If we have "srcset", then we need to find first matching "src" value.
+      // This is necessary, because when you set an src attribute, the browser will preload the image
+      // before any javascript or even CSS is applied.
+      if (srcset) {
+        pxRatio = window.devicePixelRatio || 1;
+        windowWidth = window.innerWidth * pxRatio;
+
+        temp = srcset.split(",").map(function (el) {
+          var ret = {};
+
+          el.trim()
+            .split(/\s+/)
+            .forEach(function (el, i) {
+              var value = parseInt(el.substring(0, el.length - 1), 10);
+
+              if (i === 0) {
+                return (ret.url = el);
+              }
+
+              if (value) {
+                ret.value = value;
+                ret.postfix = el[el.length - 1];
+              }
+            });
+
+          return ret;
+        });
+
+        // Sort by value
+        temp.sort(function (a, b) {
+          return a.value - b.value;
+        });
+
+        // Ok, now we have an array of all srcset values
+        for (var j = 0; j < temp.length; j++) {
+          var el = temp[j];
+
+          if ((el.postfix === "w" && el.value >= windowWidth) || (el.postfix === "x" && el.value >= pxRatio)) {
+            found = el;
+            break;
+          }
+        }
+
+        // If not found, take the last one
+        if (!found && temp.length) {
+          found = temp[temp.length - 1];
+        }
+
+        if (found) {
+          slide.src = found.url;
+
+          // If we have default width/height values, we can calculate height for matching source
+          if (slide.width && slide.height && found.postfix == "w") {
+            slide.height = (slide.width / slide.height) * found.value;
+            slide.width = found.value;
+          }
+
+          slide.opts.srcset = srcset;
+        }
+      }
+    },
+
+    // Create full-size image
+    // ======================
+
+    setBigImage: function (slide) {
+      var self = this,
+        img = document.createElement("img"),
+        $img = $(img);
+
+      slide.$image = $img
+        .one("error", function () {
+          self.setError(slide);
+        })
+        .one("load", function () {
+          var sizes;
+
+          if (!slide.$ghost) {
+            self.resolveImageSlideSize(slide, this.naturalWidth, this.naturalHeight);
+
+            self.afterLoad(slide);
+          }
+
+          if (self.isClosing) {
+            return;
+          }
+
+          if (slide.opts.srcset) {
+            sizes = slide.opts.sizes;
+
+            if (!sizes || sizes === "auto") {
+              sizes =
+                (slide.width / slide.height > 1 && $W.width() / $W.height() > 1 ? "100" : Math.round((slide.width / slide.height) * 100)) +
+                "vw";
+            }
+
+            $img.attr("sizes", sizes).attr("srcset", slide.opts.srcset);
+          }
+
+          // Hide temporary image after some delay
+          if (slide.$ghost) {
+            setTimeout(function () {
+              if (slide.$ghost && !self.isClosing) {
+                slide.$ghost.hide();
+              }
+            }, Math.min(300, Math.max(1000, slide.height / 1600)));
+          }
+
+          self.hideLoading(slide);
+        })
+        .addClass("fancybox-image")
+        .attr("src", slide.src)
+        .appendTo(slide.$content);
+
+      if ((img.complete || img.readyState == "complete") && $img.naturalWidth && $img.naturalHeight) {
+        $img.trigger("load");
+      } else if (img.error) {
+        $img.trigger("error");
+      }
+    },
+
+    // Computes the slide size from image size and maxWidth/maxHeight
+    // ==============================================================
+
+    resolveImageSlideSize: function (slide, imgWidth, imgHeight) {
+      var maxWidth = parseInt(slide.opts.width, 10),
+        maxHeight = parseInt(slide.opts.height, 10);
+
+      // Sets the default values from the image
+      slide.width = imgWidth;
+      slide.height = imgHeight;
+
+      if (maxWidth > 0) {
+        slide.width = maxWidth;
+        slide.height = Math.floor((maxWidth * imgHeight) / imgWidth);
+      }
+
+      if (maxHeight > 0) {
+        slide.width = Math.floor((maxHeight * imgWidth) / imgHeight);
+        slide.height = maxHeight;
+      }
+    },
+
+    // Create iframe wrapper, iframe and bindings
+    // ==========================================
+
+    setIframe: function (slide) {
+      var self = this,
+        opts = slide.opts.iframe,
+        $slide = slide.$slide,
+        $iframe;
+
+      slide.$content = $('<div class="fancybox-content' + (opts.preload ? " fancybox-is-hidden" : "") + '"></div>')
+        .css(opts.css)
+        .appendTo($slide);
+
+      $slide.addClass("fancybox-slide--" + slide.contentType);
+
+      slide.$iframe = $iframe = $(opts.tpl.replace(/\{rnd\}/g, new Date().getTime()))
+        .attr(opts.attr)
+        .appendTo(slide.$content);
+
+      if (opts.preload) {
+        self.showLoading(slide);
+
+        // Unfortunately, it is not always possible to determine if iframe is successfully loaded
+        // (due to browser security policy)
+
+        $iframe.on("load.fb error.fb", function (e) {
+          this.isReady = 1;
+
+          slide.$slide.trigger("refresh");
+
+          self.afterLoad(slide);
+        });
+
+        // Recalculate iframe content size
+        // ===============================
+
+        $slide.on("refresh.fb", function () {
+          var $content = slide.$content,
+            frameWidth = opts.css.width,
+            frameHeight = opts.css.height,
+            $contents,
+            $body;
+
+          if ($iframe[0].isReady !== 1) {
+            return;
+          }
+
+          try {
+            $contents = $iframe.contents();
+            $body = $contents.find("body");
+          } catch (ignore) {}
+
+          // Calculate content dimensions, if it is accessible
+          if ($body && $body.length && $body.children().length) {
+            // Avoid scrolling to top (if multiple instances)
+            $slide.css("overflow", "visible");
+
+            $content.css({
+              width: "100%",
+              "max-width": "100%",
+              height: "9999px"
+            });
+
+            if (frameWidth === undefined) {
+              frameWidth = Math.ceil(Math.max($body[0].clientWidth, $body.outerWidth(true)));
+            }
+
+            $content.css("width", frameWidth ? frameWidth : "").css("max-width", "");
+
+            if (frameHeight === undefined) {
+              frameHeight = Math.ceil(Math.max($body[0].clientHeight, $body.outerHeight(true)));
+            }
+
+            $content.css("height", frameHeight ? frameHeight : "");
+
+            $slide.css("overflow", "auto");
+          }
+
+          $content.removeClass("fancybox-is-hidden");
+        });
+      } else {
+        self.afterLoad(slide);
+      }
+
+      $iframe.attr("src", slide.src);
+
+      // Remove iframe if closing or changing gallery item
+      $slide.one("onReset", function () {
+        // This helps IE not to throw errors when closing
+        try {
+          $(this)
+            .find("iframe")
+            .hide()
+            .unbind()
+            .attr("src", "//about:blank");
+        } catch (ignore) {}
+
+        $(this)
+          .off("refresh.fb")
+          .empty();
+
+        slide.isLoaded = false;
+        slide.isRevealed = false;
+      });
+    },
+
+    // Wrap and append content to the slide
+    // ======================================
+
+    setContent: function (slide, content) {
+      var self = this;
+
+      if (self.isClosing) {
+        return;
+      }
+
+      self.hideLoading(slide);
+
+      if (slide.$content) {
+        $.fancybox.stop(slide.$content);
+      }
+
+      slide.$slide.empty();
+
+      // If content is a jQuery object, then it will be moved to the slide.
+      // The placeholder is created so we will know where to put it back.
+      if (isQuery(content) && content.parent().length) {
+        // Make sure content is not already moved to fancyBox
+        if (content.hasClass("fancybox-content") || content.parent().hasClass("fancybox-content")) {
+          content.parents(".fancybox-slide").trigger("onReset");
+        }
+
+        // Create temporary element marking original place of the content
+        slide.$placeholder = $("<div>")
+          .hide()
+          .insertAfter(content);
+
+        // Make sure content is visible
+        content.css("display", "inline-block");
+      } else if (!slide.hasError) {
+        // If content is just a plain text, try to convert it to html
+        if ($.type(content) === "string") {
+          content = $("<div>")
+            .append($.trim(content))
+            .contents();
+        }
+
+        // If "filter" option is provided, then filter content
+        if (slide.opts.filter) {
+          content = $("<div>")
+            .html(content)
+            .find(slide.opts.filter);
+        }
+      }
+
+      slide.$slide.one("onReset", function () {
+        // Pause all html5 video/audio
+        $(this)
+          .find("video,audio")
+          .trigger("pause");
+
+        // Put content back
+        if (slide.$placeholder) {
+          slide.$placeholder.after(content.removeClass("fancybox-content").hide()).remove();
+
+          slide.$placeholder = null;
+        }
+
+        // Remove custom close button
+        if (slide.$smallBtn) {
+          slide.$smallBtn.remove();
+
+          slide.$smallBtn = null;
+        }
+
+        // Remove content and mark slide as not loaded
+        if (!slide.hasError) {
+          $(this).empty();
+
+          slide.isLoaded = false;
+          slide.isRevealed = false;
+        }
+      });
+
+      $(content).appendTo(slide.$slide);
+
+      if ($(content).is("video,audio")) {
+        $(content).addClass("fancybox-video");
+
+        $(content).wrap("<div></div>");
+
+        slide.contentType = "video";
+
+        slide.opts.width = slide.opts.width || $(content).attr("width");
+        slide.opts.height = slide.opts.height || $(content).attr("height");
+      }
+
+      slide.$content = slide.$slide
+        .children()
+        .filter("div,form,main,video,audio,article,.fancybox-content")
+        .first();
+
+      slide.$content.siblings().hide();
+
+      // Re-check if there is a valid content
+      // (in some cases, ajax response can contain various elements or plain text)
+      if (!slide.$content.length) {
+        slide.$content = slide.$slide
+          .wrapInner("<div></div>")
+          .children()
+          .first();
+      }
+
+      slide.$content.addClass("fancybox-content");
+
+      slide.$slide.addClass("fancybox-slide--" + slide.contentType);
+
+      self.afterLoad(slide);
+    },
+
+    // Display error message
+    // =====================
+
+    setError: function (slide) {
+      slide.hasError = true;
+
+      slide.$slide
+        .trigger("onReset")
+        .removeClass("fancybox-slide--" + slide.contentType)
+        .addClass("fancybox-slide--error");
+
+      slide.contentType = "html";
+
+      this.setContent(slide, this.translate(slide, slide.opts.errorTpl));
+
+      if (slide.pos === this.currPos) {
+        this.isAnimating = false;
+      }
+    },
+
+    // Show loading icon inside the slide
+    // ==================================
+
+    showLoading: function (slide) {
+      var self = this;
+
+      slide = slide || self.current;
+
+      if (slide && !slide.$spinner) {
+        slide.$spinner = $(self.translate(self, self.opts.spinnerTpl))
+          .appendTo(slide.$slide)
+          .hide()
+          .fadeIn("fast");
+      }
+    },
+
+    // Remove loading icon from the slide
+    // ==================================
+
+    hideLoading: function (slide) {
+      var self = this;
+
+      slide = slide || self.current;
+
+      if (slide && slide.$spinner) {
+        slide.$spinner.stop().remove();
+
+        delete slide.$spinner;
+      }
+    },
+
+    // Adjustments after slide content has been loaded
+    // ===============================================
+
+    afterLoad: function (slide) {
+      var self = this;
+
+      if (self.isClosing) {
+        return;
+      }
+
+      slide.isLoading = false;
+      slide.isLoaded = true;
+
+      self.trigger("afterLoad", slide);
+
+      self.hideLoading(slide);
+
+      // Add small close button
+      if (slide.opts.smallBtn && (!slide.$smallBtn || !slide.$smallBtn.length)) {
+        slide.$smallBtn = $(self.translate(slide, slide.opts.btnTpl.smallBtn)).appendTo(slide.$content);
+      }
+
+      // Disable right click
+      if (slide.opts.protect && slide.$content && !slide.hasError) {
+        slide.$content.on("contextmenu.fb", function (e) {
+          if (e.button == 2) {
+            e.preventDefault();
+          }
+
+          return true;
+        });
+
+        // Add fake element on top of the image
+        // This makes a bit harder for user to select image
+        if (slide.type === "image") {
+          $('<div class="fancybox-spaceball"></div>').appendTo(slide.$content);
+        }
+      }
+
+      self.adjustCaption(slide);
+
+      self.adjustLayout(slide);
+
+      if (slide.pos === self.currPos) {
+        self.updateCursor();
+      }
+
+      self.revealContent(slide);
+    },
+
+    // Prevent caption overlap,
+    // fix css inconsistency across browsers
+    // =====================================
+
+    adjustCaption: function (slide) {
+      var self = this,
+        current = slide || self.current,
+        caption = current.opts.caption,
+        preventOverlap = current.opts.preventCaptionOverlap,
+        $caption = self.$refs.caption,
+        $clone,
+        captionH = false;
+
+      $caption.toggleClass("fancybox-caption--separate", preventOverlap);
+
+      if (preventOverlap && caption && caption.length) {
+        if (current.pos !== self.currPos) {
+          $clone = $caption.clone().appendTo($caption.parent());
+
+          $clone
+            .children()
+            .eq(0)
+            .empty()
+            .html(caption);
+
+          captionH = $clone.outerHeight(true);
+
+          $clone.empty().remove();
+        } else if (self.$caption) {
+          captionH = self.$caption.outerHeight(true);
+        }
+
+        current.$slide.css("padding-bottom", captionH || "");
+      }
+    },
+
+    // Simple hack to fix inconsistency across browsers, described here (affects Edge, too):
+    // https://bugzilla.mozilla.org/show_bug.cgi?id=748518
+    // ====================================================================================
+
+    adjustLayout: function (slide) {
+      var self = this,
+        current = slide || self.current,
+        scrollHeight,
+        marginBottom,
+        inlinePadding,
+        actualPadding;
+
+      if (current.isLoaded && current.opts.disableLayoutFix !== true) {
+        current.$content.css("margin-bottom", "");
+
+        // If we would always set margin-bottom for the content,
+        // then it would potentially break vertical align
+        if (current.$content.outerHeight() > current.$slide.height() + 0.5) {
+          inlinePadding = current.$slide[0].style["padding-bottom"];
+          actualPadding = current.$slide.css("padding-bottom");
+
+          if (parseFloat(actualPadding) > 0) {
+            scrollHeight = current.$slide[0].scrollHeight;
+
+            current.$slide.css("padding-bottom", 0);
+
+            if (Math.abs(scrollHeight - current.$slide[0].scrollHeight) < 1) {
+              marginBottom = actualPadding;
+            }
+
+            current.$slide.css("padding-bottom", inlinePadding);
+          }
+        }
+
+        current.$content.css("margin-bottom", marginBottom);
+      }
+    },
+
+    // Make content visible
+    // This method is called right after content has been loaded or
+    // user navigates gallery and transition should start
+    // ============================================================
+
+    revealContent: function (slide) {
+      var self = this,
+        $slide = slide.$slide,
+        end = false,
+        start = false,
+        isMoved = self.isMoved(slide),
+        isRevealed = slide.isRevealed,
+        effect,
+        effectClassName,
+        duration,
+        opacity;
+
+      slide.isRevealed = true;
+
+      effect = slide.opts[self.firstRun ? "animationEffect" : "transitionEffect"];
+      duration = slide.opts[self.firstRun ? "animationDuration" : "transitionDuration"];
+
+      duration = parseInt(slide.forcedDuration === undefined ? duration : slide.forcedDuration, 10);
+
+      if (isMoved || slide.pos !== self.currPos || !duration) {
+        effect = false;
+      }
+
+      // Check if can zoom
+      if (effect === "zoom") {
+        if (slide.pos === self.currPos && duration && slide.type === "image" && !slide.hasError && (start = self.getThumbPos(slide))) {
+          end = self.getFitPos(slide);
+        } else {
+          effect = "fade";
+        }
+      }
+
+      // Zoom animation
+      // ==============
+      if (effect === "zoom") {
+        self.isAnimating = true;
+
+        end.scaleX = end.width / start.width;
+        end.scaleY = end.height / start.height;
+
+        // Check if we need to animate opacity
+        opacity = slide.opts.zoomOpacity;
+
+        if (opacity == "auto") {
+          opacity = Math.abs(slide.width / slide.height - start.width / start.height) > 0.1;
+        }
+
+        if (opacity) {
+          start.opacity = 0.1;
+          end.opacity = 1;
+        }
+
+        // Draw image at start position
+        $.fancybox.setTranslate(slide.$content.removeClass("fancybox-is-hidden"), start);
+
+        forceRedraw(slide.$content);
+
+        // Start animation
+        $.fancybox.animate(slide.$content, end, duration, function () {
+          self.isAnimating = false;
+
+          self.complete();
+        });
+
+        return;
+      }
+
+      self.updateSlide(slide);
+
+      // Simply show content if no effect
+      // ================================
+      if (!effect) {
+        slide.$content.removeClass("fancybox-is-hidden");
+
+        if (!isRevealed && isMoved && slide.type === "image" && !slide.hasError) {
+          slide.$content.hide().fadeIn("fast");
+        }
+
+        if (slide.pos === self.currPos) {
+          self.complete();
+        }
+
+        return;
+      }
+
+      // Prepare for CSS transiton
+      // =========================
+      $.fancybox.stop($slide);
+
+      //effectClassName = "fancybox-animated fancybox-slide--" + (slide.pos >= self.prevPos ? "next" : "previous") + " fancybox-fx-" + effect;
+      effectClassName = "fancybox-slide--" + (slide.pos >= self.prevPos ? "next" : "previous") + " fancybox-animated fancybox-fx-" + effect;
+
+      $slide.addClass(effectClassName).removeClass("fancybox-slide--current"); //.addClass(effectClassName);
+
+      slide.$content.removeClass("fancybox-is-hidden");
+
+      // Force reflow
+      forceRedraw($slide);
+
+      if (slide.type !== "image") {
+        slide.$content.hide().show(0);
+      }
+
+      $.fancybox.animate(
+        $slide,
+        "fancybox-slide--current",
+        duration,
+        function () {
+          $slide.removeClass(effectClassName).css({
+            transform: "",
+            opacity: ""
+          });
+
+          if (slide.pos === self.currPos) {
+            self.complete();
+          }
+        },
+        true
+      );
+    },
+
+    // Check if we can and have to zoom from thumbnail
+    //================================================
+
+    getThumbPos: function (slide) {
+      var rez = false,
+        $thumb = slide.$thumb,
+        thumbPos,
+        btw,
+        brw,
+        bbw,
+        blw;
+
+      if (!$thumb || !inViewport($thumb[0])) {
+        return false;
+      }
+
+      thumbPos = $.fancybox.getTranslate($thumb);
+
+      btw = parseFloat($thumb.css("border-top-width") || 0);
+      brw = parseFloat($thumb.css("border-right-width") || 0);
+      bbw = parseFloat($thumb.css("border-bottom-width") || 0);
+      blw = parseFloat($thumb.css("border-left-width") || 0);
+
+      rez = {
+        top: thumbPos.top + btw,
+        left: thumbPos.left + blw,
+        width: thumbPos.width - brw - blw,
+        height: thumbPos.height - btw - bbw,
+        scaleX: 1,
+        scaleY: 1
+      };
+
+      return thumbPos.width > 0 && thumbPos.height > 0 ? rez : false;
+    },
+
+    // Final adjustments after current gallery item is moved to position
+    // and it`s content is loaded
+    // ==================================================================
+
+    complete: function () {
+      var self = this,
+        current = self.current,
+        slides = {},
+        $el;
+
+      if (self.isMoved() || !current.isLoaded) {
+        return;
+      }
+
+      if (!current.isComplete) {
+        current.isComplete = true;
+
+        current.$slide.siblings().trigger("onReset");
+
+        self.preload("inline");
+
+        // Trigger any CSS transiton inside the slide
+        forceRedraw(current.$slide);
+
+        current.$slide.addClass("fancybox-slide--complete");
+
+        // Remove unnecessary slides
+        $.each(self.slides, function (key, slide) {
+          if (slide.pos >= self.currPos - 1 && slide.pos <= self.currPos + 1) {
+            slides[slide.pos] = slide;
+          } else if (slide) {
+            $.fancybox.stop(slide.$slide);
+
+            slide.$slide.off().remove();
+          }
+        });
+
+        self.slides = slides;
+      }
+
+      self.isAnimating = false;
+
+      self.updateCursor();
+
+      self.trigger("afterShow");
+
+      // Autoplay first html5 video/audio
+      if (!!current.opts.video.autoStart) {
+        current.$slide
+          .find("video,audio")
+          .filter(":visible:first")
+          .trigger("play")
+          .one("ended", function () {
+            if (Document.exitFullscreen) {
+              Document.exitFullscreen();
+            } else if (this.webkitExitFullscreen) {
+              this.webkitExitFullscreen();
+            }
+
+            self.next();
+          });
+      }
+
+      // Try to focus on the first focusable element
+      if (current.opts.autoFocus && current.contentType === "html") {
+        // Look for the first input with autofocus attribute
+        $el = current.$content.find("input[autofocus]:enabled:visible:first");
+
+        if ($el.length) {
+          $el.trigger("focus");
+        } else {
+          self.focus(null, true);
+        }
+      }
+
+      // Avoid jumping
+      current.$slide.scrollTop(0).scrollLeft(0);
+    },
+
+    // Preload next and previous slides
+    // ================================
+
+    preload: function (type) {
+      var self = this,
+        prev,
+        next;
+
+      if (self.group.length < 2) {
+        return;
+      }
+
+      next = self.slides[self.currPos + 1];
+      prev = self.slides[self.currPos - 1];
+
+      if (prev && prev.type === type) {
+        self.loadSlide(prev);
+      }
+
+      if (next && next.type === type) {
+        self.loadSlide(next);
+      }
+    },
+
+    // Try to find and focus on the first focusable element
+    // ====================================================
+
+    focus: function (e, firstRun) {
+      var self = this,
+        focusableStr = [
+          "a[href]",
+          "area[href]",
+          'input:not([disabled]):not([type="hidden"]):not([aria-hidden])',
+          "select:not([disabled]):not([aria-hidden])",
+          "textarea:not([disabled]):not([aria-hidden])",
+          "button:not([disabled]):not([aria-hidden])",
+          "iframe",
+          "object",
+          "embed",
+          "video",
+          "audio",
+          "[contenteditable]",
+          '[tabindex]:not([tabindex^="-"])'
+        ].join(","),
+        focusableItems,
+        focusedItemIndex;
+
+      if (self.isClosing) {
+        return;
+      }
+
+      if (e || !self.current || !self.current.isComplete) {
+        // Focus on any element inside fancybox
+        focusableItems = self.$refs.container.find("*:visible");
+      } else {
+        // Focus inside current slide
+        focusableItems = self.current.$slide.find("*:visible" + (firstRun ? ":not(.fancybox-close-small)" : ""));
+      }
+
+      focusableItems = focusableItems.filter(focusableStr).filter(function () {
+        return $(this).css("visibility") !== "hidden" && !$(this).hasClass("disabled");
+      });
+
+      if (focusableItems.length) {
+        focusedItemIndex = focusableItems.index(document.activeElement);
+
+        if (e && e.shiftKey) {
+          // Back tab
+          if (focusedItemIndex < 0 || focusedItemIndex == 0) {
+            e.preventDefault();
+
+            focusableItems.eq(focusableItems.length - 1).trigger("focus");
+          }
+        } else {
+          // Outside or Forward tab
+          if (focusedItemIndex < 0 || focusedItemIndex == focusableItems.length - 1) {
+            if (e) {
+              e.preventDefault();
+            }
+
+            focusableItems.eq(0).trigger("focus");
+          }
+        }
+      } else {
+        self.$refs.container.trigger("focus");
+      }
+    },
+
+    // Activates current instance - brings container to the front and enables keyboard,
+    // notifies other instances about deactivating
+    // =================================================================================
+
+    activate: function () {
+      var self = this;
+
+      // Deactivate all instances
+      $(".fancybox-container").each(function () {
+        var instance = $(this).data("FancyBox");
+
+        // Skip self and closing instances
+        if (instance && instance.id !== self.id && !instance.isClosing) {
+          instance.trigger("onDeactivate");
+
+          instance.removeEvents();
+
+          instance.isVisible = false;
+        }
+      });
+
+      self.isVisible = true;
+
+      if (self.current || self.isIdle) {
+        self.update();
+
+        self.updateControls();
+      }
+
+      self.trigger("onActivate");
+
+      self.addEvents();
+    },
+
+    // Start closing procedure
+    // This will start "zoom-out" animation if needed and clean everything up afterwards
+    // =================================================================================
+
+    close: function (e, d) {
+      var self = this,
+        current = self.current,
+        effect,
+        duration,
+        $content,
+        domRect,
+        opacity,
+        start,
+        end;
+
+      var done = function () {
+        self.cleanUp(e);
+      };
+
+      if (self.isClosing) {
+        return false;
+      }
+
+      self.isClosing = true;
+
+      // If beforeClose callback prevents closing, make sure content is centered
+      if (self.trigger("beforeClose", e) === false) {
+        self.isClosing = false;
+
+        requestAFrame(function () {
+          self.update();
+        });
+
+        return false;
+      }
+
+      // Remove all events
+      // If there are multiple instances, they will be set again by "activate" method
+      self.removeEvents();
+
+      $content = current.$content;
+      effect = current.opts.animationEffect;
+      duration = $.isNumeric(d) ? d : effect ? current.opts.animationDuration : 0;
+
+      current.$slide.removeClass("fancybox-slide--complete fancybox-slide--next fancybox-slide--previous fancybox-animated");
+
+      if (e !== true) {
+        $.fancybox.stop(current.$slide);
+      } else {
+        effect = false;
+      }
+
+      // Remove other slides
+      current.$slide
+        .siblings()
+        .trigger("onReset")
+        .remove();
+
+      // Trigger animations
+      if (duration) {
+        self.$refs.container
+          .removeClass("fancybox-is-open")
+          .addClass("fancybox-is-closing")
+          .css("transition-duration", duration + "ms");
+      }
+
+      // Clean up
+      self.hideLoading(current);
+
+      self.hideControls(true);
+
+      self.updateCursor();
+
+      // Check if possible to zoom-out
+      if (
+        effect === "zoom" &&
+        !($content && duration && current.type === "image" && !self.isMoved() && !current.hasError && (end = self.getThumbPos(current)))
+      ) {
+        effect = "fade";
+      }
+
+      if (effect === "zoom") {
+        $.fancybox.stop($content);
+
+        domRect = $.fancybox.getTranslate($content);
+
+        start = {
+          top: domRect.top,
+          left: domRect.left,
+          scaleX: domRect.width / end.width,
+          scaleY: domRect.height / end.height,
+          width: end.width,
+          height: end.height
+        };
+
+        // Check if we need to animate opacity
+        opacity = current.opts.zoomOpacity;
+
+        if (opacity == "auto") {
+          opacity = Math.abs(current.width / current.height - end.width / end.height) > 0.1;
+        }
+
+        if (opacity) {
+          end.opacity = 0;
+        }
+
+        $.fancybox.setTranslate($content, start);
+
+        forceRedraw($content);
+
+        $.fancybox.animate($content, end, duration, done);
+
+        return true;
+      }
+
+      if (effect && duration) {
+        $.fancybox.animate(
+          current.$slide.addClass("fancybox-slide--previous").removeClass("fancybox-slide--current"),
+          "fancybox-animated fancybox-fx-" + effect,
+          duration,
+          done
+        );
+      } else {
+        // If skip animation
+        if (e === true) {
+          setTimeout(done, duration);
+        } else {
+          done();
+        }
+      }
+
+      return true;
+    },
+
+    // Final adjustments after removing the instance
+    // =============================================
+
+    cleanUp: function (e) {
+      var self = this,
+        instance,
+        $focus = self.current.opts.$orig,
+        x,
+        y;
+
+      self.current.$slide.trigger("onReset");
+
+      self.$refs.container.empty().remove();
+
+      self.trigger("afterClose", e);
+
+      // Place back focus
+      if (!!self.current.opts.backFocus) {
+        if (!$focus || !$focus.length || !$focus.is(":visible")) {
+          $focus = self.$trigger;
+        }
+
+        if ($focus && $focus.length) {
+          x = window.scrollX;
+          y = window.scrollY;
+
+          $focus.trigger("focus");
+
+          $("html, body")
+            .scrollTop(y)
+            .scrollLeft(x);
+        }
+      }
+
+      self.current = null;
+
+      // Check if there are other instances
+      instance = $.fancybox.getInstance();
+
+      if (instance) {
+        instance.activate();
+      } else {
+        $("body").removeClass("fancybox-active compensate-for-scrollbar");
+
+        $("#fancybox-style-noscroll").remove();
+      }
+    },
+
+    // Call callback and trigger an event
+    // ==================================
+
+    trigger: function (name, slide) {
+      var args = Array.prototype.slice.call(arguments, 1),
+        self = this,
+        obj = slide && slide.opts ? slide : self.current,
+        rez;
+
+      if (obj) {
+        args.unshift(obj);
+      } else {
+        obj = self;
+      }
+
+      args.unshift(self);
+
+      if ($.isFunction(obj.opts[name])) {
+        rez = obj.opts[name].apply(obj, args);
+      }
+
+      if (rez === false) {
+        return rez;
+      }
+
+      if (name === "afterClose" || !self.$refs) {
+        $D.trigger(name + ".fb", args);
+      } else {
+        self.$refs.container.trigger(name + ".fb", args);
+      }
+    },
+
+    // Update infobar values, navigation button states and reveal caption
+    // ==================================================================
+
+    updateControls: function () {
+      var self = this,
+        current = self.current,
+        index = current.index,
+        $container = self.$refs.container,
+        $caption = self.$refs.caption,
+        caption = current.opts.caption;
+
+      // Recalculate content dimensions
+      current.$slide.trigger("refresh");
+
+      // Set caption
+      if (caption && caption.length) {
+        self.$caption = $caption;
+
+        $caption
+          .children()
+          .eq(0)
+          .html(caption);
+      } else {
+        self.$caption = null;
+      }
+
+      if (!self.hasHiddenControls && !self.isIdle) {
+        self.showControls();
+      }
+
+      // Update info and navigation elements
+      $container.find("[data-fancybox-count]").html(self.group.length);
+      $container.find("[data-fancybox-index]").html(index + 1);
+
+      $container.find("[data-fancybox-prev]").prop("disabled", !current.opts.loop && index <= 0);
+      $container.find("[data-fancybox-next]").prop("disabled", !current.opts.loop && index >= self.group.length - 1);
+
+      if (current.type === "image") {
+        // Re-enable buttons; update download button source
+        $container
+          .find("[data-fancybox-zoom]")
+          .show()
+          .end()
+          .find("[data-fancybox-download]")
+          .attr("href", current.opts.image.src || current.src)
+          .show();
+      } else if (current.opts.toolbar) {
+        $container.find("[data-fancybox-download],[data-fancybox-zoom]").hide();
+      }
+
+      // Make sure focus is not on disabled button/element
+      if ($(document.activeElement).is(":hidden,[disabled]")) {
+        self.$refs.container.trigger("focus");
+      }
+    },
+
+    // Hide toolbar and caption
+    // ========================
+
+    hideControls: function (andCaption) {
+      var self = this,
+        arr = ["infobar", "toolbar", "nav"];
+
+      if (andCaption || !self.current.opts.preventCaptionOverlap) {
+        arr.push("caption");
+      }
+
+      this.$refs.container.removeClass(
+        arr
+        .map(function (i) {
+          return "fancybox-show-" + i;
+        })
+        .join(" ")
+      );
+
+      this.hasHiddenControls = true;
+    },
+
+    showControls: function () {
+      var self = this,
+        opts = self.current ? self.current.opts : self.opts,
+        $container = self.$refs.container;
+
+      self.hasHiddenControls = false;
+      self.idleSecondsCounter = 0;
+
+      $container
+        .toggleClass("fancybox-show-toolbar", !!(opts.toolbar && opts.buttons))
+        .toggleClass("fancybox-show-infobar", !!(opts.infobar && self.group.length > 1))
+        .toggleClass("fancybox-show-caption", !!self.$caption)
+        .toggleClass("fancybox-show-nav", !!(opts.arrows && self.group.length > 1))
+        .toggleClass("fancybox-is-modal", !!opts.modal);
+    },
+
+    // Toggle toolbar and caption
+    // ==========================
+
+    toggleControls: function () {
+      if (this.hasHiddenControls) {
+        this.showControls();
+      } else {
+        this.hideControls();
+      }
+    }
+  });
+
+  $.fancybox = {
+    version: "3.5.7",
+    defaults: defaults,
+
+    // Get current instance and execute a command.
+    //
+    // Examples of usage:
+    //
+    //   $instance = $.fancybox.getInstance();
+    //   $.fancybox.getInstance().jumpTo( 1 );
+    //   $.fancybox.getInstance( 'jumpTo', 1 );
+    //   $.fancybox.getInstance( function() {
+    //       console.info( this.currIndex );
+    //   });
+    // ======================================================
+
+    getInstance: function (command) {
+      var instance = $('.fancybox-container:not(".fancybox-is-closing"):last').data("FancyBox"),
+        args = Array.prototype.slice.call(arguments, 1);
+
+      if (instance instanceof FancyBox) {
+        if ($.type(command) === "string") {
+          instance[command].apply(instance, args);
+        } else if ($.type(command) === "function") {
+          command.apply(instance, args);
+        }
+
+        return instance;
+      }
+
+      return false;
+    },
+
+    // Create new instance
+    // ===================
+
+    open: function (items, opts, index) {
+      return new FancyBox(items, opts, index);
+    },
+
+    // Close current or all instances
+    // ==============================
+
+    close: function (all) {
+      var instance = this.getInstance();
+
+      if (instance) {
+        instance.close();
+
+        // Try to find and close next instance
+        if (all === true) {
+          this.close(all);
+        }
+      }
+    },
+
+    // Close all instances and unbind all events
+    // =========================================
+
+    destroy: function () {
+      this.close(true);
+
+      $D.add("body").off("click.fb-start", "**");
+    },
+
+    // Try to detect mobile devices
+    // ============================
+
+    isMobile: /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),
+
+    // Detect if 'translate3d' support is available
+    // ============================================
+
+    use3d: (function () {
+      var div = document.createElement("div");
+
+      return (
+        window.getComputedStyle &&
+        window.getComputedStyle(div) &&
+        window.getComputedStyle(div).getPropertyValue("transform") &&
+        !(document.documentMode && document.documentMode < 11)
+      );
+    })(),
+
+    // Helper function to get current visual state of an element
+    // returns array[ top, left, horizontal-scale, vertical-scale, opacity ]
+    // =====================================================================
+
+    getTranslate: function ($el) {
+      var domRect;
+
+      if (!$el || !$el.length) {
+        return false;
+      }
+
+      domRect = $el[0].getBoundingClientRect();
+
+      return {
+        top: domRect.top || 0,
+        left: domRect.left || 0,
+        width: domRect.width,
+        height: domRect.height,
+        opacity: parseFloat($el.css("opacity"))
+      };
+    },
+
+    // Shortcut for setting "translate3d" properties for element
+    // Can set be used to set opacity, too
+    // ========================================================
+
+    setTranslate: function ($el, props) {
+      var str = "",
+        css = {};
+
+      if (!$el || !props) {
+        return;
+      }
+
+      if (props.left !== undefined || props.top !== undefined) {
+        str =
+          (props.left === undefined ? $el.position().left : props.left) +
+          "px, " +
+          (props.top === undefined ? $el.position().top : props.top) +
+          "px";
+
+        if (this.use3d) {
+          str = "translate3d(" + str + ", 0px)";
+        } else {
+          str = "translate(" + str + ")";
+        }
+      }
+
+      if (props.scaleX !== undefined && props.scaleY !== undefined) {
+        str += " scale(" + props.scaleX + ", " + props.scaleY + ")";
+      } else if (props.scaleX !== undefined) {
+        str += " scaleX(" + props.scaleX + ")";
+      }
+
+      if (str.length) {
+        css.transform = str;
+      }
+
+      if (props.opacity !== undefined) {
+        css.opacity = props.opacity;
+      }
+
+      if (props.width !== undefined) {
+        css.width = props.width;
+      }
+
+      if (props.height !== undefined) {
+        css.height = props.height;
+      }
+
+      return $el.css(css);
+    },
+
+    // Simple CSS transition handler
+    // =============================
+
+    animate: function ($el, to, duration, callback, leaveAnimationName) {
+      var self = this,
+        from;
+
+      if ($.isFunction(duration)) {
+        callback = duration;
+        duration = null;
+      }
+
+      self.stop($el);
+
+      from = self.getTranslate($el);
+
+      $el.on(transitionEnd, function (e) {
+        // Skip events from child elements and z-index change
+        if (e && e.originalEvent && (!$el.is(e.originalEvent.target) || e.originalEvent.propertyName == "z-index")) {
+          return;
+        }
+
+        self.stop($el);
+
+        if ($.isNumeric(duration)) {
+          $el.css("transition-duration", "");
+        }
+
+        if ($.isPlainObject(to)) {
+          if (to.scaleX !== undefined && to.scaleY !== undefined) {
+            self.setTranslate($el, {
+              top: to.top,
+              left: to.left,
+              width: from.width * to.scaleX,
+              height: from.height * to.scaleY,
+              scaleX: 1,
+              scaleY: 1
+            });
+          }
+        } else if (leaveAnimationName !== true) {
+          $el.removeClass(to);
+        }
+
+        if ($.isFunction(callback)) {
+          callback(e);
+        }
+      });
+
+      if ($.isNumeric(duration)) {
+        $el.css("transition-duration", duration + "ms");
+      }
+
+      // Start animation by changing CSS properties or class name
+      if ($.isPlainObject(to)) {
+        if (to.scaleX !== undefined && to.scaleY !== undefined) {
+          delete to.width;
+          delete to.height;
+
+          if ($el.parent().hasClass("fancybox-slide--image")) {
+            $el.parent().addClass("fancybox-is-scaling");
+          }
+        }
+
+        $.fancybox.setTranslate($el, to);
+      } else {
+        $el.addClass(to);
+      }
+
+      // Make sure that `transitionend` callback gets fired
+      $el.data(
+        "timer",
+        setTimeout(function () {
+          $el.trigger(transitionEnd);
+        }, duration + 33)
+      );
+    },
+
+    stop: function ($el, callCallback) {
+      if ($el && $el.length) {
+        clearTimeout($el.data("timer"));
+
+        if (callCallback) {
+          $el.trigger(transitionEnd);
+        }
+
+        $el.off(transitionEnd).css("transition-duration", "");
+
+        $el.parent().removeClass("fancybox-is-scaling");
+      }
+    }
+  };
+
+  // Default click handler for "fancyboxed" links
+  // ============================================
+
+  function _run(e, opts) {
+    var items = [],
+      index = 0,
+      $target,
+      value,
+      instance;
+
+    // Avoid opening multiple times
+    if (e && e.isDefaultPrevented()) {
+      return;
+    }
+
+    e.preventDefault();
+
+    opts = opts || {};
+
+    if (e && e.data) {
+      opts = mergeOpts(e.data.options, opts);
+    }
+
+    $target = opts.$target || $(e.currentTarget).trigger("blur");
+    instance = $.fancybox.getInstance();
+
+    if (instance && instance.$trigger && instance.$trigger.is($target)) {
+      return;
+    }
+
+    if (opts.selector) {
+      items = $(opts.selector);
+    } else {
+      // Get all related items and find index for clicked one
+      value = $target.attr("data-fancybox") || "";
+
+      if (value) {
+        items = e.data ? e.data.items : [];
+        items = items.length ? items.filter('[data-fancybox="' + value + '"]') : $('[data-fancybox="' + value + '"]');
+      } else {
+        items = [$target];
+      }
+    }
+
+    index = $(items).index($target);
+
+    // Sometimes current item can not be found
+    if (index < 0) {
+      index = 0;
+    }
+
+    instance = $.fancybox.open(items, opts, index);
+
+    // Save last active element
+    instance.$trigger = $target;
+  }
+
+  // Create a jQuery plugin
+  // ======================
+
+  $.fn.fancybox = function (options) {
+    var selector;
+
+    options = options || {};
+    selector = options.selector || false;
+
+    if (selector) {
+      // Use body element instead of document so it executes first
+      $("body")
+        .off("click.fb-start", selector)
+        .on("click.fb-start", selector, {
+          options: options
+        }, _run);
+    } else {
+      this.off("click.fb-start").on(
+        "click.fb-start", {
+          items: this,
+          options: options
+        },
+        _run
+      );
+    }
+
+    return this;
+  };
+
+  // Self initializing plugin for all elements having `data-fancybox` attribute
+  // ==========================================================================
+
+  $D.on("click.fb-start", "[data-fancybox]", _run);
+
+  // Enable "trigger elements"
+  // =========================
+
+  $D.on("click.fb-start", "[data-fancybox-trigger]", function (e) {
+    $('[data-fancybox="' + $(this).attr("data-fancybox-trigger") + '"]')
+      .eq($(this).attr("data-fancybox-index") || 0)
+      .trigger("click.fb-start", {
+        $trigger: $(this)
+      });
+  });
+
+  // Track focus event for better accessibility styling
+  // ==================================================
+  (function () {
+    var buttonStr = ".fancybox-button",
+      focusStr = "fancybox-focus",
+      $pressed = null;
+
+    $D.on("mousedown mouseup focus blur", buttonStr, function (e) {
+      switch (e.type) {
+        case "mousedown":
+          $pressed = $(this);
+          break;
+        case "mouseup":
+          $pressed = null;
+          break;
+        case "focusin":
+          $(buttonStr).removeClass(focusStr);
+
+          if (!$(this).is($pressed) && !$(this).is("[disabled]")) {
+            $(this).addClass(focusStr);
+          }
+          break;
+        case "focusout":
+          $(buttonStr).removeClass(focusStr);
+          break;
+      }
+    });
+  })();
+})(window, document, jQuery);
+// ==========================================================================
+//
+// Media
+// Adds additional media type support
+//
+// ==========================================================================
+(function ($) {
+  "use strict";
+
+  // Object containing properties for each media type
+  var defaults = {
+    youtube: {
+      matcher: /(youtube\.com|youtu\.be|youtube\-nocookie\.com)\/(watch\?(.*&)?v=|v\/|u\/|embed\/?)?(videoseries\?list=(.*)|[\w-]{11}|\?listType=(.*)&list=(.*))(.*)/i,
+      params: {
+        autoplay: 1,
+        autohide: 1,
+        fs: 1,
+        rel: 0,
+        hd: 1,
+        wmode: "transparent",
+        enablejsapi: 1,
+        html5: 1
+      },
+      paramPlace: 8,
+      type: "iframe",
+      url: "https://www.youtube-nocookie.com/embed/$4",
+      thumb: "https://img.youtube.com/vi/$4/hqdefault.jpg"
+    },
+
+    vimeo: {
+      matcher: /^.+vimeo.com\/(.*\/)?([\d]+)(.*)?/,
+      params: {
+        autoplay: 1,
+        hd: 1,
+        show_title: 1,
+        show_byline: 1,
+        show_portrait: 0,
+        fullscreen: 1
+      },
+      paramPlace: 3,
+      type: "iframe",
+      url: "//player.vimeo.com/video/$2"
+    },
+
+    instagram: {
+      matcher: /(instagr\.am|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,
+      type: "image",
+      url: "//$1/p/$2/media/?size=l"
+    },
+
+    // Examples:
+    // http://maps.google.com/?ll=48.857995,2.294297&spn=0.007666,0.021136&t=m&z=16
+    // https://www.google.com/maps/@37.7852006,-122.4146355,14.65z
+    // https://www.google.com/maps/@52.2111123,2.9237542,6.61z?hl=en
+    // https://www.google.com/maps/place/Googleplex/@37.4220041,-122.0833494,17z/data=!4m5!3m4!1s0x0:0x6c296c66619367e0!8m2!3d37.4219998!4d-122.0840572
+    gmap_place: {
+      matcher: /(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(((maps\/(place\/(.*)\/)?\@(.*),(\d+.?\d+?)z))|(\?ll=))(.*)?/i,
+      type: "iframe",
+      url: function (rez) {
+        return (
+          "//maps.google." +
+          rez[2] +
+          "/?ll=" +
+          (rez[9] ? rez[9] + "&z=" + Math.floor(rez[10]) + (rez[12] ? rez[12].replace(/^\//, "&") : "") : rez[12] + "").replace(/\?/, "&") +
+          "&output=" +
+          (rez[12] && rez[12].indexOf("layer=c") > 0 ? "svembed" : "embed")
+        );
+      }
+    },
+
+    // Examples:
+    // https://www.google.com/maps/search/Empire+State+Building/
+    // https://www.google.com/maps/search/?api=1&query=centurylink+field
+    // https://www.google.com/maps/search/?api=1&query=47.5951518,-122.3316393
+    gmap_search: {
+      matcher: /(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(maps\/search\/)(.*)/i,
+      type: "iframe",
+      url: function (rez) {
+        return "//maps.google." + rez[2] + "/maps?q=" + rez[5].replace("query=", "q=").replace("api=1", "") + "&output=embed";
+      }
+    }
+  };
+
+  // Formats matching url to final form
+  var format = function (url, rez, params) {
+    if (!url) {
+      return;
+    }
+
+    params = params || "";
+
+    if ($.type(params) === "object") {
+      params = $.param(params, true);
+    }
+
+    $.each(rez, function (key, value) {
+      url = url.replace("$" + key, value || "");
+    });
+
+    if (params.length) {
+      url += (url.indexOf("?") > 0 ? "&" : "?") + params;
+    }
+
+    return url;
+  };
+
+  $(document).on("objectNeedsType.fb", function (e, instance, item) {
+    var url = item.src || "",
+      type = false,
+      media,
+      thumb,
+      rez,
+      params,
+      urlParams,
+      paramObj,
+      provider;
+
+    media = $.extend(true, {}, defaults, item.opts.media);
+
+    // Look for any matching media type
+    $.each(media, function (providerName, providerOpts) {
+      rez = url.match(providerOpts.matcher);
+
+      if (!rez) {
+        return;
+      }
+
+      type = providerOpts.type;
+      provider = providerName;
+      paramObj = {};
+
+      if (providerOpts.paramPlace && rez[providerOpts.paramPlace]) {
+        urlParams = rez[providerOpts.paramPlace];
+
+        if (urlParams[0] == "?") {
+          urlParams = urlParams.substring(1);
+        }
+
+        urlParams = urlParams.split("&");
+
+        for (var m = 0; m < urlParams.length; ++m) {
+          var p = urlParams[m].split("=", 2);
+
+          if (p.length == 2) {
+            paramObj[p[0]] = decodeURIComponent(p[1].replace(/\+/g, " "));
+          }
+        }
+      }
+
+      params = $.extend(true, {}, providerOpts.params, item.opts[providerName], paramObj);
+
+      url =
+        $.type(providerOpts.url) === "function" ? providerOpts.url.call(this, rez, params, item) : format(providerOpts.url, rez, params);
+
+      thumb =
+        $.type(providerOpts.thumb) === "function" ? providerOpts.thumb.call(this, rez, params, item) : format(providerOpts.thumb, rez);
+
+      if (providerName === "youtube") {
+        url = url.replace(/&t=((\d+)m)?(\d+)s/, function (match, p1, m, s) {
+          return "&start=" + ((m ? parseInt(m, 10) * 60 : 0) + parseInt(s, 10));
+        });
+      } else if (providerName === "vimeo") {
+        url = url.replace("&%23", "#");
+      }
+
+      return false;
+    });
+
+    // If it is found, then change content type and update the url
+
+    if (type) {
+      if (!item.opts.thumb && !(item.opts.$thumb && item.opts.$thumb.length)) {
+        item.opts.thumb = thumb;
+      }
+
+      if (type === "iframe") {
+        item.opts = $.extend(true, item.opts, {
+          iframe: {
+            preload: false,
+            attr: {
+              scrolling: "no"
+            }
+          }
+        });
+      }
+
+      $.extend(item, {
+        type: type,
+        src: url,
+        origSrc: item.src,
+        contentSource: provider,
+        contentType: type === "image" ? "image" : provider == "gmap_place" || provider == "gmap_search" ? "map" : "video"
+      });
+    } else if (url) {
+      item.type = item.opts.defaultType;
+    }
+  });
+
+  // Load YouTube/Video API on request to detect when video finished playing
+  var VideoAPILoader = {
+    youtube: {
+      src: "https://www.youtube.com/iframe_api",
+      class: "YT",
+      loading: false,
+      loaded: false
+    },
+
+    vimeo: {
+      src: "https://player.vimeo.com/api/player.js",
+      class: "Vimeo",
+      loading: false,
+      loaded: false
+    },
+
+    load: function (vendor) {
+      var _this = this,
+        script;
+
+      if (this[vendor].loaded) {
+        setTimeout(function () {
+          _this.done(vendor);
+        });
+        return;
+      }
+
+      if (this[vendor].loading) {
+        return;
+      }
+
+      this[vendor].loading = true;
+
+      script = document.createElement("script");
+      script.type = "text/javascript";
+      script.src = this[vendor].src;
+
+      if (vendor === "youtube") {
+        window.onYouTubeIframeAPIReady = function () {
+          _this[vendor].loaded = true;
+          _this.done(vendor);
+        };
+      } else {
+        script.onload = function () {
+          _this[vendor].loaded = true;
+          _this.done(vendor);
+        };
+      }
+
+      document.body.appendChild(script);
+    },
+    done: function (vendor) {
+      var instance, $el, player;
+
+      if (vendor === "youtube") {
+        delete window.onYouTubeIframeAPIReady;
+      }
+
+      instance = $.fancybox.getInstance();
+
+      if (instance) {
+        $el = instance.current.$content.find("iframe");
+
+        if (vendor === "youtube" && YT !== undefined && YT) {
+          player = new YT.Player($el.attr("id"), {
+            events: {
+              onStateChange: function (e) {
+                if (e.data == 0) {
+                  instance.next();
+                }
+              }
+            }
+          });
+        } else if (vendor === "vimeo" && Vimeo !== undefined && Vimeo) {
+          player = new Vimeo.Player($el);
+
+          player.on("ended", function () {
+            instance.next();
+          });
+        }
+      }
+    }
+  };
+
+  $(document).on({
+    "afterShow.fb": function (e, instance, current) {
+      if (instance.group.length > 1 && (current.contentSource === "youtube" || current.contentSource === "vimeo")) {
+        VideoAPILoader.load(current.contentSource);
+      }
+    }
+  });
+})(jQuery);
+// ==========================================================================
+//
+// Guestures
+// Adds touch guestures, handles click and tap events
+//
+// ==========================================================================
+(function (window, document, $) {
+  "use strict";
+
+  var requestAFrame = (function () {
+    return (
+      window.requestAnimationFrame ||
+      window.webkitRequestAnimationFrame ||
+      window.mozRequestAnimationFrame ||
+      window.oRequestAnimationFrame ||
+      // if all else fails, use setTimeout
+      function (callback) {
+        return window.setTimeout(callback, 1000 / 60);
+      }
+    );
+  })();
+
+  var cancelAFrame = (function () {
+    return (
+      window.cancelAnimationFrame ||
+      window.webkitCancelAnimationFrame ||
+      window.mozCancelAnimationFrame ||
+      window.oCancelAnimationFrame ||
+      function (id) {
+        window.clearTimeout(id);
+      }
+    );
+  })();
+
+  var getPointerXY = function (e) {
+    var result = [];
+
+    e = e.originalEvent || e || window.e;
+    e = e.touches && e.touches.length ? e.touches : e.changedTouches && e.changedTouches.length ? e.changedTouches : [e];
+
+    for (var key in e) {
+      if (e[key].pageX) {
+        result.push({
+          x: e[key].pageX,
+          y: e[key].pageY
+        });
+      } else if (e[key].clientX) {
+        result.push({
+          x: e[key].clientX,
+          y: e[key].clientY
+        });
+      }
+    }
+
+    return result;
+  };
+
+  var distance = function (point2, point1, what) {
+    if (!point1 || !point2) {
+      return 0;
+    }
+
+    if (what === "x") {
+      return point2.x - point1.x;
+    } else if (what === "y") {
+      return point2.y - point1.y;
+    }
+
+    return Math.sqrt(Math.pow(point2.x - point1.x, 2) + Math.pow(point2.y - point1.y, 2));
+  };
+
+  var isClickable = function ($el) {
+    if (
+      $el.is('a,area,button,[role="button"],input,label,select,summary,textarea,video,audio,iframe') ||
+      $.isFunction($el.get(0).onclick) ||
+      $el.data("selectable")
+    ) {
+      return true;
+    }
+
+    // Check for attributes like data-fancybox-next or data-fancybox-close
+    for (var i = 0, atts = $el[0].attributes, n = atts.length; i < n; i++) {
+      if (atts[i].nodeName.substr(0, 14) === "data-fancybox-") {
+        return true;
+      }
+    }
+
+    return false;
+  };
+
+  var hasScrollbars = function (el) {
+    var overflowY = window.getComputedStyle(el)["overflow-y"],
+      overflowX = window.getComputedStyle(el)["overflow-x"],
+      vertical = (overflowY === "scroll" || overflowY === "auto") && el.scrollHeight > el.clientHeight,
+      horizontal = (overflowX === "scroll" || overflowX === "auto") && el.scrollWidth > el.clientWidth;
+
+    return vertical || horizontal;
+  };
+
+  var isScrollable = function ($el) {
+    var rez = false;
+
+    while (true) {
+      rez = hasScrollbars($el.get(0));
+
+      if (rez) {
+        break;
+      }
+
+      $el = $el.parent();
+
+      if (!$el.length || $el.hasClass("fancybox-stage") || $el.is("body")) {
+        break;
+      }
+    }
+
+    return rez;
+  };
+
+  var Guestures = function (instance) {
+    var self = this;
+
+    self.instance = instance;
+
+    self.$bg = instance.$refs.bg;
+    self.$stage = instance.$refs.stage;
+    self.$container = instance.$refs.container;
+
+    self.destroy();
+
+    self.$container.on("touchstart.fb.touch mousedown.fb.touch", $.proxy(self, "ontouchstart"));
+  };
+
+  Guestures.prototype.destroy = function () {
+    var self = this;
+
+    self.$container.off(".fb.touch");
+
+    $(document).off(".fb.touch");
+
+    if (self.requestId) {
+      cancelAFrame(self.requestId);
+      self.requestId = null;
+    }
+
+    if (self.tapped) {
+      clearTimeout(self.tapped);
+      self.tapped = null;
+    }
+  };
+
+  Guestures.prototype.ontouchstart = function (e) {
+    var self = this,
+      $target = $(e.target),
+      instance = self.instance,
+      current = instance.current,
+      $slide = current.$slide,
+      $content = current.$content,
+      isTouchDevice = e.type == "touchstart";
+
+    // Do not respond to both (touch and mouse) events
+    if (isTouchDevice) {
+      self.$container.off("mousedown.fb.touch");
+    }
+
+    // Ignore right click
+    if (e.originalEvent && e.originalEvent.button == 2) {
+      return;
+    }
+
+    // Ignore taping on links, buttons, input elements
+    if (!$slide.length || !$target.length || isClickable($target) || isClickable($target.parent())) {
+      return;
+    }
+    // Ignore clicks on the scrollbar
+    if (!$target.is("img") && e.originalEvent.clientX > $target[0].clientWidth + $target.offset().left) {
+      return;
+    }
+
+    // Ignore clicks while zooming or closing
+    if (!current || instance.isAnimating || current.$slide.hasClass("fancybox-animated")) {
+      e.stopPropagation();
+      e.preventDefault();
+
+      return;
+    }
+
+    self.realPoints = self.startPoints = getPointerXY(e);
+
+    if (!self.startPoints.length) {
+      return;
+    }
+
+    // Allow other scripts to catch touch event if "touch" is set to false
+    if (current.touch) {
+      e.stopPropagation();
+    }
+
+    self.startEvent = e;
+
+    self.canTap = true;
+    self.$target = $target;
+    self.$content = $content;
+    self.opts = current.opts.touch;
+
+    self.isPanning = false;
+    self.isSwiping = false;
+    self.isZooming = false;
+    self.isScrolling = false;
+    self.canPan = instance.canPan();
+
+    self.startTime = new Date().getTime();
+    self.distanceX = self.distanceY = self.distance = 0;
+
+    self.canvasWidth = Math.round($slide[0].clientWidth);
+    self.canvasHeight = Math.round($slide[0].clientHeight);
+
+    self.contentLastPos = null;
+    self.contentStartPos = $.fancybox.getTranslate(self.$content) || {
+      top: 0,
+      left: 0
+    };
+    self.sliderStartPos = $.fancybox.getTranslate($slide);
+
+    // Since position will be absolute, but we need to make it relative to the stage
+    self.stagePos = $.fancybox.getTranslate(instance.$refs.stage);
+
+    self.sliderStartPos.top -= self.stagePos.top;
+    self.sliderStartPos.left -= self.stagePos.left;
+
+    self.contentStartPos.top -= self.stagePos.top;
+    self.contentStartPos.left -= self.stagePos.left;
+
+    $(document)
+      .off(".fb.touch")
+      .on(isTouchDevice ? "touchend.fb.touch touchcancel.fb.touch" : "mouseup.fb.touch mouseleave.fb.touch", $.proxy(self, "ontouchend"))
+      .on(isTouchDevice ? "touchmove.fb.touch" : "mousemove.fb.touch", $.proxy(self, "ontouchmove"));
+
+    if ($.fancybox.isMobile) {
+      document.addEventListener("scroll", self.onscroll, true);
+    }
+
+    // Skip if clicked outside the sliding area
+    if (!(self.opts || self.canPan) || !($target.is(self.$stage) || self.$stage.find($target).length)) {
+      if ($target.is(".fancybox-image")) {
+        e.preventDefault();
+      }
+
+      if (!($.fancybox.isMobile && $target.parents(".fancybox-caption").length)) {
+        return;
+      }
+    }
+
+    self.isScrollable = isScrollable($target) || isScrollable($target.parent());
+
+    // Check if element is scrollable and try to prevent default behavior (scrolling)
+    if (!($.fancybox.isMobile && self.isScrollable)) {
+      e.preventDefault();
+    }
+
+    // One finger or mouse click - swipe or pan an image
+    if (self.startPoints.length === 1 || current.hasError) {
+      if (self.canPan) {
+        $.fancybox.stop(self.$content);
+
+        self.isPanning = true;
+      } else {
+        self.isSwiping = true;
+      }
+
+      self.$container.addClass("fancybox-is-grabbing");
+    }
+
+    // Two fingers - zoom image
+    if (self.startPoints.length === 2 && current.type === "image" && (current.isLoaded || current.$ghost)) {
+      self.canTap = false;
+      self.isSwiping = false;
+      self.isPanning = false;
+
+      self.isZooming = true;
+
+      $.fancybox.stop(self.$content);
+
+      self.centerPointStartX = (self.startPoints[0].x + self.startPoints[1].x) * 0.5 - $(window).scrollLeft();
+      self.centerPointStartY = (self.startPoints[0].y + self.startPoints[1].y) * 0.5 - $(window).scrollTop();
+
+      self.percentageOfImageAtPinchPointX = (self.centerPointStartX - self.contentStartPos.left) / self.contentStartPos.width;
+      self.percentageOfImageAtPinchPointY = (self.centerPointStartY - self.contentStartPos.top) / self.contentStartPos.height;
+
+      self.startDistanceBetweenFingers = distance(self.startPoints[0], self.startPoints[1]);
+    }
+  };
+
+  Guestures.prototype.onscroll = function (e) {
+    var self = this;
+
+    self.isScrolling = true;
+
+    document.removeEventListener("scroll", self.onscroll, true);
+  };
+
+  Guestures.prototype.ontouchmove = function (e) {
+    var self = this;
+
+    // Make sure user has not released over iframe or disabled element
+    if (e.originalEvent.buttons !== undefined && e.originalEvent.buttons === 0) {
+      self.ontouchend(e);
+      return;
+    }
+
+    if (self.isScrolling) {
+      self.canTap = false;
+      return;
+    }
+
+    self.newPoints = getPointerXY(e);
+
+    if (!(self.opts || self.canPan) || !self.newPoints.length || !self.newPoints.length) {
+      return;
+    }
+
+    if (!(self.isSwiping && self.isSwiping === true)) {
+      e.preventDefault();
+    }
+
+    self.distanceX = distance(self.newPoints[0], self.startPoints[0], "x");
+    self.distanceY = distance(self.newPoints[0], self.startPoints[0], "y");
+
+    self.distance = distance(self.newPoints[0], self.startPoints[0]);
+
+    // Skip false ontouchmove events (Chrome)
+    if (self.distance > 0) {
+      if (self.isSwiping) {
+        self.onSwipe(e);
+      } else if (self.isPanning) {
+        self.onPan();
+      } else if (self.isZooming) {
+        self.onZoom();
+      }
+    }
+  };
+
+  Guestures.prototype.onSwipe = function (e) {
+    var self = this,
+      instance = self.instance,
+      swiping = self.isSwiping,
+      left = self.sliderStartPos.left || 0,
+      angle;
+
+    // If direction is not yet determined
+    if (swiping === true) {
+      // We need at least 10px distance to correctly calculate an angle
+      if (Math.abs(self.distance) > 10) {
+        self.canTap = false;
+
+        if (instance.group.length < 2 && self.opts.vertical) {
+          self.isSwiping = "y";
+        } else if (instance.isDragging || self.opts.vertical === false || (self.opts.vertical === "auto" && $(window).width() > 800)) {
+          self.isSwiping = "x";
+        } else {
+          angle = Math.abs((Math.atan2(self.distanceY, self.distanceX) * 180) / Math.PI);
+
+          self.isSwiping = angle > 45 && angle < 135 ? "y" : "x";
+        }
+
+        if (self.isSwiping === "y" && $.fancybox.isMobile && self.isScrollable) {
+          self.isScrolling = true;
+
+          return;
+        }
+
+        instance.isDragging = self.isSwiping;
+
+        // Reset points to avoid jumping, because we dropped first swipes to calculate the angle
+        self.startPoints = self.newPoints;
+
+        $.each(instance.slides, function (index, slide) {
+          var slidePos, stagePos;
+
+          $.fancybox.stop(slide.$slide);
+
+          slidePos = $.fancybox.getTranslate(slide.$slide);
+          stagePos = $.fancybox.getTranslate(instance.$refs.stage);
+
+          slide.$slide
+            .css({
+              transform: "",
+              opacity: "",
+              "transition-duration": ""
+            })
+            .removeClass("fancybox-animated")
+            .removeClass(function (index, className) {
+              return (className.match(/(^|\s)fancybox-fx-\S+/g) || []).join(" ");
+            });
+
+          if (slide.pos === instance.current.pos) {
+            self.sliderStartPos.top = slidePos.top - stagePos.top;
+            self.sliderStartPos.left = slidePos.left - stagePos.left;
+          }
+
+          $.fancybox.setTranslate(slide.$slide, {
+            top: slidePos.top - stagePos.top,
+            left: slidePos.left - stagePos.left
+          });
+        });
+
+        // Stop slideshow
+        if (instance.SlideShow && instance.SlideShow.isActive) {
+          instance.SlideShow.stop();
+        }
+      }
+
+      return;
+    }
+
+    // Sticky edges
+    if (swiping == "x") {
+      if (
+        self.distanceX > 0 &&
+        (self.instance.group.length < 2 || (self.instance.current.index === 0 && !self.instance.current.opts.loop))
+      ) {
+        left = left + Math.pow(self.distanceX, 0.8);
+      } else if (
+        self.distanceX < 0 &&
+        (self.instance.group.length < 2 ||
+          (self.instance.current.index === self.instance.group.length - 1 && !self.instance.current.opts.loop))
+      ) {
+        left = left - Math.pow(-self.distanceX, 0.8);
+      } else {
+        left = left + self.distanceX;
+      }
+    }
+
+    self.sliderLastPos = {
+      top: swiping == "x" ? 0 : self.sliderStartPos.top + self.distanceY,
+      left: left
+    };
+
+    if (self.requestId) {
+      cancelAFrame(self.requestId);
+
+      self.requestId = null;
+    }
+
+    self.requestId = requestAFrame(function () {
+      if (self.sliderLastPos) {
+        $.each(self.instance.slides, function (index, slide) {
+          var pos = slide.pos - self.instance.currPos;
+
+          $.fancybox.setTranslate(slide.$slide, {
+            top: self.sliderLastPos.top,
+            left: self.sliderLastPos.left + pos * self.canvasWidth + pos * slide.opts.gutter
+          });
+        });
+
+        self.$container.addClass("fancybox-is-sliding");
+      }
+    });
+  };
+
+  Guestures.prototype.onPan = function () {
+    var self = this;
+
+    // Prevent accidental movement (sometimes, when tapping casually, finger can move a bit)
+    if (distance(self.newPoints[0], self.realPoints[0]) < ($.fancybox.isMobile ? 10 : 5)) {
+      self.startPoints = self.newPoints;
+      return;
+    }
+
+    self.canTap = false;
+
+    self.contentLastPos = self.limitMovement();
+
+    if (self.requestId) {
+      cancelAFrame(self.requestId);
+    }
+
+    self.requestId = requestAFrame(function () {
+      $.fancybox.setTranslate(self.$content, self.contentLastPos);
+    });
+  };
+
+  // Make panning sticky to the edges
+  Guestures.prototype.limitMovement = function () {
+    var self = this;
+
+    var canvasWidth = self.canvasWidth;
+    var canvasHeight = self.canvasHeight;
+
+    var distanceX = self.distanceX;
+    var distanceY = self.distanceY;
+
+    var contentStartPos = self.contentStartPos;
+
+    var currentOffsetX = contentStartPos.left;
+    var currentOffsetY = contentStartPos.top;
+
+    var currentWidth = contentStartPos.width;
+    var currentHeight = contentStartPos.height;
+
+    var minTranslateX, minTranslateY, maxTranslateX, maxTranslateY, newOffsetX, newOffsetY;
+
+    if (currentWidth > canvasWidth) {
+      newOffsetX = currentOffsetX + distanceX;
+    } else {
+      newOffsetX = currentOffsetX;
+    }
+
+    newOffsetY = currentOffsetY + distanceY;
+
+    // Slow down proportionally to traveled distance
+    minTranslateX = Math.max(0, canvasWidth * 0.5 - currentWidth * 0.5);
+    minTranslateY = Math.max(0, canvasHeight * 0.5 - currentHeight * 0.5);
+
+    maxTranslateX = Math.min(canvasWidth - currentWidth, canvasWidth * 0.5 - currentWidth * 0.5);
+    maxTranslateY = Math.min(canvasHeight - currentHeight, canvasHeight * 0.5 - currentHeight * 0.5);
+
+    //   ->
+    if (distanceX > 0 && newOffsetX > minTranslateX) {
+      newOffsetX = minTranslateX - 1 + Math.pow(-minTranslateX + currentOffsetX + distanceX, 0.8) || 0;
+    }
+
+    //    <-
+    if (distanceX < 0 && newOffsetX < maxTranslateX) {
+      newOffsetX = maxTranslateX + 1 - Math.pow(maxTranslateX - currentOffsetX - distanceX, 0.8) || 0;
+    }
+
+    //   \/
+    if (distanceY > 0 && newOffsetY > minTranslateY) {
+      newOffsetY = minTranslateY - 1 + Math.pow(-minTranslateY + currentOffsetY + distanceY, 0.8) || 0;
+    }
+
+    //   /\
+    if (distanceY < 0 && newOffsetY < maxTranslateY) {
+      newOffsetY = maxTranslateY + 1 - Math.pow(maxTranslateY - currentOffsetY - distanceY, 0.8) || 0;
+    }
+
+    return {
+      top: newOffsetY,
+      left: newOffsetX
+    };
+  };
+
+  Guestures.prototype.limitPosition = function (newOffsetX, newOffsetY, newWidth, newHeight) {
+    var self = this;
+
+    var canvasWidth = self.canvasWidth;
+    var canvasHeight = self.canvasHeight;
+
+    if (newWidth > canvasWidth) {
+      newOffsetX = newOffsetX > 0 ? 0 : newOffsetX;
+      newOffsetX = newOffsetX < canvasWidth - newWidth ? canvasWidth - newWidth : newOffsetX;
+    } else {
+      // Center horizontally
+      newOffsetX = Math.max(0, canvasWidth / 2 - newWidth / 2);
+    }
+
+    if (newHeight > canvasHeight) {
+      newOffsetY = newOffsetY > 0 ? 0 : newOffsetY;
+      newOffsetY = newOffsetY < canvasHeight - newHeight ? canvasHeight - newHeight : newOffsetY;
+    } else {
+      // Center vertically
+      newOffsetY = Math.max(0, canvasHeight / 2 - newHeight / 2);
+    }
+
+    return {
+      top: newOffsetY,
+      left: newOffsetX
+    };
+  };
+
+  Guestures.prototype.onZoom = function () {
+    var self = this;
+
+    // Calculate current distance between points to get pinch ratio and new width and height
+    var contentStartPos = self.contentStartPos;
+
+    var currentWidth = contentStartPos.width;
+    var currentHeight = contentStartPos.height;
+
+    var currentOffsetX = contentStartPos.left;
+    var currentOffsetY = contentStartPos.top;
+
+    var endDistanceBetweenFingers = distance(self.newPoints[0], self.newPoints[1]);
+
+    var pinchRatio = endDistanceBetweenFingers / self.startDistanceBetweenFingers;
+
+    var newWidth = Math.floor(currentWidth * pinchRatio);
+    var newHeight = Math.floor(currentHeight * pinchRatio);
+
+    // This is the translation due to pinch-zooming
+    var translateFromZoomingX = (currentWidth - newWidth) * self.percentageOfImageAtPinchPointX;
+    var translateFromZoomingY = (currentHeight - newHeight) * self.percentageOfImageAtPinchPointY;
+
+    // Point between the two touches
+    var centerPointEndX = (self.newPoints[0].x + self.newPoints[1].x) / 2 - $(window).scrollLeft();
+    var centerPointEndY = (self.newPoints[0].y + self.newPoints[1].y) / 2 - $(window).scrollTop();
+
+    // And this is the translation due to translation of the centerpoint
+    // between the two fingers
+    var translateFromTranslatingX = centerPointEndX - self.centerPointStartX;
+    var translateFromTranslatingY = centerPointEndY - self.centerPointStartY;
+
+    // The new offset is the old/current one plus the total translation
+    var newOffsetX = currentOffsetX + (translateFromZoomingX + translateFromTranslatingX);
+    var newOffsetY = currentOffsetY + (translateFromZoomingY + translateFromTranslatingY);
+
+    var newPos = {
+      top: newOffsetY,
+      left: newOffsetX,
+      scaleX: pinchRatio,
+      scaleY: pinchRatio
+    };
+
+    self.canTap = false;
+
+    self.newWidth = newWidth;
+    self.newHeight = newHeight;
+
+    self.contentLastPos = newPos;
+
+    if (self.requestId) {
+      cancelAFrame(self.requestId);
+    }
+
+    self.requestId = requestAFrame(function () {
+      $.fancybox.setTranslate(self.$content, self.contentLastPos);
+    });
+  };
+
+  Guestures.prototype.ontouchend = function (e) {
+    var self = this;
+
+    var swiping = self.isSwiping;
+    var panning = self.isPanning;
+    var zooming = self.isZooming;
+    var scrolling = self.isScrolling;
+
+    self.endPoints = getPointerXY(e);
+    self.dMs = Math.max(new Date().getTime() - self.startTime, 1);
+
+    self.$container.removeClass("fancybox-is-grabbing");
+
+    $(document).off(".fb.touch");
+
+    document.removeEventListener("scroll", self.onscroll, true);
+
+    if (self.requestId) {
+      cancelAFrame(self.requestId);
+
+      self.requestId = null;
+    }
+
+    self.isSwiping = false;
+    self.isPanning = false;
+    self.isZooming = false;
+    self.isScrolling = false;
+
+    self.instance.isDragging = false;
+
+    if (self.canTap) {
+      return self.onTap(e);
+    }
+
+    self.speed = 100;
+
+    // Speed in px/ms
+    self.velocityX = (self.distanceX / self.dMs) * 0.5;
+    self.velocityY = (self.distanceY / self.dMs) * 0.5;
+
+    if (panning) {
+      self.endPanning();
+    } else if (zooming) {
+      self.endZooming();
+    } else {
+      self.endSwiping(swiping, scrolling);
+    }
+
+    return;
+  };
+
+  Guestures.prototype.endSwiping = function (swiping, scrolling) {
+    var self = this,
+      ret = false,
+      len = self.instance.group.length,
+      distanceX = Math.abs(self.distanceX),
+      canAdvance = swiping == "x" && len > 1 && ((self.dMs > 130 && distanceX > 10) || distanceX > 50),
+      speedX = 300;
+
+    self.sliderLastPos = null;
+
+    // Close if swiped vertically / navigate if horizontally
+    if (swiping == "y" && !scrolling && Math.abs(self.distanceY) > 50) {
+      // Continue vertical movement
+      $.fancybox.animate(
+        self.instance.current.$slide, {
+          top: self.sliderStartPos.top + self.distanceY + self.velocityY * 150,
+          opacity: 0
+        },
+        200
+      );
+      ret = self.instance.close(true, 250);
+    } else if (canAdvance && self.distanceX > 0) {
+      ret = self.instance.previous(speedX);
+    } else if (canAdvance && self.distanceX < 0) {
+      ret = self.instance.next(speedX);
+    }
+
+    if (ret === false && (swiping == "x" || swiping == "y")) {
+      self.instance.centerSlide(200);
+    }
+
+    self.$container.removeClass("fancybox-is-sliding");
+  };
+
+  // Limit panning from edges
+  // ========================
+  Guestures.prototype.endPanning = function () {
+    var self = this,
+      newOffsetX,
+      newOffsetY,
+      newPos;
+
+    if (!self.contentLastPos) {
+      return;
+    }
+
+    if (self.opts.momentum === false || self.dMs > 350) {
+      newOffsetX = self.contentLastPos.left;
+      newOffsetY = self.contentLastPos.top;
+    } else {
+      // Continue movement
+      newOffsetX = self.contentLastPos.left + self.velocityX * 500;
+      newOffsetY = self.contentLastPos.top + self.velocityY * 500;
+    }
+
+    newPos = self.limitPosition(newOffsetX, newOffsetY, self.contentStartPos.width, self.contentStartPos.height);
+
+    newPos.width = self.contentStartPos.width;
+    newPos.height = self.contentStartPos.height;
+
+    $.fancybox.animate(self.$content, newPos, 366);
+  };
+
+  Guestures.prototype.endZooming = function () {
+    var self = this;
+
+    var current = self.instance.current;
+
+    var newOffsetX, newOffsetY, newPos, reset;
+
+    var newWidth = self.newWidth;
+    var newHeight = self.newHeight;
+
+    if (!self.contentLastPos) {
+      return;
+    }
+
+    newOffsetX = self.contentLastPos.left;
+    newOffsetY = self.contentLastPos.top;
+
+    reset = {
+      top: newOffsetY,
+      left: newOffsetX,
+      width: newWidth,
+      height: newHeight,
+      scaleX: 1,
+      scaleY: 1
+    };
+
+    // Reset scalex/scaleY values; this helps for perfomance and does not break animation
+    $.fancybox.setTranslate(self.$content, reset);
+
+    if (newWidth < self.canvasWidth && newHeight < self.canvasHeight) {
+      self.instance.scaleToFit(150);
+    } else if (newWidth > current.width || newHeight > current.height) {
+      self.instance.scaleToActual(self.centerPointStartX, self.centerPointStartY, 150);
+    } else {
+      newPos = self.limitPosition(newOffsetX, newOffsetY, newWidth, newHeight);
+
+      $.fancybox.animate(self.$content, newPos, 150);
+    }
+  };
+
+  Guestures.prototype.onTap = function (e) {
+    var self = this;
+    var $target = $(e.target);
+
+    var instance = self.instance;
+    var current = instance.current;
+
+    var endPoints = (e && getPointerXY(e)) || self.startPoints;
+
+    var tapX = endPoints[0] ? endPoints[0].x - $(window).scrollLeft() - self.stagePos.left : 0;
+    var tapY = endPoints[0] ? endPoints[0].y - $(window).scrollTop() - self.stagePos.top : 0;
+
+    var where;
+
+    var process = function (prefix) {
+      var action = current.opts[prefix];
+
+      if ($.isFunction(action)) {
+        action = action.apply(instance, [current, e]);
+      }
+
+      if (!action) {
+        return;
+      }
+
+      switch (action) {
+        case "close":
+          instance.close(self.startEvent);
+
+          break;
+
+        case "toggleControls":
+          instance.toggleControls();
+
+          break;
+
+        case "next":
+          instance.next();
+
+          break;
+
+        case "nextOrClose":
+          if (instance.group.length > 1) {
+            instance.next();
+          } else {
+            instance.close(self.startEvent);
+          }
+
+          break;
+
+        case "zoom":
+          if (current.type == "image" && (current.isLoaded || current.$ghost)) {
+            if (instance.canPan()) {
+              instance.scaleToFit();
+            } else if (instance.isScaledDown()) {
+              instance.scaleToActual(tapX, tapY);
+            } else if (instance.group.length < 2) {
+              instance.close(self.startEvent);
+            }
+          }
+
+          break;
+      }
+    };
+
+    // Ignore right click
+    if (e.originalEvent && e.originalEvent.button == 2) {
+      return;
+    }
+
+    // Skip if clicked on the scrollbar
+    if (!$target.is("img") && tapX > $target[0].clientWidth + $target.offset().left) {
+      return;
+    }
+
+    // Check where is clicked
+    if ($target.is(".fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-container")) {
+      where = "Outside";
+    } else if ($target.is(".fancybox-slide")) {
+      where = "Slide";
+    } else if (
+      instance.current.$content &&
+      instance.current.$content
+      .find($target)
+      .addBack()
+      .filter($target).length
+    ) {
+      where = "Content";
+    } else {
+      return;
+    }
+
+    // Check if this is a double tap
+    if (self.tapped) {
+      // Stop previously created single tap
+      clearTimeout(self.tapped);
+      self.tapped = null;
+
+      // Skip if distance between taps is too big
+      if (Math.abs(tapX - self.tapX) > 50 || Math.abs(tapY - self.tapY) > 50) {
+        return this;
+      }
+
+      // OK, now we assume that this is a double-tap
+      process("dblclick" + where);
+    } else {
+      // Single tap will be processed if user has not clicked second time within 300ms
+      // or there is no need to wait for double-tap
+      self.tapX = tapX;
+      self.tapY = tapY;
+
+      if (current.opts["dblclick" + where] && current.opts["dblclick" + where] !== current.opts["click" + where]) {
+        self.tapped = setTimeout(function () {
+          self.tapped = null;
+
+          if (!instance.isAnimating) {
+            process("click" + where);
+          }
+        }, 500);
+      } else {
+        process("click" + where);
+      }
+    }
+
+    return this;
+  };
+
+  $(document)
+    .on("onActivate.fb", function (e, instance) {
+      if (instance && !instance.Guestures) {
+        instance.Guestures = new Guestures(instance);
+      }
+    })
+    .on("beforeClose.fb", function (e, instance) {
+      if (instance && instance.Guestures) {
+        instance.Guestures.destroy();
+      }
+    });
+})(window, document, jQuery);
+// ==========================================================================
+//
+// SlideShow
+// Enables slideshow functionality
+//
+// Example of usage:
+// $.fancybox.getInstance().SlideShow.start()
+//
+// ==========================================================================
+(function (document, $) {
+  "use strict";
+
+  $.extend(true, $.fancybox.defaults, {
+    btnTpl: {
+      slideShow: '<button data-fancybox-play class="fancybox-button fancybox-button--play" title="{{PLAY_START}}">' +
+        '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M6.5 5.4v13.2l11-6.6z"/></svg>' +
+        '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M8.33 5.75h2.2v12.5h-2.2V5.75zm5.15 0h2.2v12.5h-2.2V5.75z"/></svg>' +
+        "</button>"
+    },
+    slideShow: {
+      autoStart: false,
+      speed: 3000,
+      progress: true
+    }
+  });
+
+  var SlideShow = function (instance) {
+    this.instance = instance;
+    this.init();
+  };
+
+  $.extend(SlideShow.prototype, {
+    timer: null,
+    isActive: false,
+    $button: null,
+
+    init: function () {
+      var self = this,
+        instance = self.instance,
+        opts = instance.group[instance.currIndex].opts.slideShow;
+
+      self.$button = instance.$refs.toolbar.find("[data-fancybox-play]").on("click", function () {
+        self.toggle();
+      });
+
+      if (instance.group.length < 2 || !opts) {
+        self.$button.hide();
+      } else if (opts.progress) {
+        self.$progress = $('<div class="fancybox-progress"></div>').appendTo(instance.$refs.inner);
+      }
+    },
+
+    set: function (force) {
+      var self = this,
+        instance = self.instance,
+        current = instance.current;
+
+      // Check if reached last element
+      if (current && (force === true || current.opts.loop || instance.currIndex < instance.group.length - 1)) {
+        if (self.isActive && current.contentType !== "video") {
+          if (self.$progress) {
+            $.fancybox.animate(self.$progress.show(), {
+              scaleX: 1
+            }, current.opts.slideShow.speed);
+          }
+
+          self.timer = setTimeout(function () {
+            if (!instance.current.opts.loop && instance.current.index == instance.group.length - 1) {
+              instance.jumpTo(0);
+            } else {
+              instance.next();
+            }
+          }, current.opts.slideShow.speed);
+        }
+      } else {
+        self.stop();
+        instance.idleSecondsCounter = 0;
+        instance.showControls();
+      }
+    },
+
+    clear: function () {
+      var self = this;
+
+      clearTimeout(self.timer);
+
+      self.timer = null;
+
+      if (self.$progress) {
+        self.$progress.removeAttr("style").hide();
+      }
+    },
+
+    start: function () {
+      var self = this,
+        current = self.instance.current;
+
+      if (current) {
+        self.$button
+          .attr("title", (current.opts.i18n[current.opts.lang] || current.opts.i18n.en).PLAY_STOP)
+          .removeClass("fancybox-button--play")
+          .addClass("fancybox-button--pause");
+
+        self.isActive = true;
+
+        if (current.isComplete) {
+          self.set(true);
+        }
+
+        self.instance.trigger("onSlideShowChange", true);
+      }
+    },
+
+    stop: function () {
+      var self = this,
+        current = self.instance.current;
+
+      self.clear();
+
+      self.$button
+        .attr("title", (current.opts.i18n[current.opts.lang] || current.opts.i18n.en).PLAY_START)
+        .removeClass("fancybox-button--pause")
+        .addClass("fancybox-button--play");
+
+      self.isActive = false;
+
+      self.instance.trigger("onSlideShowChange", false);
+
+      if (self.$progress) {
+        self.$progress.removeAttr("style").hide();
+      }
+    },
+
+    toggle: function () {
+      var self = this;
+
+      if (self.isActive) {
+        self.stop();
+      } else {
+        self.start();
+      }
+    }
+  });
+
+  $(document).on({
+    "onInit.fb": function (e, instance) {
+      if (instance && !instance.SlideShow) {
+        instance.SlideShow = new SlideShow(instance);
+      }
+    },
+
+    "beforeShow.fb": function (e, instance, current, firstRun) {
+      var SlideShow = instance && instance.SlideShow;
+
+      if (firstRun) {
+        if (SlideShow && current.opts.slideShow.autoStart) {
+          SlideShow.start();
+        }
+      } else if (SlideShow && SlideShow.isActive) {
+        SlideShow.clear();
+      }
+    },
+
+    "afterShow.fb": function (e, instance, current) {
+      var SlideShow = instance && instance.SlideShow;
+
+      if (SlideShow && SlideShow.isActive) {
+        SlideShow.set();
+      }
+    },
+
+    "afterKeydown.fb": function (e, instance, current, keypress, keycode) {
+      var SlideShow = instance && instance.SlideShow;
+
+      // "P" or Spacebar
+      if (SlideShow && current.opts.slideShow && (keycode === 80 || keycode === 32) && !$(document.activeElement).is("button,a,input")) {
+        keypress.preventDefault();
+
+        SlideShow.toggle();
+      }
+    },
+
+    "beforeClose.fb onDeactivate.fb": function (e, instance) {
+      var SlideShow = instance && instance.SlideShow;
+
+      if (SlideShow) {
+        SlideShow.stop();
+      }
+    }
+  });
+
+  // Page Visibility API to pause slideshow when window is not active
+  $(document).on("visibilitychange", function () {
+    var instance = $.fancybox.getInstance(),
+      SlideShow = instance && instance.SlideShow;
+
+    if (SlideShow && SlideShow.isActive) {
+      if (document.hidden) {
+        SlideShow.clear();
+      } else {
+        SlideShow.set();
+      }
+    }
+  });
+})(document, jQuery);
+// ==========================================================================
+//
+// FullScreen
+// Adds fullscreen functionality
+//
+// ==========================================================================
+(function (document, $) {
+  "use strict";
+
+  // Collection of methods supported by user browser
+  var fn = (function () {
+    var fnMap = [
+      ["requestFullscreen", "exitFullscreen", "fullscreenElement", "fullscreenEnabled", "fullscreenchange", "fullscreenerror"],
+      // new WebKit
+      [
+        "webkitRequestFullscreen",
+        "webkitExitFullscreen",
+        "webkitFullscreenElement",
+        "webkitFullscreenEnabled",
+        "webkitfullscreenchange",
+        "webkitfullscreenerror"
+      ],
+      // old WebKit (Safari 5.1)
+      [
+        "webkitRequestFullScreen",
+        "webkitCancelFullScreen",
+        "webkitCurrentFullScreenElement",
+        "webkitCancelFullScreen",
+        "webkitfullscreenchange",
+        "webkitfullscreenerror"
+      ],
+      [
+        "mozRequestFullScreen",
+        "mozCancelFullScreen",
+        "mozFullScreenElement",
+        "mozFullScreenEnabled",
+        "mozfullscreenchange",
+        "mozfullscreenerror"
+      ],
+      ["msRequestFullscreen", "msExitFullscreen", "msFullscreenElement", "msFullscreenEnabled", "MSFullscreenChange", "MSFullscreenError"]
+    ];
+
+    var ret = {};
+
+    for (var i = 0; i < fnMap.length; i++) {
+      var val = fnMap[i];
+
+      if (val && val[1] in document) {
+        for (var j = 0; j < val.length; j++) {
+          ret[fnMap[0][j]] = val[j];
+        }
+
+        return ret;
+      }
+    }
+
+    return false;
+  })();
+
+  if (fn) {
+    var FullScreen = {
+      request: function (elem) {
+        elem = elem || document.documentElement;
+
+        elem[fn.requestFullscreen](elem.ALLOW_KEYBOARD_INPUT);
+      },
+      exit: function () {
+        document[fn.exitFullscreen]();
+      },
+      toggle: function (elem) {
+        elem = elem || document.documentElement;
+
+        if (this.isFullscreen()) {
+          this.exit();
+        } else {
+          this.request(elem);
+        }
+      },
+      isFullscreen: function () {
+        return Boolean(document[fn.fullscreenElement]);
+      },
+      enabled: function () {
+        return Boolean(document[fn.fullscreenEnabled]);
+      }
+    };
+
+    $.extend(true, $.fancybox.defaults, {
+      btnTpl: {
+        fullScreen: '<button data-fancybox-fullscreen class="fancybox-button fancybox-button--fsenter" title="{{FULL_SCREEN}}">' +
+          '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M7 14H5v5h5v-2H7v-3zm-2-4h2V7h3V5H5v5zm12 7h-3v2h5v-5h-2v3zM14 5v2h3v3h2V5h-5z"/></svg>' +
+          '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M5 16h3v3h2v-5H5zm3-8H5v2h5V5H8zm6 11h2v-3h3v-2h-5zm2-11V5h-2v5h5V8z"/></svg>' +
+          "</button>"
+      },
+      fullScreen: {
+        autoStart: false
+      }
+    });
+
+    $(document).on(fn.fullscreenchange, function () {
+      var isFullscreen = FullScreen.isFullscreen(),
+        instance = $.fancybox.getInstance();
+
+      if (instance) {
+        // If image is zooming, then force to stop and reposition properly
+        if (instance.current && instance.current.type === "image" && instance.isAnimating) {
+          instance.isAnimating = false;
+
+          instance.update(true, true, 0);
+
+          if (!instance.isComplete) {
+            instance.complete();
+          }
+        }
+
+        instance.trigger("onFullscreenChange", isFullscreen);
+
+        instance.$refs.container.toggleClass("fancybox-is-fullscreen", isFullscreen);
+
+        instance.$refs.toolbar
+          .find("[data-fancybox-fullscreen]")
+          .toggleClass("fancybox-button--fsenter", !isFullscreen)
+          .toggleClass("fancybox-button--fsexit", isFullscreen);
+      }
+    });
+  }
+
+  $(document).on({
+    "onInit.fb": function (e, instance) {
+      var $container;
+
+      if (!fn) {
+        instance.$refs.toolbar.find("[data-fancybox-fullscreen]").remove();
+
+        return;
+      }
+
+      if (instance && instance.group[instance.currIndex].opts.fullScreen) {
+        $container = instance.$refs.container;
+
+        $container.on("click.fb-fullscreen", "[data-fancybox-fullscreen]", function (e) {
+          e.stopPropagation();
+          e.preventDefault();
+
+          FullScreen.toggle();
+        });
+
+        if (instance.opts.fullScreen && instance.opts.fullScreen.autoStart === true) {
+          FullScreen.request();
+        }
+
+        // Expose API
+        instance.FullScreen = FullScreen;
+      } else if (instance) {
+        instance.$refs.toolbar.find("[data-fancybox-fullscreen]").hide();
+      }
+    },
+
+    "afterKeydown.fb": function (e, instance, current, keypress, keycode) {
+      // "F"
+      if (instance && instance.FullScreen && keycode === 70) {
+        keypress.preventDefault();
+
+        instance.FullScreen.toggle();
+      }
+    },
+
+    "beforeClose.fb": function (e, instance) {
+      if (instance && instance.FullScreen && instance.$refs.container.hasClass("fancybox-is-fullscreen")) {
+        FullScreen.exit();
+      }
+    }
+  });
+})(document, jQuery);
+// ==========================================================================
+//
+// Thumbs
+// Displays thumbnails in a grid
+//
+// ==========================================================================
+(function (document, $) {
+  "use strict";
+
+  var CLASS = "fancybox-thumbs",
+    CLASS_ACTIVE = CLASS + "-active";
+
+  // Make sure there are default values
+  $.fancybox.defaults = $.extend(
+    true, {
+      btnTpl: {
+        thumbs: '<button data-fancybox-thumbs class="fancybox-button fancybox-button--thumbs" title="{{THUMBS}}">' +
+          '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M14.59 14.59h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76H5.65v-3.76zm8.94-4.47h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76H5.65v-3.76zm8.94-4.47h3.76v3.76h-3.76V5.65zm-4.47 0h3.76v3.76h-3.76V5.65zm-4.47 0h3.76v3.76H5.65V5.65z"/></svg>' +
+          "</button>"
+      },
+      thumbs: {
+        autoStart: false, // Display thumbnails on opening
+        hideOnClose: true, // Hide thumbnail grid when closing animation starts
+        parentEl: ".fancybox-container", // Container is injected into this element
+        axis: "y" // Vertical (y) or horizontal (x) scrolling
+      }
+    },
+    $.fancybox.defaults
+  );
+
+  var FancyThumbs = function (instance) {
+    this.init(instance);
+  };
+
+  $.extend(FancyThumbs.prototype, {
+    $button: null,
+    $grid: null,
+    $list: null,
+    isVisible: false,
+    isActive: false,
+
+    init: function (instance) {
+      var self = this,
+        group = instance.group,
+        enabled = 0;
+
+      self.instance = instance;
+      self.opts = group[instance.currIndex].opts.thumbs;
+
+      instance.Thumbs = self;
+
+      self.$button = instance.$refs.toolbar.find("[data-fancybox-thumbs]");
+
+      // Enable thumbs if at least two group items have thumbnails
+      for (var i = 0, len = group.length; i < len; i++) {
+        if (group[i].thumb) {
+          enabled++;
+        }
+
+        if (enabled > 1) {
+          break;
+        }
+      }
+
+      if (enabled > 1 && !!self.opts) {
+        self.$button.removeAttr("style").on("click", function () {
+          self.toggle();
+        });
+
+        self.isActive = true;
+      } else {
+        self.$button.hide();
+      }
+    },
+
+    create: function () {
+      var self = this,
+        instance = self.instance,
+        parentEl = self.opts.parentEl,
+        list = [],
+        src;
+
+      if (!self.$grid) {
+        // Create main element
+        self.$grid = $('<div class="' + CLASS + " " + CLASS + "-" + self.opts.axis + '"></div>').appendTo(
+          instance.$refs.container
+          .find(parentEl)
+          .addBack()
+          .filter(parentEl)
+        );
+
+        // Add "click" event that performs gallery navigation
+        self.$grid.on("click", "a", function () {
+          instance.jumpTo($(this).attr("data-index"));
+        });
+      }
+
+      // Build the list
+      if (!self.$list) {
+        self.$list = $('<div class="' + CLASS + '__list">').appendTo(self.$grid);
+      }
+
+      $.each(instance.group, function (i, item) {
+        src = item.thumb;
+
+        if (!src && item.type === "image") {
+          src = item.src;
+        }
+
+        list.push(
+          '<a href="javascript:;" tabindex="0" data-index="' +
+          i +
+          '"' +
+          (src && src.length ? ' style="background-image:url(' + src + ')"' : 'class="fancybox-thumbs-missing"') +
+          "></a>"
+        );
+      });
+
+      self.$list[0].innerHTML = list.join("");
+
+      if (self.opts.axis === "x") {
+        // Set fixed width for list element to enable horizontal scrolling
+        self.$list.width(
+          parseInt(self.$grid.css("padding-right"), 10) +
+          instance.group.length *
+          self.$list
+          .children()
+          .eq(0)
+          .outerWidth(true)
+        );
+      }
+    },
+
+    focus: function (duration) {
+      var self = this,
+        $list = self.$list,
+        $grid = self.$grid,
+        thumb,
+        thumbPos;
+
+      if (!self.instance.current) {
+        return;
+      }
+
+      thumb = $list
+        .children()
+        .removeClass(CLASS_ACTIVE)
+        .filter('[data-index="' + self.instance.current.index + '"]')
+        .addClass(CLASS_ACTIVE);
+
+      thumbPos = thumb.position();
+
+      // Check if need to scroll to make current thumb visible
+      if (self.opts.axis === "y" && (thumbPos.top < 0 || thumbPos.top > $list.height() - thumb.outerHeight())) {
+        $list.stop().animate({
+            scrollTop: $list.scrollTop() + thumbPos.top
+          },
+          duration
+        );
+      } else if (
+        self.opts.axis === "x" &&
+        (thumbPos.left < $grid.scrollLeft() || thumbPos.left > $grid.scrollLeft() + ($grid.width() - thumb.outerWidth()))
+      ) {
+        $list
+          .parent()
+          .stop()
+          .animate({
+              scrollLeft: thumbPos.left
+            },
+            duration
+          );
+      }
+    },
+
+    update: function () {
+      var that = this;
+      that.instance.$refs.container.toggleClass("fancybox-show-thumbs", this.isVisible);
+
+      if (that.isVisible) {
+        if (!that.$grid) {
+          that.create();
+        }
+
+        that.instance.trigger("onThumbsShow");
+
+        that.focus(0);
+      } else if (that.$grid) {
+        that.instance.trigger("onThumbsHide");
+      }
+
+      // Update content position
+      that.instance.update();
+    },
+
+    hide: function () {
+      this.isVisible = false;
+      this.update();
+    },
+
+    show: function () {
+      this.isVisible = true;
+      this.update();
+    },
+
+    toggle: function () {
+      this.isVisible = !this.isVisible;
+      this.update();
+    }
+  });
+
+  $(document).on({
+    "onInit.fb": function (e, instance) {
+      var Thumbs;
+
+      if (instance && !instance.Thumbs) {
+        Thumbs = new FancyThumbs(instance);
+
+        if (Thumbs.isActive && Thumbs.opts.autoStart === true) {
+          Thumbs.show();
+        }
+      }
+    },
+
+    "beforeShow.fb": function (e, instance, item, firstRun) {
+      var Thumbs = instance && instance.Thumbs;
+
+      if (Thumbs && Thumbs.isVisible) {
+        Thumbs.focus(firstRun ? 0 : 250);
+      }
+    },
+
+    "afterKeydown.fb": function (e, instance, current, keypress, keycode) {
+      var Thumbs = instance && instance.Thumbs;
+
+      // "G"
+      if (Thumbs && Thumbs.isActive && keycode === 71) {
+        keypress.preventDefault();
+
+        Thumbs.toggle();
+      }
+    },
+
+    "beforeClose.fb": function (e, instance) {
+      var Thumbs = instance && instance.Thumbs;
+
+      if (Thumbs && Thumbs.isVisible && Thumbs.opts.hideOnClose !== false) {
+        Thumbs.$grid.hide();
+      }
+    }
+  });
+})(document, jQuery);
+//// ==========================================================================
+//
+// Share
+// Displays simple form for sharing current url
+//
+// ==========================================================================
+(function (document, $) {
+  "use strict";
+
+  $.extend(true, $.fancybox.defaults, {
+    btnTpl: {
+      share: '<button data-fancybox-share class="fancybox-button fancybox-button--share" title="{{SHARE}}">' +
+        '<svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M2.55 19c1.4-8.4 9.1-9.8 11.9-9.8V5l7 7-7 6.3v-3.5c-2.8 0-10.5 2.1-11.9 4.2z"/></svg>' +
+        "</button>"
+    },
+    share: {
+      url: function (instance, item) {
+        return (
+          (!instance.currentHash && !(item.type === "inline" || item.type === "html") ? item.origSrc || item.src : false) || window.location
+        );
+      },
+      tpl: '<div class="fancybox-share">' +
+        "<h1>{{SHARE}}</h1>" +
+        "<p>" +
+        '<a class="fancybox-share__button fancybox-share__button--fb" href="https://www.facebook.com/sharer/sharer.php?u={{url}}">' +
+        '<svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m287 456v-299c0-21 6-35 35-35h38v-63c-7-1-29-3-55-3-54 0-91 33-91 94v306m143-254h-205v72h196" /></svg>' +
+        "<span>Facebook</span>" +
+        "</a>" +
+        '<a class="fancybox-share__button fancybox-share__button--tw" href="https://twitter.com/intent/tweet?url={{url}}&text={{descr}}">' +
+        '<svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m456 133c-14 7-31 11-47 13 17-10 30-27 37-46-15 10-34 16-52 20-61-62-157-7-141 75-68-3-129-35-169-85-22 37-11 86 26 109-13 0-26-4-37-9 0 39 28 72 65 80-12 3-25 4-37 2 10 33 41 57 77 57-42 30-77 38-122 34 170 111 378-32 359-208 16-11 30-25 41-42z" /></svg>' +
+        "<span>Twitter</span>" +
+        "</a>" +
+        '<a class="fancybox-share__button fancybox-share__button--pt" href="https://www.pinterest.com/pin/create/button/?url={{url}}&description={{descr}}&media={{media}}">' +
+        '<svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m265 56c-109 0-164 78-164 144 0 39 15 74 47 87 5 2 10 0 12-5l4-19c2-6 1-8-3-13-9-11-15-25-15-45 0-58 43-110 113-110 62 0 96 38 96 88 0 67-30 122-73 122-24 0-42-19-36-44 6-29 20-60 20-81 0-19-10-35-31-35-25 0-44 26-44 60 0 21 7 36 7 36l-30 125c-8 37-1 83 0 87 0 3 4 4 5 2 2-3 32-39 42-75l16-64c8 16 31 29 56 29 74 0 124-67 124-157 0-69-58-132-146-132z" fill="#fff"/></svg>' +
+        "<span>Pinterest</span>" +
+        "</a>" +
+        "</p>" +
+        '<p><input class="fancybox-share__input" type="text" value="{{url_raw}}" onclick="select()" /></p>' +
+        "</div>"
+    }
+  });
+
+  function escapeHtml(string) {
+    var entityMap = {
+      "&": "&amp;",
+      "<": "&lt;",
+      ">": "&gt;",
+      '"': "&quot;",
+      "'": "&#39;",
+      "/": "&#x2F;",
+      "`": "&#x60;",
+      "=": "&#x3D;"
+    };
+
+    return String(string).replace(/[&<>"'`=\/]/g, function (s) {
+      return entityMap[s];
+    });
+  }
+
+  $(document).on("click", "[data-fancybox-share]", function () {
+    var instance = $.fancybox.getInstance(),
+      current = instance.current || null,
+      url,
+      tpl;
+
+    if (!current) {
+      return;
+    }
+
+    if ($.type(current.opts.share.url) === "function") {
+      url = current.opts.share.url.apply(current, [instance, current]);
+    }
+
+    tpl = current.opts.share.tpl
+      .replace(/\{\{media\}\}/g, current.type === "image" ? encodeURIComponent(current.src) : "")
+      .replace(/\{\{url\}\}/g, encodeURIComponent(url))
+      .replace(/\{\{url_raw\}\}/g, escapeHtml(url))
+      .replace(/\{\{descr\}\}/g, instance.$caption ? encodeURIComponent(instance.$caption.text()) : "");
+
+    $.fancybox.open({
+      src: instance.translate(instance, tpl),
+      type: "html",
+      opts: {
+        touch: false,
+        animationEffect: false,
+        afterLoad: function (shareInstance, shareCurrent) {
+          // Close self if parent instance is closing
+          instance.$refs.container.one("beforeClose.fb", function () {
+            shareInstance.close(null, 0);
+          });
+
+          // Opening links in a popup window
+          shareCurrent.$content.find(".fancybox-share__button").click(function () {
+            window.open(this.href, "Share", "width=550, height=450");
+            return false;
+          });
+        },
+        mobile: {
+          autoFocus: false
+        }
+      }
+    });
+  });
+})(document, jQuery);
+// ==========================================================================
+//
+// Hash
+// Enables linking to each modal
+//
+// ==========================================================================
+(function (window, document, $) {
+  "use strict";
+
+  // Simple $.escapeSelector polyfill (for jQuery prior v3)
+  if (!$.escapeSelector) {
+    $.escapeSelector = function (sel) {
+      var rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g;
+      var fcssescape = function (ch, asCodePoint) {
+        if (asCodePoint) {
+          // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER
+          if (ch === "\0") {
+            return "\uFFFD";
+          }
+
+          // Control characters and (dependent upon position) numbers get escaped as code points
+          return ch.slice(0, -1) + "\\" + ch.charCodeAt(ch.length - 1).toString(16) + " ";
+        }
+
+        // Other potentially-special ASCII characters get backslash-escaped
+        return "\\" + ch;
+      };
+
+      return (sel + "").replace(rcssescape, fcssescape);
+    };
+  }
+
+  // Get info about gallery name and current index from url
+  function parseUrl() {
+    var hash = window.location.hash.substr(1),
+      rez = hash.split("-"),
+      index = rez.length > 1 && /^\+?\d+$/.test(rez[rez.length - 1]) ? parseInt(rez.pop(-1), 10) || 1 : 1,
+      gallery = rez.join("-");
+
+    return {
+      hash: hash,
+      /* Index is starting from 1 */
+      index: index < 1 ? 1 : index,
+      gallery: gallery
+    };
+  }
+
+  // Trigger click evnt on links to open new fancyBox instance
+  function triggerFromUrl(url) {
+    if (url.gallery !== "") {
+      // If we can find element matching 'data-fancybox' atribute,
+      // then triggering click event should start fancyBox
+      $("[data-fancybox='" + $.escapeSelector(url.gallery) + "']")
+        .eq(url.index - 1)
+        .focus()
+        .trigger("click.fb-start");
+    }
+  }
+
+  // Get gallery name from current instance
+  function getGalleryID(instance) {
+    var opts, ret;
+
+    if (!instance) {
+      return false;
+    }
+
+    opts = instance.current ? instance.current.opts : instance.opts;
+    ret = opts.hash || (opts.$orig ? opts.$orig.data("fancybox") || opts.$orig.data("fancybox-trigger") : "");
+
+    return ret === "" ? false : ret;
+  }
+
+  // Start when DOM becomes ready
+  $(function () {
+    // Check if user has disabled this module
+    if ($.fancybox.defaults.hash === false) {
+      return;
+    }
+
+    // Update hash when opening/closing fancyBox
+    $(document).on({
+      "onInit.fb": function (e, instance) {
+        var url, gallery;
+
+        if (instance.group[instance.currIndex].opts.hash === false) {
+          return;
+        }
+
+        url = parseUrl();
+        gallery = getGalleryID(instance);
+
+        // Make sure gallery start index matches index from hash
+        if (gallery && url.gallery && gallery == url.gallery) {
+          instance.currIndex = url.index - 1;
+        }
+      },
+
+      "beforeShow.fb": function (e, instance, current, firstRun) {
+        var gallery;
+
+        if (!current || current.opts.hash === false) {
+          return;
+        }
+
+        // Check if need to update window hash
+        gallery = getGalleryID(instance);
+
+        if (!gallery) {
+          return;
+        }
+
+        // Variable containing last hash value set by fancyBox
+        // It will be used to determine if fancyBox needs to close after hash change is detected
+        instance.currentHash = gallery + (instance.group.length > 1 ? "-" + (current.index + 1) : "");
+
+        // If current hash is the same (this instance most likely is opened by hashchange), then do nothing
+        if (window.location.hash === "#" + instance.currentHash) {
+          return;
+        }
+
+        if (firstRun && !instance.origHash) {
+          instance.origHash = window.location.hash;
+        }
+
+        if (instance.hashTimer) {
+          clearTimeout(instance.hashTimer);
+        }
+
+        // Update hash
+        instance.hashTimer = setTimeout(function () {
+          if ("replaceState" in window.history) {
+            window.history[firstRun ? "pushState" : "replaceState"]({},
+              document.title,
+              window.location.pathname + window.location.search + "#" + instance.currentHash
+            );
+
+            if (firstRun) {
+              instance.hasCreatedHistory = true;
+            }
+          } else {
+            window.location.hash = instance.currentHash;
+          }
+
+          instance.hashTimer = null;
+        }, 300);
+      },
+
+      "beforeClose.fb": function (e, instance, current) {
+        if (!current || current.opts.hash === false) {
+          return;
+        }
+
+        clearTimeout(instance.hashTimer);
+
+        // Goto previous history entry
+        if (instance.currentHash && instance.hasCreatedHistory) {
+          window.history.back();
+        } else if (instance.currentHash) {
+          if ("replaceState" in window.history) {
+            window.history.replaceState({}, document.title, window.location.pathname + window.location.search + (instance.origHash || ""));
+          } else {
+            window.location.hash = instance.origHash;
+          }
+        }
+
+        instance.currentHash = null;
+      }
+    });
+
+    // Check if need to start/close after url has changed
+    $(window).on("hashchange.fb", function () {
+      var url = parseUrl(),
+        fb = null;
+
+      // Find last fancyBox instance that has "hash"
+      $.each(
+        $(".fancybox-container")
+        .get()
+        .reverse(),
+        function (index, value) {
+          var tmp = $(value).data("FancyBox");
+
+          if (tmp && tmp.currentHash) {
+            fb = tmp;
+            return false;
+          }
+        }
+      );
+
+      if (fb) {
+        // Now, compare hash values
+        if (fb.currentHash !== url.gallery + "-" + url.index && !(url.index === 1 && fb.currentHash == url.gallery)) {
+          fb.currentHash = null;
+
+          fb.close();
+        }
+      } else if (url.gallery !== "") {
+        triggerFromUrl(url);
+      }
+    });
+
+    // Check current hash and trigger click event on matching element to start fancyBox, if needed
+    setTimeout(function () {
+      if (!$.fancybox.getInstance()) {
+        triggerFromUrl(parseUrl());
+      }
+    }, 50);
+  });
+})(window, document, jQuery);
+// ==========================================================================
+//
+// Wheel
+// Basic mouse weheel support for gallery navigation
+//
+// ==========================================================================
+(function (document, $) {
+  "use strict";
+
+  var prevTime = new Date().getTime();
+
+  $(document).on({
+    "onInit.fb": function (e, instance, current) {
+      instance.$refs.stage.on("mousewheel DOMMouseScroll wheel MozMousePixelScroll", function (e) {
+        var current = instance.current,
+          currTime = new Date().getTime();
+
+        if (instance.group.length < 2 || current.opts.wheel === false || (current.opts.wheel === "auto" && current.type !== "image")) {
+          return;
+        }
+
+        e.preventDefault();
+        e.stopPropagation();
+
+        if (current.$slide.hasClass("fancybox-animated")) {
+          return;
+        }
+
+        e = e.originalEvent || e;
+
+        if (currTime - prevTime < 250) {
+          return;
+        }
+
+        prevTime = currTime;
+
+        instance[(-e.deltaY || -e.deltaX || e.wheelDelta || -e.detail) < 0 ? "next" : "previous"]();
+      });
+    }
+  });
+})(document, jQuery);
\ No newline at end of file
diff --git a/fancybox/asset/fancybox/jquery.fancybox.min.css b/fancybox/asset/fancybox/jquery.fancybox.min.css
new file mode 100644
index 00000000..7cc60b29
--- /dev/null
+++ b/fancybox/asset/fancybox/jquery.fancybox.min.css
@@ -0,0 +1 @@
+body.compensate-for-scrollbar{overflow:hidden}.fancybox-active{height:auto}.fancybox-is-hidden{left:-9999px;margin:0;position:absolute!important;top:-9999px;visibility:hidden}.fancybox-container{-webkit-backface-visibility:hidden;height:100%;left:0;outline:none;position:fixed;-webkit-tap-highlight-color:transparent;top:0;-ms-touch-action:manipulation;touch-action:manipulation;transform:translateZ(0);width:100%;z-index:99992}.fancybox-container *{box-sizing:border-box}.fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-stage{bottom:0;left:0;position:absolute;right:0;top:0}.fancybox-outer{-webkit-overflow-scrolling:touch;overflow-y:auto}.fancybox-bg{background:#1e1e1e;opacity:0;transition-duration:inherit;transition-property:opacity;transition-timing-function:cubic-bezier(.47,0,.74,.71)}.fancybox-is-open .fancybox-bg{opacity:.9;transition-timing-function:cubic-bezier(.22,.61,.36,1)}.fancybox-caption,.fancybox-infobar,.fancybox-navigation .fancybox-button,.fancybox-toolbar{direction:ltr;opacity:0;position:absolute;transition:opacity .25s ease,visibility 0s ease .25s;visibility:hidden;z-index:99997}.fancybox-show-caption .fancybox-caption,.fancybox-show-infobar .fancybox-infobar,.fancybox-show-nav .fancybox-navigation .fancybox-button,.fancybox-show-toolbar .fancybox-toolbar{opacity:1;transition:opacity .25s ease 0s,visibility 0s ease 0s;visibility:visible}.fancybox-infobar{color:#ccc;font-size:13px;-webkit-font-smoothing:subpixel-antialiased;height:44px;left:0;line-height:44px;min-width:44px;mix-blend-mode:difference;padding:0 10px;pointer-events:none;top:0;-webkit-touch-callout:none;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none}.fancybox-toolbar{right:0;top:0}.fancybox-stage{direction:ltr;overflow:visible;transform:translateZ(0);z-index:99994}.fancybox-is-open .fancybox-stage{overflow:hidden}.fancybox-slide{-webkit-backface-visibility:hidden;display:none;height:100%;left:0;outline:none;overflow:auto;-webkit-overflow-scrolling:touch;padding:44px;position:absolute;text-align:center;top:0;transition-property:transform,opacity;white-space:normal;width:100%;z-index:99994}.fancybox-slide:before{content:"";display:inline-block;font-size:0;height:100%;vertical-align:middle;width:0}.fancybox-is-sliding .fancybox-slide,.fancybox-slide--current,.fancybox-slide--next,.fancybox-slide--previous{display:block}.fancybox-slide--image{overflow:hidden;padding:44px 0}.fancybox-slide--image:before{display:none}.fancybox-slide--html{padding:6px}.fancybox-content{background:#fff;display:inline-block;margin:0;max-width:100%;overflow:auto;-webkit-overflow-scrolling:touch;padding:44px;position:relative;text-align:left;vertical-align:middle}.fancybox-slide--image .fancybox-content{animation-timing-function:cubic-bezier(.5,0,.14,1);-webkit-backface-visibility:hidden;background:transparent;background-repeat:no-repeat;background-size:100% 100%;left:0;max-width:none;overflow:visible;padding:0;position:absolute;top:0;transform-origin:top left;transition-property:transform,opacity;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;z-index:99995}.fancybox-can-zoomOut .fancybox-content{cursor:zoom-out}.fancybox-can-zoomIn .fancybox-content{cursor:zoom-in}.fancybox-can-pan .fancybox-content,.fancybox-can-swipe .fancybox-content{cursor:grab}.fancybox-is-grabbing .fancybox-content{cursor:grabbing}.fancybox-container [data-selectable=true]{cursor:text}.fancybox-image,.fancybox-spaceball{background:transparent;border:0;height:100%;left:0;margin:0;max-height:none;max-width:none;padding:0;position:absolute;top:0;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;width:100%}.fancybox-spaceball{z-index:1}.fancybox-slide--iframe .fancybox-content,.fancybox-slide--map .fancybox-content,.fancybox-slide--pdf .fancybox-content,.fancybox-slide--video .fancybox-content{height:100%;overflow:visible;padding:0;width:100%}.fancybox-slide--video .fancybox-content{background:#000}.fancybox-slide--map .fancybox-content{background:#e5e3df}.fancybox-slide--iframe .fancybox-content{background:#fff}.fancybox-iframe,.fancybox-video{background:transparent;border:0;display:block;height:100%;margin:0;overflow:hidden;padding:0;width:100%}.fancybox-iframe{left:0;position:absolute;top:0}.fancybox-error{background:#fff;cursor:default;max-width:400px;padding:40px;width:100%}.fancybox-error p{color:#444;font-size:16px;line-height:20px;margin:0;padding:0}.fancybox-button{background:rgba(30,30,30,.6);border:0;border-radius:0;box-shadow:none;cursor:pointer;display:inline-block;height:44px;margin:0;padding:10px;position:relative;transition:color .2s;vertical-align:top;visibility:inherit;width:44px}.fancybox-button,.fancybox-button:link,.fancybox-button:visited{color:#ccc}.fancybox-button:hover{color:#fff}.fancybox-button:focus{outline:none}.fancybox-button.fancybox-focus{outline:1px dotted}.fancybox-button[disabled],.fancybox-button[disabled]:hover{color:#888;cursor:default;outline:none}.fancybox-button div{height:100%}.fancybox-button svg{display:block;height:100%;overflow:visible;position:relative;width:100%}.fancybox-button svg path{fill:currentColor;stroke-width:0}.fancybox-button--fsenter svg:nth-child(2),.fancybox-button--fsexit svg:first-child,.fancybox-button--pause svg:first-child,.fancybox-button--play svg:nth-child(2){display:none}.fancybox-progress{background:#ff5268;height:2px;left:0;position:absolute;right:0;top:0;transform:scaleX(0);transform-origin:0;transition-property:transform;transition-timing-function:linear;z-index:99998}.fancybox-close-small{background:transparent;border:0;border-radius:0;color:#ccc;cursor:pointer;opacity:.8;padding:8px;position:absolute;right:-12px;top:-44px;z-index:401}.fancybox-close-small:hover{color:#fff;opacity:1}.fancybox-slide--html .fancybox-close-small{color:currentColor;padding:10px;right:0;top:0}.fancybox-slide--image.fancybox-is-scaling .fancybox-content{overflow:hidden}.fancybox-is-scaling .fancybox-close-small,.fancybox-is-zoomable.fancybox-can-pan .fancybox-close-small{display:none}.fancybox-navigation .fancybox-button{background-clip:content-box;height:100px;opacity:0;position:absolute;top:calc(50% - 50px);width:70px}.fancybox-navigation .fancybox-button div{padding:7px}.fancybox-navigation .fancybox-button--arrow_left{left:0;left:env(safe-area-inset-left);padding:31px 26px 31px 6px}.fancybox-navigation .fancybox-button--arrow_right{padding:31px 6px 31px 26px;right:0;right:env(safe-area-inset-right)}.fancybox-caption{background:linear-gradient(0deg,rgba(0,0,0,.85) 0,rgba(0,0,0,.3) 50%,rgba(0,0,0,.15) 65%,rgba(0,0,0,.075) 75.5%,rgba(0,0,0,.037) 82.85%,rgba(0,0,0,.019) 88%,transparent);bottom:0;color:#eee;font-size:14px;font-weight:400;left:0;line-height:1.5;padding:75px 44px 25px;pointer-events:none;right:0;text-align:center;z-index:99996}@supports (padding:max(0px)){.fancybox-caption{padding:75px max(44px,env(safe-area-inset-right)) max(25px,env(safe-area-inset-bottom)) max(44px,env(safe-area-inset-left))}}.fancybox-caption--separate{margin-top:-50px}.fancybox-caption__body{max-height:50vh;overflow:auto;pointer-events:all}.fancybox-caption a,.fancybox-caption a:link,.fancybox-caption a:visited{color:#ccc;text-decoration:none}.fancybox-caption a:hover{color:#fff;text-decoration:underline}.fancybox-loading{animation:a 1s linear infinite;background:transparent;border:4px solid #888;border-bottom-color:#fff;border-radius:50%;height:50px;left:50%;margin:-25px 0 0 -25px;opacity:.7;padding:0;position:absolute;top:50%;width:50px;z-index:99999}@keyframes a{to{transform:rotate(1turn)}}.fancybox-animated{transition-timing-function:cubic-bezier(0,0,.25,1)}.fancybox-fx-slide.fancybox-slide--previous{opacity:0;transform:translate3d(-100%,0,0)}.fancybox-fx-slide.fancybox-slide--next{opacity:0;transform:translate3d(100%,0,0)}.fancybox-fx-slide.fancybox-slide--current{opacity:1;transform:translateZ(0)}.fancybox-fx-fade.fancybox-slide--next,.fancybox-fx-fade.fancybox-slide--previous{opacity:0;transition-timing-function:cubic-bezier(.19,1,.22,1)}.fancybox-fx-fade.fancybox-slide--current{opacity:1}.fancybox-fx-zoom-in-out.fancybox-slide--previous{opacity:0;transform:scale3d(1.5,1.5,1.5)}.fancybox-fx-zoom-in-out.fancybox-slide--next{opacity:0;transform:scale3d(.5,.5,.5)}.fancybox-fx-zoom-in-out.fancybox-slide--current{opacity:1;transform:scaleX(1)}.fancybox-fx-rotate.fancybox-slide--previous{opacity:0;transform:rotate(-1turn)}.fancybox-fx-rotate.fancybox-slide--next{opacity:0;transform:rotate(1turn)}.fancybox-fx-rotate.fancybox-slide--current{opacity:1;transform:rotate(0deg)}.fancybox-fx-circular.fancybox-slide--previous{opacity:0;transform:scale3d(0,0,0) translate3d(-100%,0,0)}.fancybox-fx-circular.fancybox-slide--next{opacity:0;transform:scale3d(0,0,0) translate3d(100%,0,0)}.fancybox-fx-circular.fancybox-slide--current{opacity:1;transform:scaleX(1) translateZ(0)}.fancybox-fx-tube.fancybox-slide--previous{transform:translate3d(-100%,0,0) scale(.1) skew(-10deg)}.fancybox-fx-tube.fancybox-slide--next{transform:translate3d(100%,0,0) scale(.1) skew(10deg)}.fancybox-fx-tube.fancybox-slide--current{transform:translateZ(0) scale(1)}@media (max-height:576px){.fancybox-slide{padding-left:6px;padding-right:6px}.fancybox-slide--image{padding:6px 0}.fancybox-close-small{right:-6px}.fancybox-slide--image .fancybox-close-small{background:#4e4e4e;color:#f2f4f6;height:36px;opacity:1;padding:6px;right:0;top:0;width:36px}.fancybox-caption{padding-left:12px;padding-right:12px}@supports (padding:max(0px)){.fancybox-caption{padding-left:max(12px,env(safe-area-inset-left));padding-right:max(12px,env(safe-area-inset-right))}}}.fancybox-share{background:#f4f4f4;border-radius:3px;max-width:90%;padding:30px;text-align:center}.fancybox-share h1{color:#222;font-size:35px;font-weight:700;margin:0 0 20px}.fancybox-share p{margin:0;padding:0}.fancybox-share__button{border:0;border-radius:3px;display:inline-block;font-size:14px;font-weight:700;line-height:40px;margin:0 5px 10px;min-width:130px;padding:0 15px;text-decoration:none;transition:all .2s;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;white-space:nowrap}.fancybox-share__button:link,.fancybox-share__button:visited{color:#fff}.fancybox-share__button:hover{text-decoration:none}.fancybox-share__button--fb{background:#3b5998}.fancybox-share__button--fb:hover{background:#344e86}.fancybox-share__button--pt{background:#bd081d}.fancybox-share__button--pt:hover{background:#aa0719}.fancybox-share__button--tw{background:#1da1f2}.fancybox-share__button--tw:hover{background:#0d95e8}.fancybox-share__button svg{height:25px;margin-right:7px;position:relative;top:-1px;vertical-align:middle;width:25px}.fancybox-share__button svg path{fill:#fff}.fancybox-share__input{background:transparent;border:0;border-bottom:1px solid #d7d7d7;border-radius:0;color:#5d5b5b;font-size:14px;margin:10px 0 0;outline:none;padding:10px 15px;width:100%}.fancybox-thumbs{background:#ddd;bottom:0;display:none;margin:0;-webkit-overflow-scrolling:touch;-ms-overflow-style:-ms-autohiding-scrollbar;padding:2px 2px 4px;position:absolute;right:0;-webkit-tap-highlight-color:rgba(0,0,0,0);top:0;width:212px;z-index:99995}.fancybox-thumbs-x{overflow-x:auto;overflow-y:hidden}.fancybox-show-thumbs .fancybox-thumbs{display:block}.fancybox-show-thumbs .fancybox-inner{right:212px}.fancybox-thumbs__list{font-size:0;height:100%;list-style:none;margin:0;overflow-x:hidden;overflow-y:auto;padding:0;position:absolute;position:relative;white-space:nowrap;width:100%}.fancybox-thumbs-x .fancybox-thumbs__list{overflow:hidden}.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar{width:7px}.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar-track{background:#fff;border-radius:10px;box-shadow:inset 0 0 6px rgba(0,0,0,.3)}.fancybox-thumbs-y .fancybox-thumbs__list::-webkit-scrollbar-thumb{background:#2a2a2a;border-radius:10px}.fancybox-thumbs__list a{-webkit-backface-visibility:hidden;backface-visibility:hidden;background-color:rgba(0,0,0,.1);background-position:50%;background-repeat:no-repeat;background-size:cover;cursor:pointer;float:left;height:75px;margin:2px;max-height:calc(100% - 8px);max-width:calc(50% - 4px);outline:none;overflow:hidden;padding:0;position:relative;-webkit-tap-highlight-color:transparent;width:100px}.fancybox-thumbs__list a:before{border:6px solid #ff5268;bottom:0;content:"";left:0;opacity:0;position:absolute;right:0;top:0;transition:all .2s cubic-bezier(.25,.46,.45,.94);z-index:99991}.fancybox-thumbs__list a:focus:before{opacity:.5}.fancybox-thumbs__list a.fancybox-thumbs-active:before{opacity:1}@media (max-width:576px){.fancybox-thumbs{width:110px}.fancybox-show-thumbs .fancybox-inner{right:110px}.fancybox-thumbs__list a{max-width:calc(100% - 10px)}}
\ No newline at end of file
diff --git a/fancybox/asset/fancybox/jquery.fancybox.min.js b/fancybox/asset/fancybox/jquery.fancybox.min.js
new file mode 100644
index 00000000..d5d10f6b
--- /dev/null
+++ b/fancybox/asset/fancybox/jquery.fancybox.min.js
@@ -0,0 +1,13 @@
+// ==================================================
+// fancyBox v3.5.7
+//
+// Licensed GPLv3 for open source use
+// or fancyBox Commercial License for commercial use
+//
+// http://fancyapps.com/fancybox/
+// Copyright 2019 fancyApps
+//
+// ==================================================
+!function(t,e,n,o){"use strict";function i(t,e){var o,i,a,s=[],r=0;t&&t.isDefaultPrevented()||(t.preventDefault(),e=e||{},t&&t.data&&(e=h(t.data.options,e)),o=e.$target||n(t.currentTarget).trigger("blur"),(a=n.fancybox.getInstance())&&a.$trigger&&a.$trigger.is(o)||(e.selector?s=n(e.selector):(i=o.attr("data-fancybox")||"",i?(s=t.data?t.data.items:[],s=s.length?s.filter('[data-fancybox="'+i+'"]'):n('[data-fancybox="'+i+'"]')):s=[o]),r=n(s).index(o),r<0&&(r=0),a=n.fancybox.open(s,e,r),a.$trigger=o))}if(t.console=t.console||{info:function(t){}},n){if(n.fn.fancybox)return void console.info("fancyBox already initialized");var a={closeExisting:!1,loop:!1,gutter:50,keyboard:!0,preventCaptionOverlap:!0,arrows:!0,infobar:!0,smallBtn:"auto",toolbar:"auto",buttons:["zoom","slideShow","thumbs","close"],idleTime:3,protect:!1,modal:!1,image:{preload:!1},ajax:{settings:{data:{fancybox:!0}}},iframe:{tpl:'<iframe id="fancybox-frame{rnd}" name="fancybox-frame{rnd}" class="fancybox-iframe" allowfullscreen="allowfullscreen" allow="autoplay; fullscreen" src=""></iframe>',preload:!0,css:{},attr:{scrolling:"auto"}},video:{tpl:'<video class="fancybox-video" controls controlsList="nodownload" poster="{{poster}}"><source src="{{src}}" type="{{format}}" />Sorry, your browser doesn\'t support embedded videos, <a href="{{src}}">download</a> and watch with your favorite video player!</video>',format:"",autoStart:!0},defaultType:"image",animationEffect:"zoom",animationDuration:366,zoomOpacity:"auto",transitionEffect:"fade",transitionDuration:366,slideClass:"",baseClass:"",baseTpl:'<div class="fancybox-container" role="dialog" tabindex="-1"><div class="fancybox-bg"></div><div class="fancybox-inner"><div class="fancybox-infobar"><span data-fancybox-index></span>&nbsp;/&nbsp;<span data-fancybox-count></span></div><div class="fancybox-toolbar">{{buttons}}</div><div class="fancybox-navigation">{{arrows}}</div><div class="fancybox-stage"></div><div class="fancybox-caption"><div class="fancybox-caption__body"></div></div></div></div>',spinnerTpl:'<div class="fancybox-loading"></div>',errorTpl:'<div class="fancybox-error"><p>{{ERROR}}</p></div>',btnTpl:{download:'<a download data-fancybox-download class="fancybox-button fancybox-button--download" title="{{DOWNLOAD}}" href="javascript:;"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M18.62 17.09V19H5.38v-1.91zm-2.97-6.96L17 11.45l-5 4.87-5-4.87 1.36-1.32 2.68 2.64V5h1.92v7.77z"/></svg></a>',zoom:'<button data-fancybox-zoom class="fancybox-button fancybox-button--zoom" title="{{ZOOM}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M18.7 17.3l-3-3a5.9 5.9 0 0 0-.6-7.6 5.9 5.9 0 0 0-8.4 0 5.9 5.9 0 0 0 0 8.4 5.9 5.9 0 0 0 7.7.7l3 3a1 1 0 0 0 1.3 0c.4-.5.4-1 0-1.5zM8.1 13.8a4 4 0 0 1 0-5.7 4 4 0 0 1 5.7 0 4 4 0 0 1 0 5.7 4 4 0 0 1-5.7 0z"/></svg></button>',close:'<button data-fancybox-close class="fancybox-button fancybox-button--close" title="{{CLOSE}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M12 10.6L6.6 5.2 5.2 6.6l5.4 5.4-5.4 5.4 1.4 1.4 5.4-5.4 5.4 5.4 1.4-1.4-5.4-5.4 5.4-5.4-1.4-1.4-5.4 5.4z"/></svg></button>',arrowLeft:'<button data-fancybox-prev class="fancybox-button fancybox-button--arrow_left" title="{{PREV}}"><div><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M11.28 15.7l-1.34 1.37L5 12l4.94-5.07 1.34 1.38-2.68 2.72H19v1.94H8.6z"/></svg></div></button>',arrowRight:'<button data-fancybox-next class="fancybox-button fancybox-button--arrow_right" title="{{NEXT}}"><div><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M15.4 12.97l-2.68 2.72 1.34 1.38L19 12l-4.94-5.07-1.34 1.38 2.68 2.72H5v1.94z"/></svg></div></button>',smallBtn:'<button type="button" data-fancybox-close class="fancybox-button fancybox-close-small" title="{{CLOSE}}"><svg xmlns="http://www.w3.org/2000/svg" version="1" viewBox="0 0 24 24"><path d="M13 12l5-5-1-1-5 5-5-5-1 1 5 5-5 5 1 1 5-5 5 5 1-1z"/></svg></button>'},parentEl:"body",hideScrollbar:!0,autoFocus:!0,backFocus:!0,trapFocus:!0,fullScreen:{autoStart:!1},touch:{vertical:!0,momentum:!0},hash:null,media:{},slideShow:{autoStart:!1,speed:3e3},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:".fancybox-container",axis:"y"},wheel:"auto",onInit:n.noop,beforeLoad:n.noop,afterLoad:n.noop,beforeShow:n.noop,afterShow:n.noop,beforeClose:n.noop,afterClose:n.noop,onActivate:n.noop,onDeactivate:n.noop,clickContent:function(t,e){return"image"===t.type&&"zoom"},clickSlide:"close",clickOutside:"close",dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1,mobile:{preventCaptionOverlap:!1,idleTime:!1,clickContent:function(t,e){return"image"===t.type&&"toggleControls"},clickSlide:function(t,e){return"image"===t.type?"toggleControls":"close"},dblclickContent:function(t,e){return"image"===t.type&&"zoom"},dblclickSlide:function(t,e){return"image"===t.type&&"zoom"}},lang:"en",i18n:{en:{CLOSE:"Close",NEXT:"Next",PREV:"Previous",ERROR:"The requested content cannot be loaded. <br/> Please try again later.",PLAY_START:"Start slideshow",PLAY_STOP:"Pause slideshow",FULL_SCREEN:"Full screen",THUMBS:"Thumbnails",DOWNLOAD:"Download",SHARE:"Share",ZOOM:"Zoom"},de:{CLOSE:"Schlie&szlig;en",NEXT:"Weiter",PREV:"Zur&uuml;ck",ERROR:"Die angeforderten Daten konnten nicht geladen werden. <br/> Bitte versuchen Sie es sp&auml;ter nochmal.",PLAY_START:"Diaschau starten",PLAY_STOP:"Diaschau beenden",FULL_SCREEN:"Vollbild",THUMBS:"Vorschaubilder",DOWNLOAD:"Herunterladen",SHARE:"Teilen",ZOOM:"Vergr&ouml;&szlig;ern"}}},s=n(t),r=n(e),c=0,l=function(t){return t&&t.hasOwnProperty&&t instanceof n},d=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||t.oRequestAnimationFrame||function(e){return t.setTimeout(e,1e3/60)}}(),u=function(){return t.cancelAnimationFrame||t.webkitCancelAnimationFrame||t.mozCancelAnimationFrame||t.oCancelAnimationFrame||function(e){t.clearTimeout(e)}}(),f=function(){var t,n=e.createElement("fakeelement"),o={transition:"transitionend",OTransition:"oTransitionEnd",MozTransition:"transitionend",WebkitTransition:"webkitTransitionEnd"};for(t in o)if(void 0!==n.style[t])return o[t];return"transitionend"}(),p=function(t){return t&&t.length&&t[0].offsetHeight},h=function(t,e){var o=n.extend(!0,{},t,e);return n.each(e,function(t,e){n.isArray(e)&&(o[t]=e)}),o},g=function(t){var o,i;return!(!t||t.ownerDocument!==e)&&(n(".fancybox-container").css("pointer-events","none"),o={x:t.getBoundingClientRect().left+t.offsetWidth/2,y:t.getBoundingClientRect().top+t.offsetHeight/2},i=e.elementFromPoint(o.x,o.y)===t,n(".fancybox-container").css("pointer-events",""),i)},b=function(t,e,o){var i=this;i.opts=h({index:o},n.fancybox.defaults),n.isPlainObject(e)&&(i.opts=h(i.opts,e)),n.fancybox.isMobile&&(i.opts=h(i.opts,i.opts.mobile)),i.id=i.opts.id||++c,i.currIndex=parseInt(i.opts.index,10)||0,i.prevIndex=null,i.prevPos=null,i.currPos=0,i.firstRun=!0,i.group=[],i.slides={},i.addContent(t),i.group.length&&i.init()};n.extend(b.prototype,{init:function(){var o,i,a=this,s=a.group[a.currIndex],r=s.opts;r.closeExisting&&n.fancybox.close(!0),n("body").addClass("fancybox-active"),!n.fancybox.getInstance()&&!1!==r.hideScrollbar&&!n.fancybox.isMobile&&e.body.scrollHeight>t.innerHeight&&(n("head").append('<style id="fancybox-style-noscroll" type="text/css">.compensate-for-scrollbar{margin-right:'+(t.innerWidth-e.documentElement.clientWidth)+"px;}</style>"),n("body").addClass("compensate-for-scrollbar")),i="",n.each(r.buttons,function(t,e){i+=r.btnTpl[e]||""}),o=n(a.translate(a,r.baseTpl.replace("{{buttons}}",i).replace("{{arrows}}",r.btnTpl.arrowLeft+r.btnTpl.arrowRight))).attr("id","fancybox-container-"+a.id).addClass(r.baseClass).data("FancyBox",a).appendTo(r.parentEl),a.$refs={container:o},["bg","inner","infobar","toolbar","stage","caption","navigation"].forEach(function(t){a.$refs[t]=o.find(".fancybox-"+t)}),a.trigger("onInit"),a.activate(),a.jumpTo(a.currIndex)},translate:function(t,e){var n=t.opts.i18n[t.opts.lang]||t.opts.i18n.en;return e.replace(/\{\{(\w+)\}\}/g,function(t,e){return void 0===n[e]?t:n[e]})},addContent:function(t){var e,o=this,i=n.makeArray(t);n.each(i,function(t,e){var i,a,s,r,c,l={},d={};n.isPlainObject(e)?(l=e,d=e.opts||e):"object"===n.type(e)&&n(e).length?(i=n(e),d=i.data()||{},d=n.extend(!0,{},d,d.options),d.$orig=i,l.src=o.opts.src||d.src||i.attr("href"),l.type||l.src||(l.type="inline",l.src=e)):l={type:"html",src:e+""},l.opts=n.extend(!0,{},o.opts,d),n.isArray(d.buttons)&&(l.opts.buttons=d.buttons),n.fancybox.isMobile&&l.opts.mobile&&(l.opts=h(l.opts,l.opts.mobile)),a=l.type||l.opts.type,r=l.src||"",!a&&r&&((s=r.match(/\.(mp4|mov|ogv|webm)((\?|#).*)?$/i))?(a="video",l.opts.video.format||(l.opts.video.format="video/"+("ogv"===s[1]?"ogg":s[1]))):r.match(/(^data:image\/[a-z0-9+\/=]*,)|(\.(jp(e|g|eg)|gif|png|bmp|webp|svg|ico)((\?|#).*)?$)/i)?a="image":r.match(/\.(pdf)((\?|#).*)?$/i)?(a="iframe",l=n.extend(!0,l,{contentType:"pdf",opts:{iframe:{preload:!1}}})):"#"===r.charAt(0)&&(a="inline")),a?l.type=a:o.trigger("objectNeedsType",l),l.contentType||(l.contentType=n.inArray(l.type,["html","inline","ajax"])>-1?"html":l.type),l.index=o.group.length,"auto"==l.opts.smallBtn&&(l.opts.smallBtn=n.inArray(l.type,["html","inline","ajax"])>-1),"auto"===l.opts.toolbar&&(l.opts.toolbar=!l.opts.smallBtn),l.$thumb=l.opts.$thumb||null,l.opts.$trigger&&l.index===o.opts.index&&(l.$thumb=l.opts.$trigger.find("img:first"),l.$thumb.length&&(l.opts.$orig=l.opts.$trigger)),l.$thumb&&l.$thumb.length||!l.opts.$orig||(l.$thumb=l.opts.$orig.find("img:first")),l.$thumb&&!l.$thumb.length&&(l.$thumb=null),l.thumb=l.opts.thumb||(l.$thumb?l.$thumb[0].src:null),"function"===n.type(l.opts.caption)&&(l.opts.caption=l.opts.caption.apply(e,[o,l])),"function"===n.type(o.opts.caption)&&(l.opts.caption=o.opts.caption.apply(e,[o,l])),l.opts.caption instanceof n||(l.opts.caption=void 0===l.opts.caption?"":l.opts.caption+""),"ajax"===l.type&&(c=r.split(/\s+/,2),c.length>1&&(l.src=c.shift(),l.opts.filter=c.shift())),l.opts.modal&&(l.opts=n.extend(!0,l.opts,{trapFocus:!0,infobar:0,toolbar:0,smallBtn:0,keyboard:0,slideShow:0,fullScreen:0,thumbs:0,touch:0,clickContent:!1,clickSlide:!1,clickOutside:!1,dblclickContent:!1,dblclickSlide:!1,dblclickOutside:!1})),o.group.push(l)}),Object.keys(o.slides).length&&(o.updateControls(),(e=o.Thumbs)&&e.isActive&&(e.create(),e.focus()))},addEvents:function(){var e=this;e.removeEvents(),e.$refs.container.on("click.fb-close","[data-fancybox-close]",function(t){t.stopPropagation(),t.preventDefault(),e.close(t)}).on("touchstart.fb-prev click.fb-prev","[data-fancybox-prev]",function(t){t.stopPropagation(),t.preventDefault(),e.previous()}).on("touchstart.fb-next click.fb-next","[data-fancybox-next]",function(t){t.stopPropagation(),t.preventDefault(),e.next()}).on("click.fb","[data-fancybox-zoom]",function(t){e[e.isScaledDown()?"scaleToActual":"scaleToFit"]()}),s.on("orientationchange.fb resize.fb",function(t){t&&t.originalEvent&&"resize"===t.originalEvent.type?(e.requestId&&u(e.requestId),e.requestId=d(function(){e.update(t)})):(e.current&&"iframe"===e.current.type&&e.$refs.stage.hide(),setTimeout(function(){e.$refs.stage.show(),e.update(t)},n.fancybox.isMobile?600:250))}),r.on("keydown.fb",function(t){var o=n.fancybox?n.fancybox.getInstance():null,i=o.current,a=t.keyCode||t.which;if(9==a)return void(i.opts.trapFocus&&e.focus(t));if(!(!i.opts.keyboard||t.ctrlKey||t.altKey||t.shiftKey||n(t.target).is("input,textarea,video,audio,select")))return 8===a||27===a?(t.preventDefault(),void e.close(t)):37===a||38===a?(t.preventDefault(),void e.previous()):39===a||40===a?(t.preventDefault(),void e.next()):void e.trigger("afterKeydown",t,a)}),e.group[e.currIndex].opts.idleTime&&(e.idleSecondsCounter=0,r.on("mousemove.fb-idle mouseleave.fb-idle mousedown.fb-idle touchstart.fb-idle touchmove.fb-idle scroll.fb-idle keydown.fb-idle",function(t){e.idleSecondsCounter=0,e.isIdle&&e.showControls(),e.isIdle=!1}),e.idleInterval=t.setInterval(function(){++e.idleSecondsCounter>=e.group[e.currIndex].opts.idleTime&&!e.isDragging&&(e.isIdle=!0,e.idleSecondsCounter=0,e.hideControls())},1e3))},removeEvents:function(){var e=this;s.off("orientationchange.fb resize.fb"),r.off("keydown.fb .fb-idle"),this.$refs.container.off(".fb-close .fb-prev .fb-next"),e.idleInterval&&(t.clearInterval(e.idleInterval),e.idleInterval=null)},previous:function(t){return this.jumpTo(this.currPos-1,t)},next:function(t){return this.jumpTo(this.currPos+1,t)},jumpTo:function(t,e){var o,i,a,s,r,c,l,d,u,f=this,h=f.group.length;if(!(f.isDragging||f.isClosing||f.isAnimating&&f.firstRun)){if(t=parseInt(t,10),!(a=f.current?f.current.opts.loop:f.opts.loop)&&(t<0||t>=h))return!1;if(o=f.firstRun=!Object.keys(f.slides).length,r=f.current,f.prevIndex=f.currIndex,f.prevPos=f.currPos,s=f.createSlide(t),h>1&&((a||s.index<h-1)&&f.createSlide(t+1),(a||s.index>0)&&f.createSlide(t-1)),f.current=s,f.currIndex=s.index,f.currPos=s.pos,f.trigger("beforeShow",o),f.updateControls(),s.forcedDuration=void 0,n.isNumeric(e)?s.forcedDuration=e:e=s.opts[o?"animationDuration":"transitionDuration"],e=parseInt(e,10),i=f.isMoved(s),s.$slide.addClass("fancybox-slide--current"),o)return s.opts.animationEffect&&e&&f.$refs.container.css("transition-duration",e+"ms"),f.$refs.container.addClass("fancybox-is-open").trigger("focus"),f.loadSlide(s),void f.preload("image");c=n.fancybox.getTranslate(r.$slide),l=n.fancybox.getTranslate(f.$refs.stage),n.each(f.slides,function(t,e){n.fancybox.stop(e.$slide,!0)}),r.pos!==s.pos&&(r.isComplete=!1),r.$slide.removeClass("fancybox-slide--complete fancybox-slide--current"),i?(u=c.left-(r.pos*c.width+r.pos*r.opts.gutter),n.each(f.slides,function(t,o){o.$slide.removeClass("fancybox-animated").removeClass(function(t,e){return(e.match(/(^|\s)fancybox-fx-\S+/g)||[]).join(" ")});var i=o.pos*c.width+o.pos*o.opts.gutter;n.fancybox.setTranslate(o.$slide,{top:0,left:i-l.left+u}),o.pos!==s.pos&&o.$slide.addClass("fancybox-slide--"+(o.pos>s.pos?"next":"previous")),p(o.$slide),n.fancybox.animate(o.$slide,{top:0,left:(o.pos-s.pos)*c.width+(o.pos-s.pos)*o.opts.gutter},e,function(){o.$slide.css({transform:"",opacity:""}).removeClass("fancybox-slide--next fancybox-slide--previous"),o.pos===f.currPos&&f.complete()})})):e&&s.opts.transitionEffect&&(d="fancybox-animated fancybox-fx-"+s.opts.transitionEffect,r.$slide.addClass("fancybox-slide--"+(r.pos>s.pos?"next":"previous")),n.fancybox.animate(r.$slide,d,e,function(){r.$slide.removeClass(d).removeClass("fancybox-slide--next fancybox-slide--previous")},!1)),s.isLoaded?f.revealContent(s):f.loadSlide(s),f.preload("image")}},createSlide:function(t){var e,o,i=this;return o=t%i.group.length,o=o<0?i.group.length+o:o,!i.slides[t]&&i.group[o]&&(e=n('<div class="fancybox-slide"></div>').appendTo(i.$refs.stage),i.slides[t]=n.extend(!0,{},i.group[o],{pos:t,$slide:e,isLoaded:!1}),i.updateSlide(i.slides[t])),i.slides[t]},scaleToActual:function(t,e,o){var i,a,s,r,c,l=this,d=l.current,u=d.$content,f=n.fancybox.getTranslate(d.$slide).width,p=n.fancybox.getTranslate(d.$slide).height,h=d.width,g=d.height;l.isAnimating||l.isMoved()||!u||"image"!=d.type||!d.isLoaded||d.hasError||(l.isAnimating=!0,n.fancybox.stop(u),t=void 0===t?.5*f:t,e=void 0===e?.5*p:e,i=n.fancybox.getTranslate(u),i.top-=n.fancybox.getTranslate(d.$slide).top,i.left-=n.fancybox.getTranslate(d.$slide).left,r=h/i.width,c=g/i.height,a=.5*f-.5*h,s=.5*p-.5*g,h>f&&(a=i.left*r-(t*r-t),a>0&&(a=0),a<f-h&&(a=f-h)),g>p&&(s=i.top*c-(e*c-e),s>0&&(s=0),s<p-g&&(s=p-g)),l.updateCursor(h,g),n.fancybox.animate(u,{top:s,left:a,scaleX:r,scaleY:c},o||366,function(){l.isAnimating=!1}),l.SlideShow&&l.SlideShow.isActive&&l.SlideShow.stop())},scaleToFit:function(t){var e,o=this,i=o.current,a=i.$content;o.isAnimating||o.isMoved()||!a||"image"!=i.type||!i.isLoaded||i.hasError||(o.isAnimating=!0,n.fancybox.stop(a),e=o.getFitPos(i),o.updateCursor(e.width,e.height),n.fancybox.animate(a,{top:e.top,left:e.left,scaleX:e.width/a.width(),scaleY:e.height/a.height()},t||366,function(){o.isAnimating=!1}))},getFitPos:function(t){var e,o,i,a,s=this,r=t.$content,c=t.$slide,l=t.width||t.opts.width,d=t.height||t.opts.height,u={};return!!(t.isLoaded&&r&&r.length)&&(e=n.fancybox.getTranslate(s.$refs.stage).width,o=n.fancybox.getTranslate(s.$refs.stage).height,e-=parseFloat(c.css("paddingLeft"))+parseFloat(c.css("paddingRight"))+parseFloat(r.css("marginLeft"))+parseFloat(r.css("marginRight")),o-=parseFloat(c.css("paddingTop"))+parseFloat(c.css("paddingBottom"))+parseFloat(r.css("marginTop"))+parseFloat(r.css("marginBottom")),l&&d||(l=e,d=o),i=Math.min(1,e/l,o/d),l*=i,d*=i,l>e-.5&&(l=e),d>o-.5&&(d=o),"image"===t.type?(u.top=Math.floor(.5*(o-d))+parseFloat(c.css("paddingTop")),u.left=Math.floor(.5*(e-l))+parseFloat(c.css("paddingLeft"))):"video"===t.contentType&&(a=t.opts.width&&t.opts.height?l/d:t.opts.ratio||16/9,d>l/a?d=l/a:l>d*a&&(l=d*a)),u.width=l,u.height=d,u)},update:function(t){var e=this;n.each(e.slides,function(n,o){e.updateSlide(o,t)})},updateSlide:function(t,e){var o=this,i=t&&t.$content,a=t.width||t.opts.width,s=t.height||t.opts.height,r=t.$slide;o.adjustCaption(t),i&&(a||s||"video"===t.contentType)&&!t.hasError&&(n.fancybox.stop(i),n.fancybox.setTranslate(i,o.getFitPos(t)),t.pos===o.currPos&&(o.isAnimating=!1,o.updateCursor())),o.adjustLayout(t),r.length&&(r.trigger("refresh"),t.pos===o.currPos&&o.$refs.toolbar.add(o.$refs.navigation.find(".fancybox-button--arrow_right")).toggleClass("compensate-for-scrollbar",r.get(0).scrollHeight>r.get(0).clientHeight)),o.trigger("onUpdate",t,e)},centerSlide:function(t){var e=this,o=e.current,i=o.$slide;!e.isClosing&&o&&(i.siblings().css({transform:"",opacity:""}),i.parent().children().removeClass("fancybox-slide--previous fancybox-slide--next"),n.fancybox.animate(i,{top:0,left:0,opacity:1},void 0===t?0:t,function(){i.css({transform:"",opacity:""}),o.isComplete||e.complete()},!1))},isMoved:function(t){var e,o,i=t||this.current;return!!i&&(o=n.fancybox.getTranslate(this.$refs.stage),e=n.fancybox.getTranslate(i.$slide),!i.$slide.hasClass("fancybox-animated")&&(Math.abs(e.top-o.top)>.5||Math.abs(e.left-o.left)>.5))},updateCursor:function(t,e){var o,i,a=this,s=a.current,r=a.$refs.container;s&&!a.isClosing&&a.Guestures&&(r.removeClass("fancybox-is-zoomable fancybox-can-zoomIn fancybox-can-zoomOut fancybox-can-swipe fancybox-can-pan"),o=a.canPan(t,e),i=!!o||a.isZoomable(),r.toggleClass("fancybox-is-zoomable",i),n("[data-fancybox-zoom]").prop("disabled",!i),o?r.addClass("fancybox-can-pan"):i&&("zoom"===s.opts.clickContent||n.isFunction(s.opts.clickContent)&&"zoom"==s.opts.clickContent(s))?r.addClass("fancybox-can-zoomIn"):s.opts.touch&&(s.opts.touch.vertical||a.group.length>1)&&"video"!==s.contentType&&r.addClass("fancybox-can-swipe"))},isZoomable:function(){var t,e=this,n=e.current;if(n&&!e.isClosing&&"image"===n.type&&!n.hasError){if(!n.isLoaded)return!0;if((t=e.getFitPos(n))&&(n.width>t.width||n.height>t.height))return!0}return!1},isScaledDown:function(t,e){var o=this,i=!1,a=o.current,s=a.$content;return void 0!==t&&void 0!==e?i=t<a.width&&e<a.height:s&&(i=n.fancybox.getTranslate(s),i=i.width<a.width&&i.height<a.height),i},canPan:function(t,e){var o=this,i=o.current,a=null,s=!1;return"image"===i.type&&(i.isComplete||t&&e)&&!i.hasError&&(s=o.getFitPos(i),void 0!==t&&void 0!==e?a={width:t,height:e}:i.isComplete&&(a=n.fancybox.getTranslate(i.$content)),a&&s&&(s=Math.abs(a.width-s.width)>1.5||Math.abs(a.height-s.height)>1.5)),s},loadSlide:function(t){var e,o,i,a=this;if(!t.isLoading&&!t.isLoaded){if(t.isLoading=!0,!1===a.trigger("beforeLoad",t))return t.isLoading=!1,!1;switch(e=t.type,o=t.$slide,o.off("refresh").trigger("onReset").addClass(t.opts.slideClass),e){case"image":a.setImage(t);break;case"iframe":a.setIframe(t);break;case"html":a.setContent(t,t.src||t.content);break;case"video":a.setContent(t,t.opts.video.tpl.replace(/\{\{src\}\}/gi,t.src).replace("{{format}}",t.opts.videoFormat||t.opts.video.format||"").replace("{{poster}}",t.thumb||""));break;case"inline":n(t.src).length?a.setContent(t,n(t.src)):a.setError(t);break;case"ajax":a.showLoading(t),i=n.ajax(n.extend({},t.opts.ajax.settings,{url:t.src,success:function(e,n){"success"===n&&a.setContent(t,e)},error:function(e,n){e&&"abort"!==n&&a.setError(t)}})),o.one("onReset",function(){i.abort()});break;default:a.setError(t)}return!0}},setImage:function(t){var o,i=this;setTimeout(function(){var e=t.$image;i.isClosing||!t.isLoading||e&&e.length&&e[0].complete||t.hasError||i.showLoading(t)},50),i.checkSrcset(t),t.$content=n('<div class="fancybox-content"></div>').addClass("fancybox-is-hidden").appendTo(t.$slide.addClass("fancybox-slide--image")),!1!==t.opts.preload&&t.opts.width&&t.opts.height&&t.thumb&&(t.width=t.opts.width,t.height=t.opts.height,o=e.createElement("img"),o.onerror=function(){n(this).remove(),t.$ghost=null},o.onload=function(){i.afterLoad(t)},t.$ghost=n(o).addClass("fancybox-image").appendTo(t.$content).attr("src",t.thumb)),i.setBigImage(t)},checkSrcset:function(e){var n,o,i,a,s=e.opts.srcset||e.opts.image.srcset;if(s){i=t.devicePixelRatio||1,a=t.innerWidth*i,o=s.split(",").map(function(t){var e={};return t.trim().split(/\s+/).forEach(function(t,n){var o=parseInt(t.substring(0,t.length-1),10);if(0===n)return e.url=t;o&&(e.value=o,e.postfix=t[t.length-1])}),e}),o.sort(function(t,e){return t.value-e.value});for(var r=0;r<o.length;r++){var c=o[r];if("w"===c.postfix&&c.value>=a||"x"===c.postfix&&c.value>=i){n=c;break}}!n&&o.length&&(n=o[o.length-1]),n&&(e.src=n.url,e.width&&e.height&&"w"==n.postfix&&(e.height=e.width/e.height*n.value,e.width=n.value),e.opts.srcset=s)}},setBigImage:function(t){var o=this,i=e.createElement("img"),a=n(i);t.$image=a.one("error",function(){o.setError(t)}).one("load",function(){var e;t.$ghost||(o.resolveImageSlideSize(t,this.naturalWidth,this.naturalHeight),o.afterLoad(t)),o.isClosing||(t.opts.srcset&&(e=t.opts.sizes,e&&"auto"!==e||(e=(t.width/t.height>1&&s.width()/s.height()>1?"100":Math.round(t.width/t.height*100))+"vw"),a.attr("sizes",e).attr("srcset",t.opts.srcset)),t.$ghost&&setTimeout(function(){t.$ghost&&!o.isClosing&&t.$ghost.hide()},Math.min(300,Math.max(1e3,t.height/1600))),o.hideLoading(t))}).addClass("fancybox-image").attr("src",t.src).appendTo(t.$content),(i.complete||"complete"==i.readyState)&&a.naturalWidth&&a.naturalHeight?a.trigger("load"):i.error&&a.trigger("error")},resolveImageSlideSize:function(t,e,n){var o=parseInt(t.opts.width,10),i=parseInt(t.opts.height,10);t.width=e,t.height=n,o>0&&(t.width=o,t.height=Math.floor(o*n/e)),i>0&&(t.width=Math.floor(i*e/n),t.height=i)},setIframe:function(t){var e,o=this,i=t.opts.iframe,a=t.$slide;t.$content=n('<div class="fancybox-content'+(i.preload?" fancybox-is-hidden":"")+'"></div>').css(i.css).appendTo(a),a.addClass("fancybox-slide--"+t.contentType),t.$iframe=e=n(i.tpl.replace(/\{rnd\}/g,(new Date).getTime())).attr(i.attr).appendTo(t.$content),i.preload?(o.showLoading(t),e.on("load.fb error.fb",function(e){this.isReady=1,t.$slide.trigger("refresh"),o.afterLoad(t)}),a.on("refresh.fb",function(){var n,o,s=t.$content,r=i.css.width,c=i.css.height;if(1===e[0].isReady){try{n=e.contents(),o=n.find("body")}catch(t){}o&&o.length&&o.children().length&&(a.css("overflow","visible"),s.css({width:"100%","max-width":"100%",height:"9999px"}),void 0===r&&(r=Math.ceil(Math.max(o[0].clientWidth,o.outerWidth(!0)))),s.css("width",r||"").css("max-width",""),void 0===c&&(c=Math.ceil(Math.max(o[0].clientHeight,o.outerHeight(!0)))),s.css("height",c||""),a.css("overflow","auto")),s.removeClass("fancybox-is-hidden")}})):o.afterLoad(t),e.attr("src",t.src),a.one("onReset",function(){try{n(this).find("iframe").hide().unbind().attr("src","//about:blank")}catch(t){}n(this).off("refresh.fb").empty(),t.isLoaded=!1,t.isRevealed=!1})},setContent:function(t,e){var o=this;o.isClosing||(o.hideLoading(t),t.$content&&n.fancybox.stop(t.$content),t.$slide.empty(),l(e)&&e.parent().length?((e.hasClass("fancybox-content")||e.parent().hasClass("fancybox-content"))&&e.parents(".fancybox-slide").trigger("onReset"),t.$placeholder=n("<div>").hide().insertAfter(e),e.css("display","inline-block")):t.hasError||("string"===n.type(e)&&(e=n("<div>").append(n.trim(e)).contents()),t.opts.filter&&(e=n("<div>").html(e).find(t.opts.filter))),t.$slide.one("onReset",function(){n(this).find("video,audio").trigger("pause"),t.$placeholder&&(t.$placeholder.after(e.removeClass("fancybox-content").hide()).remove(),t.$placeholder=null),t.$smallBtn&&(t.$smallBtn.remove(),t.$smallBtn=null),t.hasError||(n(this).empty(),t.isLoaded=!1,t.isRevealed=!1)}),n(e).appendTo(t.$slide),n(e).is("video,audio")&&(n(e).addClass("fancybox-video"),n(e).wrap("<div></div>"),t.contentType="video",t.opts.width=t.opts.width||n(e).attr("width"),t.opts.height=t.opts.height||n(e).attr("height")),t.$content=t.$slide.children().filter("div,form,main,video,audio,article,.fancybox-content").first(),t.$content.siblings().hide(),t.$content.length||(t.$content=t.$slide.wrapInner("<div></div>").children().first()),t.$content.addClass("fancybox-content"),t.$slide.addClass("fancybox-slide--"+t.contentType),o.afterLoad(t))},setError:function(t){t.hasError=!0,t.$slide.trigger("onReset").removeClass("fancybox-slide--"+t.contentType).addClass("fancybox-slide--error"),t.contentType="html",this.setContent(t,this.translate(t,t.opts.errorTpl)),t.pos===this.currPos&&(this.isAnimating=!1)},showLoading:function(t){var e=this;(t=t||e.current)&&!t.$spinner&&(t.$spinner=n(e.translate(e,e.opts.spinnerTpl)).appendTo(t.$slide).hide().fadeIn("fast"))},hideLoading:function(t){var e=this;(t=t||e.current)&&t.$spinner&&(t.$spinner.stop().remove(),delete t.$spinner)},afterLoad:function(t){var e=this;e.isClosing||(t.isLoading=!1,t.isLoaded=!0,e.trigger("afterLoad",t),e.hideLoading(t),!t.opts.smallBtn||t.$smallBtn&&t.$smallBtn.length||(t.$smallBtn=n(e.translate(t,t.opts.btnTpl.smallBtn)).appendTo(t.$content)),t.opts.protect&&t.$content&&!t.hasError&&(t.$content.on("contextmenu.fb",function(t){return 2==t.button&&t.preventDefault(),!0}),"image"===t.type&&n('<div class="fancybox-spaceball"></div>').appendTo(t.$content)),e.adjustCaption(t),e.adjustLayout(t),t.pos===e.currPos&&e.updateCursor(),e.revealContent(t))},adjustCaption:function(t){var e,n=this,o=t||n.current,i=o.opts.caption,a=o.opts.preventCaptionOverlap,s=n.$refs.caption,r=!1;s.toggleClass("fancybox-caption--separate",a),a&&i&&i.length&&(o.pos!==n.currPos?(e=s.clone().appendTo(s.parent()),e.children().eq(0).empty().html(i),r=e.outerHeight(!0),e.empty().remove()):n.$caption&&(r=n.$caption.outerHeight(!0)),o.$slide.css("padding-bottom",r||""))},adjustLayout:function(t){var e,n,o,i,a=this,s=t||a.current;s.isLoaded&&!0!==s.opts.disableLayoutFix&&(s.$content.css("margin-bottom",""),s.$content.outerHeight()>s.$slide.height()+.5&&(o=s.$slide[0].style["padding-bottom"],i=s.$slide.css("padding-bottom"),parseFloat(i)>0&&(e=s.$slide[0].scrollHeight,s.$slide.css("padding-bottom",0),Math.abs(e-s.$slide[0].scrollHeight)<1&&(n=i),s.$slide.css("padding-bottom",o))),s.$content.css("margin-bottom",n))},revealContent:function(t){var e,o,i,a,s=this,r=t.$slide,c=!1,l=!1,d=s.isMoved(t),u=t.isRevealed;return t.isRevealed=!0,e=t.opts[s.firstRun?"animationEffect":"transitionEffect"],i=t.opts[s.firstRun?"animationDuration":"transitionDuration"],i=parseInt(void 0===t.forcedDuration?i:t.forcedDuration,10),!d&&t.pos===s.currPos&&i||(e=!1),"zoom"===e&&(t.pos===s.currPos&&i&&"image"===t.type&&!t.hasError&&(l=s.getThumbPos(t))?c=s.getFitPos(t):e="fade"),"zoom"===e?(s.isAnimating=!0,c.scaleX=c.width/l.width,c.scaleY=c.height/l.height,a=t.opts.zoomOpacity,"auto"==a&&(a=Math.abs(t.width/t.height-l.width/l.height)>.1),a&&(l.opacity=.1,c.opacity=1),n.fancybox.setTranslate(t.$content.removeClass("fancybox-is-hidden"),l),p(t.$content),void n.fancybox.animate(t.$content,c,i,function(){s.isAnimating=!1,s.complete()})):(s.updateSlide(t),e?(n.fancybox.stop(r),o="fancybox-slide--"+(t.pos>=s.prevPos?"next":"previous")+" fancybox-animated fancybox-fx-"+e,r.addClass(o).removeClass("fancybox-slide--current"),t.$content.removeClass("fancybox-is-hidden"),p(r),"image"!==t.type&&t.$content.hide().show(0),void n.fancybox.animate(r,"fancybox-slide--current",i,function(){r.removeClass(o).css({transform:"",opacity:""}),t.pos===s.currPos&&s.complete()},!0)):(t.$content.removeClass("fancybox-is-hidden"),u||!d||"image"!==t.type||t.hasError||t.$content.hide().fadeIn("fast"),void(t.pos===s.currPos&&s.complete())))},getThumbPos:function(t){var e,o,i,a,s,r=!1,c=t.$thumb;return!(!c||!g(c[0]))&&(e=n.fancybox.getTranslate(c),o=parseFloat(c.css("border-top-width")||0),i=parseFloat(c.css("border-right-width")||0),a=parseFloat(c.css("border-bottom-width")||0),s=parseFloat(c.css("border-left-width")||0),r={top:e.top+o,left:e.left+s,width:e.width-i-s,height:e.height-o-a,scaleX:1,scaleY:1},e.width>0&&e.height>0&&r)},complete:function(){var t,e=this,o=e.current,i={};!e.isMoved()&&o.isLoaded&&(o.isComplete||(o.isComplete=!0,o.$slide.siblings().trigger("onReset"),e.preload("inline"),p(o.$slide),o.$slide.addClass("fancybox-slide--complete"),n.each(e.slides,function(t,o){o.pos>=e.currPos-1&&o.pos<=e.currPos+1?i[o.pos]=o:o&&(n.fancybox.stop(o.$slide),o.$slide.off().remove())}),e.slides=i),e.isAnimating=!1,e.updateCursor(),e.trigger("afterShow"),o.opts.video.autoStart&&o.$slide.find("video,audio").filter(":visible:first").trigger("play").one("ended",function(){Document.exitFullscreen?Document.exitFullscreen():this.webkitExitFullscreen&&this.webkitExitFullscreen(),e.next()}),o.opts.autoFocus&&"html"===o.contentType&&(t=o.$content.find("input[autofocus]:enabled:visible:first"),t.length?t.trigger("focus"):e.focus(null,!0)),o.$slide.scrollTop(0).scrollLeft(0))},preload:function(t){var e,n,o=this;o.group.length<2||(n=o.slides[o.currPos+1],e=o.slides[o.currPos-1],e&&e.type===t&&o.loadSlide(e),n&&n.type===t&&o.loadSlide(n))},focus:function(t,o){var i,a,s=this,r=["a[href]","area[href]",'input:not([disabled]):not([type="hidden"]):not([aria-hidden])',"select:not([disabled]):not([aria-hidden])","textarea:not([disabled]):not([aria-hidden])","button:not([disabled]):not([aria-hidden])","iframe","object","embed","video","audio","[contenteditable]",'[tabindex]:not([tabindex^="-"])'].join(",");s.isClosing||(i=!t&&s.current&&s.current.isComplete?s.current.$slide.find("*:visible"+(o?":not(.fancybox-close-small)":"")):s.$refs.container.find("*:visible"),i=i.filter(r).filter(function(){return"hidden"!==n(this).css("visibility")&&!n(this).hasClass("disabled")}),i.length?(a=i.index(e.activeElement),t&&t.shiftKey?(a<0||0==a)&&(t.preventDefault(),i.eq(i.length-1).trigger("focus")):(a<0||a==i.length-1)&&(t&&t.preventDefault(),i.eq(0).trigger("focus"))):s.$refs.container.trigger("focus"))},activate:function(){var t=this;n(".fancybox-container").each(function(){var e=n(this).data("FancyBox");e&&e.id!==t.id&&!e.isClosing&&(e.trigger("onDeactivate"),e.removeEvents(),e.isVisible=!1)}),t.isVisible=!0,(t.current||t.isIdle)&&(t.update(),t.updateControls()),t.trigger("onActivate"),t.addEvents()},close:function(t,e){var o,i,a,s,r,c,l,u=this,f=u.current,h=function(){u.cleanUp(t)};return!u.isClosing&&(u.isClosing=!0,!1===u.trigger("beforeClose",t)?(u.isClosing=!1,d(function(){u.update()}),!1):(u.removeEvents(),a=f.$content,o=f.opts.animationEffect,i=n.isNumeric(e)?e:o?f.opts.animationDuration:0,f.$slide.removeClass("fancybox-slide--complete fancybox-slide--next fancybox-slide--previous fancybox-animated"),!0!==t?n.fancybox.stop(f.$slide):o=!1,f.$slide.siblings().trigger("onReset").remove(),i&&u.$refs.container.removeClass("fancybox-is-open").addClass("fancybox-is-closing").css("transition-duration",i+"ms"),u.hideLoading(f),u.hideControls(!0),u.updateCursor(),"zoom"!==o||a&&i&&"image"===f.type&&!u.isMoved()&&!f.hasError&&(l=u.getThumbPos(f))||(o="fade"),"zoom"===o?(n.fancybox.stop(a),s=n.fancybox.getTranslate(a),c={top:s.top,left:s.left,scaleX:s.width/l.width,scaleY:s.height/l.height,width:l.width,height:l.height},r=f.opts.zoomOpacity,
+"auto"==r&&(r=Math.abs(f.width/f.height-l.width/l.height)>.1),r&&(l.opacity=0),n.fancybox.setTranslate(a,c),p(a),n.fancybox.animate(a,l,i,h),!0):(o&&i?n.fancybox.animate(f.$slide.addClass("fancybox-slide--previous").removeClass("fancybox-slide--current"),"fancybox-animated fancybox-fx-"+o,i,h):!0===t?setTimeout(h,i):h(),!0)))},cleanUp:function(e){var o,i,a,s=this,r=s.current.opts.$orig;s.current.$slide.trigger("onReset"),s.$refs.container.empty().remove(),s.trigger("afterClose",e),s.current.opts.backFocus&&(r&&r.length&&r.is(":visible")||(r=s.$trigger),r&&r.length&&(i=t.scrollX,a=t.scrollY,r.trigger("focus"),n("html, body").scrollTop(a).scrollLeft(i))),s.current=null,o=n.fancybox.getInstance(),o?o.activate():(n("body").removeClass("fancybox-active compensate-for-scrollbar"),n("#fancybox-style-noscroll").remove())},trigger:function(t,e){var o,i=Array.prototype.slice.call(arguments,1),a=this,s=e&&e.opts?e:a.current;if(s?i.unshift(s):s=a,i.unshift(a),n.isFunction(s.opts[t])&&(o=s.opts[t].apply(s,i)),!1===o)return o;"afterClose"!==t&&a.$refs?a.$refs.container.trigger(t+".fb",i):r.trigger(t+".fb",i)},updateControls:function(){var t=this,o=t.current,i=o.index,a=t.$refs.container,s=t.$refs.caption,r=o.opts.caption;o.$slide.trigger("refresh"),r&&r.length?(t.$caption=s,s.children().eq(0).html(r)):t.$caption=null,t.hasHiddenControls||t.isIdle||t.showControls(),a.find("[data-fancybox-count]").html(t.group.length),a.find("[data-fancybox-index]").html(i+1),a.find("[data-fancybox-prev]").prop("disabled",!o.opts.loop&&i<=0),a.find("[data-fancybox-next]").prop("disabled",!o.opts.loop&&i>=t.group.length-1),"image"===o.type?a.find("[data-fancybox-zoom]").show().end().find("[data-fancybox-download]").attr("href",o.opts.image.src||o.src).show():o.opts.toolbar&&a.find("[data-fancybox-download],[data-fancybox-zoom]").hide(),n(e.activeElement).is(":hidden,[disabled]")&&t.$refs.container.trigger("focus")},hideControls:function(t){var e=this,n=["infobar","toolbar","nav"];!t&&e.current.opts.preventCaptionOverlap||n.push("caption"),this.$refs.container.removeClass(n.map(function(t){return"fancybox-show-"+t}).join(" ")),this.hasHiddenControls=!0},showControls:function(){var t=this,e=t.current?t.current.opts:t.opts,n=t.$refs.container;t.hasHiddenControls=!1,t.idleSecondsCounter=0,n.toggleClass("fancybox-show-toolbar",!(!e.toolbar||!e.buttons)).toggleClass("fancybox-show-infobar",!!(e.infobar&&t.group.length>1)).toggleClass("fancybox-show-caption",!!t.$caption).toggleClass("fancybox-show-nav",!!(e.arrows&&t.group.length>1)).toggleClass("fancybox-is-modal",!!e.modal)},toggleControls:function(){this.hasHiddenControls?this.showControls():this.hideControls()}}),n.fancybox={version:"3.5.7",defaults:a,getInstance:function(t){var e=n('.fancybox-container:not(".fancybox-is-closing"):last').data("FancyBox"),o=Array.prototype.slice.call(arguments,1);return e instanceof b&&("string"===n.type(t)?e[t].apply(e,o):"function"===n.type(t)&&t.apply(e,o),e)},open:function(t,e,n){return new b(t,e,n)},close:function(t){var e=this.getInstance();e&&(e.close(),!0===t&&this.close(t))},destroy:function(){this.close(!0),r.add("body").off("click.fb-start","**")},isMobile:/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent),use3d:function(){var n=e.createElement("div");return t.getComputedStyle&&t.getComputedStyle(n)&&t.getComputedStyle(n).getPropertyValue("transform")&&!(e.documentMode&&e.documentMode<11)}(),getTranslate:function(t){var e;return!(!t||!t.length)&&(e=t[0].getBoundingClientRect(),{top:e.top||0,left:e.left||0,width:e.width,height:e.height,opacity:parseFloat(t.css("opacity"))})},setTranslate:function(t,e){var n="",o={};if(t&&e)return void 0===e.left&&void 0===e.top||(n=(void 0===e.left?t.position().left:e.left)+"px, "+(void 0===e.top?t.position().top:e.top)+"px",n=this.use3d?"translate3d("+n+", 0px)":"translate("+n+")"),void 0!==e.scaleX&&void 0!==e.scaleY?n+=" scale("+e.scaleX+", "+e.scaleY+")":void 0!==e.scaleX&&(n+=" scaleX("+e.scaleX+")"),n.length&&(o.transform=n),void 0!==e.opacity&&(o.opacity=e.opacity),void 0!==e.width&&(o.width=e.width),void 0!==e.height&&(o.height=e.height),t.css(o)},animate:function(t,e,o,i,a){var s,r=this;n.isFunction(o)&&(i=o,o=null),r.stop(t),s=r.getTranslate(t),t.on(f,function(c){(!c||!c.originalEvent||t.is(c.originalEvent.target)&&"z-index"!=c.originalEvent.propertyName)&&(r.stop(t),n.isNumeric(o)&&t.css("transition-duration",""),n.isPlainObject(e)?void 0!==e.scaleX&&void 0!==e.scaleY&&r.setTranslate(t,{top:e.top,left:e.left,width:s.width*e.scaleX,height:s.height*e.scaleY,scaleX:1,scaleY:1}):!0!==a&&t.removeClass(e),n.isFunction(i)&&i(c))}),n.isNumeric(o)&&t.css("transition-duration",o+"ms"),n.isPlainObject(e)?(void 0!==e.scaleX&&void 0!==e.scaleY&&(delete e.width,delete e.height,t.parent().hasClass("fancybox-slide--image")&&t.parent().addClass("fancybox-is-scaling")),n.fancybox.setTranslate(t,e)):t.addClass(e),t.data("timer",setTimeout(function(){t.trigger(f)},o+33))},stop:function(t,e){t&&t.length&&(clearTimeout(t.data("timer")),e&&t.trigger(f),t.off(f).css("transition-duration",""),t.parent().removeClass("fancybox-is-scaling"))}},n.fn.fancybox=function(t){var e;return t=t||{},e=t.selector||!1,e?n("body").off("click.fb-start",e).on("click.fb-start",e,{options:t},i):this.off("click.fb-start").on("click.fb-start",{items:this,options:t},i),this},r.on("click.fb-start","[data-fancybox]",i),r.on("click.fb-start","[data-fancybox-trigger]",function(t){n('[data-fancybox="'+n(this).attr("data-fancybox-trigger")+'"]').eq(n(this).attr("data-fancybox-index")||0).trigger("click.fb-start",{$trigger:n(this)})}),function(){var t=null;r.on("mousedown mouseup focus blur",".fancybox-button",function(e){switch(e.type){case"mousedown":t=n(this);break;case"mouseup":t=null;break;case"focusin":n(".fancybox-button").removeClass("fancybox-focus"),n(this).is(t)||n(this).is("[disabled]")||n(this).addClass("fancybox-focus");break;case"focusout":n(".fancybox-button").removeClass("fancybox-focus")}})}()}}(window,document,jQuery),function(t){"use strict";var e={youtube:{matcher:/(youtube\.com|youtu\.be|youtube\-nocookie\.com)\/(watch\?(.*&)?v=|v\/|u\/|embed\/?)?(videoseries\?list=(.*)|[\w-]{11}|\?listType=(.*)&list=(.*))(.*)/i,params:{autoplay:1,autohide:1,fs:1,rel:0,hd:1,wmode:"transparent",enablejsapi:1,html5:1},paramPlace:8,type:"iframe",url:"https://www.youtube-nocookie.com/embed/$4",thumb:"https://img.youtube.com/vi/$4/hqdefault.jpg"},vimeo:{matcher:/^.+vimeo.com\/(.*\/)?([\d]+)(.*)?/,params:{autoplay:1,hd:1,show_title:1,show_byline:1,show_portrait:0,fullscreen:1},paramPlace:3,type:"iframe",url:"//player.vimeo.com/video/$2"},instagram:{matcher:/(instagr\.am|instagram\.com)\/p\/([a-zA-Z0-9_\-]+)\/?/i,type:"image",url:"//$1/p/$2/media/?size=l"},gmap_place:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(((maps\/(place\/(.*)\/)?\@(.*),(\d+.?\d+?)z))|(\?ll=))(.*)?/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/?ll="+(t[9]?t[9]+"&z="+Math.floor(t[10])+(t[12]?t[12].replace(/^\//,"&"):""):t[12]+"").replace(/\?/,"&")+"&output="+(t[12]&&t[12].indexOf("layer=c")>0?"svembed":"embed")}},gmap_search:{matcher:/(maps\.)?google\.([a-z]{2,3}(\.[a-z]{2})?)\/(maps\/search\/)(.*)/i,type:"iframe",url:function(t){return"//maps.google."+t[2]+"/maps?q="+t[5].replace("query=","q=").replace("api=1","")+"&output=embed"}}},n=function(e,n,o){if(e)return o=o||"","object"===t.type(o)&&(o=t.param(o,!0)),t.each(n,function(t,n){e=e.replace("$"+t,n||"")}),o.length&&(e+=(e.indexOf("?")>0?"&":"?")+o),e};t(document).on("objectNeedsType.fb",function(o,i,a){var s,r,c,l,d,u,f,p=a.src||"",h=!1;s=t.extend(!0,{},e,a.opts.media),t.each(s,function(e,o){if(c=p.match(o.matcher)){if(h=o.type,f=e,u={},o.paramPlace&&c[o.paramPlace]){d=c[o.paramPlace],"?"==d[0]&&(d=d.substring(1)),d=d.split("&");for(var i=0;i<d.length;++i){var s=d[i].split("=",2);2==s.length&&(u[s[0]]=decodeURIComponent(s[1].replace(/\+/g," ")))}}return l=t.extend(!0,{},o.params,a.opts[e],u),p="function"===t.type(o.url)?o.url.call(this,c,l,a):n(o.url,c,l),r="function"===t.type(o.thumb)?o.thumb.call(this,c,l,a):n(o.thumb,c),"youtube"===e?p=p.replace(/&t=((\d+)m)?(\d+)s/,function(t,e,n,o){return"&start="+((n?60*parseInt(n,10):0)+parseInt(o,10))}):"vimeo"===e&&(p=p.replace("&%23","#")),!1}}),h?(a.opts.thumb||a.opts.$thumb&&a.opts.$thumb.length||(a.opts.thumb=r),"iframe"===h&&(a.opts=t.extend(!0,a.opts,{iframe:{preload:!1,attr:{scrolling:"no"}}})),t.extend(a,{type:h,src:p,origSrc:a.src,contentSource:f,contentType:"image"===h?"image":"gmap_place"==f||"gmap_search"==f?"map":"video"})):p&&(a.type=a.opts.defaultType)});var o={youtube:{src:"https://www.youtube.com/iframe_api",class:"YT",loading:!1,loaded:!1},vimeo:{src:"https://player.vimeo.com/api/player.js",class:"Vimeo",loading:!1,loaded:!1},load:function(t){var e,n=this;if(this[t].loaded)return void setTimeout(function(){n.done(t)});this[t].loading||(this[t].loading=!0,e=document.createElement("script"),e.type="text/javascript",e.src=this[t].src,"youtube"===t?window.onYouTubeIframeAPIReady=function(){n[t].loaded=!0,n.done(t)}:e.onload=function(){n[t].loaded=!0,n.done(t)},document.body.appendChild(e))},done:function(e){var n,o,i;"youtube"===e&&delete window.onYouTubeIframeAPIReady,(n=t.fancybox.getInstance())&&(o=n.current.$content.find("iframe"),"youtube"===e&&void 0!==YT&&YT?i=new YT.Player(o.attr("id"),{events:{onStateChange:function(t){0==t.data&&n.next()}}}):"vimeo"===e&&void 0!==Vimeo&&Vimeo&&(i=new Vimeo.Player(o),i.on("ended",function(){n.next()})))}};t(document).on({"afterShow.fb":function(t,e,n){e.group.length>1&&("youtube"===n.contentSource||"vimeo"===n.contentSource)&&o.load(n.contentSource)}})}(jQuery),function(t,e,n){"use strict";var o=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||t.oRequestAnimationFrame||function(e){return t.setTimeout(e,1e3/60)}}(),i=function(){return t.cancelAnimationFrame||t.webkitCancelAnimationFrame||t.mozCancelAnimationFrame||t.oCancelAnimationFrame||function(e){t.clearTimeout(e)}}(),a=function(e){var n=[];e=e.originalEvent||e||t.e,e=e.touches&&e.touches.length?e.touches:e.changedTouches&&e.changedTouches.length?e.changedTouches:[e];for(var o in e)e[o].pageX?n.push({x:e[o].pageX,y:e[o].pageY}):e[o].clientX&&n.push({x:e[o].clientX,y:e[o].clientY});return n},s=function(t,e,n){return e&&t?"x"===n?t.x-e.x:"y"===n?t.y-e.y:Math.sqrt(Math.pow(t.x-e.x,2)+Math.pow(t.y-e.y,2)):0},r=function(t){if(t.is('a,area,button,[role="button"],input,label,select,summary,textarea,video,audio,iframe')||n.isFunction(t.get(0).onclick)||t.data("selectable"))return!0;for(var e=0,o=t[0].attributes,i=o.length;e<i;e++)if("data-fancybox-"===o[e].nodeName.substr(0,14))return!0;return!1},c=function(e){var n=t.getComputedStyle(e)["overflow-y"],o=t.getComputedStyle(e)["overflow-x"],i=("scroll"===n||"auto"===n)&&e.scrollHeight>e.clientHeight,a=("scroll"===o||"auto"===o)&&e.scrollWidth>e.clientWidth;return i||a},l=function(t){for(var e=!1;;){if(e=c(t.get(0)))break;if(t=t.parent(),!t.length||t.hasClass("fancybox-stage")||t.is("body"))break}return e},d=function(t){var e=this;e.instance=t,e.$bg=t.$refs.bg,e.$stage=t.$refs.stage,e.$container=t.$refs.container,e.destroy(),e.$container.on("touchstart.fb.touch mousedown.fb.touch",n.proxy(e,"ontouchstart"))};d.prototype.destroy=function(){var t=this;t.$container.off(".fb.touch"),n(e).off(".fb.touch"),t.requestId&&(i(t.requestId),t.requestId=null),t.tapped&&(clearTimeout(t.tapped),t.tapped=null)},d.prototype.ontouchstart=function(o){var i=this,c=n(o.target),d=i.instance,u=d.current,f=u.$slide,p=u.$content,h="touchstart"==o.type;if(h&&i.$container.off("mousedown.fb.touch"),(!o.originalEvent||2!=o.originalEvent.button)&&f.length&&c.length&&!r(c)&&!r(c.parent())&&(c.is("img")||!(o.originalEvent.clientX>c[0].clientWidth+c.offset().left))){if(!u||d.isAnimating||u.$slide.hasClass("fancybox-animated"))return o.stopPropagation(),void o.preventDefault();i.realPoints=i.startPoints=a(o),i.startPoints.length&&(u.touch&&o.stopPropagation(),i.startEvent=o,i.canTap=!0,i.$target=c,i.$content=p,i.opts=u.opts.touch,i.isPanning=!1,i.isSwiping=!1,i.isZooming=!1,i.isScrolling=!1,i.canPan=d.canPan(),i.startTime=(new Date).getTime(),i.distanceX=i.distanceY=i.distance=0,i.canvasWidth=Math.round(f[0].clientWidth),i.canvasHeight=Math.round(f[0].clientHeight),i.contentLastPos=null,i.contentStartPos=n.fancybox.getTranslate(i.$content)||{top:0,left:0},i.sliderStartPos=n.fancybox.getTranslate(f),i.stagePos=n.fancybox.getTranslate(d.$refs.stage),i.sliderStartPos.top-=i.stagePos.top,i.sliderStartPos.left-=i.stagePos.left,i.contentStartPos.top-=i.stagePos.top,i.contentStartPos.left-=i.stagePos.left,n(e).off(".fb.touch").on(h?"touchend.fb.touch touchcancel.fb.touch":"mouseup.fb.touch mouseleave.fb.touch",n.proxy(i,"ontouchend")).on(h?"touchmove.fb.touch":"mousemove.fb.touch",n.proxy(i,"ontouchmove")),n.fancybox.isMobile&&e.addEventListener("scroll",i.onscroll,!0),((i.opts||i.canPan)&&(c.is(i.$stage)||i.$stage.find(c).length)||(c.is(".fancybox-image")&&o.preventDefault(),n.fancybox.isMobile&&c.parents(".fancybox-caption").length))&&(i.isScrollable=l(c)||l(c.parent()),n.fancybox.isMobile&&i.isScrollable||o.preventDefault(),(1===i.startPoints.length||u.hasError)&&(i.canPan?(n.fancybox.stop(i.$content),i.isPanning=!0):i.isSwiping=!0,i.$container.addClass("fancybox-is-grabbing")),2===i.startPoints.length&&"image"===u.type&&(u.isLoaded||u.$ghost)&&(i.canTap=!1,i.isSwiping=!1,i.isPanning=!1,i.isZooming=!0,n.fancybox.stop(i.$content),i.centerPointStartX=.5*(i.startPoints[0].x+i.startPoints[1].x)-n(t).scrollLeft(),i.centerPointStartY=.5*(i.startPoints[0].y+i.startPoints[1].y)-n(t).scrollTop(),i.percentageOfImageAtPinchPointX=(i.centerPointStartX-i.contentStartPos.left)/i.contentStartPos.width,i.percentageOfImageAtPinchPointY=(i.centerPointStartY-i.contentStartPos.top)/i.contentStartPos.height,i.startDistanceBetweenFingers=s(i.startPoints[0],i.startPoints[1]))))}},d.prototype.onscroll=function(t){var n=this;n.isScrolling=!0,e.removeEventListener("scroll",n.onscroll,!0)},d.prototype.ontouchmove=function(t){var e=this;return void 0!==t.originalEvent.buttons&&0===t.originalEvent.buttons?void e.ontouchend(t):e.isScrolling?void(e.canTap=!1):(e.newPoints=a(t),void((e.opts||e.canPan)&&e.newPoints.length&&e.newPoints.length&&(e.isSwiping&&!0===e.isSwiping||t.preventDefault(),e.distanceX=s(e.newPoints[0],e.startPoints[0],"x"),e.distanceY=s(e.newPoints[0],e.startPoints[0],"y"),e.distance=s(e.newPoints[0],e.startPoints[0]),e.distance>0&&(e.isSwiping?e.onSwipe(t):e.isPanning?e.onPan():e.isZooming&&e.onZoom()))))},d.prototype.onSwipe=function(e){var a,s=this,r=s.instance,c=s.isSwiping,l=s.sliderStartPos.left||0;if(!0!==c)"x"==c&&(s.distanceX>0&&(s.instance.group.length<2||0===s.instance.current.index&&!s.instance.current.opts.loop)?l+=Math.pow(s.distanceX,.8):s.distanceX<0&&(s.instance.group.length<2||s.instance.current.index===s.instance.group.length-1&&!s.instance.current.opts.loop)?l-=Math.pow(-s.distanceX,.8):l+=s.distanceX),s.sliderLastPos={top:"x"==c?0:s.sliderStartPos.top+s.distanceY,left:l},s.requestId&&(i(s.requestId),s.requestId=null),s.requestId=o(function(){s.sliderLastPos&&(n.each(s.instance.slides,function(t,e){var o=e.pos-s.instance.currPos;n.fancybox.setTranslate(e.$slide,{top:s.sliderLastPos.top,left:s.sliderLastPos.left+o*s.canvasWidth+o*e.opts.gutter})}),s.$container.addClass("fancybox-is-sliding"))});else if(Math.abs(s.distance)>10){if(s.canTap=!1,r.group.length<2&&s.opts.vertical?s.isSwiping="y":r.isDragging||!1===s.opts.vertical||"auto"===s.opts.vertical&&n(t).width()>800?s.isSwiping="x":(a=Math.abs(180*Math.atan2(s.distanceY,s.distanceX)/Math.PI),s.isSwiping=a>45&&a<135?"y":"x"),"y"===s.isSwiping&&n.fancybox.isMobile&&s.isScrollable)return void(s.isScrolling=!0);r.isDragging=s.isSwiping,s.startPoints=s.newPoints,n.each(r.slides,function(t,e){var o,i;n.fancybox.stop(e.$slide),o=n.fancybox.getTranslate(e.$slide),i=n.fancybox.getTranslate(r.$refs.stage),e.$slide.css({transform:"",opacity:"","transition-duration":""}).removeClass("fancybox-animated").removeClass(function(t,e){return(e.match(/(^|\s)fancybox-fx-\S+/g)||[]).join(" ")}),e.pos===r.current.pos&&(s.sliderStartPos.top=o.top-i.top,s.sliderStartPos.left=o.left-i.left),n.fancybox.setTranslate(e.$slide,{top:o.top-i.top,left:o.left-i.left})}),r.SlideShow&&r.SlideShow.isActive&&r.SlideShow.stop()}},d.prototype.onPan=function(){var t=this;if(s(t.newPoints[0],t.realPoints[0])<(n.fancybox.isMobile?10:5))return void(t.startPoints=t.newPoints);t.canTap=!1,t.contentLastPos=t.limitMovement(),t.requestId&&i(t.requestId),t.requestId=o(function(){n.fancybox.setTranslate(t.$content,t.contentLastPos)})},d.prototype.limitMovement=function(){var t,e,n,o,i,a,s=this,r=s.canvasWidth,c=s.canvasHeight,l=s.distanceX,d=s.distanceY,u=s.contentStartPos,f=u.left,p=u.top,h=u.width,g=u.height;return i=h>r?f+l:f,a=p+d,t=Math.max(0,.5*r-.5*h),e=Math.max(0,.5*c-.5*g),n=Math.min(r-h,.5*r-.5*h),o=Math.min(c-g,.5*c-.5*g),l>0&&i>t&&(i=t-1+Math.pow(-t+f+l,.8)||0),l<0&&i<n&&(i=n+1-Math.pow(n-f-l,.8)||0),d>0&&a>e&&(a=e-1+Math.pow(-e+p+d,.8)||0),d<0&&a<o&&(a=o+1-Math.pow(o-p-d,.8)||0),{top:a,left:i}},d.prototype.limitPosition=function(t,e,n,o){var i=this,a=i.canvasWidth,s=i.canvasHeight;return n>a?(t=t>0?0:t,t=t<a-n?a-n:t):t=Math.max(0,a/2-n/2),o>s?(e=e>0?0:e,e=e<s-o?s-o:e):e=Math.max(0,s/2-o/2),{top:e,left:t}},d.prototype.onZoom=function(){var e=this,a=e.contentStartPos,r=a.width,c=a.height,l=a.left,d=a.top,u=s(e.newPoints[0],e.newPoints[1]),f=u/e.startDistanceBetweenFingers,p=Math.floor(r*f),h=Math.floor(c*f),g=(r-p)*e.percentageOfImageAtPinchPointX,b=(c-h)*e.percentageOfImageAtPinchPointY,m=(e.newPoints[0].x+e.newPoints[1].x)/2-n(t).scrollLeft(),v=(e.newPoints[0].y+e.newPoints[1].y)/2-n(t).scrollTop(),y=m-e.centerPointStartX,x=v-e.centerPointStartY,w=l+(g+y),$=d+(b+x),S={top:$,left:w,scaleX:f,scaleY:f};e.canTap=!1,e.newWidth=p,e.newHeight=h,e.contentLastPos=S,e.requestId&&i(e.requestId),e.requestId=o(function(){n.fancybox.setTranslate(e.$content,e.contentLastPos)})},d.prototype.ontouchend=function(t){var o=this,s=o.isSwiping,r=o.isPanning,c=o.isZooming,l=o.isScrolling;if(o.endPoints=a(t),o.dMs=Math.max((new Date).getTime()-o.startTime,1),o.$container.removeClass("fancybox-is-grabbing"),n(e).off(".fb.touch"),e.removeEventListener("scroll",o.onscroll,!0),o.requestId&&(i(o.requestId),o.requestId=null),o.isSwiping=!1,o.isPanning=!1,o.isZooming=!1,o.isScrolling=!1,o.instance.isDragging=!1,o.canTap)return o.onTap(t);o.speed=100,o.velocityX=o.distanceX/o.dMs*.5,o.velocityY=o.distanceY/o.dMs*.5,r?o.endPanning():c?o.endZooming():o.endSwiping(s,l)},d.prototype.endSwiping=function(t,e){var o=this,i=!1,a=o.instance.group.length,s=Math.abs(o.distanceX),r="x"==t&&a>1&&(o.dMs>130&&s>10||s>50);o.sliderLastPos=null,"y"==t&&!e&&Math.abs(o.distanceY)>50?(n.fancybox.animate(o.instance.current.$slide,{top:o.sliderStartPos.top+o.distanceY+150*o.velocityY,opacity:0},200),i=o.instance.close(!0,250)):r&&o.distanceX>0?i=o.instance.previous(300):r&&o.distanceX<0&&(i=o.instance.next(300)),!1!==i||"x"!=t&&"y"!=t||o.instance.centerSlide(200),o.$container.removeClass("fancybox-is-sliding")},d.prototype.endPanning=function(){var t,e,o,i=this;i.contentLastPos&&(!1===i.opts.momentum||i.dMs>350?(t=i.contentLastPos.left,e=i.contentLastPos.top):(t=i.contentLastPos.left+500*i.velocityX,e=i.contentLastPos.top+500*i.velocityY),o=i.limitPosition(t,e,i.contentStartPos.width,i.contentStartPos.height),o.width=i.contentStartPos.width,o.height=i.contentStartPos.height,n.fancybox.animate(i.$content,o,366))},d.prototype.endZooming=function(){var t,e,o,i,a=this,s=a.instance.current,r=a.newWidth,c=a.newHeight;a.contentLastPos&&(t=a.contentLastPos.left,e=a.contentLastPos.top,i={top:e,left:t,width:r,height:c,scaleX:1,scaleY:1},n.fancybox.setTranslate(a.$content,i),r<a.canvasWidth&&c<a.canvasHeight?a.instance.scaleToFit(150):r>s.width||c>s.height?a.instance.scaleToActual(a.centerPointStartX,a.centerPointStartY,150):(o=a.limitPosition(t,e,r,c),n.fancybox.animate(a.$content,o,150)))},d.prototype.onTap=function(e){var o,i=this,s=n(e.target),r=i.instance,c=r.current,l=e&&a(e)||i.startPoints,d=l[0]?l[0].x-n(t).scrollLeft()-i.stagePos.left:0,u=l[0]?l[0].y-n(t).scrollTop()-i.stagePos.top:0,f=function(t){var o=c.opts[t];if(n.isFunction(o)&&(o=o.apply(r,[c,e])),o)switch(o){case"close":r.close(i.startEvent);break;case"toggleControls":r.toggleControls();break;case"next":r.next();break;case"nextOrClose":r.group.length>1?r.next():r.close(i.startEvent);break;case"zoom":"image"==c.type&&(c.isLoaded||c.$ghost)&&(r.canPan()?r.scaleToFit():r.isScaledDown()?r.scaleToActual(d,u):r.group.length<2&&r.close(i.startEvent))}};if((!e.originalEvent||2!=e.originalEvent.button)&&(s.is("img")||!(d>s[0].clientWidth+s.offset().left))){if(s.is(".fancybox-bg,.fancybox-inner,.fancybox-outer,.fancybox-container"))o="Outside";else if(s.is(".fancybox-slide"))o="Slide";else{if(!r.current.$content||!r.current.$content.find(s).addBack().filter(s).length)return;o="Content"}if(i.tapped){if(clearTimeout(i.tapped),i.tapped=null,Math.abs(d-i.tapX)>50||Math.abs(u-i.tapY)>50)return this;f("dblclick"+o)}else i.tapX=d,i.tapY=u,c.opts["dblclick"+o]&&c.opts["dblclick"+o]!==c.opts["click"+o]?i.tapped=setTimeout(function(){i.tapped=null,r.isAnimating||f("click"+o)},500):f("click"+o);return this}},n(e).on("onActivate.fb",function(t,e){e&&!e.Guestures&&(e.Guestures=new d(e))}).on("beforeClose.fb",function(t,e){e&&e.Guestures&&e.Guestures.destroy()})}(window,document,jQuery),function(t,e){"use strict";e.extend(!0,e.fancybox.defaults,{btnTpl:{slideShow:'<button data-fancybox-play class="fancybox-button fancybox-button--play" title="{{PLAY_START}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M6.5 5.4v13.2l11-6.6z"/></svg><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M8.33 5.75h2.2v12.5h-2.2V5.75zm5.15 0h2.2v12.5h-2.2V5.75z"/></svg></button>'},slideShow:{autoStart:!1,speed:3e3,progress:!0}});var n=function(t){this.instance=t,this.init()};e.extend(n.prototype,{timer:null,isActive:!1,$button:null,init:function(){var t=this,n=t.instance,o=n.group[n.currIndex].opts.slideShow;t.$button=n.$refs.toolbar.find("[data-fancybox-play]").on("click",function(){t.toggle()}),n.group.length<2||!o?t.$button.hide():o.progress&&(t.$progress=e('<div class="fancybox-progress"></div>').appendTo(n.$refs.inner))},set:function(t){var n=this,o=n.instance,i=o.current;i&&(!0===t||i.opts.loop||o.currIndex<o.group.length-1)?n.isActive&&"video"!==i.contentType&&(n.$progress&&e.fancybox.animate(n.$progress.show(),{scaleX:1},i.opts.slideShow.speed),n.timer=setTimeout(function(){o.current.opts.loop||o.current.index!=o.group.length-1?o.next():o.jumpTo(0)},i.opts.slideShow.speed)):(n.stop(),o.idleSecondsCounter=0,o.showControls())},clear:function(){var t=this;clearTimeout(t.timer),t.timer=null,t.$progress&&t.$progress.removeAttr("style").hide()},start:function(){var t=this,e=t.instance.current;e&&(t.$button.attr("title",(e.opts.i18n[e.opts.lang]||e.opts.i18n.en).PLAY_STOP).removeClass("fancybox-button--play").addClass("fancybox-button--pause"),t.isActive=!0,e.isComplete&&t.set(!0),t.instance.trigger("onSlideShowChange",!0))},stop:function(){var t=this,e=t.instance.current;t.clear(),t.$button.attr("title",(e.opts.i18n[e.opts.lang]||e.opts.i18n.en).PLAY_START).removeClass("fancybox-button--pause").addClass("fancybox-button--play"),t.isActive=!1,t.instance.trigger("onSlideShowChange",!1),t.$progress&&t.$progress.removeAttr("style").hide()},toggle:function(){var t=this;t.isActive?t.stop():t.start()}}),e(t).on({"onInit.fb":function(t,e){e&&!e.SlideShow&&(e.SlideShow=new n(e))},"beforeShow.fb":function(t,e,n,o){var i=e&&e.SlideShow;o?i&&n.opts.slideShow.autoStart&&i.start():i&&i.isActive&&i.clear()},"afterShow.fb":function(t,e,n){var o=e&&e.SlideShow;o&&o.isActive&&o.set()},"afterKeydown.fb":function(n,o,i,a,s){var r=o&&o.SlideShow;!r||!i.opts.slideShow||80!==s&&32!==s||e(t.activeElement).is("button,a,input")||(a.preventDefault(),r.toggle())},"beforeClose.fb onDeactivate.fb":function(t,e){var n=e&&e.SlideShow;n&&n.stop()}}),e(t).on("visibilitychange",function(){var n=e.fancybox.getInstance(),o=n&&n.SlideShow;o&&o.isActive&&(t.hidden?o.clear():o.set())})}(document,jQuery),function(t,e){"use strict";var n=function(){for(var e=[["requestFullscreen","exitFullscreen","fullscreenElement","fullscreenEnabled","fullscreenchange","fullscreenerror"],["webkitRequestFullscreen","webkitExitFullscreen","webkitFullscreenElement","webkitFullscreenEnabled","webkitfullscreenchange","webkitfullscreenerror"],["webkitRequestFullScreen","webkitCancelFullScreen","webkitCurrentFullScreenElement","webkitCancelFullScreen","webkitfullscreenchange","webkitfullscreenerror"],["mozRequestFullScreen","mozCancelFullScreen","mozFullScreenElement","mozFullScreenEnabled","mozfullscreenchange","mozfullscreenerror"],["msRequestFullscreen","msExitFullscreen","msFullscreenElement","msFullscreenEnabled","MSFullscreenChange","MSFullscreenError"]],n={},o=0;o<e.length;o++){var i=e[o];if(i&&i[1]in t){for(var a=0;a<i.length;a++)n[e[0][a]]=i[a];return n}}return!1}();if(n){var o={request:function(e){e=e||t.documentElement,e[n.requestFullscreen](e.ALLOW_KEYBOARD_INPUT)},exit:function(){t[n.exitFullscreen]()},toggle:function(e){e=e||t.documentElement,this.isFullscreen()?this.exit():this.request(e)},isFullscreen:function(){return Boolean(t[n.fullscreenElement])},enabled:function(){return Boolean(t[n.fullscreenEnabled])}};e.extend(!0,e.fancybox.defaults,{btnTpl:{fullScreen:'<button data-fancybox-fullscreen class="fancybox-button fancybox-button--fsenter" title="{{FULL_SCREEN}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M7 14H5v5h5v-2H7v-3zm-2-4h2V7h3V5H5v5zm12 7h-3v2h5v-5h-2v3zM14 5v2h3v3h2V5h-5z"/></svg><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M5 16h3v3h2v-5H5zm3-8H5v2h5V5H8zm6 11h2v-3h3v-2h-5zm2-11V5h-2v5h5V8z"/></svg></button>'},fullScreen:{autoStart:!1}}),e(t).on(n.fullscreenchange,function(){var t=o.isFullscreen(),n=e.fancybox.getInstance();n&&(n.current&&"image"===n.current.type&&n.isAnimating&&(n.isAnimating=!1,n.update(!0,!0,0),n.isComplete||n.complete()),n.trigger("onFullscreenChange",t),n.$refs.container.toggleClass("fancybox-is-fullscreen",t),n.$refs.toolbar.find("[data-fancybox-fullscreen]").toggleClass("fancybox-button--fsenter",!t).toggleClass("fancybox-button--fsexit",t))})}e(t).on({"onInit.fb":function(t,e){var i;if(!n)return void e.$refs.toolbar.find("[data-fancybox-fullscreen]").remove();e&&e.group[e.currIndex].opts.fullScreen?(i=e.$refs.container,i.on("click.fb-fullscreen","[data-fancybox-fullscreen]",function(t){t.stopPropagation(),t.preventDefault(),o.toggle()}),e.opts.fullScreen&&!0===e.opts.fullScreen.autoStart&&o.request(),e.FullScreen=o):e&&e.$refs.toolbar.find("[data-fancybox-fullscreen]").hide()},"afterKeydown.fb":function(t,e,n,o,i){e&&e.FullScreen&&70===i&&(o.preventDefault(),e.FullScreen.toggle())},"beforeClose.fb":function(t,e){e&&e.FullScreen&&e.$refs.container.hasClass("fancybox-is-fullscreen")&&o.exit()}})}(document,jQuery),function(t,e){"use strict";var n="fancybox-thumbs";e.fancybox.defaults=e.extend(!0,{btnTpl:{thumbs:'<button data-fancybox-thumbs class="fancybox-button fancybox-button--thumbs" title="{{THUMBS}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M14.59 14.59h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76H5.65v-3.76zm8.94-4.47h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76h-3.76v-3.76zm-4.47 0h3.76v3.76H5.65v-3.76zm8.94-4.47h3.76v3.76h-3.76V5.65zm-4.47 0h3.76v3.76h-3.76V5.65zm-4.47 0h3.76v3.76H5.65V5.65z"/></svg></button>'},thumbs:{autoStart:!1,hideOnClose:!0,parentEl:".fancybox-container",axis:"y"}},e.fancybox.defaults);var o=function(t){this.init(t)};e.extend(o.prototype,{$button:null,$grid:null,$list:null,isVisible:!1,isActive:!1,init:function(t){var e=this,n=t.group,o=0;e.instance=t,e.opts=n[t.currIndex].opts.thumbs,t.Thumbs=e,e.$button=t.$refs.toolbar.find("[data-fancybox-thumbs]");for(var i=0,a=n.length;i<a&&(n[i].thumb&&o++,!(o>1));i++);o>1&&e.opts?(e.$button.removeAttr("style").on("click",function(){e.toggle()}),e.isActive=!0):e.$button.hide()},create:function(){var t,o=this,i=o.instance,a=o.opts.parentEl,s=[];o.$grid||(o.$grid=e('<div class="'+n+" "+n+"-"+o.opts.axis+'"></div>').appendTo(i.$refs.container.find(a).addBack().filter(a)),o.$grid.on("click","a",function(){i.jumpTo(e(this).attr("data-index"))})),o.$list||(o.$list=e('<div class="'+n+'__list">').appendTo(o.$grid)),e.each(i.group,function(e,n){t=n.thumb,t||"image"!==n.type||(t=n.src),s.push('<a href="javascript:;" tabindex="0" data-index="'+e+'"'+(t&&t.length?' style="background-image:url('+t+')"':'class="fancybox-thumbs-missing"')+"></a>")}),o.$list[0].innerHTML=s.join(""),"x"===o.opts.axis&&o.$list.width(parseInt(o.$grid.css("padding-right"),10)+i.group.length*o.$list.children().eq(0).outerWidth(!0))},focus:function(t){var e,n,o=this,i=o.$list,a=o.$grid;o.instance.current&&(e=i.children().removeClass("fancybox-thumbs-active").filter('[data-index="'+o.instance.current.index+'"]').addClass("fancybox-thumbs-active"),n=e.position(),"y"===o.opts.axis&&(n.top<0||n.top>i.height()-e.outerHeight())?i.stop().animate({scrollTop:i.scrollTop()+n.top},t):"x"===o.opts.axis&&(n.left<a.scrollLeft()||n.left>a.scrollLeft()+(a.width()-e.outerWidth()))&&i.parent().stop().animate({scrollLeft:n.left},t))},update:function(){var t=this;t.instance.$refs.container.toggleClass("fancybox-show-thumbs",this.isVisible),t.isVisible?(t.$grid||t.create(),t.instance.trigger("onThumbsShow"),t.focus(0)):t.$grid&&t.instance.trigger("onThumbsHide"),t.instance.update()},hide:function(){this.isVisible=!1,this.update()},show:function(){this.isVisible=!0,this.update()},toggle:function(){this.isVisible=!this.isVisible,this.update()}}),e(t).on({"onInit.fb":function(t,e){var n;e&&!e.Thumbs&&(n=new o(e),n.isActive&&!0===n.opts.autoStart&&n.show())},"beforeShow.fb":function(t,e,n,o){var i=e&&e.Thumbs;i&&i.isVisible&&i.focus(o?0:250)},"afterKeydown.fb":function(t,e,n,o,i){var a=e&&e.Thumbs;a&&a.isActive&&71===i&&(o.preventDefault(),a.toggle())},"beforeClose.fb":function(t,e){var n=e&&e.Thumbs;n&&n.isVisible&&!1!==n.opts.hideOnClose&&n.$grid.hide()}})}(document,jQuery),function(t,e){"use strict";function n(t){var e={"&":"&amp;","<":"&lt;",">":"&gt;",'"':"&quot;","'":"&#39;","/":"&#x2F;","`":"&#x60;","=":"&#x3D;"};return String(t).replace(/[&<>"'`=\/]/g,function(t){return e[t]})}e.extend(!0,e.fancybox.defaults,{btnTpl:{share:'<button data-fancybox-share class="fancybox-button fancybox-button--share" title="{{SHARE}}"><svg xmlns="http://www.w3.org/2000/svg" viewBox="0 0 24 24"><path d="M2.55 19c1.4-8.4 9.1-9.8 11.9-9.8V5l7 7-7 6.3v-3.5c-2.8 0-10.5 2.1-11.9 4.2z"/></svg></button>'},share:{url:function(t,e){return!t.currentHash&&"inline"!==e.type&&"html"!==e.type&&(e.origSrc||e.src)||window.location},
+tpl:'<div class="fancybox-share"><h1>{{SHARE}}</h1><p><a class="fancybox-share__button fancybox-share__button--fb" href="https://www.facebook.com/sharer/sharer.php?u={{url}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m287 456v-299c0-21 6-35 35-35h38v-63c-7-1-29-3-55-3-54 0-91 33-91 94v306m143-254h-205v72h196" /></svg><span>Facebook</span></a><a class="fancybox-share__button fancybox-share__button--tw" href="https://twitter.com/intent/tweet?url={{url}}&text={{descr}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m456 133c-14 7-31 11-47 13 17-10 30-27 37-46-15 10-34 16-52 20-61-62-157-7-141 75-68-3-129-35-169-85-22 37-11 86 26 109-13 0-26-4-37-9 0 39 28 72 65 80-12 3-25 4-37 2 10 33 41 57 77 57-42 30-77 38-122 34 170 111 378-32 359-208 16-11 30-25 41-42z" /></svg><span>Twitter</span></a><a class="fancybox-share__button fancybox-share__button--pt" href="https://www.pinterest.com/pin/create/button/?url={{url}}&description={{descr}}&media={{media}}"><svg viewBox="0 0 512 512" xmlns="http://www.w3.org/2000/svg"><path d="m265 56c-109 0-164 78-164 144 0 39 15 74 47 87 5 2 10 0 12-5l4-19c2-6 1-8-3-13-9-11-15-25-15-45 0-58 43-110 113-110 62 0 96 38 96 88 0 67-30 122-73 122-24 0-42-19-36-44 6-29 20-60 20-81 0-19-10-35-31-35-25 0-44 26-44 60 0 21 7 36 7 36l-30 125c-8 37-1 83 0 87 0 3 4 4 5 2 2-3 32-39 42-75l16-64c8 16 31 29 56 29 74 0 124-67 124-157 0-69-58-132-146-132z" fill="#fff"/></svg><span>Pinterest</span></a></p><p><input class="fancybox-share__input" type="text" value="{{url_raw}}" onclick="select()" /></p></div>'}}),e(t).on("click","[data-fancybox-share]",function(){var t,o,i=e.fancybox.getInstance(),a=i.current||null;a&&("function"===e.type(a.opts.share.url)&&(t=a.opts.share.url.apply(a,[i,a])),o=a.opts.share.tpl.replace(/\{\{media\}\}/g,"image"===a.type?encodeURIComponent(a.src):"").replace(/\{\{url\}\}/g,encodeURIComponent(t)).replace(/\{\{url_raw\}\}/g,n(t)).replace(/\{\{descr\}\}/g,i.$caption?encodeURIComponent(i.$caption.text()):""),e.fancybox.open({src:i.translate(i,o),type:"html",opts:{touch:!1,animationEffect:!1,afterLoad:function(t,e){i.$refs.container.one("beforeClose.fb",function(){t.close(null,0)}),e.$content.find(".fancybox-share__button").click(function(){return window.open(this.href,"Share","width=550, height=450"),!1})},mobile:{autoFocus:!1}}}))})}(document,jQuery),function(t,e,n){"use strict";function o(){var e=t.location.hash.substr(1),n=e.split("-"),o=n.length>1&&/^\+?\d+$/.test(n[n.length-1])?parseInt(n.pop(-1),10)||1:1,i=n.join("-");return{hash:e,index:o<1?1:o,gallery:i}}function i(t){""!==t.gallery&&n("[data-fancybox='"+n.escapeSelector(t.gallery)+"']").eq(t.index-1).focus().trigger("click.fb-start")}function a(t){var e,n;return!!t&&(e=t.current?t.current.opts:t.opts,""!==(n=e.hash||(e.$orig?e.$orig.data("fancybox")||e.$orig.data("fancybox-trigger"):""))&&n)}n.escapeSelector||(n.escapeSelector=function(t){return(t+"").replace(/([\0-\x1f\x7f]|^-?\d)|^-$|[^\x80-\uFFFF\w-]/g,function(t,e){return e?"\0"===t?"�":t.slice(0,-1)+"\\"+t.charCodeAt(t.length-1).toString(16)+" ":"\\"+t})}),n(function(){!1!==n.fancybox.defaults.hash&&(n(e).on({"onInit.fb":function(t,e){var n,i;!1!==e.group[e.currIndex].opts.hash&&(n=o(),(i=a(e))&&n.gallery&&i==n.gallery&&(e.currIndex=n.index-1))},"beforeShow.fb":function(n,o,i,s){var r;i&&!1!==i.opts.hash&&(r=a(o))&&(o.currentHash=r+(o.group.length>1?"-"+(i.index+1):""),t.location.hash!=="#"+o.currentHash&&(s&&!o.origHash&&(o.origHash=t.location.hash),o.hashTimer&&clearTimeout(o.hashTimer),o.hashTimer=setTimeout(function(){"replaceState"in t.history?(t.history[s?"pushState":"replaceState"]({},e.title,t.location.pathname+t.location.search+"#"+o.currentHash),s&&(o.hasCreatedHistory=!0)):t.location.hash=o.currentHash,o.hashTimer=null},300)))},"beforeClose.fb":function(n,o,i){i&&!1!==i.opts.hash&&(clearTimeout(o.hashTimer),o.currentHash&&o.hasCreatedHistory?t.history.back():o.currentHash&&("replaceState"in t.history?t.history.replaceState({},e.title,t.location.pathname+t.location.search+(o.origHash||"")):t.location.hash=o.origHash),o.currentHash=null)}}),n(t).on("hashchange.fb",function(){var t=o(),e=null;n.each(n(".fancybox-container").get().reverse(),function(t,o){var i=n(o).data("FancyBox");if(i&&i.currentHash)return e=i,!1}),e?e.currentHash===t.gallery+"-"+t.index||1===t.index&&e.currentHash==t.gallery||(e.currentHash=null,e.close()):""!==t.gallery&&i(t)}),setTimeout(function(){n.fancybox.getInstance()||i(o())},50))})}(window,document,jQuery),function(t,e){"use strict";var n=(new Date).getTime();e(t).on({"onInit.fb":function(t,e,o){e.$refs.stage.on("mousewheel DOMMouseScroll wheel MozMousePixelScroll",function(t){var o=e.current,i=(new Date).getTime();e.group.length<2||!1===o.opts.wheel||"auto"===o.opts.wheel&&"image"!==o.type||(t.preventDefault(),t.stopPropagation(),o.$slide.hasClass("fancybox-animated")||(t=t.originalEvent||t,i-n<250||(n=i,e[(-t.deltaY||-t.deltaX||t.wheelDelta||-t.detail)<0?"next":"previous"]())))})}})}(document,jQuery);
\ No newline at end of file
diff --git a/fancybox/createrelease b/fancybox/createrelease
new file mode 100755
index 00000000..6760c242
--- /dev/null
+++ b/fancybox/createrelease
@@ -0,0 +1,17 @@
+MODULE=fancybox
+
+cd ..
+
+# read actual version from module.json
+
+# old releases not needed anymore
+mkdir -p $MODULE/dist
+rm $MODULE/dist/*
+
+# create release for actual version
+zip -r9 $MODULE/dist/release.zip $MODULE/* -x $MODULE/dist/\* -x $MODULE/test/\* $MODULE/createrelease
+
+echo release/release.zip created.
+
+cd $MODULE
+
diff --git a/fancybox/dist/release.zip b/fancybox/dist/release.zip
new file mode 100644
index 00000000..bdce6ffc
Binary files /dev/null and b/fancybox/dist/release.zip differ
diff --git a/fancybox/fancybox.php b/fancybox/fancybox.php
new file mode 100644
index 00000000..b572b7f8
--- /dev/null
+++ b/fancybox/fancybox.php
@@ -0,0 +1,61 @@
+<?php
+/**
+ * Name: Fancybox
+ * Description: Open media attachments of posts into a fancybox overlay.
+ * Version: 1.01
+ * Author: Grischa Brockhaus <grischa@brockha.us>
+ */
+
+use Friendica\App;
+use Friendica\Core\Hook;
+use Friendica\DI;
+
+function fancybox_install()
+{
+    Hook::register('head', __FILE__, 'fancybox_head');
+    Hook::register('footer', __FILE__, 'fancybox_footer');
+    Hook::register('prepare_body_final', __FILE__, 'fancybox_render');
+}
+
+function fancybox_head(App $a, string &$b)
+{
+    DI::page()->registerStylesheet(__DIR__ . '/asset/fancybox/jquery.fancybox.min.css');
+}
+function fancybox_footer(App $a, string &$str)
+{
+    DI::page()->registerFooterScript(__DIR__ . '/asset/fancybox/jquery.fancybox.min.js');
+    DI::page()->registerFooterScript(__DIR__ . '/asset/fancybox/fancybox.config.js');
+}
+
+/*
+
+prepare_body_final
+
+Called at the end of prepare_body(). Hook data:
+
+    item: item array (input)
+    html: converted item body (input/output)
+
+*/
+
+function fancybox_render(App $a, array &$b) {
+    $matches = [];
+    $pattern='#<div class="body-attach">.*?</div>#s';
+    $gallery = 'gallery';
+    if (array_key_exists('item', $b)) {
+        $item = $b['item'];
+        if (array_key_exists('uri-id', $item)) {
+            $gallery = $gallery . '-' . $item['uri-id'];
+        }
+    }
+    $html = $b['html'];
+    while (preg_match($pattern, $html, $matches, PREG_OFFSET_CAPTURE)) {
+        if (is_array($matches)) $matches=$matches[0];
+        $part = $matches[0];
+        $replaced = str_replace('<a href', '<a data-fancybox="' . $gallery . '" href', $part);
+        $replaced = str_replace('<div class="body-attach"', '<div class="body-attach done"', $replaced);
+        $html =str_replace($part, $replaced, $html);
+    }
+    $html = str_replace('class="body-attach done"', 'class="body-attach"', $html);
+    $b['html'] = $html;
+}
\ No newline at end of file
diff --git a/fancybox/test/fancybox-3.5.7.zip b/fancybox/test/fancybox-3.5.7.zip
new file mode 100644
index 00000000..004e044a
Binary files /dev/null and b/fancybox/test/fancybox-3.5.7.zip differ
diff --git a/fancybox/test/imagetest.html b/fancybox/test/imagetest.html
new file mode 100644
index 00000000..9b81ac34
--- /dev/null
+++ b/fancybox/test/imagetest.html
@@ -0,0 +1,21 @@
+<html>
+<head>
+<!-- https://github.com/friendica/friendica/tree/stable/doc -->
+<!-- https://github.com/friendica/friendica/blob/stable/doc/Addons.md -->
+<!-- https://stackoverflow.com/questions/44409223/show-image-in-a-popup-when-i-click-button -->
+<!-- https://github.com/fancyapps/fancybox -->
+<link href="https://cdnjs.cloudflare.com/ajax/libs/fancybox/3.2.0/jquery.fancybox.min.css" rel="stylesheet" />
+<script src="https://ajax.googleapis.com/ajax/libs/jquery/2.1.1/jquery.min.js"></script>
+<script src="https://cdnjs.cloudflare.com/ajax/libs/fancybox/3.2.0/jquery.fancybox.min.js"></script>
+</head>
+<body>
+<div class="body-attach"><a data-fancybox="gallery" href="https://social.beachcom.org/system/media_attachments/files/109/395/536/026/043/860/original/cb17a73a2a5cd86f.jpeg"><img src="https://friends.brockha.us/photo/preview/600/3734" alt="" title=""></a>
+<br>
+<div class="clear"></div></div>
+
+<div class="body-attach"><a data-fancybox="gallery" href="https://media.troet.cafe/troet.cafe/media_attachments/files/109/393/109/756/233/529/original/4290ef9eb5d7b799.jpeg"><img src="https://friends.brockha.us/photo/preview/1024/3729" alt="Tardis cookie jar and Tardis book, like River Songs diary." title="Tardis cookie jar and Tardis book, like River Songs diary."></a>
+<br>
+<div class="clear"></div></div>
+
+</body>
+</html>
diff --git a/fancybox/test/test.html b/fancybox/test/test.html
new file mode 100644
index 00000000..1ff17351
--- /dev/null
+++ b/fancybox/test/test.html
@@ -0,0 +1,14 @@
+<p>Blubber Start</p>
+<div class="clearfix"></div>
+
+				<hr />
+				<div class="wall-item-content post" id="wall-item-content-21657">
+
+			<div class="wall-item-body e-content p-name" id="wall-item-body-21657" dir="auto">Aktuell blockieren Unterstützer:innen der Letzten Generation das Rollfeld des BER.<br>Einige haben sich auf dem Asphalt festgeklebt, andere fahren mit Rad über den Rangierbereich und bringen so den Flugverkehr zum Erliegen. Vor dem Betreten des BER informierten sie die Polizei. <a href="https://t.co/c6UGVfPDI9" target="_blank" rel="noopener noreferrer">https://t.co/c6UGVfPDI9</a><div class="body-attach"><a href="https://climatejustice.social/system/media_attachments/files/109/400/027/751/450/406/original/9217a95e2bca723f.jpg"><img src="https://friends.brockha.us/photo/preview/1024/4292" alt="" title=""></a>
+<br>
+<a href="https://climatejustice.social/system/media_attachments/files/109/400/028/270/759/610/original/33b8b6d69d0d98fa.jpg"><img src="https://friends.brockha.us/photo/preview/600/4294" alt="" title=""></a>
+<br>
+<a href="https://climatejustice.social/system/media_attachments/files/109/400/028/712/968/943/original/2affd82b2c9a50c9.jpg"><img src="https://friends.brockha.us/photo/preview/600/4296" alt="" title=""></a>
+<br>
+<div class="clear"></div></div></div>
+<p>Blubber Ende</p>
\ No newline at end of file
diff --git a/fancybox/test/test.out.html b/fancybox/test/test.out.html
new file mode 100644
index 00000000..e9f682f2
--- /dev/null
+++ b/fancybox/test/test.out.html
@@ -0,0 +1,14 @@
+<p>Blubber Start</p>
+<div class="clearfix"></div>
+
+				<hr />
+				<div class="wall-item-content post" id="wall-item-content-21657">
+
+			<div class="wall-item-body e-content p-name" id="wall-item-body-21657" dir="auto">Aktuell blockieren Unterstützer:innen der Letzten Generation das Rollfeld des BER.<br>Einige haben sich auf dem Asphalt festgeklebt, andere fahren mit Rad über den Rangierbereich und bringen so den Flugverkehr zum Erliegen. Vor dem Betreten des BER informierten sie die Polizei. <a href="https://t.co/c6UGVfPDI9" target="_blank" rel="noopener noreferrer">https://t.co/c6UGVfPDI9</a><div class="body-attach"><a data-fancybox="gallery" href="https://climatejustice.social/system/media_attachments/files/109/400/027/751/450/406/original/9217a95e2bca723f.jpg"><img src="https://friends.brockha.us/photo/preview/1024/4292" alt="" title=""></a>
+<br>
+<a data-fancybox="gallery" href="https://climatejustice.social/system/media_attachments/files/109/400/028/270/759/610/original/33b8b6d69d0d98fa.jpg"><img src="https://friends.brockha.us/photo/preview/600/4294" alt="" title=""></a>
+<br>
+<a data-fancybox="gallery" href="https://climatejustice.social/system/media_attachments/files/109/400/028/712/968/943/original/2affd82b2c9a50c9.jpg"><img src="https://friends.brockha.us/photo/preview/600/4296" alt="" title=""></a>
+<br>
+<div class="clear"></div></div></div>
+<p>Blubber Ende</p>
\ No newline at end of file